diff --git a/.gitignore b/.gitignore
new file mode 100644
index 0000000..3f213ef
--- /dev/null
+++ b/.gitignore
@@ -0,0 +1 @@
+db.js
diff --git a/README.md b/README.md
index a8fd352..3665003 100644
--- a/README.md
+++ b/README.md
@@ -1 +1,128 @@
-# Boost
\ No newline at end of file
+<<<<<<< HEAD
+# 선거 시스템
+
+### 1주차 과제
+
+1. 회원가입/로그인/로그아웃
+2. 회원가입 시 지역 설정
+ -> 지역 별로 후보 다르게 뜨게 하기
+3. 자기가 가입한 지역에서 후보 등록(신청) 가능
+ -> 허가 받을 필요 X(추후 과제로 나갈 예정)
+ -> 즉 후보 등록 신청을 하기만 하면 다 후보에 오를 수 있음
+4. 투표 작동 (투표 표수 반영X 결과 표기될 필요X)
+ -> 예를 들어, 체크 표시 칸 안에 클릭만 되게 하기 등
+
+##### 기본 세팅
+
+###### 필요한 패키지 설치
+
+npm init -y //
+
+npm install express mysql2 bcryptjs jsonwebtoken body-parser
+
+###### 데이터베이스 생성
+
+회원가입을 하는 users 테이블
+
+후보에 등록하면 저장되는 candidates 테이블
+
+##### 메인화면
+
+###### 모듈 기본 설정
+
+const express = require("express"); // 웹을 쉽게 구축
+
+const session = require("express-session"); //사용자의 상태정보를 서버에 저장
+
+const bodyParser = require("body-parser"); //클라이언트가 보내는 요청의 본문을 쉽게 파싱
+
+const FileStore = require("session-file-store")(session); // 세션데이터를 파일 시스템에 저장할 수 있게 해줌
+
+그 외 라우터들 설정
+
+##### 회원가입
+
+화면 레이아웃의 경우 아래 링크의 템플릿을 참고함
+
+https://sirius7.tistory.com/59
+
+// 회원가입 화면
+
+router.get("/register", function (request, response) {
+
+var title = "회원가입";
+
+var html = template.HTML(
+
+ title,
+
+ "내용"
+
+);
+
+response.send(html);
+
+});
+
+/register 경로에 get 요청이 들어오면 함수 실행 → 회원 가입 페이지 실행됨
+
+##### 로그인
+
+/login_process 경로에 post 요청이 들어오면 함수 실행 → 입력한 아이디와 비밀번호가 db에 있는지 확인
+
+##### 로그아웃
+
+/logout 경로에 get 요청이 들어오면 로그아웃 실행
+
+→ 로그아웃 시 get 함수가 사용됨을 알게되었다
+
+##### 후보등록
+
+- 개선할 점
+
+후보 등록 시 후보를 등록하려는 사람의 로그인 정보와 동일한 지역의 후보로만 출마할 수 있도록 설정하고 싶었는데 로그인 정보를 연결하는데 실패
+
+→ 로그인한 회원의 지역 정보를 어떻게 불러오는지 모르겠음
+
+##### 투표
+
+- 지역 선택
+
+db에 존재하는 후보들의 지역 이름이 테이블의 형태로 제시되도록 함
+
+후보가 없는 지역은 제시되지 않음
+
+지역을 선택하면 해당 지역에 있는 후보를 투표할 수 있는 페이지로 넘어감
+
+- 후보 선택 후 투표
+
+해당 지역에 출마한 후보들이 나오고 체크박스 선택 후 투표 버튼 누르면 투표 완료
+
+##### 1주차 정리
+
+- 회원가입과 로그인 페이지는 누군가 작성한 템플릿을 인용하여 예쁜데, 나머지 부분은 기본이라 예쁘지 않음…. 예쁘게 꾸미는 방법은 추후에 보강 예정
+
+- 후보 등록시 로그인 정보 연결하는 방법 찾아보기
+
+- node.js 실행은 $node main.js 이고 localhost3000 페이지 들어가기
+
+- readme는 어떻게 꾸미는 거죠.....?
+
+- git 연결 방법
+
+`git init`
+
+`git remote origin add (레포주소)`
+
+`git checkout -b 브랜치이름`
+
+`git add .`
+
+`git commit -m “ ”`
+
+`git push`
+
+까먹지 좀 말자……
+=======
+# Boost
+>>>>>>> fd8b8fb2af7b0068964d7c494639ebe92279ea10
diff --git a/lib_candidate/candidates.js b/lib_candidate/candidates.js
new file mode 100644
index 0000000..e921e63
--- /dev/null
+++ b/lib_candidate/candidates.js
@@ -0,0 +1,53 @@
+const express = require("express");
+const router = express.Router();
+const db = require("../db.js");
+
+// 후보 등록 페이지
+router.get("/register", (req, res) => {
+ res.send(`
+
+
+
+ 후보 등록
+
+
+ 후보 등록
+
+
+
+ `);
+});
+
+// 후보 등록 처리
+router.post("/register", (req, res) => {
+ const { name, region } = req.body;
+
+ // 로그인한 사용자의 지역 정보 가져오기
+ const userRegion = req.session.region; // 세션에서 사용자 지역 정보 가져오기
+
+ if (!name || !region) {
+ return res.status(400).send("모든 필드를 입력해야 합니다.");
+ }
+
+ // 사용자의 지역과 후보 등록 지역 비교
+ if (userRegion !== region) {
+ console.log(`사용자의 지역: ${userRegion}, 후보 등록 지역: ${region}`); // 콘솔에 지역 정보 출력
+ return res.status(403).send("자신의 지역에서만 후보 등록이 가능합니다.");
+ }
+
+ const query = "INSERT INTO candidates (name, region) VALUES (?, ?)";
+ db.query(query, [name, region], (err) => {
+ if (err) {
+ return res.status(500).send("후보 등록 실패");
+ }
+ x;
+ res.send("후보 등록 완료");
+ });
+});
+
+module.exports = router;
diff --git a/lib_candidate/votes.js b/lib_candidate/votes.js
new file mode 100644
index 0000000..78a6905
--- /dev/null
+++ b/lib_candidate/votes.js
@@ -0,0 +1,128 @@
+const express = require("express");
+const router = express.Router();
+const db = require("../db"); // db 연결 모듈
+
+// 지역 선택 페이지
+router.get("/", (req, res) => {
+ // 모든 지역 목록을 가져오는 쿼리
+ const query = "SELECT DISTINCT region FROM candidates";
+ db.query(query, (err, results) => {
+ if (err) {
+ return res.status(500).send("지역 조회 실패");
+ }
+
+ // 지역 목록을 HTML 테이블로 생성
+ let regionRows = results
+ .map(
+ (region) => `
+
+ ${region.region}
+ `
+ )
+ .join("");
+
+ // 최종 HTML 응답
+ res.send(`
+
+
+
+ 투표하기 - 지역 선택
+
+
+
+ 투표할 지역을 선택하세요
+
+
+
+ 지역
+
+
+
+ ${regionRows}
+
+
+
+
+ `);
+ });
+});
+
+// 특정 지역의 후보 페이지
+router.get("/:region", (req, res) => {
+ const region = req.params.region;
+
+ // 특정 지역의 후보 조회
+ const query = "SELECT * FROM candidates WHERE region = ?";
+ db.query(query, [region], (err, results) => {
+ if (err) {
+ return res.status(500).send("후보 조회 실패");
+ }
+
+ // 후보 목록을 HTML로 생성
+ let candidateCheckboxes = results
+ .map(
+ (candidate) => `
+
+ ${candidate.name}
+
+ `
+ )
+ .join("");
+
+ // 최종 HTML 응답
+ res.send(`
+
+
+
+ ${region} 지역 투표하기
+
+
+ ${region} 지역 투표하기
+
+
+
+ `);
+ });
+});
+
+// 투표 처리
+router.post("/", (req, res) => {
+ let { candidateIds } = req.body; // let으로 변경
+
+ // 후보자가 선택되지 않았거나 candidateIds가 존재하지 않을 경우 처리
+ if (!candidateIds) {
+ return res.status(400).send("후보를 선택해야 합니다.");
+ }
+
+ // 후보자가 하나만 선택된 경우에도 정상 처리
+ if (!Array.isArray(candidateIds)) {
+ candidateIds = [candidateIds]; // 배열이 아닌 경우 배열로 변환
+ }
+
+ // DB에 투표 저장 로직 추가 필요
+ // 예시: candidateIds 배열을 사용하여 DB에 투표 기록을 저장하는 로직을 추가하세요.
+
+ res.send("투표 완료");
+});
+
+module.exports = router;
diff --git a/lib_login/auth.js b/lib_login/auth.js
new file mode 100644
index 0000000..dd1906d
--- /dev/null
+++ b/lib_login/auth.js
@@ -0,0 +1,129 @@
+var express = require("express");
+var router = express.Router();
+
+var template = require("./template.js");
+var db = require("../db.js");
+
+// 로그인 화면
+router.get("/login", function (request, response) {
+ var title = "로그인";
+ var html = template.HTML(
+ title,
+ `
+ 로그인
+
+ 회원가입
+ `,
+ ""
+ );
+ response.send(html);
+});
+
+// 로그인 프로세스
+router.post("/login_process", function (request, response) {
+ var username = request.body.username;
+ var password = request.body.pwd;
+ if (username && password) {
+ // id와 pw가 입력되었는지 확인
+
+ db.query(
+ "SELECT * FROM users WHERE username = ? AND password = ?",
+ [username, password],
+ function (error, results, fields) {
+ if (error) throw error;
+ if (results.length > 0) {
+ // db에서의 반환값이 있으면 로그인 성공
+ request.session.is_logined = true; // 세션 정보 갱신
+ request.session.nickname = username;
+ request.session.save(function () {
+ region = request.session.region; // 사용자의 지역 정보를 세션에 저장
+ username = request.session.username; // 사용자 이름도 저장
+ response.redirect(`/`);
+ });
+ } else {
+ response.send(``);
+ }
+ }
+ );
+ } else {
+ response.send(``);
+ }
+});
+
+// 로그아웃
+router.get("/logout", function (request, response) {
+ request.session.destroy(function (err) {
+ response.redirect("/");
+ });
+});
+
+// 회원가입 화면
+router.get("/register", function (request, response) {
+ var title = "회원가입";
+ var html = template.HTML(
+ title,
+ `
+ 회원가입
+
+ `,
+ ""
+ );
+ response.send(html);
+});
+
+// 회원가입 프로세스
+router.post("/register_process", function (request, response) {
+ var username = request.body.username;
+ var password = request.body.pwd;
+ var password2 = request.body.pwd2;
+ var region = request.body.region;
+
+ if (username && password && password2 && region) {
+ db.query(
+ "SELECT * FROM users WHERE username = ?",
+ [username],
+ function (error, results, fields) {
+ // DB에 같은 이름의 회원아이디가 있는지 확인
+ if (error) throw error;
+ if (results.length <= 0 && password == password2) {
+ // DB에 같은 이름의 회원아이디가 없고, 비밀번호가 올바르게 입력된 경우
+ db.query(
+ "INSERT INTO users (username, password, region ) VALUES(?,?, ?)",
+ [username, password, region],
+ function (error, data) {
+ if (error) throw error;
+ response.send(``);
+ }
+ );
+ } else if (password != password2) {
+ // 비밀번호가 올바르게 입력되지 않은 경우
+ response.send(``);
+ } else {
+ // DB에 같은 이름의 회원아이디가 있는 경우
+ response.send(``);
+ }
+ }
+ );
+ } else {
+ // 입력되지 않은 정보가 있는 경우
+ response.send(``);
+ }
+});
+
+module.exports = router;
diff --git a/lib_login/authCheck.js b/lib_login/authCheck.js
new file mode 100644
index 0000000..df78229
--- /dev/null
+++ b/lib_login/authCheck.js
@@ -0,0 +1,16 @@
+module.exports = {
+ isOwner: function (request, response) {
+ if (request.session.is_logined) {
+ return true;
+ } else {
+ return false;
+ }
+ },
+ statusUI: function (request, response) {
+ var authStatusUI = "로그인후 사용 가능합니다";
+ if (this.isOwner(request, response)) {
+ authStatusUI = `${request.session.nickname}님 환영합니다 | 로그아웃 `;
+ }
+ return authStatusUI;
+ },
+};
diff --git a/lib_login/template.js b/lib_login/template.js
new file mode 100644
index 0000000..695b6fb
--- /dev/null
+++ b/lib_login/template.js
@@ -0,0 +1,78 @@
+module.exports = {
+ HTML: function (title, body, authStatusUI) {
+ return `
+
+
+
+ Login TEST - ${title}
+
+ ${authStatusUI}
+ ${body}
+
+
+
+ `;
+ },
+};
diff --git a/main.js b/main.js
new file mode 100644
index 0000000..140c89b
--- /dev/null
+++ b/main.js
@@ -0,0 +1,67 @@
+const express = require("express");
+const session = require("express-session");
+const bodyParser = require("body-parser");
+const FileStore = require("session-file-store")(session);
+
+var authRouter = require("./lib_login/auth");
+var authCheck = require("./lib_login/authCheck.js");
+var template = require("./lib_login/template.js");
+var candidatesRoutes = require("./lib_candidate/candidates.js");
+var votesRoutes = require("./lib_candidate/votes.js");
+
+const app = express();
+const port = 3000;
+
+app.use(bodyParser.urlencoded({ extended: false }));
+app.use(
+ session({
+ secret: "두둥탁",
+ resave: false,
+ saveUninitialized: true,
+ store: new FileStore(),
+ })
+);
+
+app.get("/", (req, res) => {
+ if (!authCheck.isOwner(req, res)) {
+ // 로그인 안되어있으면 로그인 페이지로 이동시킴
+ res.redirect("/auth/login");
+ return false;
+ } else {
+ // 로그인 되어있으면 메인 페이지로 이동시킴
+ res.redirect("/main");
+ return false;
+ }
+});
+
+// 인증 라우터
+app.use("/auth", authRouter);
+
+// 메인 페이지
+app.get("/main", (req, res) => {
+ if (!authCheck.isOwner(req, res)) {
+ // 로그인 안되어있으면 로그인 페이지로 이동시킴
+ res.redirect("/auth/login");
+ return false;
+ }
+
+ var html = template.HTML(
+ "Welcome",
+ `로그인에 성공하셨습니다.
+ 투표하기 |
+ 후보 등록하기 `,
+ authCheck.statusUI(req, res)
+ );
+ res.send(html);
+});
+
+// 후보 등록 라우터
+app.use("/candidates", candidatesRoutes);
+
+// 투표 라우터
+app.use("/votes", votesRoutes);
+
+app.listen(port, () => {
+ console.log(`Example app listening on port ${port}`);
+});
diff --git a/node_modules/.bin/mime b/node_modules/.bin/mime
new file mode 100644
index 0000000..7751de3
--- /dev/null
+++ b/node_modules/.bin/mime
@@ -0,0 +1,16 @@
+#!/bin/sh
+basedir=$(dirname "$(echo "$0" | sed -e 's,\\,/,g')")
+
+case `uname` in
+ *CYGWIN*|*MINGW*|*MSYS*)
+ if command -v cygpath > /dev/null 2>&1; then
+ basedir=`cygpath -w "$basedir"`
+ fi
+ ;;
+esac
+
+if [ -x "$basedir/node" ]; then
+ exec "$basedir/node" "$basedir/../mime/cli.js" "$@"
+else
+ exec node "$basedir/../mime/cli.js" "$@"
+fi
diff --git a/node_modules/.bin/mime.cmd b/node_modules/.bin/mime.cmd
new file mode 100644
index 0000000..54491f1
--- /dev/null
+++ b/node_modules/.bin/mime.cmd
@@ -0,0 +1,17 @@
+@ECHO off
+GOTO start
+:find_dp0
+SET dp0=%~dp0
+EXIT /b
+:start
+SETLOCAL
+CALL :find_dp0
+
+IF EXIST "%dp0%\node.exe" (
+ SET "_prog=%dp0%\node.exe"
+) ELSE (
+ SET "_prog=node"
+ SET PATHEXT=%PATHEXT:;.JS;=;%
+)
+
+endLocal & goto #_undefined_# 2>NUL || title %COMSPEC% & "%_prog%" "%dp0%\..\mime\cli.js" %*
diff --git a/node_modules/.bin/mime.ps1 b/node_modules/.bin/mime.ps1
new file mode 100644
index 0000000..2222f40
--- /dev/null
+++ b/node_modules/.bin/mime.ps1
@@ -0,0 +1,28 @@
+#!/usr/bin/env pwsh
+$basedir=Split-Path $MyInvocation.MyCommand.Definition -Parent
+
+$exe=""
+if ($PSVersionTable.PSVersion -lt "6.0" -or $IsWindows) {
+ # Fix case when both the Windows and Linux builds of Node
+ # are installed in the same directory
+ $exe=".exe"
+}
+$ret=0
+if (Test-Path "$basedir/node$exe") {
+ # Support pipeline input
+ if ($MyInvocation.ExpectingInput) {
+ $input | & "$basedir/node$exe" "$basedir/../mime/cli.js" $args
+ } else {
+ & "$basedir/node$exe" "$basedir/../mime/cli.js" $args
+ }
+ $ret=$LASTEXITCODE
+} else {
+ # Support pipeline input
+ if ($MyInvocation.ExpectingInput) {
+ $input | & "node$exe" "$basedir/../mime/cli.js" $args
+ } else {
+ & "node$exe" "$basedir/../mime/cli.js" $args
+ }
+ $ret=$LASTEXITCODE
+}
+exit $ret
diff --git a/node_modules/.bin/semver b/node_modules/.bin/semver
new file mode 100644
index 0000000..97c5327
--- /dev/null
+++ b/node_modules/.bin/semver
@@ -0,0 +1,16 @@
+#!/bin/sh
+basedir=$(dirname "$(echo "$0" | sed -e 's,\\,/,g')")
+
+case `uname` in
+ *CYGWIN*|*MINGW*|*MSYS*)
+ if command -v cygpath > /dev/null 2>&1; then
+ basedir=`cygpath -w "$basedir"`
+ fi
+ ;;
+esac
+
+if [ -x "$basedir/node" ]; then
+ exec "$basedir/node" "$basedir/../semver/bin/semver.js" "$@"
+else
+ exec node "$basedir/../semver/bin/semver.js" "$@"
+fi
diff --git a/node_modules/.bin/semver.cmd b/node_modules/.bin/semver.cmd
new file mode 100644
index 0000000..9913fa9
--- /dev/null
+++ b/node_modules/.bin/semver.cmd
@@ -0,0 +1,17 @@
+@ECHO off
+GOTO start
+:find_dp0
+SET dp0=%~dp0
+EXIT /b
+:start
+SETLOCAL
+CALL :find_dp0
+
+IF EXIST "%dp0%\node.exe" (
+ SET "_prog=%dp0%\node.exe"
+) ELSE (
+ SET "_prog=node"
+ SET PATHEXT=%PATHEXT:;.JS;=;%
+)
+
+endLocal & goto #_undefined_# 2>NUL || title %COMSPEC% & "%_prog%" "%dp0%\..\semver\bin\semver.js" %*
diff --git a/node_modules/.bin/semver.ps1 b/node_modules/.bin/semver.ps1
new file mode 100644
index 0000000..314717a
--- /dev/null
+++ b/node_modules/.bin/semver.ps1
@@ -0,0 +1,28 @@
+#!/usr/bin/env pwsh
+$basedir=Split-Path $MyInvocation.MyCommand.Definition -Parent
+
+$exe=""
+if ($PSVersionTable.PSVersion -lt "6.0" -or $IsWindows) {
+ # Fix case when both the Windows and Linux builds of Node
+ # are installed in the same directory
+ $exe=".exe"
+}
+$ret=0
+if (Test-Path "$basedir/node$exe") {
+ # Support pipeline input
+ if ($MyInvocation.ExpectingInput) {
+ $input | & "$basedir/node$exe" "$basedir/../semver/bin/semver.js" $args
+ } else {
+ & "$basedir/node$exe" "$basedir/../semver/bin/semver.js" $args
+ }
+ $ret=$LASTEXITCODE
+} else {
+ # Support pipeline input
+ if ($MyInvocation.ExpectingInput) {
+ $input | & "node$exe" "$basedir/../semver/bin/semver.js" $args
+ } else {
+ & "node$exe" "$basedir/../semver/bin/semver.js" $args
+ }
+ $ret=$LASTEXITCODE
+}
+exit $ret
diff --git a/node_modules/.package-lock.json b/node_modules/.package-lock.json
new file mode 100644
index 0000000..2475e54
--- /dev/null
+++ b/node_modules/.package-lock.json
@@ -0,0 +1,1117 @@
+{
+ "name": "backend_assign",
+ "version": "1.0.0",
+ "lockfileVersion": 3,
+ "requires": true,
+ "packages": {
+ "node_modules/accepts": {
+ "version": "1.3.8",
+ "resolved": "https://registry.npmjs.org/accepts/-/accepts-1.3.8.tgz",
+ "integrity": "sha512-PYAthTa2m2VKxuvSD3DPC/Gy+U+sOA1LAuT8mkmRuvw+NACSaeXEQ+NHcVF7rONl6qcaxV3Uuemwawk+7+SJLw==",
+ "dependencies": {
+ "mime-types": "~2.1.34",
+ "negotiator": "0.6.3"
+ },
+ "engines": {
+ "node": ">= 0.6"
+ }
+ },
+ "node_modules/array-flatten": {
+ "version": "1.1.1",
+ "resolved": "https://registry.npmjs.org/array-flatten/-/array-flatten-1.1.1.tgz",
+ "integrity": "sha512-PCVAQswWemu6UdxsDFFX/+gVeYqKAod3D3UVm91jHwynguOwAvYPhx8nNlM++NqRcK6CxxpUafjmhIdKiHibqg=="
+ },
+ "node_modules/asn1.js": {
+ "version": "5.4.1",
+ "resolved": "https://registry.npmjs.org/asn1.js/-/asn1.js-5.4.1.tgz",
+ "integrity": "sha512-+I//4cYPccV8LdmBLiX8CYvf9Sp3vQsrqu2QNXRcrbiWvcx/UdlFiqUJJzxRQxgsZmvhXhn4cSKeSmoFjVdupA==",
+ "dependencies": {
+ "bn.js": "^4.0.0",
+ "inherits": "^2.0.1",
+ "minimalistic-assert": "^1.0.0",
+ "safer-buffer": "^2.1.0"
+ }
+ },
+ "node_modules/aws-ssl-profiles": {
+ "version": "1.1.2",
+ "resolved": "https://registry.npmjs.org/aws-ssl-profiles/-/aws-ssl-profiles-1.1.2.tgz",
+ "integrity": "sha512-NZKeq9AfyQvEeNlN0zSYAaWrmBffJh3IELMZfRpJVWgrpEbtEpnjvzqBPf+mxoI287JohRDoa+/nsfqqiZmF6g==",
+ "engines": {
+ "node": ">= 6.0.0"
+ }
+ },
+ "node_modules/bagpipe": {
+ "version": "0.3.5",
+ "resolved": "https://registry.npmjs.org/bagpipe/-/bagpipe-0.3.5.tgz",
+ "integrity": "sha512-42sAlmPDKes1nLm/aly+0VdaopSU9br+jkRELedhQxI5uXHgtk47I83Mpmf4zoNTRMASdLFtUkimlu/Z9zQ8+g=="
+ },
+ "node_modules/bcryptjs": {
+ "version": "2.4.3",
+ "resolved": "https://registry.npmjs.org/bcryptjs/-/bcryptjs-2.4.3.tgz",
+ "integrity": "sha512-V/Hy/X9Vt7f3BbPJEi8BdVFMByHi+jNXrYkW3huaybV/kQ0KJg0Y6PkEMbn+zeT+i+SiKZ/HMqJGIIt4LZDqNQ=="
+ },
+ "node_modules/bn.js": {
+ "version": "4.12.1",
+ "resolved": "https://registry.npmjs.org/bn.js/-/bn.js-4.12.1.tgz",
+ "integrity": "sha512-k8TVBiPkPJT9uHLdOKfFpqcfprwBFOAAXXozRubr7R7PfIuKvQlzcI4M0pALeqXN09vdaMbUdUj+pass+uULAg=="
+ },
+ "node_modules/body-parser": {
+ "version": "1.20.3",
+ "resolved": "https://registry.npmjs.org/body-parser/-/body-parser-1.20.3.tgz",
+ "integrity": "sha512-7rAxByjUMqQ3/bHJy7D6OGXvx/MMc4IqBn/X0fcM1QUcAItpZrBEYhWGem+tzXH90c+G01ypMcYJBO9Y30203g==",
+ "dependencies": {
+ "bytes": "3.1.2",
+ "content-type": "~1.0.5",
+ "debug": "2.6.9",
+ "depd": "2.0.0",
+ "destroy": "1.2.0",
+ "http-errors": "2.0.0",
+ "iconv-lite": "0.4.24",
+ "on-finished": "2.4.1",
+ "qs": "6.13.0",
+ "raw-body": "2.5.2",
+ "type-is": "~1.6.18",
+ "unpipe": "1.0.0"
+ },
+ "engines": {
+ "node": ">= 0.8",
+ "npm": "1.2.8000 || >= 1.4.16"
+ }
+ },
+ "node_modules/buffer-equal-constant-time": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/buffer-equal-constant-time/-/buffer-equal-constant-time-1.0.1.tgz",
+ "integrity": "sha512-zRpUiDwd/xk6ADqPMATG8vc9VPrkck7T07OIx0gnjmJAnHnTVXNQG3vfvWNuiZIkwu9KrKdA1iJKfsfTVxE6NA=="
+ },
+ "node_modules/bytes": {
+ "version": "3.1.2",
+ "resolved": "https://registry.npmjs.org/bytes/-/bytes-3.1.2.tgz",
+ "integrity": "sha512-/Nf7TyzTx6S3yRJObOAV7956r8cr2+Oj8AC5dt8wSP3BQAoeX58NoHyCU8P8zGkNXStjTSi6fzO6F0pBdcYbEg==",
+ "engines": {
+ "node": ">= 0.8"
+ }
+ },
+ "node_modules/call-bind": {
+ "version": "1.0.7",
+ "resolved": "https://registry.npmjs.org/call-bind/-/call-bind-1.0.7.tgz",
+ "integrity": "sha512-GHTSNSYICQ7scH7sZ+M2rFopRoLh8t2bLSW6BbgrtLsahOIB5iyAVJf9GjWK3cYTDaMj4XdBpM1cA6pIS0Kv2w==",
+ "dependencies": {
+ "es-define-property": "^1.0.0",
+ "es-errors": "^1.3.0",
+ "function-bind": "^1.1.2",
+ "get-intrinsic": "^1.2.4",
+ "set-function-length": "^1.2.1"
+ },
+ "engines": {
+ "node": ">= 0.4"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/content-disposition": {
+ "version": "0.5.4",
+ "resolved": "https://registry.npmjs.org/content-disposition/-/content-disposition-0.5.4.tgz",
+ "integrity": "sha512-FveZTNuGw04cxlAiWbzi6zTAL/lhehaWbTtgluJh4/E95DqMwTmha3KZN1aAWA8cFIhHzMZUvLevkw5Rqk+tSQ==",
+ "dependencies": {
+ "safe-buffer": "5.2.1"
+ },
+ "engines": {
+ "node": ">= 0.6"
+ }
+ },
+ "node_modules/content-type": {
+ "version": "1.0.5",
+ "resolved": "https://registry.npmjs.org/content-type/-/content-type-1.0.5.tgz",
+ "integrity": "sha512-nTjqfcBFEipKdXCv4YDQWCfmcLZKm81ldF0pAopTvyrFGVbcR6P/VAAd5G7N+0tTr8QqiU0tFadD6FK4NtJwOA==",
+ "engines": {
+ "node": ">= 0.6"
+ }
+ },
+ "node_modules/cookie": {
+ "version": "0.7.1",
+ "resolved": "https://registry.npmjs.org/cookie/-/cookie-0.7.1.tgz",
+ "integrity": "sha512-6DnInpx7SJ2AK3+CTUE/ZM0vWTUboZCegxhC2xiIydHR9jNuTAASBrfEpHhiGOZw/nX51bHt6YQl8jsGo4y/0w==",
+ "engines": {
+ "node": ">= 0.6"
+ }
+ },
+ "node_modules/cookie-signature": {
+ "version": "1.0.6",
+ "resolved": "https://registry.npmjs.org/cookie-signature/-/cookie-signature-1.0.6.tgz",
+ "integrity": "sha512-QADzlaHc8icV8I7vbaJXJwod9HWYp8uCqf1xa4OfNu1T7JVxQIrUgOWtHdNDtPiywmFbiS12VjotIXLrKM3orQ=="
+ },
+ "node_modules/debug": {
+ "version": "2.6.9",
+ "resolved": "https://registry.npmjs.org/debug/-/debug-2.6.9.tgz",
+ "integrity": "sha512-bC7ElrdJaJnPbAP+1EotYvqZsb3ecl5wi6Bfi6BJTUcNowp6cvspg0jXznRTKDjm/E7AdgFBVeAPVMNcKGsHMA==",
+ "dependencies": {
+ "ms": "2.0.0"
+ }
+ },
+ "node_modules/define-data-property": {
+ "version": "1.1.4",
+ "resolved": "https://registry.npmjs.org/define-data-property/-/define-data-property-1.1.4.tgz",
+ "integrity": "sha512-rBMvIzlpA8v6E+SJZoo++HAYqsLrkg7MSfIinMPFhmkorw7X+dOXVJQs+QT69zGkzMyfDnIMN2Wid1+NbL3T+A==",
+ "dependencies": {
+ "es-define-property": "^1.0.0",
+ "es-errors": "^1.3.0",
+ "gopd": "^1.0.1"
+ },
+ "engines": {
+ "node": ">= 0.4"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/denque": {
+ "version": "2.1.0",
+ "resolved": "https://registry.npmjs.org/denque/-/denque-2.1.0.tgz",
+ "integrity": "sha512-HVQE3AAb/pxF8fQAoiqpvg9i3evqug3hoiwakOyZAwJm+6vZehbkYXZ0l4JxS+I3QxM97v5aaRNhj8v5oBhekw==",
+ "engines": {
+ "node": ">=0.10"
+ }
+ },
+ "node_modules/depd": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/depd/-/depd-2.0.0.tgz",
+ "integrity": "sha512-g7nH6P6dyDioJogAAGprGpCtVImJhpPk/roCzdb3fIh61/s/nPsfR6onyMwkCAR/OlC3yBC0lESvUoQEAssIrw==",
+ "engines": {
+ "node": ">= 0.8"
+ }
+ },
+ "node_modules/destroy": {
+ "version": "1.2.0",
+ "resolved": "https://registry.npmjs.org/destroy/-/destroy-1.2.0.tgz",
+ "integrity": "sha512-2sJGJTaXIIaR1w4iJSNoN0hnMY7Gpc/n8D4qSCJw8QqFWXf7cuAgnEHxBpweaVcPevC2l3KpjYCx3NypQQgaJg==",
+ "engines": {
+ "node": ">= 0.8",
+ "npm": "1.2.8000 || >= 1.4.16"
+ }
+ },
+ "node_modules/ecdsa-sig-formatter": {
+ "version": "1.0.11",
+ "resolved": "https://registry.npmjs.org/ecdsa-sig-formatter/-/ecdsa-sig-formatter-1.0.11.tgz",
+ "integrity": "sha512-nagl3RYrbNv6kQkeJIpt6NJZy8twLB/2vtz6yN9Z4vRKHN4/QZJIEbqohALSgwKdnksuY3k5Addp5lg8sVoVcQ==",
+ "dependencies": {
+ "safe-buffer": "^5.0.1"
+ }
+ },
+ "node_modules/ee-first": {
+ "version": "1.1.1",
+ "resolved": "https://registry.npmjs.org/ee-first/-/ee-first-1.1.1.tgz",
+ "integrity": "sha512-WMwm9LhRUo+WUaRN+vRuETqG89IgZphVSNkdFgeb6sS/E4OrDIN7t48CAewSHXc6C8lefD8KKfr5vY61brQlow=="
+ },
+ "node_modules/encodeurl": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/encodeurl/-/encodeurl-2.0.0.tgz",
+ "integrity": "sha512-Q0n9HRi4m6JuGIV1eFlmvJB7ZEVxu93IrMyiMsGC0lrMJMWzRgx6WGquyfQgZVb31vhGgXnfmPNNXmxnOkRBrg==",
+ "engines": {
+ "node": ">= 0.8"
+ }
+ },
+ "node_modules/es-define-property": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/es-define-property/-/es-define-property-1.0.0.tgz",
+ "integrity": "sha512-jxayLKShrEqqzJ0eumQbVhTYQM27CfT1T35+gCgDFoL82JLsXqTJ76zv6A0YLOgEnLUMvLzsDsGIrl8NFpT2gQ==",
+ "dependencies": {
+ "get-intrinsic": "^1.2.4"
+ },
+ "engines": {
+ "node": ">= 0.4"
+ }
+ },
+ "node_modules/es-errors": {
+ "version": "1.3.0",
+ "resolved": "https://registry.npmjs.org/es-errors/-/es-errors-1.3.0.tgz",
+ "integrity": "sha512-Zf5H2Kxt2xjTvbJvP2ZWLEICxA6j+hAmMzIlypy4xcBg1vKVnx89Wy0GbS+kf5cwCVFFzdCFh2XSCFNULS6csw==",
+ "engines": {
+ "node": ">= 0.4"
+ }
+ },
+ "node_modules/escape-html": {
+ "version": "1.0.3",
+ "resolved": "https://registry.npmjs.org/escape-html/-/escape-html-1.0.3.tgz",
+ "integrity": "sha512-NiSupZ4OeuGwr68lGIeym/ksIZMJodUGOSCZ/FSnTxcrekbvqrgdUxlJOMpijaKZVjAJrWrGs/6Jy8OMuyj9ow=="
+ },
+ "node_modules/etag": {
+ "version": "1.8.1",
+ "resolved": "https://registry.npmjs.org/etag/-/etag-1.8.1.tgz",
+ "integrity": "sha512-aIL5Fx7mawVa300al2BnEE4iNvo1qETxLrPI/o05L7z6go7fCw1J6EQmbK4FmJ2AS7kgVF/KEZWufBfdClMcPg==",
+ "engines": {
+ "node": ">= 0.6"
+ }
+ },
+ "node_modules/express": {
+ "version": "4.21.1",
+ "resolved": "https://registry.npmjs.org/express/-/express-4.21.1.tgz",
+ "integrity": "sha512-YSFlK1Ee0/GC8QaO91tHcDxJiE/X4FbpAyQWkxAvG6AXCuR65YzK8ua6D9hvi/TzUfZMpc+BwuM1IPw8fmQBiQ==",
+ "dependencies": {
+ "accepts": "~1.3.8",
+ "array-flatten": "1.1.1",
+ "body-parser": "1.20.3",
+ "content-disposition": "0.5.4",
+ "content-type": "~1.0.4",
+ "cookie": "0.7.1",
+ "cookie-signature": "1.0.6",
+ "debug": "2.6.9",
+ "depd": "2.0.0",
+ "encodeurl": "~2.0.0",
+ "escape-html": "~1.0.3",
+ "etag": "~1.8.1",
+ "finalhandler": "1.3.1",
+ "fresh": "0.5.2",
+ "http-errors": "2.0.0",
+ "merge-descriptors": "1.0.3",
+ "methods": "~1.1.2",
+ "on-finished": "2.4.1",
+ "parseurl": "~1.3.3",
+ "path-to-regexp": "0.1.10",
+ "proxy-addr": "~2.0.7",
+ "qs": "6.13.0",
+ "range-parser": "~1.2.1",
+ "safe-buffer": "5.2.1",
+ "send": "0.19.0",
+ "serve-static": "1.16.2",
+ "setprototypeof": "1.2.0",
+ "statuses": "2.0.1",
+ "type-is": "~1.6.18",
+ "utils-merge": "1.0.1",
+ "vary": "~1.1.2"
+ },
+ "engines": {
+ "node": ">= 0.10.0"
+ }
+ },
+ "node_modules/express-session": {
+ "version": "1.18.1",
+ "resolved": "https://registry.npmjs.org/express-session/-/express-session-1.18.1.tgz",
+ "integrity": "sha512-a5mtTqEaZvBCL9A9aqkrtfz+3SMDhOVUnjafjo+s7A9Txkq+SVX2DLvSp1Zrv4uCXa3lMSK3viWnh9Gg07PBUA==",
+ "dependencies": {
+ "cookie": "0.7.2",
+ "cookie-signature": "1.0.7",
+ "debug": "2.6.9",
+ "depd": "~2.0.0",
+ "on-headers": "~1.0.2",
+ "parseurl": "~1.3.3",
+ "safe-buffer": "5.2.1",
+ "uid-safe": "~2.1.5"
+ },
+ "engines": {
+ "node": ">= 0.8.0"
+ }
+ },
+ "node_modules/express-session/node_modules/cookie": {
+ "version": "0.7.2",
+ "resolved": "https://registry.npmjs.org/cookie/-/cookie-0.7.2.tgz",
+ "integrity": "sha512-yki5XnKuf750l50uGTllt6kKILY4nQ1eNIQatoXEByZ5dWgnKqbnqmTrBE5B4N7lrMJKQ2ytWMiTO2o0v6Ew/w==",
+ "engines": {
+ "node": ">= 0.6"
+ }
+ },
+ "node_modules/express-session/node_modules/cookie-signature": {
+ "version": "1.0.7",
+ "resolved": "https://registry.npmjs.org/cookie-signature/-/cookie-signature-1.0.7.tgz",
+ "integrity": "sha512-NXdYc3dLr47pBkpUCHtKSwIOQXLVn8dZEuywboCOJY/osA0wFSLlSawr3KN8qXJEyX66FcONTH8EIlVuK0yyFA=="
+ },
+ "node_modules/finalhandler": {
+ "version": "1.3.1",
+ "resolved": "https://registry.npmjs.org/finalhandler/-/finalhandler-1.3.1.tgz",
+ "integrity": "sha512-6BN9trH7bp3qvnrRyzsBz+g3lZxTNZTbVO2EV1CS0WIcDbawYVdYvGflME/9QP0h0pYlCDBCTjYa9nZzMDpyxQ==",
+ "dependencies": {
+ "debug": "2.6.9",
+ "encodeurl": "~2.0.0",
+ "escape-html": "~1.0.3",
+ "on-finished": "2.4.1",
+ "parseurl": "~1.3.3",
+ "statuses": "2.0.1",
+ "unpipe": "~1.0.0"
+ },
+ "engines": {
+ "node": ">= 0.8"
+ }
+ },
+ "node_modules/forwarded": {
+ "version": "0.2.0",
+ "resolved": "https://registry.npmjs.org/forwarded/-/forwarded-0.2.0.tgz",
+ "integrity": "sha512-buRG0fpBtRHSTCOASe6hD258tEubFoRLb4ZNA6NxMVHNw2gOcwHo9wyablzMzOA5z9xA9L1KNjk/Nt6MT9aYow==",
+ "engines": {
+ "node": ">= 0.6"
+ }
+ },
+ "node_modules/fresh": {
+ "version": "0.5.2",
+ "resolved": "https://registry.npmjs.org/fresh/-/fresh-0.5.2.tgz",
+ "integrity": "sha512-zJ2mQYM18rEFOudeV4GShTGIQ7RbzA7ozbU9I/XBpm7kqgMywgmylMwXHxZJmkVoYkna9d2pVXVXPdYTP9ej8Q==",
+ "engines": {
+ "node": ">= 0.6"
+ }
+ },
+ "node_modules/fs-extra": {
+ "version": "8.1.0",
+ "resolved": "https://registry.npmjs.org/fs-extra/-/fs-extra-8.1.0.tgz",
+ "integrity": "sha512-yhlQgA6mnOJUKOsRUFsgJdQCvkKhcz8tlZG5HBQfReYZy46OwLcY+Zia0mtdHsOo9y/hP+CxMN0TU9QxoOtG4g==",
+ "dependencies": {
+ "graceful-fs": "^4.2.0",
+ "jsonfile": "^4.0.0",
+ "universalify": "^0.1.0"
+ },
+ "engines": {
+ "node": ">=6 <7 || >=8"
+ }
+ },
+ "node_modules/function-bind": {
+ "version": "1.1.2",
+ "resolved": "https://registry.npmjs.org/function-bind/-/function-bind-1.1.2.tgz",
+ "integrity": "sha512-7XHNxH7qX9xG5mIwxkhumTox/MIRNcOgDrxWsMt2pAr23WHp6MrRlN7FBSFpCpr+oVO0F744iUgR82nJMfG2SA==",
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/generate-function": {
+ "version": "2.3.1",
+ "resolved": "https://registry.npmjs.org/generate-function/-/generate-function-2.3.1.tgz",
+ "integrity": "sha512-eeB5GfMNeevm/GRYq20ShmsaGcmI81kIX2K9XQx5miC8KdHaC6Jm0qQ8ZNeGOi7wYB8OsdxKs+Y2oVuTFuVwKQ==",
+ "dependencies": {
+ "is-property": "^1.0.2"
+ }
+ },
+ "node_modules/get-intrinsic": {
+ "version": "1.2.4",
+ "resolved": "https://registry.npmjs.org/get-intrinsic/-/get-intrinsic-1.2.4.tgz",
+ "integrity": "sha512-5uYhsJH8VJBTv7oslg4BznJYhDoRI6waYCxMmCdnTrcCrHA/fCFKoTFz2JKKE0HdDFUF7/oQuhzumXJK7paBRQ==",
+ "dependencies": {
+ "es-errors": "^1.3.0",
+ "function-bind": "^1.1.2",
+ "has-proto": "^1.0.1",
+ "has-symbols": "^1.0.3",
+ "hasown": "^2.0.0"
+ },
+ "engines": {
+ "node": ">= 0.4"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/gopd": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/gopd/-/gopd-1.0.1.tgz",
+ "integrity": "sha512-d65bNlIadxvpb/A2abVdlqKqV563juRnZ1Wtk6s1sIR8uNsXR70xqIzVqxVf1eTqDunwT2MkczEeaezCKTZhwA==",
+ "dependencies": {
+ "get-intrinsic": "^1.1.3"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/graceful-fs": {
+ "version": "4.2.11",
+ "resolved": "https://registry.npmjs.org/graceful-fs/-/graceful-fs-4.2.11.tgz",
+ "integrity": "sha512-RbJ5/jmFcNNCcDV5o9eTnBLJ/HszWV0P73bc+Ff4nS/rJj+YaS6IGyiOL0VoBYX+l1Wrl3k63h/KrH+nhJ0XvQ=="
+ },
+ "node_modules/has-property-descriptors": {
+ "version": "1.0.2",
+ "resolved": "https://registry.npmjs.org/has-property-descriptors/-/has-property-descriptors-1.0.2.tgz",
+ "integrity": "sha512-55JNKuIW+vq4Ke1BjOTjM2YctQIvCT7GFzHwmfZPGo5wnrgkid0YQtnAleFSqumZm4az3n2BS+erby5ipJdgrg==",
+ "dependencies": {
+ "es-define-property": "^1.0.0"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/has-proto": {
+ "version": "1.0.3",
+ "resolved": "https://registry.npmjs.org/has-proto/-/has-proto-1.0.3.tgz",
+ "integrity": "sha512-SJ1amZAJUiZS+PhsVLf5tGydlaVB8EdFpaSO4gmiUKUOxk8qzn5AIy4ZeJUmh22znIdk/uMAUT2pl3FxzVUH+Q==",
+ "engines": {
+ "node": ">= 0.4"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/has-symbols": {
+ "version": "1.0.3",
+ "resolved": "https://registry.npmjs.org/has-symbols/-/has-symbols-1.0.3.tgz",
+ "integrity": "sha512-l3LCuF6MgDNwTDKkdYGEihYjt5pRPbEg46rtlmnSPlUbgmB8LOIrKJbYYFBSbnPaJexMKtiPO8hmeRjRz2Td+A==",
+ "engines": {
+ "node": ">= 0.4"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/hasown": {
+ "version": "2.0.2",
+ "resolved": "https://registry.npmjs.org/hasown/-/hasown-2.0.2.tgz",
+ "integrity": "sha512-0hJU9SCPvmMzIBdZFqNPXWa6dqh7WdH0cII9y+CyS8rG3nL48Bclra9HmKhVVUHyPWNH5Y7xDwAB7bfgSjkUMQ==",
+ "dependencies": {
+ "function-bind": "^1.1.2"
+ },
+ "engines": {
+ "node": ">= 0.4"
+ }
+ },
+ "node_modules/http-errors": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/http-errors/-/http-errors-2.0.0.tgz",
+ "integrity": "sha512-FtwrG/euBzaEjYeRqOgly7G0qviiXoJWnvEH2Z1plBdXgbyjv34pHTSb9zoeHMyDy33+DWy5Wt9Wo+TURtOYSQ==",
+ "dependencies": {
+ "depd": "2.0.0",
+ "inherits": "2.0.4",
+ "setprototypeof": "1.2.0",
+ "statuses": "2.0.1",
+ "toidentifier": "1.0.1"
+ },
+ "engines": {
+ "node": ">= 0.8"
+ }
+ },
+ "node_modules/iconv-lite": {
+ "version": "0.4.24",
+ "resolved": "https://registry.npmjs.org/iconv-lite/-/iconv-lite-0.4.24.tgz",
+ "integrity": "sha512-v3MXnZAcvnywkTUEZomIActle7RXXeedOR31wwl7VlyoXO4Qi9arvSenNQWne1TcRwhCL1HwLI21bEqdpj8/rA==",
+ "dependencies": {
+ "safer-buffer": ">= 2.1.2 < 3"
+ },
+ "engines": {
+ "node": ">=0.10.0"
+ }
+ },
+ "node_modules/imurmurhash": {
+ "version": "0.1.4",
+ "resolved": "https://registry.npmjs.org/imurmurhash/-/imurmurhash-0.1.4.tgz",
+ "integrity": "sha512-JmXMZ6wuvDmLiHEml9ykzqO6lwFbof0GG4IkcGaENdCRDDmMVnny7s5HsIgHCbaq0w2MyPhDqkhTUgS2LU2PHA==",
+ "engines": {
+ "node": ">=0.8.19"
+ }
+ },
+ "node_modules/inherits": {
+ "version": "2.0.4",
+ "resolved": "https://registry.npmjs.org/inherits/-/inherits-2.0.4.tgz",
+ "integrity": "sha512-k/vGaX4/Yla3WzyMCvTQOXYeIHvqOKtnqBduzTHpzpQZzAskKMhZ2K+EnBiSM9zGSoIFeMpXKxa4dYeZIQqewQ=="
+ },
+ "node_modules/ipaddr.js": {
+ "version": "1.9.1",
+ "resolved": "https://registry.npmjs.org/ipaddr.js/-/ipaddr.js-1.9.1.tgz",
+ "integrity": "sha512-0KI/607xoxSToH7GjN1FfSbLoU0+btTicjsQSWQlh/hZykN8KpmMf7uYwPW3R+akZ6R/w18ZlXSHBYXiYUPO3g==",
+ "engines": {
+ "node": ">= 0.10"
+ }
+ },
+ "node_modules/is-property": {
+ "version": "1.0.2",
+ "resolved": "https://registry.npmjs.org/is-property/-/is-property-1.0.2.tgz",
+ "integrity": "sha512-Ks/IoX00TtClbGQr4TWXemAnktAQvYB7HzcCxDGqEZU6oCmb2INHuOoKxbtR+HFkmYWBKv/dOZtGRiAjDhj92g=="
+ },
+ "node_modules/is-typedarray": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/is-typedarray/-/is-typedarray-1.0.0.tgz",
+ "integrity": "sha512-cyA56iCMHAh5CdzjJIa4aohJyeO1YbwLi3Jc35MmRU6poroFjIGZzUzupGiRPOjgHg9TLu43xbpwXk523fMxKA=="
+ },
+ "node_modules/jsonfile": {
+ "version": "4.0.0",
+ "resolved": "https://registry.npmjs.org/jsonfile/-/jsonfile-4.0.0.tgz",
+ "integrity": "sha512-m6F1R3z8jjlf2imQHS2Qez5sjKWQzbuuhuJ/FKYFRZvPE3PuHcSMVZzfsLhGVOkfd20obL5SWEBew5ShlquNxg==",
+ "optionalDependencies": {
+ "graceful-fs": "^4.1.6"
+ }
+ },
+ "node_modules/jsonwebtoken": {
+ "version": "9.0.2",
+ "resolved": "https://registry.npmjs.org/jsonwebtoken/-/jsonwebtoken-9.0.2.tgz",
+ "integrity": "sha512-PRp66vJ865SSqOlgqS8hujT5U4AOgMfhrwYIuIhfKaoSCZcirrmASQr8CX7cUg+RMih+hgznrjp99o+W4pJLHQ==",
+ "dependencies": {
+ "jws": "^3.2.2",
+ "lodash.includes": "^4.3.0",
+ "lodash.isboolean": "^3.0.3",
+ "lodash.isinteger": "^4.0.4",
+ "lodash.isnumber": "^3.0.3",
+ "lodash.isplainobject": "^4.0.6",
+ "lodash.isstring": "^4.0.1",
+ "lodash.once": "^4.0.0",
+ "ms": "^2.1.1",
+ "semver": "^7.5.4"
+ },
+ "engines": {
+ "node": ">=12",
+ "npm": ">=6"
+ }
+ },
+ "node_modules/jsonwebtoken/node_modules/ms": {
+ "version": "2.1.3",
+ "resolved": "https://registry.npmjs.org/ms/-/ms-2.1.3.tgz",
+ "integrity": "sha512-6FlzubTLZG3J2a/NVCAleEhjzq5oxgHyaCU9yYXvcLsvoVaHJq/s5xXI6/XXP6tz7R9xAOtHnSO/tXtF3WRTlA=="
+ },
+ "node_modules/jwa": {
+ "version": "1.4.1",
+ "resolved": "https://registry.npmjs.org/jwa/-/jwa-1.4.1.tgz",
+ "integrity": "sha512-qiLX/xhEEFKUAJ6FiBMbes3w9ATzyk5W7Hvzpa/SLYdxNtng+gcurvrI7TbACjIXlsJyr05/S1oUhZrc63evQA==",
+ "dependencies": {
+ "buffer-equal-constant-time": "1.0.1",
+ "ecdsa-sig-formatter": "1.0.11",
+ "safe-buffer": "^5.0.1"
+ }
+ },
+ "node_modules/jws": {
+ "version": "3.2.2",
+ "resolved": "https://registry.npmjs.org/jws/-/jws-3.2.2.tgz",
+ "integrity": "sha512-YHlZCB6lMTllWDtSPHz/ZXTsi8S00usEV6v1tjq8tOUZzw7DpSDWVXjXDre6ed1w/pd495ODpHZYSdkRTsa0HA==",
+ "dependencies": {
+ "jwa": "^1.4.1",
+ "safe-buffer": "^5.0.1"
+ }
+ },
+ "node_modules/kruptein": {
+ "version": "2.2.3",
+ "resolved": "https://registry.npmjs.org/kruptein/-/kruptein-2.2.3.tgz",
+ "integrity": "sha512-BTwprBPTzkFT9oTugxKd3WnWrX630MqUDsnmBuoa98eQs12oD4n4TeI0GbpdGcYn/73Xueg2rfnw+oK4dovnJg==",
+ "dependencies": {
+ "asn1.js": "^5.4.1"
+ },
+ "engines": {
+ "node": ">6"
+ }
+ },
+ "node_modules/lodash.includes": {
+ "version": "4.3.0",
+ "resolved": "https://registry.npmjs.org/lodash.includes/-/lodash.includes-4.3.0.tgz",
+ "integrity": "sha512-W3Bx6mdkRTGtlJISOvVD/lbqjTlPPUDTMnlXZFnVwi9NKJ6tiAk6LVdlhZMm17VZisqhKcgzpO5Wz91PCt5b0w=="
+ },
+ "node_modules/lodash.isboolean": {
+ "version": "3.0.3",
+ "resolved": "https://registry.npmjs.org/lodash.isboolean/-/lodash.isboolean-3.0.3.tgz",
+ "integrity": "sha512-Bz5mupy2SVbPHURB98VAcw+aHh4vRV5IPNhILUCsOzRmsTmSQ17jIuqopAentWoehktxGd9e/hbIXq980/1QJg=="
+ },
+ "node_modules/lodash.isinteger": {
+ "version": "4.0.4",
+ "resolved": "https://registry.npmjs.org/lodash.isinteger/-/lodash.isinteger-4.0.4.tgz",
+ "integrity": "sha512-DBwtEWN2caHQ9/imiNeEA5ys1JoRtRfY3d7V9wkqtbycnAmTvRRmbHKDV4a0EYc678/dia0jrte4tjYwVBaZUA=="
+ },
+ "node_modules/lodash.isnumber": {
+ "version": "3.0.3",
+ "resolved": "https://registry.npmjs.org/lodash.isnumber/-/lodash.isnumber-3.0.3.tgz",
+ "integrity": "sha512-QYqzpfwO3/CWf3XP+Z+tkQsfaLL/EnUlXWVkIk5FUPc4sBdTehEqZONuyRt2P67PXAk+NXmTBcc97zw9t1FQrw=="
+ },
+ "node_modules/lodash.isplainobject": {
+ "version": "4.0.6",
+ "resolved": "https://registry.npmjs.org/lodash.isplainobject/-/lodash.isplainobject-4.0.6.tgz",
+ "integrity": "sha512-oSXzaWypCMHkPC3NvBEaPHf0KsA5mvPrOPgQWDsbg8n7orZ290M0BmC/jgRZ4vcJ6DTAhjrsSYgdsW/F+MFOBA=="
+ },
+ "node_modules/lodash.isstring": {
+ "version": "4.0.1",
+ "resolved": "https://registry.npmjs.org/lodash.isstring/-/lodash.isstring-4.0.1.tgz",
+ "integrity": "sha512-0wJxfxH1wgO3GrbuP+dTTk7op+6L41QCXbGINEmD+ny/G/eCqGzxyCsh7159S+mgDDcoarnBw6PC1PS5+wUGgw=="
+ },
+ "node_modules/lodash.once": {
+ "version": "4.1.1",
+ "resolved": "https://registry.npmjs.org/lodash.once/-/lodash.once-4.1.1.tgz",
+ "integrity": "sha512-Sb487aTOCr9drQVL8pIxOzVhafOjZN9UU54hiN8PU3uAiSV7lx1yYNpbNmex2PK6dSJoNTSJUUswT651yww3Mg=="
+ },
+ "node_modules/long": {
+ "version": "5.2.3",
+ "resolved": "https://registry.npmjs.org/long/-/long-5.2.3.tgz",
+ "integrity": "sha512-lcHwpNoggQTObv5apGNCTdJrO69eHOZMi4BNC+rTLER8iHAqGrUVeLh/irVIM7zTw2bOXA8T6uNPeujwOLg/2Q=="
+ },
+ "node_modules/lru-cache": {
+ "version": "7.18.3",
+ "resolved": "https://registry.npmjs.org/lru-cache/-/lru-cache-7.18.3.tgz",
+ "integrity": "sha512-jumlc0BIUrS3qJGgIkWZsyfAM7NCWiBcCDhnd+3NNM5KbBmLTgHVfWBcg6W+rLUsIpzpERPsvwUP7CckAQSOoA==",
+ "engines": {
+ "node": ">=12"
+ }
+ },
+ "node_modules/lru.min": {
+ "version": "1.1.1",
+ "resolved": "https://registry.npmjs.org/lru.min/-/lru.min-1.1.1.tgz",
+ "integrity": "sha512-FbAj6lXil6t8z4z3j0E5mfRlPzxkySotzUHwRXjlpRh10vc6AI6WN62ehZj82VG7M20rqogJ0GLwar2Xa05a8Q==",
+ "engines": {
+ "bun": ">=1.0.0",
+ "deno": ">=1.30.0",
+ "node": ">=8.0.0"
+ },
+ "funding": {
+ "type": "github",
+ "url": "https://github.com/sponsors/wellwelwel"
+ }
+ },
+ "node_modules/media-typer": {
+ "version": "0.3.0",
+ "resolved": "https://registry.npmjs.org/media-typer/-/media-typer-0.3.0.tgz",
+ "integrity": "sha512-dq+qelQ9akHpcOl/gUVRTxVIOkAJ1wR3QAvb4RsVjS8oVoFjDGTc679wJYmUmknUF5HwMLOgb5O+a3KxfWapPQ==",
+ "engines": {
+ "node": ">= 0.6"
+ }
+ },
+ "node_modules/merge-descriptors": {
+ "version": "1.0.3",
+ "resolved": "https://registry.npmjs.org/merge-descriptors/-/merge-descriptors-1.0.3.tgz",
+ "integrity": "sha512-gaNvAS7TZ897/rVaZ0nMtAyxNyi/pdbjbAwUpFQpN70GqnVfOiXpeUUMKRBmzXaSQ8DdTX4/0ms62r2K+hE6mQ==",
+ "funding": {
+ "url": "https://github.com/sponsors/sindresorhus"
+ }
+ },
+ "node_modules/methods": {
+ "version": "1.1.2",
+ "resolved": "https://registry.npmjs.org/methods/-/methods-1.1.2.tgz",
+ "integrity": "sha512-iclAHeNqNm68zFtnZ0e+1L2yUIdvzNoauKU4WBA3VvH/vPFieF7qfRlwUZU+DA9P9bPXIS90ulxoUoCH23sV2w==",
+ "engines": {
+ "node": ">= 0.6"
+ }
+ },
+ "node_modules/mime": {
+ "version": "1.6.0",
+ "resolved": "https://registry.npmjs.org/mime/-/mime-1.6.0.tgz",
+ "integrity": "sha512-x0Vn8spI+wuJ1O6S7gnbaQg8Pxh4NNHb7KSINmEWKiPE4RKOplvijn+NkmYmmRgP68mc70j2EbeTFRsrswaQeg==",
+ "bin": {
+ "mime": "cli.js"
+ },
+ "engines": {
+ "node": ">=4"
+ }
+ },
+ "node_modules/mime-db": {
+ "version": "1.52.0",
+ "resolved": "https://registry.npmjs.org/mime-db/-/mime-db-1.52.0.tgz",
+ "integrity": "sha512-sPU4uV7dYlvtWJxwwxHD0PuihVNiE7TyAbQ5SWxDCB9mUYvOgroQOwYQQOKPJ8CIbE+1ETVlOoK1UC2nU3gYvg==",
+ "engines": {
+ "node": ">= 0.6"
+ }
+ },
+ "node_modules/mime-types": {
+ "version": "2.1.35",
+ "resolved": "https://registry.npmjs.org/mime-types/-/mime-types-2.1.35.tgz",
+ "integrity": "sha512-ZDY+bPm5zTTF+YpCrAU9nK0UgICYPT0QtT1NZWFv4s++TNkcgVaT0g6+4R2uI4MjQjzysHB1zxuWL50hzaeXiw==",
+ "dependencies": {
+ "mime-db": "1.52.0"
+ },
+ "engines": {
+ "node": ">= 0.6"
+ }
+ },
+ "node_modules/minimalistic-assert": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/minimalistic-assert/-/minimalistic-assert-1.0.1.tgz",
+ "integrity": "sha512-UtJcAD4yEaGtjPezWuO9wC4nwUnVH/8/Im3yEHQP4b67cXlD/Qr9hdITCU1xDbSEXg2XKNaP8jsReV7vQd00/A=="
+ },
+ "node_modules/ms": {
+ "version": "2.0.0",
+ "resolved": "https://registry.npmjs.org/ms/-/ms-2.0.0.tgz",
+ "integrity": "sha512-Tpp60P6IUJDTuOq/5Z8cdskzJujfwqfOTkrwIwj7IRISpnkJnT6SyJ4PCPnGMoFjC9ddhal5KVIYtAt97ix05A=="
+ },
+ "node_modules/mysql2": {
+ "version": "3.11.4",
+ "resolved": "https://registry.npmjs.org/mysql2/-/mysql2-3.11.4.tgz",
+ "integrity": "sha512-Z2o3tY4Z8EvSRDwknaC40MdZ3+m0sKbpnXrShQLdxPrAvcNli7jLrD2Zd2IzsRMw4eK9Yle500FDmlkIqp+krg==",
+ "dependencies": {
+ "aws-ssl-profiles": "^1.1.1",
+ "denque": "^2.1.0",
+ "generate-function": "^2.3.1",
+ "iconv-lite": "^0.6.3",
+ "long": "^5.2.1",
+ "lru.min": "^1.0.0",
+ "named-placeholders": "^1.1.3",
+ "seq-queue": "^0.0.5",
+ "sqlstring": "^2.3.2"
+ },
+ "engines": {
+ "node": ">= 8.0"
+ }
+ },
+ "node_modules/mysql2/node_modules/iconv-lite": {
+ "version": "0.6.3",
+ "resolved": "https://registry.npmjs.org/iconv-lite/-/iconv-lite-0.6.3.tgz",
+ "integrity": "sha512-4fCk79wshMdzMp2rH06qWrJE4iolqLhCUH+OiuIgU++RB0+94NlDL81atO7GX55uUKueo0txHNtvEyI6D7WdMw==",
+ "dependencies": {
+ "safer-buffer": ">= 2.1.2 < 3.0.0"
+ },
+ "engines": {
+ "node": ">=0.10.0"
+ }
+ },
+ "node_modules/named-placeholders": {
+ "version": "1.1.3",
+ "resolved": "https://registry.npmjs.org/named-placeholders/-/named-placeholders-1.1.3.tgz",
+ "integrity": "sha512-eLoBxg6wE/rZkJPhU/xRX1WTpkFEwDJEN96oxFrTsqBdbT5ec295Q+CoHrL9IT0DipqKhmGcaZmwOt8OON5x1w==",
+ "dependencies": {
+ "lru-cache": "^7.14.1"
+ },
+ "engines": {
+ "node": ">=12.0.0"
+ }
+ },
+ "node_modules/negotiator": {
+ "version": "0.6.3",
+ "resolved": "https://registry.npmjs.org/negotiator/-/negotiator-0.6.3.tgz",
+ "integrity": "sha512-+EUsqGPLsM+j/zdChZjsnX51g4XrHFOIXwfnCVPGlQk/k5giakcKsuxCObBRu6DSm9opw/O6slWbJdghQM4bBg==",
+ "engines": {
+ "node": ">= 0.6"
+ }
+ },
+ "node_modules/object-assign": {
+ "version": "4.1.1",
+ "resolved": "https://registry.npmjs.org/object-assign/-/object-assign-4.1.1.tgz",
+ "integrity": "sha512-rJgTQnkUnH1sFw8yT6VSU3zD3sWmu6sZhIseY8VX+GRu3P6F7Fu+JNDoXfklElbLJSnc3FUQHVe4cU5hj+BcUg==",
+ "engines": {
+ "node": ">=0.10.0"
+ }
+ },
+ "node_modules/object-inspect": {
+ "version": "1.13.3",
+ "resolved": "https://registry.npmjs.org/object-inspect/-/object-inspect-1.13.3.tgz",
+ "integrity": "sha512-kDCGIbxkDSXE3euJZZXzc6to7fCrKHNI/hSRQnRuQ+BWjFNzZwiFF8fj/6o2t2G9/jTj8PSIYTfCLelLZEeRpA==",
+ "engines": {
+ "node": ">= 0.4"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/on-finished": {
+ "version": "2.4.1",
+ "resolved": "https://registry.npmjs.org/on-finished/-/on-finished-2.4.1.tgz",
+ "integrity": "sha512-oVlzkg3ENAhCk2zdv7IJwd/QUD4z2RxRwpkcGY8psCVcCYZNq4wYnVWALHM+brtuJjePWiYF/ClmuDr8Ch5+kg==",
+ "dependencies": {
+ "ee-first": "1.1.1"
+ },
+ "engines": {
+ "node": ">= 0.8"
+ }
+ },
+ "node_modules/on-headers": {
+ "version": "1.0.2",
+ "resolved": "https://registry.npmjs.org/on-headers/-/on-headers-1.0.2.tgz",
+ "integrity": "sha512-pZAE+FJLoyITytdqK0U5s+FIpjN0JP3OzFi/u8Rx+EV5/W+JTWGXG8xFzevE7AjBfDqHv/8vL8qQsIhHnqRkrA==",
+ "engines": {
+ "node": ">= 0.8"
+ }
+ },
+ "node_modules/parseurl": {
+ "version": "1.3.3",
+ "resolved": "https://registry.npmjs.org/parseurl/-/parseurl-1.3.3.tgz",
+ "integrity": "sha512-CiyeOxFT/JZyN5m0z9PfXw4SCBJ6Sygz1Dpl0wqjlhDEGGBP1GnsUVEL0p63hoG1fcj3fHynXi9NYO4nWOL+qQ==",
+ "engines": {
+ "node": ">= 0.8"
+ }
+ },
+ "node_modules/path-to-regexp": {
+ "version": "0.1.10",
+ "resolved": "https://registry.npmjs.org/path-to-regexp/-/path-to-regexp-0.1.10.tgz",
+ "integrity": "sha512-7lf7qcQidTku0Gu3YDPc8DJ1q7OOucfa/BSsIwjuh56VU7katFvuM8hULfkwB3Fns/rsVF7PwPKVw1sl5KQS9w=="
+ },
+ "node_modules/proxy-addr": {
+ "version": "2.0.7",
+ "resolved": "https://registry.npmjs.org/proxy-addr/-/proxy-addr-2.0.7.tgz",
+ "integrity": "sha512-llQsMLSUDUPT44jdrU/O37qlnifitDP+ZwrmmZcoSKyLKvtZxpyV0n2/bD/N4tBAAZ/gJEdZU7KMraoK1+XYAg==",
+ "dependencies": {
+ "forwarded": "0.2.0",
+ "ipaddr.js": "1.9.1"
+ },
+ "engines": {
+ "node": ">= 0.10"
+ }
+ },
+ "node_modules/qs": {
+ "version": "6.13.0",
+ "resolved": "https://registry.npmjs.org/qs/-/qs-6.13.0.tgz",
+ "integrity": "sha512-+38qI9SOr8tfZ4QmJNplMUxqjbe7LKvvZgWdExBOmd+egZTtjLB67Gu0HRX3u/XOq7UU2Nx6nsjvS16Z9uwfpg==",
+ "dependencies": {
+ "side-channel": "^1.0.6"
+ },
+ "engines": {
+ "node": ">=0.6"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/random-bytes": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/random-bytes/-/random-bytes-1.0.0.tgz",
+ "integrity": "sha512-iv7LhNVO047HzYR3InF6pUcUsPQiHTM1Qal51DcGSuZFBil1aBBWG5eHPNek7bvILMaYJ/8RU1e8w1AMdHmLQQ==",
+ "engines": {
+ "node": ">= 0.8"
+ }
+ },
+ "node_modules/range-parser": {
+ "version": "1.2.1",
+ "resolved": "https://registry.npmjs.org/range-parser/-/range-parser-1.2.1.tgz",
+ "integrity": "sha512-Hrgsx+orqoygnmhFbKaHE6c296J+HTAQXoxEF6gNupROmmGJRoyzfG3ccAveqCBrwr/2yxQ5BVd/GTl5agOwSg==",
+ "engines": {
+ "node": ">= 0.6"
+ }
+ },
+ "node_modules/raw-body": {
+ "version": "2.5.2",
+ "resolved": "https://registry.npmjs.org/raw-body/-/raw-body-2.5.2.tgz",
+ "integrity": "sha512-8zGqypfENjCIqGhgXToC8aB2r7YrBX+AQAfIPs/Mlk+BtPTztOvTS01NRW/3Eh60J+a48lt8qsCzirQ6loCVfA==",
+ "dependencies": {
+ "bytes": "3.1.2",
+ "http-errors": "2.0.0",
+ "iconv-lite": "0.4.24",
+ "unpipe": "1.0.0"
+ },
+ "engines": {
+ "node": ">= 0.8"
+ }
+ },
+ "node_modules/retry": {
+ "version": "0.12.0",
+ "resolved": "https://registry.npmjs.org/retry/-/retry-0.12.0.tgz",
+ "integrity": "sha512-9LkiTwjUh6rT555DtE9rTX+BKByPfrMzEAtnlEtdEwr3Nkffwiihqe2bWADg+OQRjt9gl6ICdmB/ZFDCGAtSow==",
+ "engines": {
+ "node": ">= 4"
+ }
+ },
+ "node_modules/safe-buffer": {
+ "version": "5.2.1",
+ "resolved": "https://registry.npmjs.org/safe-buffer/-/safe-buffer-5.2.1.tgz",
+ "integrity": "sha512-rp3So07KcdmmKbGvgaNxQSJr7bGVSVk5S9Eq1F+ppbRo70+YeaDxkw5Dd8NPN+GD6bjnYm2VuPuCXmpuYvmCXQ==",
+ "funding": [
+ {
+ "type": "github",
+ "url": "https://github.com/sponsors/feross"
+ },
+ {
+ "type": "patreon",
+ "url": "https://www.patreon.com/feross"
+ },
+ {
+ "type": "consulting",
+ "url": "https://feross.org/support"
+ }
+ ]
+ },
+ "node_modules/safer-buffer": {
+ "version": "2.1.2",
+ "resolved": "https://registry.npmjs.org/safer-buffer/-/safer-buffer-2.1.2.tgz",
+ "integrity": "sha512-YZo3K82SD7Riyi0E1EQPojLz7kpepnSQI9IyPbHHg1XXXevb5dJI7tpyN2ADxGcQbHG7vcyRHk0cbwqcQriUtg=="
+ },
+ "node_modules/semver": {
+ "version": "7.6.3",
+ "resolved": "https://registry.npmjs.org/semver/-/semver-7.6.3.tgz",
+ "integrity": "sha512-oVekP1cKtI+CTDvHWYFUcMtsK/00wmAEfyqKfNdARm8u1wNVhSgaX7A8d4UuIlUI5e84iEwOhs7ZPYRmzU9U6A==",
+ "bin": {
+ "semver": "bin/semver.js"
+ },
+ "engines": {
+ "node": ">=10"
+ }
+ },
+ "node_modules/send": {
+ "version": "0.19.0",
+ "resolved": "https://registry.npmjs.org/send/-/send-0.19.0.tgz",
+ "integrity": "sha512-dW41u5VfLXu8SJh5bwRmyYUbAoSB3c9uQh6L8h/KtsFREPWpbX1lrljJo186Jc4nmci/sGUZ9a0a0J2zgfq2hw==",
+ "dependencies": {
+ "debug": "2.6.9",
+ "depd": "2.0.0",
+ "destroy": "1.2.0",
+ "encodeurl": "~1.0.2",
+ "escape-html": "~1.0.3",
+ "etag": "~1.8.1",
+ "fresh": "0.5.2",
+ "http-errors": "2.0.0",
+ "mime": "1.6.0",
+ "ms": "2.1.3",
+ "on-finished": "2.4.1",
+ "range-parser": "~1.2.1",
+ "statuses": "2.0.1"
+ },
+ "engines": {
+ "node": ">= 0.8.0"
+ }
+ },
+ "node_modules/send/node_modules/encodeurl": {
+ "version": "1.0.2",
+ "resolved": "https://registry.npmjs.org/encodeurl/-/encodeurl-1.0.2.tgz",
+ "integrity": "sha512-TPJXq8JqFaVYm2CWmPvnP2Iyo4ZSM7/QKcSmuMLDObfpH5fi7RUGmd/rTDf+rut/saiDiQEeVTNgAmJEdAOx0w==",
+ "engines": {
+ "node": ">= 0.8"
+ }
+ },
+ "node_modules/send/node_modules/ms": {
+ "version": "2.1.3",
+ "resolved": "https://registry.npmjs.org/ms/-/ms-2.1.3.tgz",
+ "integrity": "sha512-6FlzubTLZG3J2a/NVCAleEhjzq5oxgHyaCU9yYXvcLsvoVaHJq/s5xXI6/XXP6tz7R9xAOtHnSO/tXtF3WRTlA=="
+ },
+ "node_modules/seq-queue": {
+ "version": "0.0.5",
+ "resolved": "https://registry.npmjs.org/seq-queue/-/seq-queue-0.0.5.tgz",
+ "integrity": "sha512-hr3Wtp/GZIc/6DAGPDcV4/9WoZhjrkXsi5B/07QgX8tsdc6ilr7BFM6PM6rbdAX1kFSDYeZGLipIZZKyQP0O5Q=="
+ },
+ "node_modules/serve-static": {
+ "version": "1.16.2",
+ "resolved": "https://registry.npmjs.org/serve-static/-/serve-static-1.16.2.tgz",
+ "integrity": "sha512-VqpjJZKadQB/PEbEwvFdO43Ax5dFBZ2UECszz8bQ7pi7wt//PWe1P6MN7eCnjsatYtBT6EuiClbjSWP2WrIoTw==",
+ "dependencies": {
+ "encodeurl": "~2.0.0",
+ "escape-html": "~1.0.3",
+ "parseurl": "~1.3.3",
+ "send": "0.19.0"
+ },
+ "engines": {
+ "node": ">= 0.8.0"
+ }
+ },
+ "node_modules/session-file-store": {
+ "version": "1.5.0",
+ "resolved": "https://registry.npmjs.org/session-file-store/-/session-file-store-1.5.0.tgz",
+ "integrity": "sha512-60IZaJNzyu2tIeHutkYE8RiXVx3KRvacOxfLr2Mj92SIsRIroDsH0IlUUR6fJAjoTW4RQISbaOApa2IZpIwFdQ==",
+ "dependencies": {
+ "bagpipe": "^0.3.5",
+ "fs-extra": "^8.0.1",
+ "kruptein": "^2.0.4",
+ "object-assign": "^4.1.1",
+ "retry": "^0.12.0",
+ "write-file-atomic": "3.0.3"
+ },
+ "engines": {
+ "node": ">= 6"
+ }
+ },
+ "node_modules/set-function-length": {
+ "version": "1.2.2",
+ "resolved": "https://registry.npmjs.org/set-function-length/-/set-function-length-1.2.2.tgz",
+ "integrity": "sha512-pgRc4hJ4/sNjWCSS9AmnS40x3bNMDTknHgL5UaMBTMyJnU90EgWh1Rz+MC9eFu4BuN/UwZjKQuY/1v3rM7HMfg==",
+ "dependencies": {
+ "define-data-property": "^1.1.4",
+ "es-errors": "^1.3.0",
+ "function-bind": "^1.1.2",
+ "get-intrinsic": "^1.2.4",
+ "gopd": "^1.0.1",
+ "has-property-descriptors": "^1.0.2"
+ },
+ "engines": {
+ "node": ">= 0.4"
+ }
+ },
+ "node_modules/setprototypeof": {
+ "version": "1.2.0",
+ "resolved": "https://registry.npmjs.org/setprototypeof/-/setprototypeof-1.2.0.tgz",
+ "integrity": "sha512-E5LDX7Wrp85Kil5bhZv46j8jOeboKq5JMmYM3gVGdGH8xFpPWXUMsNrlODCrkoxMEeNi/XZIwuRvY4XNwYMJpw=="
+ },
+ "node_modules/side-channel": {
+ "version": "1.0.6",
+ "resolved": "https://registry.npmjs.org/side-channel/-/side-channel-1.0.6.tgz",
+ "integrity": "sha512-fDW/EZ6Q9RiO8eFG8Hj+7u/oW+XrPTIChwCOM2+th2A6OblDtYYIpve9m+KvI9Z4C9qSEXlaGR6bTEYHReuglA==",
+ "dependencies": {
+ "call-bind": "^1.0.7",
+ "es-errors": "^1.3.0",
+ "get-intrinsic": "^1.2.4",
+ "object-inspect": "^1.13.1"
+ },
+ "engines": {
+ "node": ">= 0.4"
+ },
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ }
+ },
+ "node_modules/signal-exit": {
+ "version": "3.0.7",
+ "resolved": "https://registry.npmjs.org/signal-exit/-/signal-exit-3.0.7.tgz",
+ "integrity": "sha512-wnD2ZE+l+SPC/uoS0vXeE9L1+0wuaMqKlfz9AMUo38JsyLSBWSFcHR1Rri62LZc12vLr1gb3jl7iwQhgwpAbGQ=="
+ },
+ "node_modules/sqlstring": {
+ "version": "2.3.3",
+ "resolved": "https://registry.npmjs.org/sqlstring/-/sqlstring-2.3.3.tgz",
+ "integrity": "sha512-qC9iz2FlN7DQl3+wjwn3802RTyjCx7sDvfQEXchwa6CWOx07/WVfh91gBmQ9fahw8snwGEWU3xGzOt4tFyHLxg==",
+ "engines": {
+ "node": ">= 0.6"
+ }
+ },
+ "node_modules/statuses": {
+ "version": "2.0.1",
+ "resolved": "https://registry.npmjs.org/statuses/-/statuses-2.0.1.tgz",
+ "integrity": "sha512-RwNA9Z/7PrK06rYLIzFMlaF+l73iwpzsqRIFgbMLbTcLD6cOao82TaWefPXQvB2fOC4AjuYSEndS7N/mTCbkdQ==",
+ "engines": {
+ "node": ">= 0.8"
+ }
+ },
+ "node_modules/toidentifier": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/toidentifier/-/toidentifier-1.0.1.tgz",
+ "integrity": "sha512-o5sSPKEkg/DIQNmH43V0/uerLrpzVedkUh8tGNvaeXpfpuwjKenlSox/2O/BTlZUtEe+JG7s5YhEz608PlAHRA==",
+ "engines": {
+ "node": ">=0.6"
+ }
+ },
+ "node_modules/type-is": {
+ "version": "1.6.18",
+ "resolved": "https://registry.npmjs.org/type-is/-/type-is-1.6.18.tgz",
+ "integrity": "sha512-TkRKr9sUTxEH8MdfuCSP7VizJyzRNMjj2J2do2Jr3Kym598JVdEksuzPQCnlFPW4ky9Q+iA+ma9BGm06XQBy8g==",
+ "dependencies": {
+ "media-typer": "0.3.0",
+ "mime-types": "~2.1.24"
+ },
+ "engines": {
+ "node": ">= 0.6"
+ }
+ },
+ "node_modules/typedarray-to-buffer": {
+ "version": "3.1.5",
+ "resolved": "https://registry.npmjs.org/typedarray-to-buffer/-/typedarray-to-buffer-3.1.5.tgz",
+ "integrity": "sha512-zdu8XMNEDepKKR+XYOXAVPtWui0ly0NtohUscw+UmaHiAWT8hrV1rr//H6V+0DvJ3OQ19S979M0laLfX8rm82Q==",
+ "dependencies": {
+ "is-typedarray": "^1.0.0"
+ }
+ },
+ "node_modules/uid-safe": {
+ "version": "2.1.5",
+ "resolved": "https://registry.npmjs.org/uid-safe/-/uid-safe-2.1.5.tgz",
+ "integrity": "sha512-KPHm4VL5dDXKz01UuEd88Df+KzynaohSL9fBh096KWAxSKZQDI2uBrVqtvRM4rwrIrRRKsdLNML/lnaaVSRioA==",
+ "dependencies": {
+ "random-bytes": "~1.0.0"
+ },
+ "engines": {
+ "node": ">= 0.8"
+ }
+ },
+ "node_modules/universalify": {
+ "version": "0.1.2",
+ "resolved": "https://registry.npmjs.org/universalify/-/universalify-0.1.2.tgz",
+ "integrity": "sha512-rBJeI5CXAlmy1pV+617WB9J63U6XcazHHF2f2dbJix4XzpUF0RS3Zbj0FGIOCAva5P/d/GBOYaACQ1w+0azUkg==",
+ "engines": {
+ "node": ">= 4.0.0"
+ }
+ },
+ "node_modules/unpipe": {
+ "version": "1.0.0",
+ "resolved": "https://registry.npmjs.org/unpipe/-/unpipe-1.0.0.tgz",
+ "integrity": "sha512-pjy2bYhSsufwWlKwPc+l3cN7+wuJlK6uz0YdJEOlQDbl6jo/YlPi4mb8agUkVC8BF7V8NuzeyPNqRksA3hztKQ==",
+ "engines": {
+ "node": ">= 0.8"
+ }
+ },
+ "node_modules/utils-merge": {
+ "version": "1.0.1",
+ "resolved": "https://registry.npmjs.org/utils-merge/-/utils-merge-1.0.1.tgz",
+ "integrity": "sha512-pMZTvIkT1d+TFGvDOqodOclx0QWkkgi6Tdoa8gC8ffGAAqz9pzPTZWAybbsHHoED/ztMtkv/VoYTYyShUn81hA==",
+ "engines": {
+ "node": ">= 0.4.0"
+ }
+ },
+ "node_modules/vary": {
+ "version": "1.1.2",
+ "resolved": "https://registry.npmjs.org/vary/-/vary-1.1.2.tgz",
+ "integrity": "sha512-BNGbWLfd0eUPabhkXUVm0j8uuvREyTh5ovRa/dyow/BqAbZJyC+5fU+IzQOzmAKzYqYRAISoRhdQr3eIZ/PXqg==",
+ "engines": {
+ "node": ">= 0.8"
+ }
+ },
+ "node_modules/write-file-atomic": {
+ "version": "3.0.3",
+ "resolved": "https://registry.npmjs.org/write-file-atomic/-/write-file-atomic-3.0.3.tgz",
+ "integrity": "sha512-AvHcyZ5JnSfq3ioSyjrBkH9yW4m7Ayk8/9My/DD9onKeu/94fwrMocemO2QAJFAlnnDN+ZDS+ZjAR5ua1/PV/Q==",
+ "dependencies": {
+ "imurmurhash": "^0.1.4",
+ "is-typedarray": "^1.0.0",
+ "signal-exit": "^3.0.2",
+ "typedarray-to-buffer": "^3.1.5"
+ }
+ }
+ }
+}
diff --git a/node_modules/accepts/HISTORY.md b/node_modules/accepts/HISTORY.md
new file mode 100644
index 0000000..cb5990c
--- /dev/null
+++ b/node_modules/accepts/HISTORY.md
@@ -0,0 +1,243 @@
+1.3.8 / 2022-02-02
+==================
+
+ * deps: mime-types@~2.1.34
+ - deps: mime-db@~1.51.0
+ * deps: negotiator@0.6.3
+
+1.3.7 / 2019-04-29
+==================
+
+ * deps: negotiator@0.6.2
+ - Fix sorting charset, encoding, and language with extra parameters
+
+1.3.6 / 2019-04-28
+==================
+
+ * deps: mime-types@~2.1.24
+ - deps: mime-db@~1.40.0
+
+1.3.5 / 2018-02-28
+==================
+
+ * deps: mime-types@~2.1.18
+ - deps: mime-db@~1.33.0
+
+1.3.4 / 2017-08-22
+==================
+
+ * deps: mime-types@~2.1.16
+ - deps: mime-db@~1.29.0
+
+1.3.3 / 2016-05-02
+==================
+
+ * deps: mime-types@~2.1.11
+ - deps: mime-db@~1.23.0
+ * deps: negotiator@0.6.1
+ - perf: improve `Accept` parsing speed
+ - perf: improve `Accept-Charset` parsing speed
+ - perf: improve `Accept-Encoding` parsing speed
+ - perf: improve `Accept-Language` parsing speed
+
+1.3.2 / 2016-03-08
+==================
+
+ * deps: mime-types@~2.1.10
+ - Fix extension of `application/dash+xml`
+ - Update primary extension for `audio/mp4`
+ - deps: mime-db@~1.22.0
+
+1.3.1 / 2016-01-19
+==================
+
+ * deps: mime-types@~2.1.9
+ - deps: mime-db@~1.21.0
+
+1.3.0 / 2015-09-29
+==================
+
+ * deps: mime-types@~2.1.7
+ - deps: mime-db@~1.19.0
+ * deps: negotiator@0.6.0
+ - Fix including type extensions in parameters in `Accept` parsing
+ - Fix parsing `Accept` parameters with quoted equals
+ - Fix parsing `Accept` parameters with quoted semicolons
+ - Lazy-load modules from main entry point
+ - perf: delay type concatenation until needed
+ - perf: enable strict mode
+ - perf: hoist regular expressions
+ - perf: remove closures getting spec properties
+ - perf: remove a closure from media type parsing
+ - perf: remove property delete from media type parsing
+
+1.2.13 / 2015-09-06
+===================
+
+ * deps: mime-types@~2.1.6
+ - deps: mime-db@~1.18.0
+
+1.2.12 / 2015-07-30
+===================
+
+ * deps: mime-types@~2.1.4
+ - deps: mime-db@~1.16.0
+
+1.2.11 / 2015-07-16
+===================
+
+ * deps: mime-types@~2.1.3
+ - deps: mime-db@~1.15.0
+
+1.2.10 / 2015-07-01
+===================
+
+ * deps: mime-types@~2.1.2
+ - deps: mime-db@~1.14.0
+
+1.2.9 / 2015-06-08
+==================
+
+ * deps: mime-types@~2.1.1
+ - perf: fix deopt during mapping
+
+1.2.8 / 2015-06-07
+==================
+
+ * deps: mime-types@~2.1.0
+ - deps: mime-db@~1.13.0
+ * perf: avoid argument reassignment & argument slice
+ * perf: avoid negotiator recursive construction
+ * perf: enable strict mode
+ * perf: remove unnecessary bitwise operator
+
+1.2.7 / 2015-05-10
+==================
+
+ * deps: negotiator@0.5.3
+ - Fix media type parameter matching to be case-insensitive
+
+1.2.6 / 2015-05-07
+==================
+
+ * deps: mime-types@~2.0.11
+ - deps: mime-db@~1.9.1
+ * deps: negotiator@0.5.2
+ - Fix comparing media types with quoted values
+ - Fix splitting media types with quoted commas
+
+1.2.5 / 2015-03-13
+==================
+
+ * deps: mime-types@~2.0.10
+ - deps: mime-db@~1.8.0
+
+1.2.4 / 2015-02-14
+==================
+
+ * Support Node.js 0.6
+ * deps: mime-types@~2.0.9
+ - deps: mime-db@~1.7.0
+ * deps: negotiator@0.5.1
+ - Fix preference sorting to be stable for long acceptable lists
+
+1.2.3 / 2015-01-31
+==================
+
+ * deps: mime-types@~2.0.8
+ - deps: mime-db@~1.6.0
+
+1.2.2 / 2014-12-30
+==================
+
+ * deps: mime-types@~2.0.7
+ - deps: mime-db@~1.5.0
+
+1.2.1 / 2014-12-30
+==================
+
+ * deps: mime-types@~2.0.5
+ - deps: mime-db@~1.3.1
+
+1.2.0 / 2014-12-19
+==================
+
+ * deps: negotiator@0.5.0
+ - Fix list return order when large accepted list
+ - Fix missing identity encoding when q=0 exists
+ - Remove dynamic building of Negotiator class
+
+1.1.4 / 2014-12-10
+==================
+
+ * deps: mime-types@~2.0.4
+ - deps: mime-db@~1.3.0
+
+1.1.3 / 2014-11-09
+==================
+
+ * deps: mime-types@~2.0.3
+ - deps: mime-db@~1.2.0
+
+1.1.2 / 2014-10-14
+==================
+
+ * deps: negotiator@0.4.9
+ - Fix error when media type has invalid parameter
+
+1.1.1 / 2014-09-28
+==================
+
+ * deps: mime-types@~2.0.2
+ - deps: mime-db@~1.1.0
+ * deps: negotiator@0.4.8
+ - Fix all negotiations to be case-insensitive
+ - Stable sort preferences of same quality according to client order
+
+1.1.0 / 2014-09-02
+==================
+
+ * update `mime-types`
+
+1.0.7 / 2014-07-04
+==================
+
+ * Fix wrong type returned from `type` when match after unknown extension
+
+1.0.6 / 2014-06-24
+==================
+
+ * deps: negotiator@0.4.7
+
+1.0.5 / 2014-06-20
+==================
+
+ * fix crash when unknown extension given
+
+1.0.4 / 2014-06-19
+==================
+
+ * use `mime-types`
+
+1.0.3 / 2014-06-11
+==================
+
+ * deps: negotiator@0.4.6
+ - Order by specificity when quality is the same
+
+1.0.2 / 2014-05-29
+==================
+
+ * Fix interpretation when header not in request
+ * deps: pin negotiator@0.4.5
+
+1.0.1 / 2014-01-18
+==================
+
+ * Identity encoding isn't always acceptable
+ * deps: negotiator@~0.4.0
+
+1.0.0 / 2013-12-27
+==================
+
+ * Genesis
diff --git a/node_modules/accepts/LICENSE b/node_modules/accepts/LICENSE
new file mode 100644
index 0000000..0616607
--- /dev/null
+++ b/node_modules/accepts/LICENSE
@@ -0,0 +1,23 @@
+(The MIT License)
+
+Copyright (c) 2014 Jonathan Ong
+Copyright (c) 2015 Douglas Christopher Wilson
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/node_modules/accepts/README.md b/node_modules/accepts/README.md
new file mode 100644
index 0000000..82680c5
--- /dev/null
+++ b/node_modules/accepts/README.md
@@ -0,0 +1,140 @@
+# accepts
+
+[![NPM Version][npm-version-image]][npm-url]
+[![NPM Downloads][npm-downloads-image]][npm-url]
+[![Node.js Version][node-version-image]][node-version-url]
+[![Build Status][github-actions-ci-image]][github-actions-ci-url]
+[![Test Coverage][coveralls-image]][coveralls-url]
+
+Higher level content negotiation based on [negotiator](https://www.npmjs.com/package/negotiator).
+Extracted from [koa](https://www.npmjs.com/package/koa) for general use.
+
+In addition to negotiator, it allows:
+
+- Allows types as an array or arguments list, ie `(['text/html', 'application/json'])`
+ as well as `('text/html', 'application/json')`.
+- Allows type shorthands such as `json`.
+- Returns `false` when no types match
+- Treats non-existent headers as `*`
+
+## Installation
+
+This is a [Node.js](https://nodejs.org/en/) module available through the
+[npm registry](https://www.npmjs.com/). Installation is done using the
+[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally):
+
+```sh
+$ npm install accepts
+```
+
+## API
+
+```js
+var accepts = require('accepts')
+```
+
+### accepts(req)
+
+Create a new `Accepts` object for the given `req`.
+
+#### .charset(charsets)
+
+Return the first accepted charset. If nothing in `charsets` is accepted,
+then `false` is returned.
+
+#### .charsets()
+
+Return the charsets that the request accepts, in the order of the client's
+preference (most preferred first).
+
+#### .encoding(encodings)
+
+Return the first accepted encoding. If nothing in `encodings` is accepted,
+then `false` is returned.
+
+#### .encodings()
+
+Return the encodings that the request accepts, in the order of the client's
+preference (most preferred first).
+
+#### .language(languages)
+
+Return the first accepted language. If nothing in `languages` is accepted,
+then `false` is returned.
+
+#### .languages()
+
+Return the languages that the request accepts, in the order of the client's
+preference (most preferred first).
+
+#### .type(types)
+
+Return the first accepted type (and it is returned as the same text as what
+appears in the `types` array). If nothing in `types` is accepted, then `false`
+is returned.
+
+The `types` array can contain full MIME types or file extensions. Any value
+that is not a full MIME types is passed to `require('mime-types').lookup`.
+
+#### .types()
+
+Return the types that the request accepts, in the order of the client's
+preference (most preferred first).
+
+## Examples
+
+### Simple type negotiation
+
+This simple example shows how to use `accepts` to return a different typed
+respond body based on what the client wants to accept. The server lists it's
+preferences in order and will get back the best match between the client and
+server.
+
+```js
+var accepts = require('accepts')
+var http = require('http')
+
+function app (req, res) {
+ var accept = accepts(req)
+
+ // the order of this list is significant; should be server preferred order
+ switch (accept.type(['json', 'html'])) {
+ case 'json':
+ res.setHeader('Content-Type', 'application/json')
+ res.write('{"hello":"world!"}')
+ break
+ case 'html':
+ res.setHeader('Content-Type', 'text/html')
+ res.write('hello, world! ')
+ break
+ default:
+ // the fallback is text/plain, so no need to specify it above
+ res.setHeader('Content-Type', 'text/plain')
+ res.write('hello, world!')
+ break
+ }
+
+ res.end()
+}
+
+http.createServer(app).listen(3000)
+```
+
+You can test this out with the cURL program:
+```sh
+curl -I -H'Accept: text/html' http://localhost:3000/
+```
+
+## License
+
+[MIT](LICENSE)
+
+[coveralls-image]: https://badgen.net/coveralls/c/github/jshttp/accepts/master
+[coveralls-url]: https://coveralls.io/r/jshttp/accepts?branch=master
+[github-actions-ci-image]: https://badgen.net/github/checks/jshttp/accepts/master?label=ci
+[github-actions-ci-url]: https://github.com/jshttp/accepts/actions/workflows/ci.yml
+[node-version-image]: https://badgen.net/npm/node/accepts
+[node-version-url]: https://nodejs.org/en/download
+[npm-downloads-image]: https://badgen.net/npm/dm/accepts
+[npm-url]: https://npmjs.org/package/accepts
+[npm-version-image]: https://badgen.net/npm/v/accepts
diff --git a/node_modules/accepts/index.js b/node_modules/accepts/index.js
new file mode 100644
index 0000000..e9b2f63
--- /dev/null
+++ b/node_modules/accepts/index.js
@@ -0,0 +1,238 @@
+/*!
+ * accepts
+ * Copyright(c) 2014 Jonathan Ong
+ * Copyright(c) 2015 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+'use strict'
+
+/**
+ * Module dependencies.
+ * @private
+ */
+
+var Negotiator = require('negotiator')
+var mime = require('mime-types')
+
+/**
+ * Module exports.
+ * @public
+ */
+
+module.exports = Accepts
+
+/**
+ * Create a new Accepts object for the given req.
+ *
+ * @param {object} req
+ * @public
+ */
+
+function Accepts (req) {
+ if (!(this instanceof Accepts)) {
+ return new Accepts(req)
+ }
+
+ this.headers = req.headers
+ this.negotiator = new Negotiator(req)
+}
+
+/**
+ * Check if the given `type(s)` is acceptable, returning
+ * the best match when true, otherwise `undefined`, in which
+ * case you should respond with 406 "Not Acceptable".
+ *
+ * The `type` value may be a single mime type string
+ * such as "application/json", the extension name
+ * such as "json" or an array `["json", "html", "text/plain"]`. When a list
+ * or array is given the _best_ match, if any is returned.
+ *
+ * Examples:
+ *
+ * // Accept: text/html
+ * this.types('html');
+ * // => "html"
+ *
+ * // Accept: text/*, application/json
+ * this.types('html');
+ * // => "html"
+ * this.types('text/html');
+ * // => "text/html"
+ * this.types('json', 'text');
+ * // => "json"
+ * this.types('application/json');
+ * // => "application/json"
+ *
+ * // Accept: text/*, application/json
+ * this.types('image/png');
+ * this.types('png');
+ * // => undefined
+ *
+ * // Accept: text/*;q=.5, application/json
+ * this.types(['html', 'json']);
+ * this.types('html', 'json');
+ * // => "json"
+ *
+ * @param {String|Array} types...
+ * @return {String|Array|Boolean}
+ * @public
+ */
+
+Accepts.prototype.type =
+Accepts.prototype.types = function (types_) {
+ var types = types_
+
+ // support flattened arguments
+ if (types && !Array.isArray(types)) {
+ types = new Array(arguments.length)
+ for (var i = 0; i < types.length; i++) {
+ types[i] = arguments[i]
+ }
+ }
+
+ // no types, return all requested types
+ if (!types || types.length === 0) {
+ return this.negotiator.mediaTypes()
+ }
+
+ // no accept header, return first given type
+ if (!this.headers.accept) {
+ return types[0]
+ }
+
+ var mimes = types.map(extToMime)
+ var accepts = this.negotiator.mediaTypes(mimes.filter(validMime))
+ var first = accepts[0]
+
+ return first
+ ? types[mimes.indexOf(first)]
+ : false
+}
+
+/**
+ * Return accepted encodings or best fit based on `encodings`.
+ *
+ * Given `Accept-Encoding: gzip, deflate`
+ * an array sorted by quality is returned:
+ *
+ * ['gzip', 'deflate']
+ *
+ * @param {String|Array} encodings...
+ * @return {String|Array}
+ * @public
+ */
+
+Accepts.prototype.encoding =
+Accepts.prototype.encodings = function (encodings_) {
+ var encodings = encodings_
+
+ // support flattened arguments
+ if (encodings && !Array.isArray(encodings)) {
+ encodings = new Array(arguments.length)
+ for (var i = 0; i < encodings.length; i++) {
+ encodings[i] = arguments[i]
+ }
+ }
+
+ // no encodings, return all requested encodings
+ if (!encodings || encodings.length === 0) {
+ return this.negotiator.encodings()
+ }
+
+ return this.negotiator.encodings(encodings)[0] || false
+}
+
+/**
+ * Return accepted charsets or best fit based on `charsets`.
+ *
+ * Given `Accept-Charset: utf-8, iso-8859-1;q=0.2, utf-7;q=0.5`
+ * an array sorted by quality is returned:
+ *
+ * ['utf-8', 'utf-7', 'iso-8859-1']
+ *
+ * @param {String|Array} charsets...
+ * @return {String|Array}
+ * @public
+ */
+
+Accepts.prototype.charset =
+Accepts.prototype.charsets = function (charsets_) {
+ var charsets = charsets_
+
+ // support flattened arguments
+ if (charsets && !Array.isArray(charsets)) {
+ charsets = new Array(arguments.length)
+ for (var i = 0; i < charsets.length; i++) {
+ charsets[i] = arguments[i]
+ }
+ }
+
+ // no charsets, return all requested charsets
+ if (!charsets || charsets.length === 0) {
+ return this.negotiator.charsets()
+ }
+
+ return this.negotiator.charsets(charsets)[0] || false
+}
+
+/**
+ * Return accepted languages or best fit based on `langs`.
+ *
+ * Given `Accept-Language: en;q=0.8, es, pt`
+ * an array sorted by quality is returned:
+ *
+ * ['es', 'pt', 'en']
+ *
+ * @param {String|Array} langs...
+ * @return {Array|String}
+ * @public
+ */
+
+Accepts.prototype.lang =
+Accepts.prototype.langs =
+Accepts.prototype.language =
+Accepts.prototype.languages = function (languages_) {
+ var languages = languages_
+
+ // support flattened arguments
+ if (languages && !Array.isArray(languages)) {
+ languages = new Array(arguments.length)
+ for (var i = 0; i < languages.length; i++) {
+ languages[i] = arguments[i]
+ }
+ }
+
+ // no languages, return all requested languages
+ if (!languages || languages.length === 0) {
+ return this.negotiator.languages()
+ }
+
+ return this.negotiator.languages(languages)[0] || false
+}
+
+/**
+ * Convert extnames to mime.
+ *
+ * @param {String} type
+ * @return {String}
+ * @private
+ */
+
+function extToMime (type) {
+ return type.indexOf('/') === -1
+ ? mime.lookup(type)
+ : type
+}
+
+/**
+ * Check if mime is valid.
+ *
+ * @param {String} type
+ * @return {String}
+ * @private
+ */
+
+function validMime (type) {
+ return typeof type === 'string'
+}
diff --git a/node_modules/accepts/package.json b/node_modules/accepts/package.json
new file mode 100644
index 0000000..0f2d15d
--- /dev/null
+++ b/node_modules/accepts/package.json
@@ -0,0 +1,47 @@
+{
+ "name": "accepts",
+ "description": "Higher-level content negotiation",
+ "version": "1.3.8",
+ "contributors": [
+ "Douglas Christopher Wilson ",
+ "Jonathan Ong (http://jongleberry.com)"
+ ],
+ "license": "MIT",
+ "repository": "jshttp/accepts",
+ "dependencies": {
+ "mime-types": "~2.1.34",
+ "negotiator": "0.6.3"
+ },
+ "devDependencies": {
+ "deep-equal": "1.0.1",
+ "eslint": "7.32.0",
+ "eslint-config-standard": "14.1.1",
+ "eslint-plugin-import": "2.25.4",
+ "eslint-plugin-markdown": "2.2.1",
+ "eslint-plugin-node": "11.1.0",
+ "eslint-plugin-promise": "4.3.1",
+ "eslint-plugin-standard": "4.1.0",
+ "mocha": "9.2.0",
+ "nyc": "15.1.0"
+ },
+ "files": [
+ "LICENSE",
+ "HISTORY.md",
+ "index.js"
+ ],
+ "engines": {
+ "node": ">= 0.6"
+ },
+ "scripts": {
+ "lint": "eslint .",
+ "test": "mocha --reporter spec --check-leaks --bail test/",
+ "test-ci": "nyc --reporter=lcov --reporter=text npm test",
+ "test-cov": "nyc --reporter=html --reporter=text npm test"
+ },
+ "keywords": [
+ "content",
+ "negotiation",
+ "accept",
+ "accepts"
+ ]
+}
diff --git a/node_modules/array-flatten/LICENSE b/node_modules/array-flatten/LICENSE
new file mode 100644
index 0000000..983fbe8
--- /dev/null
+++ b/node_modules/array-flatten/LICENSE
@@ -0,0 +1,21 @@
+The MIT License (MIT)
+
+Copyright (c) 2014 Blake Embrey (hello@blakeembrey.com)
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE.
diff --git a/node_modules/array-flatten/README.md b/node_modules/array-flatten/README.md
new file mode 100644
index 0000000..91fa5b6
--- /dev/null
+++ b/node_modules/array-flatten/README.md
@@ -0,0 +1,43 @@
+# Array Flatten
+
+[![NPM version][npm-image]][npm-url]
+[![NPM downloads][downloads-image]][downloads-url]
+[![Build status][travis-image]][travis-url]
+[![Test coverage][coveralls-image]][coveralls-url]
+
+> Flatten an array of nested arrays into a single flat array. Accepts an optional depth.
+
+## Installation
+
+```
+npm install array-flatten --save
+```
+
+## Usage
+
+```javascript
+var flatten = require('array-flatten')
+
+flatten([1, [2, [3, [4, [5], 6], 7], 8], 9])
+//=> [1, 2, 3, 4, 5, 6, 7, 8, 9]
+
+flatten([1, [2, [3, [4, [5], 6], 7], 8], 9], 2)
+//=> [1, 2, 3, [4, [5], 6], 7, 8, 9]
+
+(function () {
+ flatten(arguments) //=> [1, 2, 3]
+})(1, [2, 3])
+```
+
+## License
+
+MIT
+
+[npm-image]: https://img.shields.io/npm/v/array-flatten.svg?style=flat
+[npm-url]: https://npmjs.org/package/array-flatten
+[downloads-image]: https://img.shields.io/npm/dm/array-flatten.svg?style=flat
+[downloads-url]: https://npmjs.org/package/array-flatten
+[travis-image]: https://img.shields.io/travis/blakeembrey/array-flatten.svg?style=flat
+[travis-url]: https://travis-ci.org/blakeembrey/array-flatten
+[coveralls-image]: https://img.shields.io/coveralls/blakeembrey/array-flatten.svg?style=flat
+[coveralls-url]: https://coveralls.io/r/blakeembrey/array-flatten?branch=master
diff --git a/node_modules/array-flatten/array-flatten.js b/node_modules/array-flatten/array-flatten.js
new file mode 100644
index 0000000..089117b
--- /dev/null
+++ b/node_modules/array-flatten/array-flatten.js
@@ -0,0 +1,64 @@
+'use strict'
+
+/**
+ * Expose `arrayFlatten`.
+ */
+module.exports = arrayFlatten
+
+/**
+ * Recursive flatten function with depth.
+ *
+ * @param {Array} array
+ * @param {Array} result
+ * @param {Number} depth
+ * @return {Array}
+ */
+function flattenWithDepth (array, result, depth) {
+ for (var i = 0; i < array.length; i++) {
+ var value = array[i]
+
+ if (depth > 0 && Array.isArray(value)) {
+ flattenWithDepth(value, result, depth - 1)
+ } else {
+ result.push(value)
+ }
+ }
+
+ return result
+}
+
+/**
+ * Recursive flatten function. Omitting depth is slightly faster.
+ *
+ * @param {Array} array
+ * @param {Array} result
+ * @return {Array}
+ */
+function flattenForever (array, result) {
+ for (var i = 0; i < array.length; i++) {
+ var value = array[i]
+
+ if (Array.isArray(value)) {
+ flattenForever(value, result)
+ } else {
+ result.push(value)
+ }
+ }
+
+ return result
+}
+
+/**
+ * Flatten an array, with the ability to define a depth.
+ *
+ * @param {Array} array
+ * @param {Number} depth
+ * @return {Array}
+ */
+function arrayFlatten (array, depth) {
+ if (depth == null) {
+ return flattenForever(array, [])
+ }
+
+ return flattenWithDepth(array, [], depth)
+}
diff --git a/node_modules/array-flatten/package.json b/node_modules/array-flatten/package.json
new file mode 100644
index 0000000..1a24e2a
--- /dev/null
+++ b/node_modules/array-flatten/package.json
@@ -0,0 +1,39 @@
+{
+ "name": "array-flatten",
+ "version": "1.1.1",
+ "description": "Flatten an array of nested arrays into a single flat array",
+ "main": "array-flatten.js",
+ "files": [
+ "array-flatten.js",
+ "LICENSE"
+ ],
+ "scripts": {
+ "test": "istanbul cover _mocha -- -R spec"
+ },
+ "repository": {
+ "type": "git",
+ "url": "git://github.com/blakeembrey/array-flatten.git"
+ },
+ "keywords": [
+ "array",
+ "flatten",
+ "arguments",
+ "depth"
+ ],
+ "author": {
+ "name": "Blake Embrey",
+ "email": "hello@blakeembrey.com",
+ "url": "http://blakeembrey.me"
+ },
+ "license": "MIT",
+ "bugs": {
+ "url": "https://github.com/blakeembrey/array-flatten/issues"
+ },
+ "homepage": "https://github.com/blakeembrey/array-flatten",
+ "devDependencies": {
+ "istanbul": "^0.3.13",
+ "mocha": "^2.2.4",
+ "pre-commit": "^1.0.7",
+ "standard": "^3.7.3"
+ }
+}
diff --git a/node_modules/asn1.js/.eslintrc.js b/node_modules/asn1.js/.eslintrc.js
new file mode 100644
index 0000000..6b5dc44
--- /dev/null
+++ b/node_modules/asn1.js/.eslintrc.js
@@ -0,0 +1,27 @@
+module.exports = {
+ 'env': {
+ 'browser': false,
+ 'commonjs': true,
+ 'es6': true,
+ 'node': true
+ },
+ 'extends': 'eslint:recommended',
+ 'rules': {
+ 'indent': [
+ 'error',
+ 2
+ ],
+ 'linebreak-style': [
+ 'error',
+ 'unix'
+ ],
+ 'quotes': [
+ 'error',
+ 'single'
+ ],
+ 'semi': [
+ 'error',
+ 'always'
+ ]
+ }
+};
diff --git a/node_modules/asn1.js/LICENSE b/node_modules/asn1.js/LICENSE
new file mode 100644
index 0000000..caaf4f2
--- /dev/null
+++ b/node_modules/asn1.js/LICENSE
@@ -0,0 +1,21 @@
+MIT License
+
+Copyright (c) 2017 Fedor Indutny
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
+SOFTWARE.
diff --git a/node_modules/asn1.js/README.md b/node_modules/asn1.js/README.md
new file mode 100644
index 0000000..9f04af7
--- /dev/null
+++ b/node_modules/asn1.js/README.md
@@ -0,0 +1,100 @@
+# ASN1.js
+
+ASN.1 DER Encoder/Decoder and DSL.
+
+## Example
+
+Define model:
+
+```javascript
+var asn = require('asn1.js');
+
+var Human = asn.define('Human', function() {
+ this.seq().obj(
+ this.key('firstName').octstr(),
+ this.key('lastName').octstr(),
+ this.key('age').int(),
+ this.key('gender').enum({ 0: 'male', 1: 'female' }),
+ this.key('bio').seqof(Bio)
+ );
+});
+
+var Bio = asn.define('Bio', function() {
+ this.seq().obj(
+ this.key('time').gentime(),
+ this.key('description').octstr()
+ );
+});
+```
+
+Encode data:
+
+```javascript
+var output = Human.encode({
+ firstName: 'Thomas',
+ lastName: 'Anderson',
+ age: 28,
+ gender: 'male',
+ bio: [
+ {
+ time: +new Date('31 March 1999'),
+ description: 'freedom of mind'
+ }
+ ]
+}, 'der');
+```
+
+Decode data:
+
+```javascript
+var human = Human.decode(output, 'der');
+console.log(human);
+/*
+{ firstName: ,
+ lastName: ,
+ age: 28,
+ gender: 'male',
+ bio:
+ [ { time: 922820400000,
+ description: } ] }
+*/
+```
+
+### Partial decode
+
+Its possible to parse data without stopping on first error. In order to do it,
+you should call:
+
+```javascript
+var human = Human.decode(output, 'der', { partial: true });
+console.log(human);
+/*
+{ result: { ... },
+ errors: [ ... ] }
+*/
+```
+
+#### LICENSE
+
+This software is licensed under the MIT License.
+
+Copyright Fedor Indutny, 2017.
+
+Permission is hereby granted, free of charge, to any person obtaining a
+copy of this software and associated documentation files (the
+"Software"), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to permit
+persons to whom the Software is furnished to do so, subject to the
+following conditions:
+
+The above copyright notice and this permission notice shall be included
+in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS
+OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN
+NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM,
+DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR
+OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE
+USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/node_modules/asn1.js/lib/asn1.js b/node_modules/asn1.js/lib/asn1.js
new file mode 100644
index 0000000..c7d70b8
--- /dev/null
+++ b/node_modules/asn1.js/lib/asn1.js
@@ -0,0 +1,11 @@
+'use strict';
+
+const asn1 = exports;
+
+asn1.bignum = require('bn.js');
+
+asn1.define = require('./asn1/api').define;
+asn1.base = require('./asn1/base');
+asn1.constants = require('./asn1/constants');
+asn1.decoders = require('./asn1/decoders');
+asn1.encoders = require('./asn1/encoders');
diff --git a/node_modules/asn1.js/lib/asn1/api.js b/node_modules/asn1.js/lib/asn1/api.js
new file mode 100644
index 0000000..61e3eb2
--- /dev/null
+++ b/node_modules/asn1.js/lib/asn1/api.js
@@ -0,0 +1,57 @@
+'use strict';
+
+const encoders = require('./encoders');
+const decoders = require('./decoders');
+const inherits = require('inherits');
+
+const api = exports;
+
+api.define = function define(name, body) {
+ return new Entity(name, body);
+};
+
+function Entity(name, body) {
+ this.name = name;
+ this.body = body;
+
+ this.decoders = {};
+ this.encoders = {};
+}
+
+Entity.prototype._createNamed = function createNamed(Base) {
+ const name = this.name;
+
+ function Generated(entity) {
+ this._initNamed(entity, name);
+ }
+ inherits(Generated, Base);
+ Generated.prototype._initNamed = function _initNamed(entity, name) {
+ Base.call(this, entity, name);
+ };
+
+ return new Generated(this);
+};
+
+Entity.prototype._getDecoder = function _getDecoder(enc) {
+ enc = enc || 'der';
+ // Lazily create decoder
+ if (!this.decoders.hasOwnProperty(enc))
+ this.decoders[enc] = this._createNamed(decoders[enc]);
+ return this.decoders[enc];
+};
+
+Entity.prototype.decode = function decode(data, enc, options) {
+ return this._getDecoder(enc).decode(data, options);
+};
+
+Entity.prototype._getEncoder = function _getEncoder(enc) {
+ enc = enc || 'der';
+ // Lazily create encoder
+ if (!this.encoders.hasOwnProperty(enc))
+ this.encoders[enc] = this._createNamed(encoders[enc]);
+ return this.encoders[enc];
+};
+
+Entity.prototype.encode = function encode(data, enc, /* internal */ reporter) {
+ return this._getEncoder(enc).encode(data, reporter);
+};
diff --git a/node_modules/asn1.js/lib/asn1/base/buffer.js b/node_modules/asn1.js/lib/asn1/base/buffer.js
new file mode 100644
index 0000000..bb5bc06
--- /dev/null
+++ b/node_modules/asn1.js/lib/asn1/base/buffer.js
@@ -0,0 +1,153 @@
+'use strict';
+
+const inherits = require('inherits');
+const Reporter = require('../base/reporter').Reporter;
+const Buffer = require('safer-buffer').Buffer;
+
+function DecoderBuffer(base, options) {
+ Reporter.call(this, options);
+ if (!Buffer.isBuffer(base)) {
+ this.error('Input not Buffer');
+ return;
+ }
+
+ this.base = base;
+ this.offset = 0;
+ this.length = base.length;
+}
+inherits(DecoderBuffer, Reporter);
+exports.DecoderBuffer = DecoderBuffer;
+
+DecoderBuffer.isDecoderBuffer = function isDecoderBuffer(data) {
+ if (data instanceof DecoderBuffer) {
+ return true;
+ }
+
+ // Or accept compatible API
+ const isCompatible = typeof data === 'object' &&
+ Buffer.isBuffer(data.base) &&
+ data.constructor.name === 'DecoderBuffer' &&
+ typeof data.offset === 'number' &&
+ typeof data.length === 'number' &&
+ typeof data.save === 'function' &&
+ typeof data.restore === 'function' &&
+ typeof data.isEmpty === 'function' &&
+ typeof data.readUInt8 === 'function' &&
+ typeof data.skip === 'function' &&
+ typeof data.raw === 'function';
+
+ return isCompatible;
+};
+
+DecoderBuffer.prototype.save = function save() {
+ return { offset: this.offset, reporter: Reporter.prototype.save.call(this) };
+};
+
+DecoderBuffer.prototype.restore = function restore(save) {
+ // Return skipped data
+ const res = new DecoderBuffer(this.base);
+ res.offset = save.offset;
+ res.length = this.offset;
+
+ this.offset = save.offset;
+ Reporter.prototype.restore.call(this, save.reporter);
+
+ return res;
+};
+
+DecoderBuffer.prototype.isEmpty = function isEmpty() {
+ return this.offset === this.length;
+};
+
+DecoderBuffer.prototype.readUInt8 = function readUInt8(fail) {
+ if (this.offset + 1 <= this.length)
+ return this.base.readUInt8(this.offset++, true);
+ else
+ return this.error(fail || 'DecoderBuffer overrun');
+};
+
+DecoderBuffer.prototype.skip = function skip(bytes, fail) {
+ if (!(this.offset + bytes <= this.length))
+ return this.error(fail || 'DecoderBuffer overrun');
+
+ const res = new DecoderBuffer(this.base);
+
+ // Share reporter state
+ res._reporterState = this._reporterState;
+
+ res.offset = this.offset;
+ res.length = this.offset + bytes;
+ this.offset += bytes;
+ return res;
+};
+
+DecoderBuffer.prototype.raw = function raw(save) {
+ return this.base.slice(save ? save.offset : this.offset, this.length);
+};
+
+function EncoderBuffer(value, reporter) {
+ if (Array.isArray(value)) {
+ this.length = 0;
+ this.value = value.map(function(item) {
+ if (!EncoderBuffer.isEncoderBuffer(item))
+ item = new EncoderBuffer(item, reporter);
+ this.length += item.length;
+ return item;
+ }, this);
+ } else if (typeof value === 'number') {
+ if (!(0 <= value && value <= 0xff))
+ return reporter.error('non-byte EncoderBuffer value');
+ this.value = value;
+ this.length = 1;
+ } else if (typeof value === 'string') {
+ this.value = value;
+ this.length = Buffer.byteLength(value);
+ } else if (Buffer.isBuffer(value)) {
+ this.value = value;
+ this.length = value.length;
+ } else {
+ return reporter.error('Unsupported type: ' + typeof value);
+ }
+}
+exports.EncoderBuffer = EncoderBuffer;
+
+EncoderBuffer.isEncoderBuffer = function isEncoderBuffer(data) {
+ if (data instanceof EncoderBuffer) {
+ return true;
+ }
+
+ // Or accept compatible API
+ const isCompatible = typeof data === 'object' &&
+ data.constructor.name === 'EncoderBuffer' &&
+ typeof data.length === 'number' &&
+ typeof data.join === 'function';
+
+ return isCompatible;
+};
+
+EncoderBuffer.prototype.join = function join(out, offset) {
+ if (!out)
+ out = Buffer.alloc(this.length);
+ if (!offset)
+ offset = 0;
+
+ if (this.length === 0)
+ return out;
+
+ if (Array.isArray(this.value)) {
+ this.value.forEach(function(item) {
+ item.join(out, offset);
+ offset += item.length;
+ });
+ } else {
+ if (typeof this.value === 'number')
+ out[offset] = this.value;
+ else if (typeof this.value === 'string')
+ out.write(this.value, offset);
+ else if (Buffer.isBuffer(this.value))
+ this.value.copy(out, offset);
+ offset += this.length;
+ }
+
+ return out;
+};
diff --git a/node_modules/asn1.js/lib/asn1/base/index.js b/node_modules/asn1.js/lib/asn1/base/index.js
new file mode 100644
index 0000000..8b92f20
--- /dev/null
+++ b/node_modules/asn1.js/lib/asn1/base/index.js
@@ -0,0 +1,8 @@
+'use strict';
+
+const base = exports;
+
+base.Reporter = require('./reporter').Reporter;
+base.DecoderBuffer = require('./buffer').DecoderBuffer;
+base.EncoderBuffer = require('./buffer').EncoderBuffer;
+base.Node = require('./node');
diff --git a/node_modules/asn1.js/lib/asn1/base/node.js b/node_modules/asn1.js/lib/asn1/base/node.js
new file mode 100644
index 0000000..d676d21
--- /dev/null
+++ b/node_modules/asn1.js/lib/asn1/base/node.js
@@ -0,0 +1,638 @@
+'use strict';
+
+const Reporter = require('../base/reporter').Reporter;
+const EncoderBuffer = require('../base/buffer').EncoderBuffer;
+const DecoderBuffer = require('../base/buffer').DecoderBuffer;
+const assert = require('minimalistic-assert');
+
+// Supported tags
+const tags = [
+ 'seq', 'seqof', 'set', 'setof', 'objid', 'bool',
+ 'gentime', 'utctime', 'null_', 'enum', 'int', 'objDesc',
+ 'bitstr', 'bmpstr', 'charstr', 'genstr', 'graphstr', 'ia5str', 'iso646str',
+ 'numstr', 'octstr', 'printstr', 't61str', 'unistr', 'utf8str', 'videostr'
+];
+
+// Public methods list
+const methods = [
+ 'key', 'obj', 'use', 'optional', 'explicit', 'implicit', 'def', 'choice',
+ 'any', 'contains'
+].concat(tags);
+
+// Overrided methods list
+const overrided = [
+ '_peekTag', '_decodeTag', '_use',
+ '_decodeStr', '_decodeObjid', '_decodeTime',
+ '_decodeNull', '_decodeInt', '_decodeBool', '_decodeList',
+
+ '_encodeComposite', '_encodeStr', '_encodeObjid', '_encodeTime',
+ '_encodeNull', '_encodeInt', '_encodeBool'
+];
+
+function Node(enc, parent, name) {
+ const state = {};
+ this._baseState = state;
+
+ state.name = name;
+ state.enc = enc;
+
+ state.parent = parent || null;
+ state.children = null;
+
+ // State
+ state.tag = null;
+ state.args = null;
+ state.reverseArgs = null;
+ state.choice = null;
+ state.optional = false;
+ state.any = false;
+ state.obj = false;
+ state.use = null;
+ state.useDecoder = null;
+ state.key = null;
+ state['default'] = null;
+ state.explicit = null;
+ state.implicit = null;
+ state.contains = null;
+
+ // Should create new instance on each method
+ if (!state.parent) {
+ state.children = [];
+ this._wrap();
+ }
+}
+module.exports = Node;
+
+const stateProps = [
+ 'enc', 'parent', 'children', 'tag', 'args', 'reverseArgs', 'choice',
+ 'optional', 'any', 'obj', 'use', 'alteredUse', 'key', 'default', 'explicit',
+ 'implicit', 'contains'
+];
+
+Node.prototype.clone = function clone() {
+ const state = this._baseState;
+ const cstate = {};
+ stateProps.forEach(function(prop) {
+ cstate[prop] = state[prop];
+ });
+ const res = new this.constructor(cstate.parent);
+ res._baseState = cstate;
+ return res;
+};
+
+Node.prototype._wrap = function wrap() {
+ const state = this._baseState;
+ methods.forEach(function(method) {
+ this[method] = function _wrappedMethod() {
+ const clone = new this.constructor(this);
+ state.children.push(clone);
+ return clone[method].apply(clone, arguments);
+ };
+ }, this);
+};
+
+Node.prototype._init = function init(body) {
+ const state = this._baseState;
+
+ assert(state.parent === null);
+ body.call(this);
+
+ // Filter children
+ state.children = state.children.filter(function(child) {
+ return child._baseState.parent === this;
+ }, this);
+ assert.equal(state.children.length, 1, 'Root node can have only one child');
+};
+
+Node.prototype._useArgs = function useArgs(args) {
+ const state = this._baseState;
+
+ // Filter children and args
+ const children = args.filter(function(arg) {
+ return arg instanceof this.constructor;
+ }, this);
+ args = args.filter(function(arg) {
+ return !(arg instanceof this.constructor);
+ }, this);
+
+ if (children.length !== 0) {
+ assert(state.children === null);
+ state.children = children;
+
+ // Replace parent to maintain backward link
+ children.forEach(function(child) {
+ child._baseState.parent = this;
+ }, this);
+ }
+ if (args.length !== 0) {
+ assert(state.args === null);
+ state.args = args;
+ state.reverseArgs = args.map(function(arg) {
+ if (typeof arg !== 'object' || arg.constructor !== Object)
+ return arg;
+
+ const res = {};
+ Object.keys(arg).forEach(function(key) {
+ if (key == (key | 0))
+ key |= 0;
+ const value = arg[key];
+ res[value] = key;
+ });
+ return res;
+ });
+ }
+};
+
+//
+// Overrided methods
+//
+
+overrided.forEach(function(method) {
+ Node.prototype[method] = function _overrided() {
+ const state = this._baseState;
+ throw new Error(method + ' not implemented for encoding: ' + state.enc);
+ };
+});
+
+//
+// Public methods
+//
+
+tags.forEach(function(tag) {
+ Node.prototype[tag] = function _tagMethod() {
+ const state = this._baseState;
+ const args = Array.prototype.slice.call(arguments);
+
+ assert(state.tag === null);
+ state.tag = tag;
+
+ this._useArgs(args);
+
+ return this;
+ };
+});
+
+Node.prototype.use = function use(item) {
+ assert(item);
+ const state = this._baseState;
+
+ assert(state.use === null);
+ state.use = item;
+
+ return this;
+};
+
+Node.prototype.optional = function optional() {
+ const state = this._baseState;
+
+ state.optional = true;
+
+ return this;
+};
+
+Node.prototype.def = function def(val) {
+ const state = this._baseState;
+
+ assert(state['default'] === null);
+ state['default'] = val;
+ state.optional = true;
+
+ return this;
+};
+
+Node.prototype.explicit = function explicit(num) {
+ const state = this._baseState;
+
+ assert(state.explicit === null && state.implicit === null);
+ state.explicit = num;
+
+ return this;
+};
+
+Node.prototype.implicit = function implicit(num) {
+ const state = this._baseState;
+
+ assert(state.explicit === null && state.implicit === null);
+ state.implicit = num;
+
+ return this;
+};
+
+Node.prototype.obj = function obj() {
+ const state = this._baseState;
+ const args = Array.prototype.slice.call(arguments);
+
+ state.obj = true;
+
+ if (args.length !== 0)
+ this._useArgs(args);
+
+ return this;
+};
+
+Node.prototype.key = function key(newKey) {
+ const state = this._baseState;
+
+ assert(state.key === null);
+ state.key = newKey;
+
+ return this;
+};
+
+Node.prototype.any = function any() {
+ const state = this._baseState;
+
+ state.any = true;
+
+ return this;
+};
+
+Node.prototype.choice = function choice(obj) {
+ const state = this._baseState;
+
+ assert(state.choice === null);
+ state.choice = obj;
+ this._useArgs(Object.keys(obj).map(function(key) {
+ return obj[key];
+ }));
+
+ return this;
+};
+
+Node.prototype.contains = function contains(item) {
+ const state = this._baseState;
+
+ assert(state.use === null);
+ state.contains = item;
+
+ return this;
+};
+
+//
+// Decoding
+//
+
+Node.prototype._decode = function decode(input, options) {
+ const state = this._baseState;
+
+ // Decode root node
+ if (state.parent === null)
+ return input.wrapResult(state.children[0]._decode(input, options));
+
+ let result = state['default'];
+ let present = true;
+
+ let prevKey = null;
+ if (state.key !== null)
+ prevKey = input.enterKey(state.key);
+
+ // Check if tag is there
+ if (state.optional) {
+ let tag = null;
+ if (state.explicit !== null)
+ tag = state.explicit;
+ else if (state.implicit !== null)
+ tag = state.implicit;
+ else if (state.tag !== null)
+ tag = state.tag;
+
+ if (tag === null && !state.any) {
+ // Trial and Error
+ const save = input.save();
+ try {
+ if (state.choice === null)
+ this._decodeGeneric(state.tag, input, options);
+ else
+ this._decodeChoice(input, options);
+ present = true;
+ } catch (e) {
+ present = false;
+ }
+ input.restore(save);
+ } else {
+ present = this._peekTag(input, tag, state.any);
+
+ if (input.isError(present))
+ return present;
+ }
+ }
+
+ // Push object on stack
+ let prevObj;
+ if (state.obj && present)
+ prevObj = input.enterObject();
+
+ if (present) {
+ // Unwrap explicit values
+ if (state.explicit !== null) {
+ const explicit = this._decodeTag(input, state.explicit);
+ if (input.isError(explicit))
+ return explicit;
+ input = explicit;
+ }
+
+ const start = input.offset;
+
+ // Unwrap implicit and normal values
+ if (state.use === null && state.choice === null) {
+ let save;
+ if (state.any)
+ save = input.save();
+ const body = this._decodeTag(
+ input,
+ state.implicit !== null ? state.implicit : state.tag,
+ state.any
+ );
+ if (input.isError(body))
+ return body;
+
+ if (state.any)
+ result = input.raw(save);
+ else
+ input = body;
+ }
+
+ if (options && options.track && state.tag !== null)
+ options.track(input.path(), start, input.length, 'tagged');
+
+ if (options && options.track && state.tag !== null)
+ options.track(input.path(), input.offset, input.length, 'content');
+
+ // Select proper method for tag
+ if (state.any) {
+ // no-op
+ } else if (state.choice === null) {
+ result = this._decodeGeneric(state.tag, input, options);
+ } else {
+ result = this._decodeChoice(input, options);
+ }
+
+ if (input.isError(result))
+ return result;
+
+ // Decode children
+ if (!state.any && state.choice === null && state.children !== null) {
+ state.children.forEach(function decodeChildren(child) {
+ // NOTE: We are ignoring errors here, to let parser continue with other
+ // parts of encoded data
+ child._decode(input, options);
+ });
+ }
+
+ // Decode contained/encoded by schema, only in bit or octet strings
+ if (state.contains && (state.tag === 'octstr' || state.tag === 'bitstr')) {
+ const data = new DecoderBuffer(result);
+ result = this._getUse(state.contains, input._reporterState.obj)
+ ._decode(data, options);
+ }
+ }
+
+ // Pop object
+ if (state.obj && present)
+ result = input.leaveObject(prevObj);
+
+ // Set key
+ if (state.key !== null && (result !== null || present === true))
+ input.leaveKey(prevKey, state.key, result);
+ else if (prevKey !== null)
+ input.exitKey(prevKey);
+
+ return result;
+};
+
+Node.prototype._decodeGeneric = function decodeGeneric(tag, input, options) {
+ const state = this._baseState;
+
+ if (tag === 'seq' || tag === 'set')
+ return null;
+ if (tag === 'seqof' || tag === 'setof')
+ return this._decodeList(input, tag, state.args[0], options);
+ else if (/str$/.test(tag))
+ return this._decodeStr(input, tag, options);
+ else if (tag === 'objid' && state.args)
+ return this._decodeObjid(input, state.args[0], state.args[1], options);
+ else if (tag === 'objid')
+ return this._decodeObjid(input, null, null, options);
+ else if (tag === 'gentime' || tag === 'utctime')
+ return this._decodeTime(input, tag, options);
+ else if (tag === 'null_')
+ return this._decodeNull(input, options);
+ else if (tag === 'bool')
+ return this._decodeBool(input, options);
+ else if (tag === 'objDesc')
+ return this._decodeStr(input, tag, options);
+ else if (tag === 'int' || tag === 'enum')
+ return this._decodeInt(input, state.args && state.args[0], options);
+
+ if (state.use !== null) {
+ return this._getUse(state.use, input._reporterState.obj)
+ ._decode(input, options);
+ } else {
+ return input.error('unknown tag: ' + tag);
+ }
+};
+
+Node.prototype._getUse = function _getUse(entity, obj) {
+
+ const state = this._baseState;
+ // Create altered use decoder if implicit is set
+ state.useDecoder = this._use(entity, obj);
+ assert(state.useDecoder._baseState.parent === null);
+ state.useDecoder = state.useDecoder._baseState.children[0];
+ if (state.implicit !== state.useDecoder._baseState.implicit) {
+ state.useDecoder = state.useDecoder.clone();
+ state.useDecoder._baseState.implicit = state.implicit;
+ }
+ return state.useDecoder;
+};
+
+Node.prototype._decodeChoice = function decodeChoice(input, options) {
+ const state = this._baseState;
+ let result = null;
+ let match = false;
+
+ Object.keys(state.choice).some(function(key) {
+ const save = input.save();
+ const node = state.choice[key];
+ try {
+ const value = node._decode(input, options);
+ if (input.isError(value))
+ return false;
+
+ result = { type: key, value: value };
+ match = true;
+ } catch (e) {
+ input.restore(save);
+ return false;
+ }
+ return true;
+ }, this);
+
+ if (!match)
+ return input.error('Choice not matched');
+
+ return result;
+};
+
+//
+// Encoding
+//
+
+Node.prototype._createEncoderBuffer = function createEncoderBuffer(data) {
+ return new EncoderBuffer(data, this.reporter);
+};
+
+Node.prototype._encode = function encode(data, reporter, parent) {
+ const state = this._baseState;
+ if (state['default'] !== null && state['default'] === data)
+ return;
+
+ const result = this._encodeValue(data, reporter, parent);
+ if (result === undefined)
+ return;
+
+ if (this._skipDefault(result, reporter, parent))
+ return;
+
+ return result;
+};
+
+Node.prototype._encodeValue = function encode(data, reporter, parent) {
+ const state = this._baseState;
+
+ // Decode root node
+ if (state.parent === null)
+ return state.children[0]._encode(data, reporter || new Reporter());
+
+ let result = null;
+
+ // Set reporter to share it with a child class
+ this.reporter = reporter;
+
+ // Check if data is there
+ if (state.optional && data === undefined) {
+ if (state['default'] !== null)
+ data = state['default'];
+ else
+ return;
+ }
+
+ // Encode children first
+ let content = null;
+ let primitive = false;
+ if (state.any) {
+ // Anything that was given is translated to buffer
+ result = this._createEncoderBuffer(data);
+ } else if (state.choice) {
+ result = this._encodeChoice(data, reporter);
+ } else if (state.contains) {
+ content = this._getUse(state.contains, parent)._encode(data, reporter);
+ primitive = true;
+ } else if (state.children) {
+ content = state.children.map(function(child) {
+ if (child._baseState.tag === 'null_')
+ return child._encode(null, reporter, data);
+
+ if (child._baseState.key === null)
+ return reporter.error('Child should have a key');
+ const prevKey = reporter.enterKey(child._baseState.key);
+
+ if (typeof data !== 'object')
+ return reporter.error('Child expected, but input is not object');
+
+ const res = child._encode(data[child._baseState.key], reporter, data);
+ reporter.leaveKey(prevKey);
+
+ return res;
+ }, this).filter(function(child) {
+ return child;
+ });
+ content = this._createEncoderBuffer(content);
+ } else {
+ if (state.tag === 'seqof' || state.tag === 'setof') {
+ // TODO(indutny): this should be thrown on DSL level
+ if (!(state.args && state.args.length === 1))
+ return reporter.error('Too many args for : ' + state.tag);
+
+ if (!Array.isArray(data))
+ return reporter.error('seqof/setof, but data is not Array');
+
+ const child = this.clone();
+ child._baseState.implicit = null;
+ content = this._createEncoderBuffer(data.map(function(item) {
+ const state = this._baseState;
+
+ return this._getUse(state.args[0], data)._encode(item, reporter);
+ }, child));
+ } else if (state.use !== null) {
+ result = this._getUse(state.use, parent)._encode(data, reporter);
+ } else {
+ content = this._encodePrimitive(state.tag, data);
+ primitive = true;
+ }
+ }
+
+ // Encode data itself
+ if (!state.any && state.choice === null) {
+ const tag = state.implicit !== null ? state.implicit : state.tag;
+ const cls = state.implicit === null ? 'universal' : 'context';
+
+ if (tag === null) {
+ if (state.use === null)
+ reporter.error('Tag could be omitted only for .use()');
+ } else {
+ if (state.use === null)
+ result = this._encodeComposite(tag, primitive, cls, content);
+ }
+ }
+
+ // Wrap in explicit
+ if (state.explicit !== null)
+ result = this._encodeComposite(state.explicit, false, 'context', result);
+
+ return result;
+};
+
+Node.prototype._encodeChoice = function encodeChoice(data, reporter) {
+ const state = this._baseState;
+
+ const node = state.choice[data.type];
+ if (!node) {
+ assert(
+ false,
+ data.type + ' not found in ' +
+ JSON.stringify(Object.keys(state.choice)));
+ }
+ return node._encode(data.value, reporter);
+};
+
+Node.prototype._encodePrimitive = function encodePrimitive(tag, data) {
+ const state = this._baseState;
+
+ if (/str$/.test(tag))
+ return this._encodeStr(data, tag);
+ else if (tag === 'objid' && state.args)
+ return this._encodeObjid(data, state.reverseArgs[0], state.args[1]);
+ else if (tag === 'objid')
+ return this._encodeObjid(data, null, null);
+ else if (tag === 'gentime' || tag === 'utctime')
+ return this._encodeTime(data, tag);
+ else if (tag === 'null_')
+ return this._encodeNull();
+ else if (tag === 'int' || tag === 'enum')
+ return this._encodeInt(data, state.args && state.reverseArgs[0]);
+ else if (tag === 'bool')
+ return this._encodeBool(data);
+ else if (tag === 'objDesc')
+ return this._encodeStr(data, tag);
+ else
+ throw new Error('Unsupported tag: ' + tag);
+};
+
+Node.prototype._isNumstr = function isNumstr(str) {
+ return /^[0-9 ]*$/.test(str);
+};
+
+Node.prototype._isPrintstr = function isPrintstr(str) {
+ return /^[A-Za-z0-9 '()+,-./:=?]*$/.test(str);
+};
diff --git a/node_modules/asn1.js/lib/asn1/base/reporter.js b/node_modules/asn1.js/lib/asn1/base/reporter.js
new file mode 100644
index 0000000..d05fe12
--- /dev/null
+++ b/node_modules/asn1.js/lib/asn1/base/reporter.js
@@ -0,0 +1,123 @@
+'use strict';
+
+const inherits = require('inherits');
+
+function Reporter(options) {
+ this._reporterState = {
+ obj: null,
+ path: [],
+ options: options || {},
+ errors: []
+ };
+}
+exports.Reporter = Reporter;
+
+Reporter.prototype.isError = function isError(obj) {
+ return obj instanceof ReporterError;
+};
+
+Reporter.prototype.save = function save() {
+ const state = this._reporterState;
+
+ return { obj: state.obj, pathLen: state.path.length };
+};
+
+Reporter.prototype.restore = function restore(data) {
+ const state = this._reporterState;
+
+ state.obj = data.obj;
+ state.path = state.path.slice(0, data.pathLen);
+};
+
+Reporter.prototype.enterKey = function enterKey(key) {
+ return this._reporterState.path.push(key);
+};
+
+Reporter.prototype.exitKey = function exitKey(index) {
+ const state = this._reporterState;
+
+ state.path = state.path.slice(0, index - 1);
+};
+
+Reporter.prototype.leaveKey = function leaveKey(index, key, value) {
+ const state = this._reporterState;
+
+ this.exitKey(index);
+ if (state.obj !== null)
+ state.obj[key] = value;
+};
+
+Reporter.prototype.path = function path() {
+ return this._reporterState.path.join('/');
+};
+
+Reporter.prototype.enterObject = function enterObject() {
+ const state = this._reporterState;
+
+ const prev = state.obj;
+ state.obj = {};
+ return prev;
+};
+
+Reporter.prototype.leaveObject = function leaveObject(prev) {
+ const state = this._reporterState;
+
+ const now = state.obj;
+ state.obj = prev;
+ return now;
+};
+
+Reporter.prototype.error = function error(msg) {
+ let err;
+ const state = this._reporterState;
+
+ const inherited = msg instanceof ReporterError;
+ if (inherited) {
+ err = msg;
+ } else {
+ err = new ReporterError(state.path.map(function(elem) {
+ return '[' + JSON.stringify(elem) + ']';
+ }).join(''), msg.message || msg, msg.stack);
+ }
+
+ if (!state.options.partial)
+ throw err;
+
+ if (!inherited)
+ state.errors.push(err);
+
+ return err;
+};
+
+Reporter.prototype.wrapResult = function wrapResult(result) {
+ const state = this._reporterState;
+ if (!state.options.partial)
+ return result;
+
+ return {
+ result: this.isError(result) ? null : result,
+ errors: state.errors
+ };
+};
+
+function ReporterError(path, msg) {
+ this.path = path;
+ this.rethrow(msg);
+}
+inherits(ReporterError, Error);
+
+ReporterError.prototype.rethrow = function rethrow(msg) {
+ this.message = msg + ' at: ' + (this.path || '(shallow)');
+ if (Error.captureStackTrace)
+ Error.captureStackTrace(this, ReporterError);
+
+ if (!this.stack) {
+ try {
+ // IE only adds stack when thrown
+ throw new Error(this.message);
+ } catch (e) {
+ this.stack = e.stack;
+ }
+ }
+ return this;
+};
diff --git a/node_modules/asn1.js/lib/asn1/constants/der.js b/node_modules/asn1.js/lib/asn1/constants/der.js
new file mode 100644
index 0000000..2b678aa
--- /dev/null
+++ b/node_modules/asn1.js/lib/asn1/constants/der.js
@@ -0,0 +1,58 @@
+'use strict';
+
+// Helper
+function reverse(map) {
+ const res = {};
+
+ Object.keys(map).forEach(function(key) {
+ // Convert key to integer if it is stringified
+ if ((key | 0) == key)
+ key = key | 0;
+
+ const value = map[key];
+ res[value] = key;
+ });
+
+ return res;
+}
+
+exports.tagClass = {
+ 0: 'universal',
+ 1: 'application',
+ 2: 'context',
+ 3: 'private'
+};
+exports.tagClassByName = reverse(exports.tagClass);
+
+exports.tag = {
+ 0x00: 'end',
+ 0x01: 'bool',
+ 0x02: 'int',
+ 0x03: 'bitstr',
+ 0x04: 'octstr',
+ 0x05: 'null_',
+ 0x06: 'objid',
+ 0x07: 'objDesc',
+ 0x08: 'external',
+ 0x09: 'real',
+ 0x0a: 'enum',
+ 0x0b: 'embed',
+ 0x0c: 'utf8str',
+ 0x0d: 'relativeOid',
+ 0x10: 'seq',
+ 0x11: 'set',
+ 0x12: 'numstr',
+ 0x13: 'printstr',
+ 0x14: 't61str',
+ 0x15: 'videostr',
+ 0x16: 'ia5str',
+ 0x17: 'utctime',
+ 0x18: 'gentime',
+ 0x19: 'graphstr',
+ 0x1a: 'iso646str',
+ 0x1b: 'genstr',
+ 0x1c: 'unistr',
+ 0x1d: 'charstr',
+ 0x1e: 'bmpstr'
+};
+exports.tagByName = reverse(exports.tag);
diff --git a/node_modules/asn1.js/lib/asn1/constants/index.js b/node_modules/asn1.js/lib/asn1/constants/index.js
new file mode 100644
index 0000000..632cf3d
--- /dev/null
+++ b/node_modules/asn1.js/lib/asn1/constants/index.js
@@ -0,0 +1,21 @@
+'use strict';
+
+const constants = exports;
+
+// Helper
+constants._reverse = function reverse(map) {
+ const res = {};
+
+ Object.keys(map).forEach(function(key) {
+ // Convert key to integer if it is stringified
+ if ((key | 0) == key)
+ key = key | 0;
+
+ const value = map[key];
+ res[value] = key;
+ });
+
+ return res;
+};
+
+constants.der = require('./der');
diff --git a/node_modules/asn1.js/lib/asn1/decoders/der.js b/node_modules/asn1.js/lib/asn1/decoders/der.js
new file mode 100644
index 0000000..c5b0515
--- /dev/null
+++ b/node_modules/asn1.js/lib/asn1/decoders/der.js
@@ -0,0 +1,335 @@
+'use strict';
+
+const inherits = require('inherits');
+
+const bignum = require('bn.js');
+const DecoderBuffer = require('../base/buffer').DecoderBuffer;
+const Node = require('../base/node');
+
+// Import DER constants
+const der = require('../constants/der');
+
+function DERDecoder(entity) {
+ this.enc = 'der';
+ this.name = entity.name;
+ this.entity = entity;
+
+ // Construct base tree
+ this.tree = new DERNode();
+ this.tree._init(entity.body);
+}
+module.exports = DERDecoder;
+
+DERDecoder.prototype.decode = function decode(data, options) {
+ if (!DecoderBuffer.isDecoderBuffer(data)) {
+ data = new DecoderBuffer(data, options);
+ }
+
+ return this.tree._decode(data, options);
+};
+
+// Tree methods
+
+function DERNode(parent) {
+ Node.call(this, 'der', parent);
+}
+inherits(DERNode, Node);
+
+DERNode.prototype._peekTag = function peekTag(buffer, tag, any) {
+ if (buffer.isEmpty())
+ return false;
+
+ const state = buffer.save();
+ const decodedTag = derDecodeTag(buffer, 'Failed to peek tag: "' + tag + '"');
+ if (buffer.isError(decodedTag))
+ return decodedTag;
+
+ buffer.restore(state);
+
+ return decodedTag.tag === tag || decodedTag.tagStr === tag ||
+ (decodedTag.tagStr + 'of') === tag || any;
+};
+
+DERNode.prototype._decodeTag = function decodeTag(buffer, tag, any) {
+ const decodedTag = derDecodeTag(buffer,
+ 'Failed to decode tag of "' + tag + '"');
+ if (buffer.isError(decodedTag))
+ return decodedTag;
+
+ let len = derDecodeLen(buffer,
+ decodedTag.primitive,
+ 'Failed to get length of "' + tag + '"');
+
+ // Failure
+ if (buffer.isError(len))
+ return len;
+
+ if (!any &&
+ decodedTag.tag !== tag &&
+ decodedTag.tagStr !== tag &&
+ decodedTag.tagStr + 'of' !== tag) {
+ return buffer.error('Failed to match tag: "' + tag + '"');
+ }
+
+ if (decodedTag.primitive || len !== null)
+ return buffer.skip(len, 'Failed to match body of: "' + tag + '"');
+
+ // Indefinite length... find END tag
+ const state = buffer.save();
+ const res = this._skipUntilEnd(
+ buffer,
+ 'Failed to skip indefinite length body: "' + this.tag + '"');
+ if (buffer.isError(res))
+ return res;
+
+ len = buffer.offset - state.offset;
+ buffer.restore(state);
+ return buffer.skip(len, 'Failed to match body of: "' + tag + '"');
+};
+
+DERNode.prototype._skipUntilEnd = function skipUntilEnd(buffer, fail) {
+ for (;;) {
+ const tag = derDecodeTag(buffer, fail);
+ if (buffer.isError(tag))
+ return tag;
+ const len = derDecodeLen(buffer, tag.primitive, fail);
+ if (buffer.isError(len))
+ return len;
+
+ let res;
+ if (tag.primitive || len !== null)
+ res = buffer.skip(len);
+ else
+ res = this._skipUntilEnd(buffer, fail);
+
+ // Failure
+ if (buffer.isError(res))
+ return res;
+
+ if (tag.tagStr === 'end')
+ break;
+ }
+};
+
+DERNode.prototype._decodeList = function decodeList(buffer, tag, decoder,
+ options) {
+ const result = [];
+ while (!buffer.isEmpty()) {
+ const possibleEnd = this._peekTag(buffer, 'end');
+ if (buffer.isError(possibleEnd))
+ return possibleEnd;
+
+ const res = decoder.decode(buffer, 'der', options);
+ if (buffer.isError(res) && possibleEnd)
+ break;
+ result.push(res);
+ }
+ return result;
+};
+
+DERNode.prototype._decodeStr = function decodeStr(buffer, tag) {
+ if (tag === 'bitstr') {
+ const unused = buffer.readUInt8();
+ if (buffer.isError(unused))
+ return unused;
+ return { unused: unused, data: buffer.raw() };
+ } else if (tag === 'bmpstr') {
+ const raw = buffer.raw();
+ if (raw.length % 2 === 1)
+ return buffer.error('Decoding of string type: bmpstr length mismatch');
+
+ let str = '';
+ for (let i = 0; i < raw.length / 2; i++) {
+ str += String.fromCharCode(raw.readUInt16BE(i * 2));
+ }
+ return str;
+ } else if (tag === 'numstr') {
+ const numstr = buffer.raw().toString('ascii');
+ if (!this._isNumstr(numstr)) {
+ return buffer.error('Decoding of string type: ' +
+ 'numstr unsupported characters');
+ }
+ return numstr;
+ } else if (tag === 'octstr') {
+ return buffer.raw();
+ } else if (tag === 'objDesc') {
+ return buffer.raw();
+ } else if (tag === 'printstr') {
+ const printstr = buffer.raw().toString('ascii');
+ if (!this._isPrintstr(printstr)) {
+ return buffer.error('Decoding of string type: ' +
+ 'printstr unsupported characters');
+ }
+ return printstr;
+ } else if (/str$/.test(tag)) {
+ return buffer.raw().toString();
+ } else {
+ return buffer.error('Decoding of string type: ' + tag + ' unsupported');
+ }
+};
+
+DERNode.prototype._decodeObjid = function decodeObjid(buffer, values, relative) {
+ let result;
+ const identifiers = [];
+ let ident = 0;
+ let subident = 0;
+ while (!buffer.isEmpty()) {
+ subident = buffer.readUInt8();
+ ident <<= 7;
+ ident |= subident & 0x7f;
+ if ((subident & 0x80) === 0) {
+ identifiers.push(ident);
+ ident = 0;
+ }
+ }
+ if (subident & 0x80)
+ identifiers.push(ident);
+
+ const first = (identifiers[0] / 40) | 0;
+ const second = identifiers[0] % 40;
+
+ if (relative)
+ result = identifiers;
+ else
+ result = [first, second].concat(identifiers.slice(1));
+
+ if (values) {
+ let tmp = values[result.join(' ')];
+ if (tmp === undefined)
+ tmp = values[result.join('.')];
+ if (tmp !== undefined)
+ result = tmp;
+ }
+
+ return result;
+};
+
+DERNode.prototype._decodeTime = function decodeTime(buffer, tag) {
+ const str = buffer.raw().toString();
+
+ let year;
+ let mon;
+ let day;
+ let hour;
+ let min;
+ let sec;
+ if (tag === 'gentime') {
+ year = str.slice(0, 4) | 0;
+ mon = str.slice(4, 6) | 0;
+ day = str.slice(6, 8) | 0;
+ hour = str.slice(8, 10) | 0;
+ min = str.slice(10, 12) | 0;
+ sec = str.slice(12, 14) | 0;
+ } else if (tag === 'utctime') {
+ year = str.slice(0, 2) | 0;
+ mon = str.slice(2, 4) | 0;
+ day = str.slice(4, 6) | 0;
+ hour = str.slice(6, 8) | 0;
+ min = str.slice(8, 10) | 0;
+ sec = str.slice(10, 12) | 0;
+ if (year < 70)
+ year = 2000 + year;
+ else
+ year = 1900 + year;
+ } else {
+ return buffer.error('Decoding ' + tag + ' time is not supported yet');
+ }
+
+ return Date.UTC(year, mon - 1, day, hour, min, sec, 0);
+};
+
+DERNode.prototype._decodeNull = function decodeNull() {
+ return null;
+};
+
+DERNode.prototype._decodeBool = function decodeBool(buffer) {
+ const res = buffer.readUInt8();
+ if (buffer.isError(res))
+ return res;
+ else
+ return res !== 0;
+};
+
+DERNode.prototype._decodeInt = function decodeInt(buffer, values) {
+ // Bigint, return as it is (assume big endian)
+ const raw = buffer.raw();
+ let res = new bignum(raw);
+
+ if (values)
+ res = values[res.toString(10)] || res;
+
+ return res;
+};
+
+DERNode.prototype._use = function use(entity, obj) {
+ if (typeof entity === 'function')
+ entity = entity(obj);
+ return entity._getDecoder('der').tree;
+};
+
+// Utility methods
+
+function derDecodeTag(buf, fail) {
+ let tag = buf.readUInt8(fail);
+ if (buf.isError(tag))
+ return tag;
+
+ const cls = der.tagClass[tag >> 6];
+ const primitive = (tag & 0x20) === 0;
+
+ // Multi-octet tag - load
+ if ((tag & 0x1f) === 0x1f) {
+ let oct = tag;
+ tag = 0;
+ while ((oct & 0x80) === 0x80) {
+ oct = buf.readUInt8(fail);
+ if (buf.isError(oct))
+ return oct;
+
+ tag <<= 7;
+ tag |= oct & 0x7f;
+ }
+ } else {
+ tag &= 0x1f;
+ }
+ const tagStr = der.tag[tag];
+
+ return {
+ cls: cls,
+ primitive: primitive,
+ tag: tag,
+ tagStr: tagStr
+ };
+}
+
+function derDecodeLen(buf, primitive, fail) {
+ let len = buf.readUInt8(fail);
+ if (buf.isError(len))
+ return len;
+
+ // Indefinite form
+ if (!primitive && len === 0x80)
+ return null;
+
+ // Definite form
+ if ((len & 0x80) === 0) {
+ // Short form
+ return len;
+ }
+
+ // Long form
+ const num = len & 0x7f;
+ if (num > 4)
+ return buf.error('length octect is too long');
+
+ len = 0;
+ for (let i = 0; i < num; i++) {
+ len <<= 8;
+ const j = buf.readUInt8(fail);
+ if (buf.isError(j))
+ return j;
+ len |= j;
+ }
+
+ return len;
+}
diff --git a/node_modules/asn1.js/lib/asn1/decoders/index.js b/node_modules/asn1.js/lib/asn1/decoders/index.js
new file mode 100644
index 0000000..14fb05a
--- /dev/null
+++ b/node_modules/asn1.js/lib/asn1/decoders/index.js
@@ -0,0 +1,6 @@
+'use strict';
+
+const decoders = exports;
+
+decoders.der = require('./der');
+decoders.pem = require('./pem');
diff --git a/node_modules/asn1.js/lib/asn1/decoders/pem.js b/node_modules/asn1.js/lib/asn1/decoders/pem.js
new file mode 100644
index 0000000..2b050ef
--- /dev/null
+++ b/node_modules/asn1.js/lib/asn1/decoders/pem.js
@@ -0,0 +1,51 @@
+'use strict';
+
+const inherits = require('inherits');
+const Buffer = require('safer-buffer').Buffer;
+
+const DERDecoder = require('./der');
+
+function PEMDecoder(entity) {
+ DERDecoder.call(this, entity);
+ this.enc = 'pem';
+}
+inherits(PEMDecoder, DERDecoder);
+module.exports = PEMDecoder;
+
+PEMDecoder.prototype.decode = function decode(data, options) {
+ const lines = data.toString().split(/[\r\n]+/g);
+
+ const label = options.label.toUpperCase();
+
+ const re = /^-----(BEGIN|END) ([^-]+)-----$/;
+ let start = -1;
+ let end = -1;
+ for (let i = 0; i < lines.length; i++) {
+ const match = lines[i].match(re);
+ if (match === null)
+ continue;
+
+ if (match[2] !== label)
+ continue;
+
+ if (start === -1) {
+ if (match[1] !== 'BEGIN')
+ break;
+ start = i;
+ } else {
+ if (match[1] !== 'END')
+ break;
+ end = i;
+ break;
+ }
+ }
+ if (start === -1 || end === -1)
+ throw new Error('PEM section not found for: ' + label);
+
+ const base64 = lines.slice(start + 1, end).join('');
+ // Remove excessive symbols
+ base64.replace(/[^a-z0-9+/=]+/gi, '');
+
+ const input = Buffer.from(base64, 'base64');
+ return DERDecoder.prototype.decode.call(this, input, options);
+};
diff --git a/node_modules/asn1.js/lib/asn1/encoders/der.js b/node_modules/asn1.js/lib/asn1/encoders/der.js
new file mode 100644
index 0000000..55eb435
--- /dev/null
+++ b/node_modules/asn1.js/lib/asn1/encoders/der.js
@@ -0,0 +1,295 @@
+'use strict';
+
+const inherits = require('inherits');
+const Buffer = require('safer-buffer').Buffer;
+const Node = require('../base/node');
+
+// Import DER constants
+const der = require('../constants/der');
+
+function DEREncoder(entity) {
+ this.enc = 'der';
+ this.name = entity.name;
+ this.entity = entity;
+
+ // Construct base tree
+ this.tree = new DERNode();
+ this.tree._init(entity.body);
+}
+module.exports = DEREncoder;
+
+DEREncoder.prototype.encode = function encode(data, reporter) {
+ return this.tree._encode(data, reporter).join();
+};
+
+// Tree methods
+
+function DERNode(parent) {
+ Node.call(this, 'der', parent);
+}
+inherits(DERNode, Node);
+
+DERNode.prototype._encodeComposite = function encodeComposite(tag,
+ primitive,
+ cls,
+ content) {
+ const encodedTag = encodeTag(tag, primitive, cls, this.reporter);
+
+ // Short form
+ if (content.length < 0x80) {
+ const header = Buffer.alloc(2);
+ header[0] = encodedTag;
+ header[1] = content.length;
+ return this._createEncoderBuffer([ header, content ]);
+ }
+
+ // Long form
+ // Count octets required to store length
+ let lenOctets = 1;
+ for (let i = content.length; i >= 0x100; i >>= 8)
+ lenOctets++;
+
+ const header = Buffer.alloc(1 + 1 + lenOctets);
+ header[0] = encodedTag;
+ header[1] = 0x80 | lenOctets;
+
+ for (let i = 1 + lenOctets, j = content.length; j > 0; i--, j >>= 8)
+ header[i] = j & 0xff;
+
+ return this._createEncoderBuffer([ header, content ]);
+};
+
+DERNode.prototype._encodeStr = function encodeStr(str, tag) {
+ if (tag === 'bitstr') {
+ return this._createEncoderBuffer([ str.unused | 0, str.data ]);
+ } else if (tag === 'bmpstr') {
+ const buf = Buffer.alloc(str.length * 2);
+ for (let i = 0; i < str.length; i++) {
+ buf.writeUInt16BE(str.charCodeAt(i), i * 2);
+ }
+ return this._createEncoderBuffer(buf);
+ } else if (tag === 'numstr') {
+ if (!this._isNumstr(str)) {
+ return this.reporter.error('Encoding of string type: numstr supports ' +
+ 'only digits and space');
+ }
+ return this._createEncoderBuffer(str);
+ } else if (tag === 'printstr') {
+ if (!this._isPrintstr(str)) {
+ return this.reporter.error('Encoding of string type: printstr supports ' +
+ 'only latin upper and lower case letters, ' +
+ 'digits, space, apostrophe, left and rigth ' +
+ 'parenthesis, plus sign, comma, hyphen, ' +
+ 'dot, slash, colon, equal sign, ' +
+ 'question mark');
+ }
+ return this._createEncoderBuffer(str);
+ } else if (/str$/.test(tag)) {
+ return this._createEncoderBuffer(str);
+ } else if (tag === 'objDesc') {
+ return this._createEncoderBuffer(str);
+ } else {
+ return this.reporter.error('Encoding of string type: ' + tag +
+ ' unsupported');
+ }
+};
+
+DERNode.prototype._encodeObjid = function encodeObjid(id, values, relative) {
+ if (typeof id === 'string') {
+ if (!values)
+ return this.reporter.error('string objid given, but no values map found');
+ if (!values.hasOwnProperty(id))
+ return this.reporter.error('objid not found in values map');
+ id = values[id].split(/[\s.]+/g);
+ for (let i = 0; i < id.length; i++)
+ id[i] |= 0;
+ } else if (Array.isArray(id)) {
+ id = id.slice();
+ for (let i = 0; i < id.length; i++)
+ id[i] |= 0;
+ }
+
+ if (!Array.isArray(id)) {
+ return this.reporter.error('objid() should be either array or string, ' +
+ 'got: ' + JSON.stringify(id));
+ }
+
+ if (!relative) {
+ if (id[1] >= 40)
+ return this.reporter.error('Second objid identifier OOB');
+ id.splice(0, 2, id[0] * 40 + id[1]);
+ }
+
+ // Count number of octets
+ let size = 0;
+ for (let i = 0; i < id.length; i++) {
+ let ident = id[i];
+ for (size++; ident >= 0x80; ident >>= 7)
+ size++;
+ }
+
+ const objid = Buffer.alloc(size);
+ let offset = objid.length - 1;
+ for (let i = id.length - 1; i >= 0; i--) {
+ let ident = id[i];
+ objid[offset--] = ident & 0x7f;
+ while ((ident >>= 7) > 0)
+ objid[offset--] = 0x80 | (ident & 0x7f);
+ }
+
+ return this._createEncoderBuffer(objid);
+};
+
+function two(num) {
+ if (num < 10)
+ return '0' + num;
+ else
+ return num;
+}
+
+DERNode.prototype._encodeTime = function encodeTime(time, tag) {
+ let str;
+ const date = new Date(time);
+
+ if (tag === 'gentime') {
+ str = [
+ two(date.getUTCFullYear()),
+ two(date.getUTCMonth() + 1),
+ two(date.getUTCDate()),
+ two(date.getUTCHours()),
+ two(date.getUTCMinutes()),
+ two(date.getUTCSeconds()),
+ 'Z'
+ ].join('');
+ } else if (tag === 'utctime') {
+ str = [
+ two(date.getUTCFullYear() % 100),
+ two(date.getUTCMonth() + 1),
+ two(date.getUTCDate()),
+ two(date.getUTCHours()),
+ two(date.getUTCMinutes()),
+ two(date.getUTCSeconds()),
+ 'Z'
+ ].join('');
+ } else {
+ this.reporter.error('Encoding ' + tag + ' time is not supported yet');
+ }
+
+ return this._encodeStr(str, 'octstr');
+};
+
+DERNode.prototype._encodeNull = function encodeNull() {
+ return this._createEncoderBuffer('');
+};
+
+DERNode.prototype._encodeInt = function encodeInt(num, values) {
+ if (typeof num === 'string') {
+ if (!values)
+ return this.reporter.error('String int or enum given, but no values map');
+ if (!values.hasOwnProperty(num)) {
+ return this.reporter.error('Values map doesn\'t contain: ' +
+ JSON.stringify(num));
+ }
+ num = values[num];
+ }
+
+ // Bignum, assume big endian
+ if (typeof num !== 'number' && !Buffer.isBuffer(num)) {
+ const numArray = num.toArray();
+ if (!num.sign && numArray[0] & 0x80) {
+ numArray.unshift(0);
+ }
+ num = Buffer.from(numArray);
+ }
+
+ if (Buffer.isBuffer(num)) {
+ let size = num.length;
+ if (num.length === 0)
+ size++;
+
+ const out = Buffer.alloc(size);
+ num.copy(out);
+ if (num.length === 0)
+ out[0] = 0;
+ return this._createEncoderBuffer(out);
+ }
+
+ if (num < 0x80)
+ return this._createEncoderBuffer(num);
+
+ if (num < 0x100)
+ return this._createEncoderBuffer([0, num]);
+
+ let size = 1;
+ for (let i = num; i >= 0x100; i >>= 8)
+ size++;
+
+ const out = new Array(size);
+ for (let i = out.length - 1; i >= 0; i--) {
+ out[i] = num & 0xff;
+ num >>= 8;
+ }
+ if(out[0] & 0x80) {
+ out.unshift(0);
+ }
+
+ return this._createEncoderBuffer(Buffer.from(out));
+};
+
+DERNode.prototype._encodeBool = function encodeBool(value) {
+ return this._createEncoderBuffer(value ? 0xff : 0);
+};
+
+DERNode.prototype._use = function use(entity, obj) {
+ if (typeof entity === 'function')
+ entity = entity(obj);
+ return entity._getEncoder('der').tree;
+};
+
+DERNode.prototype._skipDefault = function skipDefault(dataBuffer, reporter, parent) {
+ const state = this._baseState;
+ let i;
+ if (state['default'] === null)
+ return false;
+
+ const data = dataBuffer.join();
+ if (state.defaultBuffer === undefined)
+ state.defaultBuffer = this._encodeValue(state['default'], reporter, parent).join();
+
+ if (data.length !== state.defaultBuffer.length)
+ return false;
+
+ for (i=0; i < data.length; i++)
+ if (data[i] !== state.defaultBuffer[i])
+ return false;
+
+ return true;
+};
+
+// Utility methods
+
+function encodeTag(tag, primitive, cls, reporter) {
+ let res;
+
+ if (tag === 'seqof')
+ tag = 'seq';
+ else if (tag === 'setof')
+ tag = 'set';
+
+ if (der.tagByName.hasOwnProperty(tag))
+ res = der.tagByName[tag];
+ else if (typeof tag === 'number' && (tag | 0) === tag)
+ res = tag;
+ else
+ return reporter.error('Unknown tag: ' + tag);
+
+ if (res >= 0x1f)
+ return reporter.error('Multi-octet tag encoding unsupported');
+
+ if (!primitive)
+ res |= 0x20;
+
+ res |= (der.tagClassByName[cls || 'universal'] << 6);
+
+ return res;
+}
diff --git a/node_modules/asn1.js/lib/asn1/encoders/index.js b/node_modules/asn1.js/lib/asn1/encoders/index.js
new file mode 100644
index 0000000..bb8ea34
--- /dev/null
+++ b/node_modules/asn1.js/lib/asn1/encoders/index.js
@@ -0,0 +1,6 @@
+'use strict';
+
+const encoders = exports;
+
+encoders.der = require('./der');
+encoders.pem = require('./pem');
diff --git a/node_modules/asn1.js/lib/asn1/encoders/pem.js b/node_modules/asn1.js/lib/asn1/encoders/pem.js
new file mode 100644
index 0000000..77fbdb4
--- /dev/null
+++ b/node_modules/asn1.js/lib/asn1/encoders/pem.js
@@ -0,0 +1,23 @@
+'use strict';
+
+const inherits = require('inherits');
+
+const DEREncoder = require('./der');
+
+function PEMEncoder(entity) {
+ DEREncoder.call(this, entity);
+ this.enc = 'pem';
+}
+inherits(PEMEncoder, DEREncoder);
+module.exports = PEMEncoder;
+
+PEMEncoder.prototype.encode = function encode(data, options) {
+ const buf = DEREncoder.prototype.encode.call(this, data);
+
+ const p = buf.toString('base64');
+ const out = [ '-----BEGIN ' + options.label + '-----' ];
+ for (let i = 0; i < p.length; i += 64)
+ out.push(p.slice(i, i + 64));
+ out.push('-----END ' + options.label + '-----');
+ return out.join('\n');
+};
diff --git a/node_modules/asn1.js/package.json b/node_modules/asn1.js/package.json
new file mode 100644
index 0000000..7b7d053
--- /dev/null
+++ b/node_modules/asn1.js/package.json
@@ -0,0 +1,36 @@
+{
+ "name": "asn1.js",
+ "version": "5.4.1",
+ "description": "ASN.1 encoder and decoder",
+ "main": "lib/asn1.js",
+ "scripts": {
+ "lint-2560": "eslint --fix rfc/2560/*.js rfc/2560/test/*.js",
+ "lint-5280": "eslint --fix rfc/5280/*.js rfc/5280/test/*.js",
+ "lint": "eslint --fix lib/*.js lib/**/*.js lib/**/**/*.js && npm run lint-2560 && npm run lint-5280",
+ "test": "mocha --reporter spec test/*-test.js && cd rfc/2560 && npm i && npm test && cd ../../rfc/5280 && npm i && npm test && cd ../../ && npm run lint"
+ },
+ "repository": {
+ "type": "git",
+ "url": "git@github.com:indutny/asn1.js"
+ },
+ "keywords": [
+ "asn.1",
+ "der"
+ ],
+ "author": "Fedor Indutny",
+ "license": "MIT",
+ "bugs": {
+ "url": "https://github.com/indutny/asn1.js/issues"
+ },
+ "homepage": "https://github.com/indutny/asn1.js",
+ "devDependencies": {
+ "eslint": "^4.10.0",
+ "mocha": "^7.0.0"
+ },
+ "dependencies": {
+ "bn.js": "^4.0.0",
+ "inherits": "^2.0.1",
+ "minimalistic-assert": "^1.0.0",
+ "safer-buffer": "^2.1.0"
+ }
+}
diff --git a/node_modules/aws-ssl-profiles/LICENSE b/node_modules/aws-ssl-profiles/LICENSE
new file mode 100644
index 0000000..95dc096
--- /dev/null
+++ b/node_modules/aws-ssl-profiles/LICENSE
@@ -0,0 +1,19 @@
+Copyright (c) 2024 Andrey Sidorov, Douglas Wilson, Weslley Araújo and contributors.
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE.
diff --git a/node_modules/aws-ssl-profiles/README.md b/node_modules/aws-ssl-profiles/README.md
new file mode 100644
index 0000000..99acaad
--- /dev/null
+++ b/node_modules/aws-ssl-profiles/README.md
@@ -0,0 +1,146 @@
+# AWS SSL Profiles
+
+[**AWS RDS**](https://aws.amazon.com/rds/) **SSL** Certificates Bundles.
+
+**Table of Contents**
+
+- [Installation](#installation)
+- [Usage](#usage)
+ - [**mysqljs/mysql**](#mysqljsmysql)
+ - [**MySQL2**](#mysql2)
+ - [**node-postgres**](#node-postgres)
+ - [Custom `ssl` options](#custom-ssl-options)
+- [License](#license)
+- [Security](#security)
+- [Contributing](#contributing)
+- [Acknowledgements](#acknowledgements)
+
+---
+
+## Installation
+
+```bash
+npm install --save aws-ssl-profiles
+```
+
+---
+
+## Usage
+
+### [mysqljs/mysql](https://github.com/mysqljs/mysql)
+
+```js
+const mysql = require('mysql');
+const awsCaBundle = require('aws-ssl-profiles');
+
+// mysql connection
+const connection = mysql.createConnection({
+ //...
+ ssl: awsCaBundle,
+});
+
+// mysql connection pool
+const pool = mysql.createPool({
+ //...
+ ssl: awsCaBundle,
+});
+```
+
+### [MySQL2](https://github.com/sidorares/node-mysql2)
+
+```js
+const mysql = require('mysql2');
+const awsCaBundle = require('aws-ssl-profiles');
+
+// mysql2 connection
+const connection = mysql.createConnection({
+ //...
+ ssl: awsCaBundle,
+});
+
+// mysql2 connection pool
+const pool = mysql.createPool({
+ //...
+ ssl: awsCaBundle,
+});
+```
+
+### [node-postgres](https://github.com/brianc/node-postgres)
+
+```js
+const pg = require('pg');
+const awsCaBundle = require('aws-ssl-profiles');
+
+// pg connection
+const client = new pg.Client({
+ // ...
+ ssl: awsCaBundle,
+});
+
+// pg connection pool
+const pool = new pg.Pool({
+ // ...
+ ssl: awsCaBundle,
+});
+```
+
+### Custom `ssl` options
+
+Using **AWS SSL Profiles** with custom `ssl` options:
+
+```js
+{
+ // ...
+ ssl: {
+ ...awsCaBundle,
+ rejectUnauthorized: true,
+ // ...
+ }
+}
+```
+
+```js
+{
+ // ...
+ ssl: {
+ ca: awsCaBundle.ca,
+ rejectUnauthorized: true,
+ // ...
+ }
+}
+```
+
+### Custom bundles
+
+```js
+const { proxyBundle } = require('aws-ssl-profiles');
+
+{
+ // ...
+ ssl: proxyBundle,
+}
+```
+
+---
+
+## License
+
+**AWS SSL Profiles** is under the [**MIT License**](./LICENSE).
+
+---
+
+## Security
+
+Please check the [**SECURITY.md**](./SECURITY.md).
+
+---
+
+## Contributing
+
+Please check the [**CONTRIBUTING.md**](./CONTRIBUTING.md) for instructions.
+
+---
+
+## Acknowledgements
+
+[**Contributors**](https://github.com/mysqljs/aws-ssl-profiles/graphs/contributors).
diff --git a/node_modules/aws-ssl-profiles/lib/@types/profiles.d.ts b/node_modules/aws-ssl-profiles/lib/@types/profiles.d.ts
new file mode 100644
index 0000000..a02c121
--- /dev/null
+++ b/node_modules/aws-ssl-profiles/lib/@types/profiles.d.ts
@@ -0,0 +1,4 @@
+export type CA = string[];
+export type Profiles = {
+ ca: CA;
+};
diff --git a/node_modules/aws-ssl-profiles/lib/@types/profiles.js b/node_modules/aws-ssl-profiles/lib/@types/profiles.js
new file mode 100644
index 0000000..c8ad2e5
--- /dev/null
+++ b/node_modules/aws-ssl-profiles/lib/@types/profiles.js
@@ -0,0 +1,2 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
diff --git a/node_modules/aws-ssl-profiles/lib/index.d.ts b/node_modules/aws-ssl-profiles/lib/index.d.ts
new file mode 100644
index 0000000..18d181b
--- /dev/null
+++ b/node_modules/aws-ssl-profiles/lib/index.d.ts
@@ -0,0 +1,8 @@
+import type { Profiles } from "./@types/profiles.js";
+export declare const proxyBundle: Profiles;
+declare const profiles: Profiles;
+declare module "aws-ssl-profiles" {
+ const profiles: Profiles & { proxyBundle: Profiles };
+ export = profiles;
+}
+export default profiles;
diff --git a/node_modules/aws-ssl-profiles/lib/index.js b/node_modules/aws-ssl-profiles/lib/index.js
new file mode 100644
index 0000000..d702ca7
--- /dev/null
+++ b/node_modules/aws-ssl-profiles/lib/index.js
@@ -0,0 +1,13 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+const defaults_js_1 = require("./profiles/ca/defaults.js");
+const proxies_js_1 = require("./profiles/ca/proxies.js");
+const proxyBundle = {
+ ca: proxies_js_1.proxies,
+};
+const profiles = {
+ ca: [...defaults_js_1.defaults, ...proxies_js_1.proxies],
+};
+module.exports = profiles;
+module.exports.proxyBundle = proxyBundle;
+module.exports.default = profiles;
diff --git a/node_modules/aws-ssl-profiles/lib/profiles/ca/defaults.d.ts b/node_modules/aws-ssl-profiles/lib/profiles/ca/defaults.d.ts
new file mode 100644
index 0000000..347c7b5
--- /dev/null
+++ b/node_modules/aws-ssl-profiles/lib/profiles/ca/defaults.d.ts
@@ -0,0 +1,9 @@
+import type { CA } from '../../@types/profiles.js';
+/**
+ * CA Certificates for **Amazon RDS** (2024)
+ *
+ * - https://docs.aws.amazon.com/AmazonRDS/latest/UserGuide/UsingWithRDS.SSL.html
+ * - https://docs.amazonaws.cn/en_us/AmazonRDS/latest/AuroraUserGuide/UsingWithRDS.SSL.html
+ * - https://docs.aws.amazon.com/AmazonRDS/latest/AuroraUserGuide/aurora-serverless.html#aurora-serverless.tls
+ */
+export declare const defaults: CA;
diff --git a/node_modules/aws-ssl-profiles/lib/profiles/ca/defaults.js b/node_modules/aws-ssl-profiles/lib/profiles/ca/defaults.js
new file mode 100644
index 0000000..343c8a0
--- /dev/null
+++ b/node_modules/aws-ssl-profiles/lib/profiles/ca/defaults.js
@@ -0,0 +1,2888 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.defaults = void 0;
+/**
+ * CA Certificates for **Amazon RDS** (2024)
+ *
+ * - https://docs.aws.amazon.com/AmazonRDS/latest/UserGuide/UsingWithRDS.SSL.html
+ * - https://docs.amazonaws.cn/en_us/AmazonRDS/latest/AuroraUserGuide/UsingWithRDS.SSL.html
+ * - https://docs.aws.amazon.com/AmazonRDS/latest/AuroraUserGuide/aurora-serverless.html#aurora-serverless.tls
+ */
+exports.defaults = [
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIEEjCCAvqgAwIBAgIJAM2ZN/+nPi27MA0GCSqGSIb3DQEBCwUAMIGVMQswCQYD\n' +
+ 'VQQGEwJVUzEQMA4GA1UEBwwHU2VhdHRsZTETMBEGA1UECAwKV2FzaGluZ3RvbjEi\n' +
+ 'MCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywgSW5jLjETMBEGA1UECwwKQW1h\n' +
+ 'em9uIFJEUzEmMCQGA1UEAwwdQW1hem9uIFJEUyBhZi1zb3V0aC0xIFJvb3QgQ0Ew\n' +
+ 'HhcNMTkxMDI4MTgwNTU4WhcNMjQxMDI2MTgwNTU4WjCBlTELMAkGA1UEBhMCVVMx\n' +
+ 'EDAOBgNVBAcMB1NlYXR0bGUxEzARBgNVBAgMCldhc2hpbmd0b24xIjAgBgNVBAoM\n' +
+ 'GUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4xEzARBgNVBAsMCkFtYXpvbiBSRFMx\n' +
+ 'JjAkBgNVBAMMHUFtYXpvbiBSRFMgYWYtc291dGgtMSBSb290IENBMIIBIjANBgkq\n' +
+ 'hkiG9w0BAQEFAAOCAQ8AMIIBCgKCAQEAwR2351uPMZaJk2gMGT+1sk8HE9MQh2rc\n' +
+ '/sCnbxGn2p1c7Oi9aBbd/GiFijeJb2BXvHU+TOq3d3Jjqepq8tapXVt4ojbTJNyC\n' +
+ 'J5E7r7KjTktKdLxtBE1MK25aY+IRJjtdU6vG3KiPKUT1naO3xs3yt0F76WVuFivd\n' +
+ '9OHv2a+KHvPkRUWIxpmAHuMY9SIIMmEZtVE7YZGx5ah0iO4JzItHcbVR0y0PBH55\n' +
+ 'arpFBddpIVHCacp1FUPxSEWkOpI7q0AaU4xfX0fe1BV5HZYRKpBOIp1TtZWvJD+X\n' +
+ 'jGUtL1BEsT5vN5g9MkqdtYrC+3SNpAk4VtpvJrdjraI/hhvfeXNnAwIDAQABo2Mw\n' +
+ 'YTAOBgNVHQ8BAf8EBAMCAQYwDwYDVR0TAQH/BAUwAwEB/zAdBgNVHQ4EFgQUEEi/\n' +
+ 'WWMcBJsoGXg+EZwkQ0MscZQwHwYDVR0jBBgwFoAUEEi/WWMcBJsoGXg+EZwkQ0Ms\n' +
+ 'cZQwDQYJKoZIhvcNAQELBQADggEBAGDZ5js5Pc/gC58LJrwMPXFhJDBS8QuDm23C\n' +
+ 'FFUdlqucskwOS3907ErK1ZkmVJCIqFLArHqskFXMAkRZ2PNR7RjWLqBs+0znG5yH\n' +
+ 'hRKb4DXzhUFQ18UBRcvT6V6zN97HTRsEEaNhM/7k8YLe7P8vfNZ28VIoJIGGgv9D\n' +
+ 'wQBBvkxQ71oOmAG0AwaGD0ORGUfbYry9Dz4a4IcUsZyRWRMADixgrFv6VuETp26s\n' +
+ '/+z+iqNaGWlELBKh3iQCT6Y/1UnkPLO42bxrCSyOvshdkYN58Q2gMTE1SVTqyo8G\n' +
+ 'Lw8lLAz9bnvUSgHzB3jRrSx6ggF/WRMRYlR++y6LXP4SAsSAaC0=\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIEEjCCAvqgAwIBAgIJAJYM4LxvTZA6MA0GCSqGSIb3DQEBCwUAMIGVMQswCQYD\n' +
+ 'VQQGEwJVUzEQMA4GA1UEBwwHU2VhdHRsZTETMBEGA1UECAwKV2FzaGluZ3RvbjEi\n' +
+ 'MCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywgSW5jLjETMBEGA1UECwwKQW1h\n' +
+ 'em9uIFJEUzEmMCQGA1UEAwwdQW1hem9uIFJEUyBldS1zb3V0aC0xIFJvb3QgQ0Ew\n' +
+ 'HhcNMTkxMDMwMjAyMDM2WhcNMjQxMDI4MjAyMDM2WjCBlTELMAkGA1UEBhMCVVMx\n' +
+ 'EDAOBgNVBAcMB1NlYXR0bGUxEzARBgNVBAgMCldhc2hpbmd0b24xIjAgBgNVBAoM\n' +
+ 'GUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4xEzARBgNVBAsMCkFtYXpvbiBSRFMx\n' +
+ 'JjAkBgNVBAMMHUFtYXpvbiBSRFMgZXUtc291dGgtMSBSb290IENBMIIBIjANBgkq\n' +
+ 'hkiG9w0BAQEFAAOCAQ8AMIIBCgKCAQEAqM921jXCXeqpRNCS9CBPOe5N7gMaEt+D\n' +
+ 's5uR3riZbqzRlHGiF1jZihkXfHAIQewDwy+Yz+Oec1aEZCQMhUHxZJPusuX0cJfj\n' +
+ 'b+UluFqHIijL2TfXJ3D0PVLLoNTQJZ8+GAPECyojAaNuoHbdVqxhOcznMsXIXVFq\n' +
+ 'yVLKDGvyKkJjai/iSPDrQMXufg3kWt0ISjNLvsG5IFXgP4gttsM8i0yvRd4QcHoo\n' +
+ 'DjvH7V3cS+CQqW5SnDrGnHToB0RLskE1ET+oNOfeN9PWOxQprMOX/zmJhnJQlTqD\n' +
+ 'QP7jcf7SddxrKFjuziFiouskJJyNDsMjt1Lf60+oHZhed2ogTeifGwIDAQABo2Mw\n' +
+ 'YTAOBgNVHQ8BAf8EBAMCAQYwDwYDVR0TAQH/BAUwAwEB/zAdBgNVHQ4EFgQUFBAF\n' +
+ 'cgJe/BBuZiGeZ8STfpkgRYQwHwYDVR0jBBgwFoAUFBAFcgJe/BBuZiGeZ8STfpkg\n' +
+ 'RYQwDQYJKoZIhvcNAQELBQADggEBAKAYUtlvDuX2UpZW9i1QgsjFuy/ErbW0dLHU\n' +
+ 'e/IcFtju2z6RLZ+uF+5A8Kme7IKG1hgt8s+w9TRVQS/7ukQzoK3TaN6XKXRosjtc\n' +
+ 'o9Rm4gYWM8bmglzY1TPNaiI4HC7546hSwJhubjN0bXCuj/0sHD6w2DkiGuwKNAef\n' +
+ 'yTu5vZhPkeNyXLykxkzz7bNp2/PtMBnzIp+WpS7uUDmWyScGPohKMq5PqvL59z+L\n' +
+ 'ZI3CYeMZrJ5VpXUg3fNNIz/83N3G0sk7wr0ohs/kHTP7xPOYB0zD7Ku4HA0Q9Swf\n' +
+ 'WX0qr6UQgTPMjfYDLffI7aEId0gxKw1eGYc6Cq5JAZ3ipi/cBFc=\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIEEjCCAvqgAwIBAgIJANew34ehz5l8MA0GCSqGSIb3DQEBCwUAMIGVMQswCQYD\n' +
+ 'VQQGEwJVUzEQMA4GA1UEBwwHU2VhdHRsZTETMBEGA1UECAwKV2FzaGluZ3RvbjEi\n' +
+ 'MCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywgSW5jLjETMBEGA1UECwwKQW1h\n' +
+ 'em9uIFJEUzEmMCQGA1UEAwwdQW1hem9uIFJEUyBtZS1zb3V0aC0xIFJvb3QgQ0Ew\n' +
+ 'HhcNMTkwNTEwMjE0ODI3WhcNMjQwNTA4MjE0ODI3WjCBlTELMAkGA1UEBhMCVVMx\n' +
+ 'EDAOBgNVBAcMB1NlYXR0bGUxEzARBgNVBAgMCldhc2hpbmd0b24xIjAgBgNVBAoM\n' +
+ 'GUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4xEzARBgNVBAsMCkFtYXpvbiBSRFMx\n' +
+ 'JjAkBgNVBAMMHUFtYXpvbiBSRFMgbWUtc291dGgtMSBSb290IENBMIIBIjANBgkq\n' +
+ 'hkiG9w0BAQEFAAOCAQ8AMIIBCgKCAQEAp7BYV88MukcY+rq0r79+C8UzkT30fEfT\n' +
+ 'aPXbx1d6M7uheGN4FMaoYmL+JE1NZPaMRIPTHhFtLSdPccInvenRDIatcXX+jgOk\n' +
+ 'UA6lnHQ98pwN0pfDUyz/Vph4jBR9LcVkBbe0zdoKKp+HGbMPRU0N2yNrog9gM5O8\n' +
+ 'gkU/3O2csJ/OFQNnj4c2NQloGMUpEmedwJMOyQQfcUyt9CvZDfIPNnheUS29jGSw\n' +
+ 'ERpJe/AENu8Pxyc72jaXQuD+FEi2Ck6lBkSlWYQFhTottAeGvVFNCzKszCntrtqd\n' +
+ 'rdYUwurYsLTXDHv9nW2hfDUQa0mhXf9gNDOBIVAZugR9NqNRNyYLHQIDAQABo2Mw\n' +
+ 'YTAOBgNVHQ8BAf8EBAMCAQYwDwYDVR0TAQH/BAUwAwEB/zAdBgNVHQ4EFgQU54cf\n' +
+ 'DjgwBx4ycBH8+/r8WXdaiqYwHwYDVR0jBBgwFoAU54cfDjgwBx4ycBH8+/r8WXda\n' +
+ 'iqYwDQYJKoZIhvcNAQELBQADggEBAIIMTSPx/dR7jlcxggr+O6OyY49Rlap2laKA\n' +
+ 'eC/XI4ySP3vQkIFlP822U9Kh8a9s46eR0uiwV4AGLabcu0iKYfXjPkIprVCqeXV7\n' +
+ 'ny9oDtrbflyj7NcGdZLvuzSwgl9SYTJp7PVCZtZutsPYlbJrBPHwFABvAkMvRtDB\n' +
+ 'hitIg4AESDGPoCl94sYHpfDfjpUDMSrAMDUyO6DyBdZH5ryRMAs3lGtsmkkNUrso\n' +
+ 'aTW6R05681Z0mvkRdb+cdXtKOSuDZPoe2wJJIaz3IlNQNSrB5TImMYgmt6iAsFhv\n' +
+ '3vfTSTKrZDNTJn4ybG6pq1zWExoXsktZPylJly6R3RBwV6nwqBM=\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIEBjCCAu6gAwIBAgIJAMc0ZzaSUK51MA0GCSqGSIb3DQEBCwUAMIGPMQswCQYD\n' +
+ 'VQQGEwJVUzEQMA4GA1UEBwwHU2VhdHRsZTETMBEGA1UECAwKV2FzaGluZ3RvbjEi\n' +
+ 'MCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywgSW5jLjETMBEGA1UECwwKQW1h\n' +
+ 'em9uIFJEUzEgMB4GA1UEAwwXQW1hem9uIFJEUyBSb290IDIwMTkgQ0EwHhcNMTkw\n' +
+ 'ODIyMTcwODUwWhcNMjQwODIyMTcwODUwWjCBjzELMAkGA1UEBhMCVVMxEDAOBgNV\n' +
+ 'BAcMB1NlYXR0bGUxEzARBgNVBAgMCldhc2hpbmd0b24xIjAgBgNVBAoMGUFtYXpv\n' +
+ 'biBXZWIgU2VydmljZXMsIEluYy4xEzARBgNVBAsMCkFtYXpvbiBSRFMxIDAeBgNV\n' +
+ 'BAMMF0FtYXpvbiBSRFMgUm9vdCAyMDE5IENBMIIBIjANBgkqhkiG9w0BAQEFAAOC\n' +
+ 'AQ8AMIIBCgKCAQEArXnF/E6/Qh+ku3hQTSKPMhQQlCpoWvnIthzX6MK3p5a0eXKZ\n' +
+ 'oWIjYcNNG6UwJjp4fUXl6glp53Jobn+tWNX88dNH2n8DVbppSwScVE2LpuL+94vY\n' +
+ '0EYE/XxN7svKea8YvlrqkUBKyxLxTjh+U/KrGOaHxz9v0l6ZNlDbuaZw3qIWdD/I\n' +
+ '6aNbGeRUVtpM6P+bWIoxVl/caQylQS6CEYUk+CpVyJSkopwJlzXT07tMoDL5WgX9\n' +
+ 'O08KVgDNz9qP/IGtAcRduRcNioH3E9v981QO1zt/Gpb2f8NqAjUUCUZzOnij6mx9\n' +
+ 'McZ+9cWX88CRzR0vQODWuZscgI08NvM69Fn2SQIDAQABo2MwYTAOBgNVHQ8BAf8E\n' +
+ 'BAMCAQYwDwYDVR0TAQH/BAUwAwEB/zAdBgNVHQ4EFgQUc19g2LzLA5j0Kxc0LjZa\n' +
+ 'pmD/vB8wHwYDVR0jBBgwFoAUc19g2LzLA5j0Kxc0LjZapmD/vB8wDQYJKoZIhvcN\n' +
+ 'AQELBQADggEBAHAG7WTmyjzPRIM85rVj+fWHsLIvqpw6DObIjMWokpliCeMINZFV\n' +
+ 'ynfgBKsf1ExwbvJNzYFXW6dihnguDG9VMPpi2up/ctQTN8tm9nDKOy08uNZoofMc\n' +
+ 'NUZxKCEkVKZv+IL4oHoeayt8egtv3ujJM6V14AstMQ6SwvwvA93EP/Ug2e4WAXHu\n' +
+ 'cbI1NAbUgVDqp+DRdfvZkgYKryjTWd/0+1fS8X1bBZVWzl7eirNVnHbSH2ZDpNuY\n' +
+ '0SBd8dj5F6ld3t58ydZbrTHze7JJOd8ijySAp4/kiu9UfZWuTPABzDa/DSdz9Dk/\n' +
+ 'zPW4CXXvhLmE02TA9/HeCw3KEHIwicNuEfw=\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIEEDCCAvigAwIBAgIJAKFMXyltvuRdMA0GCSqGSIb3DQEBCwUAMIGUMQswCQYD\n' +
+ 'VQQGEwJVUzEQMA4GA1UEBwwHU2VhdHRsZTETMBEGA1UECAwKV2FzaGluZ3RvbjEi\n' +
+ 'MCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywgSW5jLjETMBEGA1UECwwKQW1h\n' +
+ 'em9uIFJEUzElMCMGA1UEAwwcQW1hem9uIFJEUyBCZXRhIFJvb3QgMjAxOSBDQTAe\n' +
+ 'Fw0xOTA4MTkxNzM4MjZaFw0yNDA4MTkxNzM4MjZaMIGUMQswCQYDVQQGEwJVUzEQ\n' +
+ 'MA4GA1UEBwwHU2VhdHRsZTETMBEGA1UECAwKV2FzaGluZ3RvbjEiMCAGA1UECgwZ\n' +
+ 'QW1hem9uIFdlYiBTZXJ2aWNlcywgSW5jLjETMBEGA1UECwwKQW1hem9uIFJEUzEl\n' +
+ 'MCMGA1UEAwwcQW1hem9uIFJEUyBCZXRhIFJvb3QgMjAxOSBDQTCCASIwDQYJKoZI\n' +
+ 'hvcNAQEBBQADggEPADCCAQoCggEBAMkZdnIH9ndatGAcFo+DppGJ1HUt4x+zeO+0\n' +
+ 'ZZ29m0sfGetVulmTlv2d5b66e+QXZFWpcPQMouSxxYTW08TbrQiZngKr40JNXftA\n' +
+ 'atvzBqIImD4II0ZX5UEVj2h98qe/ypW5xaDN7fEa5e8FkYB1TEemPaWIbNXqchcL\n' +
+ 'tV7IJPr3Cd7Z5gZJlmujIVDPpMuSiNaal9/6nT9oqN+JSM1fx5SzrU5ssg1Vp1vv\n' +
+ '5Xab64uOg7wCJRB9R2GC9XD04odX6VcxUAGrZo6LR64ZSifupo3l+R5sVOc5i8NH\n' +
+ 'skdboTzU9H7+oSdqoAyhIU717PcqeDum23DYlPE2nGBWckE+eT8CAwEAAaNjMGEw\n' +
+ 'DgYDVR0PAQH/BAQDAgEGMA8GA1UdEwEB/wQFMAMBAf8wHQYDVR0OBBYEFK2hDBWl\n' +
+ 'sbHzt/EHd0QYOooqcFPhMB8GA1UdIwQYMBaAFK2hDBWlsbHzt/EHd0QYOooqcFPh\n' +
+ 'MA0GCSqGSIb3DQEBCwUAA4IBAQAO/718k8EnOqJDx6wweUscGTGL/QdKXUzTVRAx\n' +
+ 'JUsjNUv49mH2HQVEW7oxszfH6cPCaupNAddMhQc4C/af6GHX8HnqfPDk27/yBQI+\n' +
+ 'yBBvIanGgxv9c9wBbmcIaCEWJcsLp3HzXSYHmjiqkViXwCpYfkoV3Ns2m8bp+KCO\n' +
+ 'y9XmcCKRaXkt237qmoxoh2sGmBHk2UlQtOsMC0aUQ4d7teAJG0q6pbyZEiPyKZY1\n' +
+ 'XR/UVxMJL0Q4iVpcRS1kaNCMfqS2smbLJeNdsan8pkw1dvPhcaVTb7CvjhJtjztF\n' +
+ 'YfDzAI5794qMlWxwilKMmUvDlPPOTen8NNHkLwWvyFCH7Doh\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIEFjCCAv6gAwIBAgIJAMzYZJ+R9NBVMA0GCSqGSIb3DQEBCwUAMIGXMQswCQYD\n' +
+ 'VQQGEwJVUzEQMA4GA1UEBwwHU2VhdHRsZTETMBEGA1UECAwKV2FzaGluZ3RvbjEi\n' +
+ 'MCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywgSW5jLjETMBEGA1UECwwKQW1h\n' +
+ 'em9uIFJEUzEoMCYGA1UEAwwfQW1hem9uIFJEUyBQcmV2aWV3IFJvb3QgMjAxOSBD\n' +
+ 'QTAeFw0xOTA4MjEyMjI5NDlaFw0yNDA4MjEyMjI5NDlaMIGXMQswCQYDVQQGEwJV\n' +
+ 'UzEQMA4GA1UEBwwHU2VhdHRsZTETMBEGA1UECAwKV2FzaGluZ3RvbjEiMCAGA1UE\n' +
+ 'CgwZQW1hem9uIFdlYiBTZXJ2aWNlcywgSW5jLjETMBEGA1UECwwKQW1hem9uIFJE\n' +
+ 'UzEoMCYGA1UEAwwfQW1hem9uIFJEUyBQcmV2aWV3IFJvb3QgMjAxOSBDQTCCASIw\n' +
+ 'DQYJKoZIhvcNAQEBBQADggEPADCCAQoCggEBAM7kkS6vjgKKQTPynC2NjdN5aPPV\n' +
+ 'O71G0JJS/2ARVBVJd93JLiGovVJilfWYfwZCs4gTRSSjrUD4D4HyqCd6A+eEEtJq\n' +
+ 'M0DEC7i0dC+9WNTsPszuB206Jy2IUmxZMIKJAA1NHSbIMjB+b6/JhbSUi7nKdbR/\n' +
+ 'brj83bF+RoSA+ogrgX7mQbxhmFcoZN9OGaJgYKsKWUt5Wqv627KkGodUK8mDepgD\n' +
+ 'S3ZfoRQRx3iceETpcmHJvaIge6+vyDX3d9Z22jmvQ4AKv3py2CmU2UwuhOltFDwB\n' +
+ '0ddtb39vgwrJxaGfiMRHpEP1DfNLWHAnA69/pgZPwIggidS+iBPUhgucMp8CAwEA\n' +
+ 'AaNjMGEwDgYDVR0PAQH/BAQDAgEGMA8GA1UdEwEB/wQFMAMBAf8wHQYDVR0OBBYE\n' +
+ 'FGnTGpQuQ2H/DZlXMQijZEhjs7TdMB8GA1UdIwQYMBaAFGnTGpQuQ2H/DZlXMQij\n' +
+ 'ZEhjs7TdMA0GCSqGSIb3DQEBCwUAA4IBAQC3xz1vQvcXAfpcZlngiRWeqU8zQAMQ\n' +
+ 'LZPCFNv7PVk4pmqX+ZiIRo4f9Zy7TrOVcboCnqmP/b/mNq0gVF4O+88jwXJZD+f8\n' +
+ '/RnABMZcnGU+vK0YmxsAtYU6TIb1uhRFmbF8K80HHbj9vSjBGIQdPCbvmR2zY6VJ\n' +
+ 'BYM+w9U9hp6H4DVMLKXPc1bFlKA5OBTgUtgkDibWJKFOEPW3UOYwp9uq6pFoN0AO\n' +
+ 'xMTldqWFsOF3bJIlvOY0c/1EFZXu3Ns6/oCP//Ap9vumldYMUZWmbK+gK33FPOXV\n' +
+ '8BQ6jNC29icv7lLDpRPwjibJBXX+peDR5UK4FdYcswWEB1Tix5X8dYu6\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIECTCCAvGgAwIBAgICEAAwDQYJKoZIhvcNAQELBQAwgZUxCzAJBgNVBAYTAlVT\n' +
+ 'MRAwDgYDVQQHDAdTZWF0dGxlMRMwEQYDVQQIDApXYXNoaW5ndG9uMSIwIAYDVQQK\n' +
+ 'DBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMuMRMwEQYDVQQLDApBbWF6b24gUkRT\n' +
+ 'MSYwJAYDVQQDDB1BbWF6b24gUkRTIGFmLXNvdXRoLTEgUm9vdCBDQTAeFw0xOTEw\n' +
+ 'MjgxODA2NTNaFw0yNDEwMjgxODA2NTNaMIGQMQswCQYDVQQGEwJVUzETMBEGA1UE\n' +
+ 'CAwKV2FzaGluZ3RvbjEQMA4GA1UEBwwHU2VhdHRsZTEiMCAGA1UECgwZQW1hem9u\n' +
+ 'IFdlYiBTZXJ2aWNlcywgSW5jLjETMBEGA1UECwwKQW1hem9uIFJEUzEhMB8GA1UE\n' +
+ 'AwwYQW1hem9uIFJEUyBhZi1zb3V0aC0xIENBMIIBIjANBgkqhkiG9w0BAQEFAAOC\n' +
+ 'AQ8AMIIBCgKCAQEAvtV1OqmFa8zCVQSKOvPUJERLVFtd4rZmDpImc5rIoeBk7w/P\n' +
+ '9lcKUJjO8R/w1a2lJXx3oQ81tiY0Piw6TpT62YWVRMWrOw8+Vxq1dNaDSFp9I8d0\n' +
+ 'UHillSSbOk6FOrPDp+R6AwbGFqUDebbN5LFFoDKbhNmH1BVS0a6YNKpGigLRqhka\n' +
+ 'cClPslWtPqtjbaP3Jbxl26zWzLo7OtZl98dR225pq8aApNBwmtgA7Gh60HK/cX0t\n' +
+ '32W94n8D+GKSg6R4MKredVFqRTi9hCCNUu0sxYPoELuM+mHiqB5NPjtm92EzCWs+\n' +
+ '+vgWhMc6GxG+82QSWx1Vj8sgLqtE/vLrWddf5QIDAQABo2YwZDAOBgNVHQ8BAf8E\n' +
+ 'BAMCAQYwEgYDVR0TAQH/BAgwBgEB/wIBADAdBgNVHQ4EFgQUuLB4gYVJrSKJj/Gz\n' +
+ 'pqc6yeA+RcAwHwYDVR0jBBgwFoAUEEi/WWMcBJsoGXg+EZwkQ0MscZQwDQYJKoZI\n' +
+ 'hvcNAQELBQADggEBABauYOZxUhe9/RhzGJ8MsWCz8eKcyDVd4FCnY6Qh+9wcmYNT\n' +
+ 'LtnD88LACtJKb/b81qYzcB0Em6+zVJ3Z9jznfr6buItE6es9wAoja22Xgv44BTHL\n' +
+ 'rimbgMwpTt3uEMXDffaS0Ww6YWb3pSE0XYI2ISMWz+xRERRf+QqktSaL39zuiaW5\n' +
+ 'tfZMre+YhohRa/F0ZQl3RCd6yFcLx4UoSPqQsUl97WhYzwAxZZfwvLJXOc4ATt3u\n' +
+ 'VlCUylNDkaZztDJc/yN5XQoK9W5nOt2cLu513MGYKbuarQr8f+gYU8S+qOyuSRSP\n' +
+ 'NRITzwCRVnsJE+2JmcRInn/NcanB7uOGqTvJ9+c=\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIECTCCAvGgAwIBAgICEAAwDQYJKoZIhvcNAQELBQAwgZUxCzAJBgNVBAYTAlVT\n' +
+ 'MRAwDgYDVQQHDAdTZWF0dGxlMRMwEQYDVQQIDApXYXNoaW5ndG9uMSIwIAYDVQQK\n' +
+ 'DBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMuMRMwEQYDVQQLDApBbWF6b24gUkRT\n' +
+ 'MSYwJAYDVQQDDB1BbWF6b24gUkRTIGV1LXNvdXRoLTEgUm9vdCBDQTAeFw0xOTEw\n' +
+ 'MzAyMDIxMzBaFw0yNDEwMzAyMDIxMzBaMIGQMQswCQYDVQQGEwJVUzETMBEGA1UE\n' +
+ 'CAwKV2FzaGluZ3RvbjEQMA4GA1UEBwwHU2VhdHRsZTEiMCAGA1UECgwZQW1hem9u\n' +
+ 'IFdlYiBTZXJ2aWNlcywgSW5jLjETMBEGA1UECwwKQW1hem9uIFJEUzEhMB8GA1UE\n' +
+ 'AwwYQW1hem9uIFJEUyBldS1zb3V0aC0xIENBMIIBIjANBgkqhkiG9w0BAQEFAAOC\n' +
+ 'AQ8AMIIBCgKCAQEAtEyjYcajx6xImJn8Vz1zjdmL4ANPgQXwF7+tF7xccmNAZETb\n' +
+ 'bzb3I9i5fZlmrRaVznX+9biXVaGxYzIUIR3huQ3Q283KsDYnVuGa3mk690vhvJbB\n' +
+ 'QIPgKa5mVwJppnuJm78KqaSpi0vxyCPe3h8h6LLFawVyWrYNZ4okli1/U582eef8\n' +
+ 'RzJp/Ear3KgHOLIiCdPDF0rjOdCG1MOlDLixVnPn9IYOciqO+VivXBg+jtfc5J+L\n' +
+ 'AaPm0/Yx4uELt1tkbWkm4BvTU/gBOODnYziITZM0l6Fgwvbwgq5duAtKW+h031lC\n' +
+ '37rEvrclqcp4wrsUYcLAWX79ZyKIlRxcAdvEhQIDAQABo2YwZDAOBgNVHQ8BAf8E\n' +
+ 'BAMCAQYwEgYDVR0TAQH/BAgwBgEB/wIBADAdBgNVHQ4EFgQU7zPyc0azQxnBCe7D\n' +
+ 'b9KAadH1QSEwHwYDVR0jBBgwFoAUFBAFcgJe/BBuZiGeZ8STfpkgRYQwDQYJKoZI\n' +
+ 'hvcNAQELBQADggEBAFGaNiYxg7yC/xauXPlaqLCtwbm2dKyK9nIFbF/7be8mk7Q3\n' +
+ 'MOA0of1vGHPLVQLr6bJJpD9MAbUcm4cPAwWaxwcNpxOjYOFDaq10PCK4eRAxZWwF\n' +
+ 'NJRIRmGsl8NEsMNTMCy8X+Kyw5EzH4vWFl5Uf2bGKOeFg0zt43jWQVOX6C+aL3Cd\n' +
+ 'pRS5MhmYpxMG8irrNOxf4NVFE2zpJOCm3bn0STLhkDcV/ww4zMzObTJhiIb5wSWn\n' +
+ 'EXKKWhUXuRt7A2y1KJtXpTbSRHQxE++69Go1tWhXtRiULCJtf7wF2Ksm0RR/AdXT\n' +
+ '1uR1vKyH5KBJPX3ppYkQDukoHTFR0CpB+G84NLo=\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIECTCCAvGgAwIBAgICEAAwDQYJKoZIhvcNAQELBQAwgZUxCzAJBgNVBAYTAlVT\n' +
+ 'MRAwDgYDVQQHDAdTZWF0dGxlMRMwEQYDVQQIDApXYXNoaW5ndG9uMSIwIAYDVQQK\n' +
+ 'DBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMuMRMwEQYDVQQLDApBbWF6b24gUkRT\n' +
+ 'MSYwJAYDVQQDDB1BbWF6b24gUkRTIG1lLXNvdXRoLTEgUm9vdCBDQTAeFw0xOTA1\n' +
+ 'MTAyMTU4NDNaFw0yNTA2MDExMjAwMDBaMIGQMQswCQYDVQQGEwJVUzETMBEGA1UE\n' +
+ 'CAwKV2FzaGluZ3RvbjEQMA4GA1UEBwwHU2VhdHRsZTEiMCAGA1UECgwZQW1hem9u\n' +
+ 'IFdlYiBTZXJ2aWNlcywgSW5jLjETMBEGA1UECwwKQW1hem9uIFJEUzEhMB8GA1UE\n' +
+ 'AwwYQW1hem9uIFJEUyBtZS1zb3V0aC0xIENBMIIBIjANBgkqhkiG9w0BAQEFAAOC\n' +
+ 'AQ8AMIIBCgKCAQEAudOYPZH+ihJAo6hNYMB5izPVBe3TYhnZm8+X3IoaaYiKtsp1\n' +
+ 'JJhkTT0CEejYIQ58Fh4QrMUyWvU8qsdK3diNyQRoYLbctsBPgxBR1u07eUJDv38/\n' +
+ 'C1JlqgHmMnMi4y68Iy7ymv50QgAMuaBqgEBRI1R6Lfbyrb2YvH5txjJyTVMwuCfd\n' +
+ 'YPAtZVouRz0JxmnfsHyxjE+So56uOKTDuw++Ho4HhZ7Qveej7XB8b+PIPuroknd3\n' +
+ 'FQB5RVbXRvt5ZcVD4F2fbEdBniF7FAF4dEiofVCQGQ2nynT7dZdEIPfPdH3n7ZmE\n' +
+ 'lAOmwHQ6G83OsiHRBLnbp+QZRgOsjkHJxT20bQIDAQABo2YwZDAOBgNVHQ8BAf8E\n' +
+ 'BAMCAQYwEgYDVR0TAQH/BAgwBgEB/wIBADAdBgNVHQ4EFgQUOEVDM7VomRH4HVdA\n' +
+ 'QvIMNq2tXOcwHwYDVR0jBBgwFoAU54cfDjgwBx4ycBH8+/r8WXdaiqYwDQYJKoZI\n' +
+ 'hvcNAQELBQADggEBAHhvMssj+Th8IpNePU6RH0BiL6o9c437R3Q4IEJeFdYL+nZz\n' +
+ 'PW/rELDPvLRUNMfKM+KzduLZ+l29HahxefejYPXtvXBlq/E/9czFDD4fWXg+zVou\n' +
+ 'uDXhyrV4kNmP4S0eqsAP/jQHPOZAMFA4yVwO9hlqmePhyDnszCh9c1PfJSBh49+b\n' +
+ '4w7i/L3VBOMt8j3EKYvqz0gVfpeqhJwL4Hey8UbVfJRFJMJzfNHpePqtDRAY7yjV\n' +
+ 'PYquRaV2ab/E+/7VFkWMM4tazYz/qsYA2jSH+4xDHvYk8LnsbcrF9iuidQmEc5sb\n' +
+ 'FgcWaSKG4DJjcI5k7AJLWcXyTDt21Ci43LE+I9Q=\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIECDCCAvCgAwIBAgICVIYwDQYJKoZIhvcNAQELBQAwgY8xCzAJBgNVBAYTAlVT\n' +
+ 'MRAwDgYDVQQHDAdTZWF0dGxlMRMwEQYDVQQIDApXYXNoaW5ndG9uMSIwIAYDVQQK\n' +
+ 'DBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMuMRMwEQYDVQQLDApBbWF6b24gUkRT\n' +
+ 'MSAwHgYDVQQDDBdBbWF6b24gUkRTIFJvb3QgMjAxOSBDQTAeFw0xOTA5MDQxNzEz\n' +
+ 'MDRaFw0yNDA4MjIxNzA4NTBaMIGVMQswCQYDVQQGEwJVUzETMBEGA1UECAwKV2Fz\n' +
+ 'aGluZ3RvbjEQMA4GA1UEBwwHU2VhdHRsZTEiMCAGA1UECgwZQW1hem9uIFdlYiBT\n' +
+ 'ZXJ2aWNlcywgSW5jLjETMBEGA1UECwwKQW1hem9uIFJEUzEmMCQGA1UEAwwdQW1h\n' +
+ 'em9uIFJEUyBhcC1zb3V0aC0xIDIwMTkgQ0EwggEiMA0GCSqGSIb3DQEBAQUAA4IB\n' +
+ 'DwAwggEKAoIBAQDUYOz1hGL42yUCrcsMSOoU8AeD/3KgZ4q7gP+vAz1WnY9K/kim\n' +
+ 'eWN/2Qqzlo3+mxSFQFyD4MyV3+CnCPnBl9Sh1G/F6kThNiJ7dEWSWBQGAB6HMDbC\n' +
+ 'BaAsmUc1UIz8sLTL3fO+S9wYhA63Wun0Fbm/Rn2yk/4WnJAaMZcEtYf6e0KNa0LM\n' +
+ 'p/kN/70/8cD3iz3dDR8zOZFpHoCtf0ek80QqTich0A9n3JLxR6g6tpwoYviVg89e\n' +
+ 'qCjQ4axxOkWWeusLeTJCcY6CkVyFvDAKvcUl1ytM5AiaUkXblE7zDFXRM4qMMRdt\n' +
+ 'lPm8d3pFxh0fRYk8bIKnpmtOpz3RIctDrZZxAgMBAAGjZjBkMA4GA1UdDwEB/wQE\n' +
+ 'AwIBBjASBgNVHRMBAf8ECDAGAQH/AgEAMB0GA1UdDgQWBBT99wKJftD3jb4sHoHG\n' +
+ 'i3uGlH6W6TAfBgNVHSMEGDAWgBRzX2DYvMsDmPQrFzQuNlqmYP+8HzANBgkqhkiG\n' +
+ '9w0BAQsFAAOCAQEAZ17hhr3dII3hUfuHQ1hPWGrpJOX/G9dLzkprEIcCidkmRYl+\n' +
+ 'hu1Pe3caRMh/17+qsoEErmnVq5jNY9X1GZL04IZH8YbHc7iRHw3HcWAdhN8633+K\n' +
+ 'jYEB2LbJ3vluCGnCejq9djDb6alOugdLMJzxOkHDhMZ6/gYbECOot+ph1tQuZXzD\n' +
+ 'tZ7prRsrcuPBChHlPjmGy8M9z8u+kF196iNSUGC4lM8vLkHM7ycc1/ZOwRq9aaTe\n' +
+ 'iOghbQQyAEe03MWCyDGtSmDfr0qEk+CHN+6hPiaL8qKt4s+V9P7DeK4iW08ny8Ox\n' +
+ 'AVS7u0OK/5+jKMAMrKwpYrBydOjTUTHScocyNw==\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIEBzCCAu+gAwIBAgICQ2QwDQYJKoZIhvcNAQELBQAwgY8xCzAJBgNVBAYTAlVT\n' +
+ 'MRAwDgYDVQQHDAdTZWF0dGxlMRMwEQYDVQQIDApXYXNoaW5ndG9uMSIwIAYDVQQK\n' +
+ 'DBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMuMRMwEQYDVQQLDApBbWF6b24gUkRT\n' +
+ 'MSAwHgYDVQQDDBdBbWF6b24gUkRTIFJvb3QgMjAxOSBDQTAeFw0xOTA5MDUxODQ2\n' +
+ 'MjlaFw0yNDA4MjIxNzA4NTBaMIGUMQswCQYDVQQGEwJVUzETMBEGA1UECAwKV2Fz\n' +
+ 'aGluZ3RvbjEQMA4GA1UEBwwHU2VhdHRsZTEiMCAGA1UECgwZQW1hem9uIFdlYiBT\n' +
+ 'ZXJ2aWNlcywgSW5jLjETMBEGA1UECwwKQW1hem9uIFJEUzElMCMGA1UEAwwcQW1h\n' +
+ 'em9uIFJEUyBzYS1lYXN0LTEgMjAxOSBDQTCCASIwDQYJKoZIhvcNAQEBBQADggEP\n' +
+ 'ADCCAQoCggEBAMMvR+ReRnOzqJzoaPipNTt1Z2VA968jlN1+SYKUrYM3No+Vpz0H\n' +
+ 'M6Tn0oYB66ByVsXiGc28ulsqX1HbHsxqDPwvQTKvO7SrmDokoAkjJgLocOLUAeld\n' +
+ '5AwvUjxGRP6yY90NV7X786MpnYb2Il9DIIaV9HjCmPt+rjy2CZjS0UjPjCKNfB8J\n' +
+ 'bFjgW6GGscjeyGb/zFwcom5p4j0rLydbNaOr9wOyQrtt3ZQWLYGY9Zees/b8pmcc\n' +
+ 'Jt+7jstZ2UMV32OO/kIsJ4rMUn2r/uxccPwAc1IDeRSSxOrnFKhW3Cu69iB3bHp7\n' +
+ 'JbawY12g7zshE4I14sHjv3QoXASoXjx4xgMCAwEAAaNmMGQwDgYDVR0PAQH/BAQD\n' +
+ 'AgEGMBIGA1UdEwEB/wQIMAYBAf8CAQAwHQYDVR0OBBYEFI1Fc/Ql2jx+oJPgBVYq\n' +
+ 'ccgP0pQ8MB8GA1UdIwQYMBaAFHNfYNi8ywOY9CsXNC42WqZg/7wfMA0GCSqGSIb3\n' +
+ 'DQEBCwUAA4IBAQB4VVVabVp70myuYuZ3vltQIWqSUMhkaTzehMgGcHjMf9iLoZ/I\n' +
+ '93KiFUSGnek5cRePyS9wcpp0fcBT3FvkjpUdCjVtdttJgZFhBxgTd8y26ImdDDMR\n' +
+ '4+BUuhI5msvjL08f+Vkkpu1GQcGmyFVPFOy/UY8iefu+QyUuiBUnUuEDd49Hw0Fn\n' +
+ '/kIPII6Vj82a2mWV/Q8e+rgN8dIRksRjKI03DEoP8lhPlsOkhdwU6Uz9Vu6NOB2Q\n' +
+ 'Ls1kbcxAc7cFSyRVJEhh12Sz9d0q/CQSTFsVJKOjSNQBQfVnLz1GwO/IieUEAr4C\n' +
+ 'jkTntH0r1LX5b/GwN4R887LvjAEdTbg1his7\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIECDCCAvCgAwIBAgIDAIkHMA0GCSqGSIb3DQEBCwUAMIGPMQswCQYDVQQGEwJV\n' +
+ 'UzEQMA4GA1UEBwwHU2VhdHRsZTETMBEGA1UECAwKV2FzaGluZ3RvbjEiMCAGA1UE\n' +
+ 'CgwZQW1hem9uIFdlYiBTZXJ2aWNlcywgSW5jLjETMBEGA1UECwwKQW1hem9uIFJE\n' +
+ 'UzEgMB4GA1UEAwwXQW1hem9uIFJEUyBSb290IDIwMTkgQ0EwHhcNMTkwOTA2MTc0\n' +
+ 'MDIxWhcNMjQwODIyMTcwODUwWjCBlDELMAkGA1UEBhMCVVMxEzARBgNVBAgMCldh\n' +
+ 'c2hpbmd0b24xEDAOBgNVBAcMB1NlYXR0bGUxIjAgBgNVBAoMGUFtYXpvbiBXZWIg\n' +
+ 'U2VydmljZXMsIEluYy4xEzARBgNVBAsMCkFtYXpvbiBSRFMxJTAjBgNVBAMMHEFt\n' +
+ 'YXpvbiBSRFMgdXMtd2VzdC0xIDIwMTkgQ0EwggEiMA0GCSqGSIb3DQEBAQUAA4IB\n' +
+ 'DwAwggEKAoIBAQDD2yzbbAl77OofTghDMEf624OvU0eS9O+lsdO0QlbfUfWa1Kd6\n' +
+ '0WkgjkLZGfSRxEHMCnrv4UPBSK/Qwn6FTjkDLgemhqBtAnplN4VsoDL+BkRX4Wwq\n' +
+ '/dSQJE2b+0hm9w9UMVGFDEq1TMotGGTD2B71eh9HEKzKhGzqiNeGsiX4VV+LJzdH\n' +
+ 'uM23eGisNqmd4iJV0zcAZ+Gbh2zK6fqTOCvXtm7Idccv8vZZnyk1FiWl3NR4WAgK\n' +
+ 'AkvWTIoFU3Mt7dIXKKClVmvssG8WHCkd3Xcb4FHy/G756UZcq67gMMTX/9fOFM/v\n' +
+ 'l5C0+CHl33Yig1vIDZd+fXV1KZD84dEJfEvHAgMBAAGjZjBkMA4GA1UdDwEB/wQE\n' +
+ 'AwIBBjASBgNVHRMBAf8ECDAGAQH/AgEAMB0GA1UdDgQWBBR+ap20kO/6A7pPxo3+\n' +
+ 'T3CfqZpQWjAfBgNVHSMEGDAWgBRzX2DYvMsDmPQrFzQuNlqmYP+8HzANBgkqhkiG\n' +
+ '9w0BAQsFAAOCAQEAHCJky2tPjPttlDM/RIqExupBkNrnSYnOK4kr9xJ3sl8UF2DA\n' +
+ 'PAnYsjXp3rfcjN/k/FVOhxwzi3cXJF/2Tjj39Bm/OEfYTOJDNYtBwB0VVH4ffa/6\n' +
+ 'tZl87jaIkrxJcreeeHqYMnIxeN0b/kliyA+a5L2Yb0VPjt9INq34QDc1v74FNZ17\n' +
+ '4z8nr1nzg4xsOWu0Dbjo966lm4nOYIGBRGOKEkHZRZ4mEiMgr3YLkv8gSmeitx57\n' +
+ 'Z6dVemNtUic/LVo5Iqw4n3TBS0iF2C1Q1xT/s3h+0SXZlfOWttzSluDvoMv5PvCd\n' +
+ 'pFjNn+aXLAALoihL1MJSsxydtsLjOBro5eK0Vw==\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIEDDCCAvSgAwIBAgICOFAwDQYJKoZIhvcNAQELBQAwgY8xCzAJBgNVBAYTAlVT\n' +
+ 'MRAwDgYDVQQHDAdTZWF0dGxlMRMwEQYDVQQIDApXYXNoaW5ndG9uMSIwIAYDVQQK\n' +
+ 'DBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMuMRMwEQYDVQQLDApBbWF6b24gUkRT\n' +
+ 'MSAwHgYDVQQDDBdBbWF6b24gUkRTIFJvb3QgMjAxOSBDQTAeFw0xOTA5MTAxNzQ2\n' +
+ 'MjFaFw0yNDA4MjIxNzA4NTBaMIGZMQswCQYDVQQGEwJVUzETMBEGA1UECAwKV2Fz\n' +
+ 'aGluZ3RvbjEQMA4GA1UEBwwHU2VhdHRsZTEiMCAGA1UECgwZQW1hem9uIFdlYiBT\n' +
+ 'ZXJ2aWNlcywgSW5jLjETMBEGA1UECwwKQW1hem9uIFJEUzEqMCgGA1UEAwwhQW1h\n' +
+ 'em9uIFJEUyBhcC1ub3J0aGVhc3QtMiAyMDE5IENBMIIBIjANBgkqhkiG9w0BAQEF\n' +
+ 'AAOCAQ8AMIIBCgKCAQEAzU72e6XbaJbi4HjJoRNjKxzUEuChKQIt7k3CWzNnmjc5\n' +
+ '8I1MjCpa2W1iw1BYVysXSNSsLOtUsfvBZxi/1uyMn5ZCaf9aeoA9UsSkFSZBjOCN\n' +
+ 'DpKPCmfV1zcEOvJz26+1m8WDg+8Oa60QV0ou2AU1tYcw98fOQjcAES0JXXB80P2s\n' +
+ '3UfkNcnDz+l4k7j4SllhFPhH6BQ4lD2NiFAP4HwoG6FeJUn45EPjzrydxjq6v5Fc\n' +
+ 'cQ8rGuHADVXotDbEhaYhNjIrsPL+puhjWfhJjheEw8c4whRZNp6gJ/b6WEes/ZhZ\n' +
+ 'h32DwsDsZw0BfRDUMgUn8TdecNexHUw8vQWeC181hwIDAQABo2YwZDAOBgNVHQ8B\n' +
+ 'Af8EBAMCAQYwEgYDVR0TAQH/BAgwBgEB/wIBADAdBgNVHQ4EFgQUwW9bWgkWkr0U\n' +
+ 'lrOsq2kvIdrECDgwHwYDVR0jBBgwFoAUc19g2LzLA5j0Kxc0LjZapmD/vB8wDQYJ\n' +
+ 'KoZIhvcNAQELBQADggEBAEugF0Gj7HVhX0ehPZoGRYRt3PBuI2YjfrrJRTZ9X5wc\n' +
+ '9T8oHmw07mHmNy1qqWvooNJg09bDGfB0k5goC2emDiIiGfc/kvMLI7u+eQOoMKj6\n' +
+ 'mkfCncyRN3ty08Po45vTLBFZGUvtQmjM6yKewc4sXiASSBmQUpsMbiHRCL72M5qV\n' +
+ 'obcJOjGcIdDTmV1BHdWT+XcjynsGjUqOvQWWhhLPrn4jWe6Xuxll75qlrpn3IrIx\n' +
+ 'CRBv/5r7qbcQJPOgwQsyK4kv9Ly8g7YT1/vYBlR3cRsYQjccw5ceWUj2DrMVWhJ4\n' +
+ 'prf+E3Aa4vYmLLOUUvKnDQ1k3RGNu56V0tonsQbfsaM=\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIECjCCAvKgAwIBAgICEzUwDQYJKoZIhvcNAQELBQAwgY8xCzAJBgNVBAYTAlVT\n' +
+ 'MRAwDgYDVQQHDAdTZWF0dGxlMRMwEQYDVQQIDApXYXNoaW5ndG9uMSIwIAYDVQQK\n' +
+ 'DBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMuMRMwEQYDVQQLDApBbWF6b24gUkRT\n' +
+ 'MSAwHgYDVQQDDBdBbWF6b24gUkRTIFJvb3QgMjAxOSBDQTAeFw0xOTA5MTAyMDUy\n' +
+ 'MjVaFw0yNDA4MjIxNzA4NTBaMIGXMQswCQYDVQQGEwJVUzETMBEGA1UECAwKV2Fz\n' +
+ 'aGluZ3RvbjEQMA4GA1UEBwwHU2VhdHRsZTEiMCAGA1UECgwZQW1hem9uIFdlYiBT\n' +
+ 'ZXJ2aWNlcywgSW5jLjETMBEGA1UECwwKQW1hem9uIFJEUzEoMCYGA1UEAwwfQW1h\n' +
+ 'em9uIFJEUyBjYS1jZW50cmFsLTEgMjAxOSBDQTCCASIwDQYJKoZIhvcNAQEBBQAD\n' +
+ 'ggEPADCCAQoCggEBAOxHqdcPSA2uBjsCP4DLSlqSoPuQ/X1kkJLusVRKiQE2zayB\n' +
+ 'viuCBt4VB9Qsh2rW3iYGM+usDjltGnI1iUWA5KHcvHszSMkWAOYWLiMNKTlg6LCp\n' +
+ 'XnE89tvj5dIH6U8WlDvXLdjB/h30gW9JEX7S8supsBSci2GxEzb5mRdKaDuuF/0O\n' +
+ 'qvz4YE04pua3iZ9QwmMFuTAOYzD1M72aOpj+7Ac+YLMM61qOtU+AU6MndnQkKoQi\n' +
+ 'qmUN2A9IFaqHFzRlSdXwKCKUA4otzmz+/N3vFwjb5F4DSsbsrMfjeHMo6o/nb6Nh\n' +
+ 'YDb0VJxxPee6TxSuN7CQJ2FxMlFUezcoXqwqXD0CAwEAAaNmMGQwDgYDVR0PAQH/\n' +
+ 'BAQDAgEGMBIGA1UdEwEB/wQIMAYBAf8CAQAwHQYDVR0OBBYEFDGGpon9WfIpsggE\n' +
+ 'CxHq8hZ7E2ESMB8GA1UdIwQYMBaAFHNfYNi8ywOY9CsXNC42WqZg/7wfMA0GCSqG\n' +
+ 'SIb3DQEBCwUAA4IBAQAvpeQYEGZvoTVLgV9rd2+StPYykMsmFjWQcyn3dBTZRXC2\n' +
+ 'lKq7QhQczMAOhEaaN29ZprjQzsA2X/UauKzLR2Uyqc2qOeO9/YOl0H3qauo8C/W9\n' +
+ 'r8xqPbOCDLEXlOQ19fidXyyEPHEq5WFp8j+fTh+s8WOx2M7IuC0ANEetIZURYhSp\n' +
+ 'xl9XOPRCJxOhj7JdelhpweX0BJDNHeUFi0ClnFOws8oKQ7sQEv66d5ddxqqZ3NVv\n' +
+ 'RbCvCtEutQMOUMIuaygDlMn1anSM8N7Wndx8G6+Uy67AnhjGx7jw/0YPPxopEj6x\n' +
+ 'JXP8j0sJbcT9K/9/fPVLNT25RvQ/93T2+IQL4Ca2\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIEBzCCAu+gAwIBAgICYpgwDQYJKoZIhvcNAQELBQAwgY8xCzAJBgNVBAYTAlVT\n' +
+ 'MRAwDgYDVQQHDAdTZWF0dGxlMRMwEQYDVQQIDApXYXNoaW5ndG9uMSIwIAYDVQQK\n' +
+ 'DBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMuMRMwEQYDVQQLDApBbWF6b24gUkRT\n' +
+ 'MSAwHgYDVQQDDBdBbWF6b24gUkRTIFJvb3QgMjAxOSBDQTAeFw0xOTA5MTExNzMx\n' +
+ 'NDhaFw0yNDA4MjIxNzA4NTBaMIGUMQswCQYDVQQGEwJVUzETMBEGA1UECAwKV2Fz\n' +
+ 'aGluZ3RvbjEQMA4GA1UEBwwHU2VhdHRsZTEiMCAGA1UECgwZQW1hem9uIFdlYiBT\n' +
+ 'ZXJ2aWNlcywgSW5jLjETMBEGA1UECwwKQW1hem9uIFJEUzElMCMGA1UEAwwcQW1h\n' +
+ 'em9uIFJEUyBldS13ZXN0LTEgMjAxOSBDQTCCASIwDQYJKoZIhvcNAQEBBQADggEP\n' +
+ 'ADCCAQoCggEBAMk3YdSZ64iAYp6MyyKtYJtNzv7zFSnnNf6vv0FB4VnfITTMmOyZ\n' +
+ 'LXqKAT2ahZ00hXi34ewqJElgU6eUZT/QlzdIu359TEZyLVPwURflL6SWgdG01Q5X\n' +
+ 'O++7fSGcBRyIeuQWs9FJNIIqK8daF6qw0Rl5TXfu7P9dBc3zkgDXZm2DHmxGDD69\n' +
+ '7liQUiXzoE1q2Z9cA8+jirDioJxN9av8hQt12pskLQumhlArsMIhjhHRgF03HOh5\n' +
+ 'tvi+RCfihVOxELyIRTRpTNiIwAqfZxxTWFTgfn+gijTmd0/1DseAe82aYic8JbuS\n' +
+ 'EMbrDduAWsqrnJ4GPzxHKLXX0JasCUcWyMECAwEAAaNmMGQwDgYDVR0PAQH/BAQD\n' +
+ 'AgEGMBIGA1UdEwEB/wQIMAYBAf8CAQAwHQYDVR0OBBYEFPLtsq1NrwJXO13C9eHt\n' +
+ 'sLY11AGwMB8GA1UdIwQYMBaAFHNfYNi8ywOY9CsXNC42WqZg/7wfMA0GCSqGSIb3\n' +
+ 'DQEBCwUAA4IBAQAnWBKj5xV1A1mYd0kIgDdkjCwQkiKF5bjIbGkT3YEFFbXoJlSP\n' +
+ '0lZZ/hDaOHI8wbLT44SzOvPEEmWF9EE7SJzkvSdQrUAWR9FwDLaU427ALI3ngNHy\n' +
+ 'lGJ2hse1fvSRNbmg8Sc9GBv8oqNIBPVuw+AJzHTacZ1OkyLZrz1c1QvwvwN2a+Jd\n' +
+ 'vH0V0YIhv66llKcYDMUQJAQi4+8nbRxXWv6Gq3pvrFoorzsnkr42V3JpbhnYiK+9\n' +
+ 'nRKd4uWl62KRZjGkfMbmsqZpj2fdSWMY1UGyN1k+kDmCSWYdrTRDP0xjtIocwg+A\n' +
+ 'J116n4hV/5mbA0BaPiS2krtv17YAeHABZcvz\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIECjCCAvKgAwIBAgICV2YwDQYJKoZIhvcNAQELBQAwgY8xCzAJBgNVBAYTAlVT\n' +
+ 'MRAwDgYDVQQHDAdTZWF0dGxlMRMwEQYDVQQIDApXYXNoaW5ndG9uMSIwIAYDVQQK\n' +
+ 'DBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMuMRMwEQYDVQQLDApBbWF6b24gUkRT\n' +
+ 'MSAwHgYDVQQDDBdBbWF6b24gUkRTIFJvb3QgMjAxOSBDQTAeFw0xOTA5MTExOTM2\n' +
+ 'MjBaFw0yNDA4MjIxNzA4NTBaMIGXMQswCQYDVQQGEwJVUzETMBEGA1UECAwKV2Fz\n' +
+ 'aGluZ3RvbjEQMA4GA1UEBwwHU2VhdHRsZTEiMCAGA1UECgwZQW1hem9uIFdlYiBT\n' +
+ 'ZXJ2aWNlcywgSW5jLjETMBEGA1UECwwKQW1hem9uIFJEUzEoMCYGA1UEAwwfQW1h\n' +
+ 'em9uIFJEUyBldS1jZW50cmFsLTEgMjAxOSBDQTCCASIwDQYJKoZIhvcNAQEBBQAD\n' +
+ 'ggEPADCCAQoCggEBAMEx54X2pHVv86APA0RWqxxRNmdkhAyp2R1cFWumKQRofoFv\n' +
+ 'n+SPXdkpIINpMuEIGJANozdiEz7SPsrAf8WHyD93j/ZxrdQftRcIGH41xasetKGl\n' +
+ 'I67uans8d+pgJgBKGb/Z+B5m+UsIuEVekpvgpwKtmmaLFC/NCGuSsJoFsRqoa6Gh\n' +
+ 'm34W6yJoY87UatddCqLY4IIXaBFsgK9Q/wYzYLbnWM6ZZvhJ52VMtdhcdzeTHNW0\n' +
+ '5LGuXJOF7Ahb4JkEhoo6TS2c0NxB4l4MBfBPgti+O7WjR3FfZHpt18A6Zkq6A2u6\n' +
+ 'D/oTSL6c9/3sAaFTFgMyL3wHb2YlW0BPiljZIqECAwEAAaNmMGQwDgYDVR0PAQH/\n' +
+ 'BAQDAgEGMBIGA1UdEwEB/wQIMAYBAf8CAQAwHQYDVR0OBBYEFOcAToAc6skWffJa\n' +
+ 'TnreaswAfrbcMB8GA1UdIwQYMBaAFHNfYNi8ywOY9CsXNC42WqZg/7wfMA0GCSqG\n' +
+ 'SIb3DQEBCwUAA4IBAQA1d0Whc1QtspK496mFWfFEQNegLh0a9GWYlJm+Htcj5Nxt\n' +
+ 'DAIGXb+8xrtOZFHmYP7VLCT5Zd2C+XytqseK/+s07iAr0/EPF+O2qcyQWMN5KhgE\n' +
+ 'cXw2SwuP9FPV3i+YAm11PBVeenrmzuk9NrdHQ7TxU4v7VGhcsd2C++0EisrmquWH\n' +
+ 'mgIfmVDGxphwoES52cY6t3fbnXmTkvENvR+h3rj+fUiSz0aSo+XZUGHPgvuEKM/W\n' +
+ 'CBD9Smc9CBoBgvy7BgHRgRUmwtABZHFUIEjHI5rIr7ZvYn+6A0O6sogRfvVYtWFc\n' +
+ 'qpyrW1YX8mD0VlJ8fGKM3G+aCOsiiPKDV/Uafrm+\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIECDCCAvCgAwIBAgICGAcwDQYJKoZIhvcNAQELBQAwgY8xCzAJBgNVBAYTAlVT\n' +
+ 'MRAwDgYDVQQHDAdTZWF0dGxlMRMwEQYDVQQIDApXYXNoaW5ndG9uMSIwIAYDVQQK\n' +
+ 'DBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMuMRMwEQYDVQQLDApBbWF6b24gUkRT\n' +
+ 'MSAwHgYDVQQDDBdBbWF6b24gUkRTIFJvb3QgMjAxOSBDQTAeFw0xOTA5MTIxODE5\n' +
+ 'NDRaFw0yNDA4MjIxNzA4NTBaMIGVMQswCQYDVQQGEwJVUzETMBEGA1UECAwKV2Fz\n' +
+ 'aGluZ3RvbjEQMA4GA1UEBwwHU2VhdHRsZTEiMCAGA1UECgwZQW1hem9uIFdlYiBT\n' +
+ 'ZXJ2aWNlcywgSW5jLjETMBEGA1UECwwKQW1hem9uIFJEUzEmMCQGA1UEAwwdQW1h\n' +
+ 'em9uIFJEUyBldS1ub3J0aC0xIDIwMTkgQ0EwggEiMA0GCSqGSIb3DQEBAQUAA4IB\n' +
+ 'DwAwggEKAoIBAQCiIYnhe4UNBbdBb/nQxl5giM0XoVHWNrYV5nB0YukA98+TPn9v\n' +
+ 'Aoj1RGYmtryjhrf01Kuv8SWO+Eom95L3zquoTFcE2gmxCfk7bp6qJJ3eHOJB+QUO\n' +
+ 'XsNRh76fwDzEF1yTeZWH49oeL2xO13EAx4PbZuZpZBttBM5zAxgZkqu4uWQczFEs\n' +
+ 'JXfla7z2fvWmGcTagX10O5C18XaFroV0ubvSyIi75ue9ykg/nlFAeB7O0Wxae88e\n' +
+ 'uhiBEFAuLYdqWnsg3459NfV8Yi1GnaitTym6VI3tHKIFiUvkSiy0DAlAGV2iiyJE\n' +
+ 'q+DsVEO4/hSINJEtII4TMtysOsYPpINqeEzRAgMBAAGjZjBkMA4GA1UdDwEB/wQE\n' +
+ 'AwIBBjASBgNVHRMBAf8ECDAGAQH/AgEAMB0GA1UdDgQWBBRR0UpnbQyjnHChgmOc\n' +
+ 'hnlc0PogzTAfBgNVHSMEGDAWgBRzX2DYvMsDmPQrFzQuNlqmYP+8HzANBgkqhkiG\n' +
+ '9w0BAQsFAAOCAQEAKJD4xVzSf4zSGTBJrmamo86jl1NHQxXUApAZuBZEc8tqC6TI\n' +
+ 'T5CeoSr9CMuVC8grYyBjXblC4OsM5NMvmsrXl/u5C9dEwtBFjo8mm53rOOIm1fxl\n' +
+ 'I1oYB/9mtO9ANWjkykuLzWeBlqDT/i7ckaKwalhLODsRDO73vRhYNjsIUGloNsKe\n' +
+ 'pxw3dzHwAZx4upSdEVG4RGCZ1D0LJ4Gw40OfD69hfkDfRVVxKGrbEzqxXRvovmDc\n' +
+ 'tKLdYZO/6REoca36v4BlgIs1CbUXJGLSXUwtg7YXGLSVBJ/U0+22iGJmBSNcoyUN\n' +
+ 'cjPFD9JQEhDDIYYKSGzIYpvslvGc4T5ISXFiuQ==\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIEBzCCAu+gAwIBAgICZIEwDQYJKoZIhvcNAQELBQAwgY8xCzAJBgNVBAYTAlVT\n' +
+ 'MRAwDgYDVQQHDAdTZWF0dGxlMRMwEQYDVQQIDApXYXNoaW5ndG9uMSIwIAYDVQQK\n' +
+ 'DBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMuMRMwEQYDVQQLDApBbWF6b24gUkRT\n' +
+ 'MSAwHgYDVQQDDBdBbWF6b24gUkRTIFJvb3QgMjAxOSBDQTAeFw0xOTA5MTIyMTMy\n' +
+ 'MzJaFw0yNDA4MjIxNzA4NTBaMIGUMQswCQYDVQQGEwJVUzETMBEGA1UECAwKV2Fz\n' +
+ 'aGluZ3RvbjEQMA4GA1UEBwwHU2VhdHRsZTEiMCAGA1UECgwZQW1hem9uIFdlYiBT\n' +
+ 'ZXJ2aWNlcywgSW5jLjETMBEGA1UECwwKQW1hem9uIFJEUzElMCMGA1UEAwwcQW1h\n' +
+ 'em9uIFJEUyBldS13ZXN0LTIgMjAxOSBDQTCCASIwDQYJKoZIhvcNAQEBBQADggEP\n' +
+ 'ADCCAQoCggEBALGiwqjiF7xIjT0Sx7zB3764K2T2a1DHnAxEOr+/EIftWKxWzT3u\n' +
+ 'PFwS2eEZcnKqSdRQ+vRzonLBeNLO4z8aLjQnNbkizZMBuXGm4BqRm1Kgq3nlLDQn\n' +
+ '7YqdijOq54SpShvR/8zsO4sgMDMmHIYAJJOJqBdaus2smRt0NobIKc0liy7759KB\n' +
+ '6kmQ47Gg+kfIwxrQA5zlvPLeQImxSoPi9LdbRoKvu7Iot7SOa+jGhVBh3VdqndJX\n' +
+ '7tm/saj4NE375csmMETFLAOXjat7zViMRwVorX4V6AzEg1vkzxXpA9N7qywWIT5Y\n' +
+ 'fYaq5M8i6vvLg0CzrH9fHORtnkdjdu1y+0MCAwEAAaNmMGQwDgYDVR0PAQH/BAQD\n' +
+ 'AgEGMBIGA1UdEwEB/wQIMAYBAf8CAQAwHQYDVR0OBBYEFFOhOx1yt3Z7mvGB9jBv\n' +
+ '2ymdZwiOMB8GA1UdIwQYMBaAFHNfYNi8ywOY9CsXNC42WqZg/7wfMA0GCSqGSIb3\n' +
+ 'DQEBCwUAA4IBAQBehqY36UGDvPVU9+vtaYGr38dBbp+LzkjZzHwKT1XJSSUc2wqM\n' +
+ 'hnCIQKilonrTIvP1vmkQi8qHPvDRtBZKqvz/AErW/ZwQdZzqYNFd+BmOXaeZWV0Q\n' +
+ 'oHtDzXmcwtP8aUQpxN0e1xkWb1E80qoy+0uuRqb/50b/R4Q5qqSfJhkn6z8nwB10\n' +
+ '7RjLtJPrK8igxdpr3tGUzfAOyiPrIDncY7UJaL84GFp7WWAkH0WG3H8Y8DRcRXOU\n' +
+ 'mqDxDLUP3rNuow3jnGxiUY+gGX5OqaZg4f4P6QzOSmeQYs6nLpH0PiN00+oS1BbD\n' +
+ 'bpWdZEttILPI+vAYkU4QuBKKDjJL6HbSd+cn\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIECDCCAvCgAwIBAgIDAIVCMA0GCSqGSIb3DQEBCwUAMIGPMQswCQYDVQQGEwJV\n' +
+ 'UzEQMA4GA1UEBwwHU2VhdHRsZTETMBEGA1UECAwKV2FzaGluZ3RvbjEiMCAGA1UE\n' +
+ 'CgwZQW1hem9uIFdlYiBTZXJ2aWNlcywgSW5jLjETMBEGA1UECwwKQW1hem9uIFJE\n' +
+ 'UzEgMB4GA1UEAwwXQW1hem9uIFJEUyBSb290IDIwMTkgQ0EwHhcNMTkwOTEzMTcw\n' +
+ 'NjQxWhcNMjQwODIyMTcwODUwWjCBlDELMAkGA1UEBhMCVVMxEzARBgNVBAgMCldh\n' +
+ 'c2hpbmd0b24xEDAOBgNVBAcMB1NlYXR0bGUxIjAgBgNVBAoMGUFtYXpvbiBXZWIg\n' +
+ 'U2VydmljZXMsIEluYy4xEzARBgNVBAsMCkFtYXpvbiBSRFMxJTAjBgNVBAMMHEFt\n' +
+ 'YXpvbiBSRFMgdXMtZWFzdC0yIDIwMTkgQ0EwggEiMA0GCSqGSIb3DQEBAQUAA4IB\n' +
+ 'DwAwggEKAoIBAQDE+T2xYjUbxOp+pv+gRA3FO24+1zCWgXTDF1DHrh1lsPg5k7ht\n' +
+ '2KPYzNc+Vg4E+jgPiW0BQnA6jStX5EqVh8BU60zELlxMNvpg4KumniMCZ3krtMUC\n' +
+ 'au1NF9rM7HBh+O+DYMBLK5eSIVt6lZosOb7bCi3V6wMLA8YqWSWqabkxwN4w0vXI\n' +
+ '8lu5uXXFRemHnlNf+yA/4YtN4uaAyd0ami9+klwdkZfkrDOaiy59haOeBGL8EB/c\n' +
+ 'dbJJlguHH5CpCscs3RKtOOjEonXnKXldxarFdkMzi+aIIjQ8GyUOSAXHtQHb3gZ4\n' +
+ 'nS6Ey0CMlwkB8vUObZU9fnjKJcL5QCQqOfwvAgMBAAGjZjBkMA4GA1UdDwEB/wQE\n' +
+ 'AwIBBjASBgNVHRMBAf8ECDAGAQH/AgEAMB0GA1UdDgQWBBQUPuRHohPxx4VjykmH\n' +
+ '6usGrLL1ETAfBgNVHSMEGDAWgBRzX2DYvMsDmPQrFzQuNlqmYP+8HzANBgkqhkiG\n' +
+ '9w0BAQsFAAOCAQEAUdR9Vb3y33Yj6X6KGtuthZ08SwjImVQPtknzpajNE5jOJAh8\n' +
+ 'quvQnU9nlnMO85fVDU1Dz3lLHGJ/YG1pt1Cqq2QQ200JcWCvBRgdvH6MjHoDQpqZ\n' +
+ 'HvQ3vLgOGqCLNQKFuet9BdpsHzsctKvCVaeBqbGpeCtt3Hh/26tgx0rorPLw90A2\n' +
+ 'V8QSkZJjlcKkLa58N5CMM8Xz8KLWg3MZeT4DmlUXVCukqK2RGuP2L+aME8dOxqNv\n' +
+ 'OnOz1zrL5mR2iJoDpk8+VE/eBDmJX40IJk6jBjWoxAO/RXq+vBozuF5YHN1ujE92\n' +
+ 'tO8HItgTp37XT8bJBAiAnt5mxw+NLSqtxk2QdQ==\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIEDDCCAvSgAwIBAgICY4kwDQYJKoZIhvcNAQELBQAwgY8xCzAJBgNVBAYTAlVT\n' +
+ 'MRAwDgYDVQQHDAdTZWF0dGxlMRMwEQYDVQQIDApXYXNoaW5ndG9uMSIwIAYDVQQK\n' +
+ 'DBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMuMRMwEQYDVQQLDApBbWF6b24gUkRT\n' +
+ 'MSAwHgYDVQQDDBdBbWF6b24gUkRTIFJvb3QgMjAxOSBDQTAeFw0xOTA5MTMyMDEx\n' +
+ 'NDJaFw0yNDA4MjIxNzA4NTBaMIGZMQswCQYDVQQGEwJVUzETMBEGA1UECAwKV2Fz\n' +
+ 'aGluZ3RvbjEQMA4GA1UEBwwHU2VhdHRsZTEiMCAGA1UECgwZQW1hem9uIFdlYiBT\n' +
+ 'ZXJ2aWNlcywgSW5jLjETMBEGA1UECwwKQW1hem9uIFJEUzEqMCgGA1UEAwwhQW1h\n' +
+ 'em9uIFJEUyBhcC1zb3V0aGVhc3QtMSAyMDE5IENBMIIBIjANBgkqhkiG9w0BAQEF\n' +
+ 'AAOCAQ8AMIIBCgKCAQEAr5u9OuLL/OF/fBNUX2kINJLzFl4DnmrhnLuSeSnBPgbb\n' +
+ 'qddjf5EFFJBfv7IYiIWEFPDbDG5hoBwgMup5bZDbas+ZTJTotnnxVJTQ6wlhTmns\n' +
+ 'eHECcg2pqGIKGrxZfbQhlj08/4nNAPvyYCTS0bEcmQ1emuDPyvJBYDDLDU6AbCB5\n' +
+ '6Z7YKFQPTiCBblvvNzchjLWF9IpkqiTsPHiEt21sAdABxj9ityStV3ja/W9BfgxH\n' +
+ 'wzABSTAQT6FbDwmQMo7dcFOPRX+hewQSic2Rn1XYjmNYzgEHisdUsH7eeXREAcTw\n' +
+ '61TRvaLH8AiOWBnTEJXPAe6wYfrcSd1pD0MXpoB62wIDAQABo2YwZDAOBgNVHQ8B\n' +
+ 'Af8EBAMCAQYwEgYDVR0TAQH/BAgwBgEB/wIBADAdBgNVHQ4EFgQUytwMiomQOgX5\n' +
+ 'Ichd+2lDWRUhkikwHwYDVR0jBBgwFoAUc19g2LzLA5j0Kxc0LjZapmD/vB8wDQYJ\n' +
+ 'KoZIhvcNAQELBQADggEBACf6lRDpfCD7BFRqiWM45hqIzffIaysmVfr+Jr+fBTjP\n' +
+ 'uYe/ba1omSrNGG23bOcT9LJ8hkQJ9d+FxUwYyICQNWOy6ejicm4z0C3VhphbTPqj\n' +
+ 'yjpt9nG56IAcV8BcRJh4o/2IfLNzC/dVuYJV8wj7XzwlvjysenwdrJCoLadkTr1h\n' +
+ 'eIdG6Le07sB9IxrGJL9e04afk37h7c8ESGSE4E+oS4JQEi3ATq8ne1B9DQ9SasXi\n' +
+ 'IRmhNAaISDzOPdyLXi9N9V9Lwe/DHcja7hgLGYx3UqfjhLhOKwp8HtoZORixAmOI\n' +
+ 'HfILgNmwyugAbuZoCazSKKBhQ0wgO0WZ66ZKTMG8Oho=\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIEBzCCAu+gAwIBAgICUYkwDQYJKoZIhvcNAQELBQAwgY8xCzAJBgNVBAYTAlVT\n' +
+ 'MRAwDgYDVQQHDAdTZWF0dGxlMRMwEQYDVQQIDApXYXNoaW5ndG9uMSIwIAYDVQQK\n' +
+ 'DBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMuMRMwEQYDVQQLDApBbWF6b24gUkRT\n' +
+ 'MSAwHgYDVQQDDBdBbWF6b24gUkRTIFJvb3QgMjAxOSBDQTAeFw0xOTA5MTYxODIx\n' +
+ 'MTVaFw0yNDA4MjIxNzA4NTBaMIGUMQswCQYDVQQGEwJVUzETMBEGA1UECAwKV2Fz\n' +
+ 'aGluZ3RvbjEQMA4GA1UEBwwHU2VhdHRsZTEiMCAGA1UECgwZQW1hem9uIFdlYiBT\n' +
+ 'ZXJ2aWNlcywgSW5jLjETMBEGA1UECwwKQW1hem9uIFJEUzElMCMGA1UEAwwcQW1h\n' +
+ 'em9uIFJEUyB1cy13ZXN0LTIgMjAxOSBDQTCCASIwDQYJKoZIhvcNAQEBBQADggEP\n' +
+ 'ADCCAQoCggEBANCEZBZyu6yJQFZBJmSUZfSZd3Ui2gitczMKC4FLr0QzkbxY+cLa\n' +
+ 'uVONIOrPt4Rwi+3h/UdnUg917xao3S53XDf1TDMFEYp4U8EFPXqCn/GXBIWlU86P\n' +
+ 'PvBN+gzw3nS+aco7WXb+woTouvFVkk8FGU7J532llW8o/9ydQyDIMtdIkKTuMfho\n' +
+ 'OiNHSaNc+QXQ32TgvM9A/6q7ksUoNXGCP8hDOkSZ/YOLiI5TcdLh/aWj00ziL5bj\n' +
+ 'pvytiMZkilnc9dLY9QhRNr0vGqL0xjmWdoEXz9/OwjmCihHqJq+20MJPsvFm7D6a\n' +
+ '2NKybR9U+ddrjb8/iyLOjURUZnj5O+2+OPcCAwEAAaNmMGQwDgYDVR0PAQH/BAQD\n' +
+ 'AgEGMBIGA1UdEwEB/wQIMAYBAf8CAQAwHQYDVR0OBBYEFEBxMBdv81xuzqcK5TVu\n' +
+ 'pHj+Aor8MB8GA1UdIwQYMBaAFHNfYNi8ywOY9CsXNC42WqZg/7wfMA0GCSqGSIb3\n' +
+ 'DQEBCwUAA4IBAQBZkfiVqGoJjBI37aTlLOSjLcjI75L5wBrwO39q+B4cwcmpj58P\n' +
+ '3sivv+jhYfAGEbQnGRzjuFoyPzWnZ1DesRExX+wrmHsLLQbF2kVjLZhEJMHF9eB7\n' +
+ 'GZlTPdTzHErcnuXkwA/OqyXMpj9aghcQFuhCNguEfnROY9sAoK2PTfnTz9NJHL+Q\n' +
+ 'UpDLEJEUfc0GZMVWYhahc0x38ZnSY2SKacIPECQrTI0KpqZv/P+ijCEcMD9xmYEb\n' +
+ 'jL4en+XKS1uJpw5fIU5Sj0MxhdGstH6S84iAE5J3GM3XHklGSFwwqPYvuTXvANH6\n' +
+ 'uboynxRgSae59jIlAK6Jrr6GWMwQRbgcaAlW\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIEDDCCAvSgAwIBAgICEkYwDQYJKoZIhvcNAQELBQAwgY8xCzAJBgNVBAYTAlVT\n' +
+ 'MRAwDgYDVQQHDAdTZWF0dGxlMRMwEQYDVQQIDApXYXNoaW5ndG9uMSIwIAYDVQQK\n' +
+ 'DBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMuMRMwEQYDVQQLDApBbWF6b24gUkRT\n' +
+ 'MSAwHgYDVQQDDBdBbWF6b24gUkRTIFJvb3QgMjAxOSBDQTAeFw0xOTA5MTYxOTUz\n' +
+ 'NDdaFw0yNDA4MjIxNzA4NTBaMIGZMQswCQYDVQQGEwJVUzETMBEGA1UECAwKV2Fz\n' +
+ 'aGluZ3RvbjEQMA4GA1UEBwwHU2VhdHRsZTEiMCAGA1UECgwZQW1hem9uIFdlYiBT\n' +
+ 'ZXJ2aWNlcywgSW5jLjETMBEGA1UECwwKQW1hem9uIFJEUzEqMCgGA1UEAwwhQW1h\n' +
+ 'em9uIFJEUyBhcC1zb3V0aGVhc3QtMiAyMDE5IENBMIIBIjANBgkqhkiG9w0BAQEF\n' +
+ 'AAOCAQ8AMIIBCgKCAQEAufodI2Flker8q7PXZG0P0vmFSlhQDw907A6eJuF/WeMo\n' +
+ 'GHnll3b4S6nC3oRS3nGeRMHbyU2KKXDwXNb3Mheu+ox+n5eb/BJ17eoj9HbQR1cd\n' +
+ 'gEkIciiAltf8gpMMQH4anP7TD+HNFlZnP7ii3geEJB2GGXSxgSWvUzH4etL67Zmn\n' +
+ 'TpGDWQMB0T8lK2ziLCMF4XAC/8xDELN/buHCNuhDpxpPebhct0T+f6Arzsiswt2j\n' +
+ '7OeNeLLZwIZvVwAKF7zUFjC6m7/VmTQC8nidVY559D6l0UhhU0Co/txgq3HVsMOH\n' +
+ 'PbxmQUwJEKAzQXoIi+4uZzHFZrvov/nDTNJUhC6DqwIDAQABo2YwZDAOBgNVHQ8B\n' +
+ 'Af8EBAMCAQYwEgYDVR0TAQH/BAgwBgEB/wIBADAdBgNVHQ4EFgQUwaZpaCme+EiV\n' +
+ 'M5gcjeHZSTgOn4owHwYDVR0jBBgwFoAUc19g2LzLA5j0Kxc0LjZapmD/vB8wDQYJ\n' +
+ 'KoZIhvcNAQELBQADggEBAAR6a2meCZuXO2TF9bGqKGtZmaah4pH2ETcEVUjkvXVz\n' +
+ 'sl+ZKbYjrun+VkcMGGKLUjS812e7eDF726ptoku9/PZZIxlJB0isC/0OyixI8N4M\n' +
+ 'NsEyvp52XN9QundTjkl362bomPnHAApeU0mRbMDRR2JdT70u6yAzGLGsUwMkoNnw\n' +
+ '1VR4XKhXHYGWo7KMvFrZ1KcjWhubxLHxZWXRulPVtGmyWg/MvE6KF+2XMLhojhUL\n' +
+ '+9jB3Fpn53s6KMx5tVq1x8PukHmowcZuAF8k+W4gk8Y68wIwynrdZrKRyRv6CVtR\n' +
+ 'FZ8DeJgoNZT3y/GT254VqMxxfuy2Ccb/RInd16tEvVk=\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIEDDCCAvSgAwIBAgICOYIwDQYJKoZIhvcNAQELBQAwgY8xCzAJBgNVBAYTAlVT\n' +
+ 'MRAwDgYDVQQHDAdTZWF0dGxlMRMwEQYDVQQIDApXYXNoaW5ndG9uMSIwIAYDVQQK\n' +
+ 'DBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMuMRMwEQYDVQQLDApBbWF6b24gUkRT\n' +
+ 'MSAwHgYDVQQDDBdBbWF6b24gUkRTIFJvb3QgMjAxOSBDQTAeFw0xOTA5MTcyMDA1\n' +
+ 'MjlaFw0yNDA4MjIxNzA4NTBaMIGZMQswCQYDVQQGEwJVUzETMBEGA1UECAwKV2Fz\n' +
+ 'aGluZ3RvbjEQMA4GA1UEBwwHU2VhdHRsZTEiMCAGA1UECgwZQW1hem9uIFdlYiBT\n' +
+ 'ZXJ2aWNlcywgSW5jLjETMBEGA1UECwwKQW1hem9uIFJEUzEqMCgGA1UEAwwhQW1h\n' +
+ 'em9uIFJEUyBhcC1ub3J0aGVhc3QtMyAyMDE5IENBMIIBIjANBgkqhkiG9w0BAQEF\n' +
+ 'AAOCAQ8AMIIBCgKCAQEA4dMak8W+XW8y/2F6nRiytFiA4XLwePadqWebGtlIgyCS\n' +
+ 'kbug8Jv5w7nlMkuxOxoUeD4WhI6A9EkAn3r0REM/2f0aYnd2KPxeqS2MrtdxxHw1\n' +
+ 'xoOxk2x0piNSlOz6yog1idsKR5Wurf94fvM9FdTrMYPPrDabbGqiBMsZZmoHLvA3\n' +
+ 'Z+57HEV2tU0Ei3vWeGIqnNjIekS+E06KhASxrkNU5vi611UsnYZlSi0VtJsH4UGV\n' +
+ 'LhnHl53aZL0YFO5mn/fzuNG/51qgk/6EFMMhaWInXX49Dia9FnnuWXwVwi6uX1Wn\n' +
+ '7kjoHi5VtmC8ZlGEHroxX2DxEr6bhJTEpcLMnoQMqwIDAQABo2YwZDAOBgNVHQ8B\n' +
+ 'Af8EBAMCAQYwEgYDVR0TAQH/BAgwBgEB/wIBADAdBgNVHQ4EFgQUsUI5Cb3SWB8+\n' +
+ 'gv1YLN/ABPMdxSAwHwYDVR0jBBgwFoAUc19g2LzLA5j0Kxc0LjZapmD/vB8wDQYJ\n' +
+ 'KoZIhvcNAQELBQADggEBAJAF3E9PM1uzVL8YNdzb6fwJrxxqI2shvaMVmC1mXS+w\n' +
+ 'G0zh4v2hBZOf91l1EO0rwFD7+fxoI6hzQfMxIczh875T6vUXePKVOCOKI5wCrDad\n' +
+ 'zQbVqbFbdhsBjF4aUilOdtw2qjjs9JwPuB0VXN4/jY7m21oKEOcnpe36+7OiSPjN\n' +
+ 'xngYewCXKrSRqoj3mw+0w/+exYj3Wsush7uFssX18av78G+ehKPIVDXptOCP/N7W\n' +
+ '8iKVNeQ2QGTnu2fzWsGUSvMGyM7yqT+h1ILaT//yQS8er511aHMLc142bD4D9VSy\n' +
+ 'DgactwPDTShK/PXqhvNey9v/sKXm4XatZvwcc8KYlW4=\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIEDDCCAvSgAwIBAgICcEUwDQYJKoZIhvcNAQELBQAwgY8xCzAJBgNVBAYTAlVT\n' +
+ 'MRAwDgYDVQQHDAdTZWF0dGxlMRMwEQYDVQQIDApXYXNoaW5ndG9uMSIwIAYDVQQK\n' +
+ 'DBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMuMRMwEQYDVQQLDApBbWF6b24gUkRT\n' +
+ 'MSAwHgYDVQQDDBdBbWF6b24gUkRTIFJvb3QgMjAxOSBDQTAeFw0xOTA5MTgxNjU2\n' +
+ 'MjBaFw0yNDA4MjIxNzA4NTBaMIGZMQswCQYDVQQGEwJVUzETMBEGA1UECAwKV2Fz\n' +
+ 'aGluZ3RvbjEQMA4GA1UEBwwHU2VhdHRsZTEiMCAGA1UECgwZQW1hem9uIFdlYiBT\n' +
+ 'ZXJ2aWNlcywgSW5jLjETMBEGA1UECwwKQW1hem9uIFJEUzEqMCgGA1UEAwwhQW1h\n' +
+ 'em9uIFJEUyBhcC1ub3J0aGVhc3QtMSAyMDE5IENBMIIBIjANBgkqhkiG9w0BAQEF\n' +
+ 'AAOCAQ8AMIIBCgKCAQEAndtkldmHtk4TVQAyqhAvtEHSMb6pLhyKrIFved1WO3S7\n' +
+ '+I+bWwv9b2W/ljJxLq9kdT43bhvzonNtI4a1LAohS6bqyirmk8sFfsWT3akb+4Sx\n' +
+ '1sjc8Ovc9eqIWJCrUiSvv7+cS7ZTA9AgM1PxvHcsqrcUXiK3Jd/Dax9jdZE1e15s\n' +
+ 'BEhb2OEPE+tClFZ+soj8h8Pl2Clo5OAppEzYI4LmFKtp1X/BOf62k4jviXuCSst3\n' +
+ 'UnRJzE/CXtjmN6oZySVWSe0rQYuyqRl6//9nK40cfGKyxVnimB8XrrcxUN743Vud\n' +
+ 'QQVU0Esm8OVTX013mXWQXJHP2c0aKkog8LOga0vobQIDAQABo2YwZDAOBgNVHQ8B\n' +
+ 'Af8EBAMCAQYwEgYDVR0TAQH/BAgwBgEB/wIBADAdBgNVHQ4EFgQULmoOS1mFSjj+\n' +
+ 'snUPx4DgS3SkLFYwHwYDVR0jBBgwFoAUc19g2LzLA5j0Kxc0LjZapmD/vB8wDQYJ\n' +
+ 'KoZIhvcNAQELBQADggEBAAkVL2P1M2/G9GM3DANVAqYOwmX0Xk58YBHQu6iiQg4j\n' +
+ 'b4Ky/qsZIsgT7YBsZA4AOcPKQFgGTWhe9pvhmXqoN3RYltN8Vn7TbUm/ZVDoMsrM\n' +
+ 'gwv0+TKxW1/u7s8cXYfHPiTzVSJuOogHx99kBW6b2f99GbP7O1Sv3sLq4j6lVvBX\n' +
+ 'Fiacf5LAWC925nvlTzLlBgIc3O9xDtFeAGtZcEtxZJ4fnGXiqEnN4539+nqzIyYq\n' +
+ 'nvlgCzyvcfRAxwltrJHuuRu6Maw5AGcd2Y0saMhqOVq9KYKFKuD/927BTrbd2JVf\n' +
+ '2sGWyuPZPCk3gq+5pCjbD0c6DkhcMGI6WwxvM5V/zSM=\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIEBzCCAu+gAwIBAgICJDQwDQYJKoZIhvcNAQELBQAwgY8xCzAJBgNVBAYTAlVT\n' +
+ 'MRAwDgYDVQQHDAdTZWF0dGxlMRMwEQYDVQQIDApXYXNoaW5ndG9uMSIwIAYDVQQK\n' +
+ 'DBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMuMRMwEQYDVQQLDApBbWF6b24gUkRT\n' +
+ 'MSAwHgYDVQQDDBdBbWF6b24gUkRTIFJvb3QgMjAxOSBDQTAeFw0xOTA5MTgxNzAz\n' +
+ 'MTVaFw0yNDA4MjIxNzA4NTBaMIGUMQswCQYDVQQGEwJVUzETMBEGA1UECAwKV2Fz\n' +
+ 'aGluZ3RvbjEQMA4GA1UEBwwHU2VhdHRsZTEiMCAGA1UECgwZQW1hem9uIFdlYiBT\n' +
+ 'ZXJ2aWNlcywgSW5jLjETMBEGA1UECwwKQW1hem9uIFJEUzElMCMGA1UEAwwcQW1h\n' +
+ 'em9uIFJEUyBldS13ZXN0LTMgMjAxOSBDQTCCASIwDQYJKoZIhvcNAQEBBQADggEP\n' +
+ 'ADCCAQoCggEBAL9bL7KE0n02DLVtlZ2PL+g/BuHpMYFq2JnE2RgompGurDIZdjmh\n' +
+ '1pxfL3nT+QIVMubuAOy8InRfkRxfpxyjKYdfLJTPJG+jDVL+wDcPpACFVqoV7Prg\n' +
+ 'pVYEV0lc5aoYw4bSeYFhdzgim6F8iyjoPnObjll9mo4XsHzSoqJLCd0QC+VG9Fw2\n' +
+ 'q+GDRZrLRmVM2oNGDRbGpGIFg77aRxRapFZa8SnUgs2AqzuzKiprVH5i0S0M6dWr\n' +
+ 'i+kk5epmTtkiDHceX+dP/0R1NcnkCPoQ9TglyXyPdUdTPPRfKCq12dftqll+u4mV\n' +
+ 'ARdN6WFjovxax8EAP2OAUTi1afY+1JFMj+sCAwEAAaNmMGQwDgYDVR0PAQH/BAQD\n' +
+ 'AgEGMBIGA1UdEwEB/wQIMAYBAf8CAQAwHQYDVR0OBBYEFLfhrbrO5exkCVgxW0x3\n' +
+ 'Y2mAi8lNMB8GA1UdIwQYMBaAFHNfYNi8ywOY9CsXNC42WqZg/7wfMA0GCSqGSIb3\n' +
+ 'DQEBCwUAA4IBAQAigQ5VBNGyw+OZFXwxeJEAUYaXVoP/qrhTOJ6mCE2DXUVEoJeV\n' +
+ 'SxScy/TlFA9tJXqmit8JH8VQ/xDL4ubBfeMFAIAo4WzNWDVoeVMqphVEcDWBHsI1\n' +
+ 'AETWzfsapRS9yQekOMmxg63d/nV8xewIl8aNVTHdHYXMqhhik47VrmaVEok1UQb3\n' +
+ 'O971RadLXIEbVd9tjY5bMEHm89JsZDnDEw1hQXBb67Elu64OOxoKaHBgUH8AZn/2\n' +
+ 'zFsL1ynNUjOhCSAA15pgd1vjwc0YsBbAEBPcHBWYBEyME6NLNarjOzBl4FMtATSF\n' +
+ 'wWCKRGkvqN8oxYhwR2jf2rR5Mu4DWkK5Q8Ep\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIEBzCCAu+gAwIBAgICJVUwDQYJKoZIhvcNAQELBQAwgY8xCzAJBgNVBAYTAlVT\n' +
+ 'MRAwDgYDVQQHDAdTZWF0dGxlMRMwEQYDVQQIDApXYXNoaW5ndG9uMSIwIAYDVQQK\n' +
+ 'DBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMuMRMwEQYDVQQLDApBbWF6b24gUkRT\n' +
+ 'MSAwHgYDVQQDDBdBbWF6b24gUkRTIFJvb3QgMjAxOSBDQTAeFw0xOTA5MTkxODE2\n' +
+ 'NTNaFw0yNDA4MjIxNzA4NTBaMIGUMQswCQYDVQQGEwJVUzETMBEGA1UECAwKV2Fz\n' +
+ 'aGluZ3RvbjEQMA4GA1UEBwwHU2VhdHRsZTEiMCAGA1UECgwZQW1hem9uIFdlYiBT\n' +
+ 'ZXJ2aWNlcywgSW5jLjETMBEGA1UECwwKQW1hem9uIFJEUzElMCMGA1UEAwwcQW1h\n' +
+ 'em9uIFJEUyB1cy1lYXN0LTEgMjAxOSBDQTCCASIwDQYJKoZIhvcNAQEBBQADggEP\n' +
+ 'ADCCAQoCggEBAM3i/k2u6cqbMdcISGRvh+m+L0yaSIoOXjtpNEoIftAipTUYoMhL\n' +
+ 'InXGlQBVA4shkekxp1N7HXe1Y/iMaPEyb3n+16pf3vdjKl7kaSkIhjdUz3oVUEYt\n' +
+ 'i8Z/XeJJ9H2aEGuiZh3kHixQcZczn8cg3dA9aeeyLSEnTkl/npzLf//669Ammyhs\n' +
+ 'XcAo58yvT0D4E0D/EEHf2N7HRX7j/TlyWvw/39SW0usiCrHPKDLxByLojxLdHzso\n' +
+ 'QIp/S04m+eWn6rmD+uUiRteN1hI5ncQiA3wo4G37mHnUEKo6TtTUh+sd/ku6a8HK\n' +
+ 'glMBcgqudDI90s1OpuIAWmuWpY//8xEG2YECAwEAAaNmMGQwDgYDVR0PAQH/BAQD\n' +
+ 'AgEGMBIGA1UdEwEB/wQIMAYBAf8CAQAwHQYDVR0OBBYEFPqhoWZcrVY9mU7tuemR\n' +
+ 'RBnQIj1jMB8GA1UdIwQYMBaAFHNfYNi8ywOY9CsXNC42WqZg/7wfMA0GCSqGSIb3\n' +
+ 'DQEBCwUAA4IBAQB6zOLZ+YINEs72heHIWlPZ8c6WY8MDU+Be5w1M+BK2kpcVhCUK\n' +
+ 'PJO4nMXpgamEX8DIiaO7emsunwJzMSvavSPRnxXXTKIc0i/g1EbiDjnYX9d85DkC\n' +
+ 'E1LaAUCmCZBVi9fIe0H2r9whIh4uLWZA41oMnJx/MOmo3XyMfQoWcqaSFlMqfZM4\n' +
+ '0rNoB/tdHLNuV4eIdaw2mlHxdWDtF4oH+HFm+2cVBUVC1jXKrFv/euRVtsTT+A6i\n' +
+ 'h2XBHKxQ1Y4HgAn0jACP2QSPEmuoQEIa57bEKEcZsBR8SDY6ZdTd2HLRIApcCOSF\n' +
+ 'MRM8CKLeF658I0XgF8D5EsYoKPsA+74Z+jDH\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIEETCCAvmgAwIBAgICEAAwDQYJKoZIhvcNAQELBQAwgZQxCzAJBgNVBAYTAlVT\n' +
+ 'MRAwDgYDVQQHDAdTZWF0dGxlMRMwEQYDVQQIDApXYXNoaW5ndG9uMSIwIAYDVQQK\n' +
+ 'DBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMuMRMwEQYDVQQLDApBbWF6b24gUkRT\n' +
+ 'MSUwIwYDVQQDDBxBbWF6b24gUkRTIEJldGEgUm9vdCAyMDE5IENBMB4XDTE5MDgy\n' +
+ 'MDE3MTAwN1oXDTI0MDgxOTE3MzgyNlowgZkxCzAJBgNVBAYTAlVTMRMwEQYDVQQI\n' +
+ 'DApXYXNoaW5ndG9uMRAwDgYDVQQHDAdTZWF0dGxlMSIwIAYDVQQKDBlBbWF6b24g\n' +
+ 'V2ViIFNlcnZpY2VzLCBJbmMuMRMwEQYDVQQLDApBbWF6b24gUkRTMSowKAYDVQQD\n' +
+ 'DCFBbWF6b24gUkRTIEJldGEgdXMtZWFzdC0xIDIwMTkgQ0EwggEiMA0GCSqGSIb3\n' +
+ 'DQEBAQUAA4IBDwAwggEKAoIBAQDTNCOlotQcLP8TP82U2+nk0bExVuuMVOgFeVMx\n' +
+ 'vbUHZQeIj9ikjk+jm6eTDnnkhoZcmJiJgRy+5Jt69QcRbb3y3SAU7VoHgtraVbxF\n' +
+ 'QDh7JEHI9tqEEVOA5OvRrDRcyeEYBoTDgh76ROco2lR+/9uCvGtHVrMCtG7BP7ZB\n' +
+ 'sSVNAr1IIRZZqKLv2skKT/7mzZR2ivcw9UeBBTUf8xsfiYVBvMGoEsXEycjYdf6w\n' +
+ 'WV+7XS7teNOc9UgsFNN+9AhIBc1jvee5E//72/4F8pAttAg/+mmPUyIKtekNJ4gj\n' +
+ 'OAR2VAzGx1ybzWPwIgOudZFHXFduxvq4f1hIRPH0KbQ/gkRrAgMBAAGjZjBkMA4G\n' +
+ 'A1UdDwEB/wQEAwIBBjASBgNVHRMBAf8ECDAGAQH/AgEAMB0GA1UdDgQWBBTkvpCD\n' +
+ '6C43rar9TtJoXr7q8dkrrjAfBgNVHSMEGDAWgBStoQwVpbGx87fxB3dEGDqKKnBT\n' +
+ '4TANBgkqhkiG9w0BAQsFAAOCAQEAJd9fOSkwB3uVdsS+puj6gCER8jqmhd3g/J5V\n' +
+ 'Zjk9cKS8H0e8pq/tMxeJ8kpurPAzUk5RkCspGt2l0BSwmf3ahr8aJRviMX6AuW3/\n' +
+ 'g8aKplTvq/WMNGKLXONa3Sq8591J+ce8gtOX/1rDKmFI4wQ/gUzOSYiT991m7QKS\n' +
+ 'Fr6HMgFuz7RNJbb3Fy5cnurh8eYWA7mMv7laiLwTNsaro5qsqErD5uXuot6o9beT\n' +
+ 'a+GiKinEur35tNxAr47ax4IRubuIzyfCrezjfKc5raVV2NURJDyKP0m0CCaffAxE\n' +
+ 'qn2dNfYc3v1D8ypg3XjHlOzRo32RB04o8ALHMD9LSwsYDLpMag==\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIEFzCCAv+gAwIBAgICFSUwDQYJKoZIhvcNAQELBQAwgZcxCzAJBgNVBAYTAlVT\n' +
+ 'MRAwDgYDVQQHDAdTZWF0dGxlMRMwEQYDVQQIDApXYXNoaW5ndG9uMSIwIAYDVQQK\n' +
+ 'DBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMuMRMwEQYDVQQLDApBbWF6b24gUkRT\n' +
+ 'MSgwJgYDVQQDDB9BbWF6b24gUkRTIFByZXZpZXcgUm9vdCAyMDE5IENBMB4XDTE5\n' +
+ 'MDgyMTIyMzk0N1oXDTI0MDgyMTIyMjk0OVowgZwxCzAJBgNVBAYTAlVTMRMwEQYD\n' +
+ 'VQQIDApXYXNoaW5ndG9uMRAwDgYDVQQHDAdTZWF0dGxlMSIwIAYDVQQKDBlBbWF6\n' +
+ 'b24gV2ViIFNlcnZpY2VzLCBJbmMuMRMwEQYDVQQLDApBbWF6b24gUkRTMS0wKwYD\n' +
+ 'VQQDDCRBbWF6b24gUkRTIFByZXZpZXcgdXMtZWFzdC0yIDIwMTkgQ0EwggEiMA0G\n' +
+ 'CSqGSIb3DQEBAQUAA4IBDwAwggEKAoIBAQD0dB/U7qRnSf05wOi7m10Pa2uPMTJv\n' +
+ 'r6U/3Y17a5prq5Zr4++CnSUYarG51YuIf355dKs+7Lpzs782PIwCmLpzAHKWzix6\n' +
+ 'pOaTQ+WZ0+vUMTxyqgqWbsBgSCyP7pVBiyqnmLC/L4az9XnscrbAX4pNaoJxsuQe\n' +
+ 'mzBo6yofjQaAzCX69DuqxFkVTRQnVy7LCFkVaZtjNAftnAHJjVgQw7lIhdGZp9q9\n' +
+ 'IafRt2gteihYfpn+EAQ/t/E4MnhrYs4CPLfS7BaYXBycEKC5Muj1l4GijNNQ0Efo\n' +
+ 'xG8LSZz7SNgUvfVwiNTaqfLP3AtEAWiqxyMyh3VO+1HpCjT7uNBFtmF3AgMBAAGj\n' +
+ 'ZjBkMA4GA1UdDwEB/wQEAwIBBjASBgNVHRMBAf8ECDAGAQH/AgEAMB0GA1UdDgQW\n' +
+ 'BBQtinkdrj+0B2+qdXngV2tgHnPIujAfBgNVHSMEGDAWgBRp0xqULkNh/w2ZVzEI\n' +
+ 'o2RIY7O03TANBgkqhkiG9w0BAQsFAAOCAQEAtJdqbCxDeMc8VN1/RzCabw9BIL/z\n' +
+ '73Auh8eFTww/sup26yn8NWUkfbckeDYr1BrXa+rPyLfHpg06kwR8rBKyrs5mHwJx\n' +
+ 'bvOzXD/5WTdgreB+2Fb7mXNvWhenYuji1MF+q1R2DXV3I05zWHteKX6Dajmx+Uuq\n' +
+ 'Yq78oaCBSV48hMxWlp8fm40ANCL1+gzQ122xweMFN09FmNYFhwuW+Ao+Vv90ZfQG\n' +
+ 'PYwTvN4n/gegw2TYcifGZC2PNX74q3DH03DXe5fvNgRW5plgz/7f+9mS+YHd5qa9\n' +
+ 'tYTPUvoRbi169ou6jicsMKUKPORHWhiTpSCWR1FMMIbsAcsyrvtIsuaGCQ==\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIID/jCCAuagAwIBAgIQdOCSuA9psBpQd8EI368/0DANBgkqhkiG9w0BAQsFADCB\n' +
+ 'lzELMAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIElu\n' +
+ 'Yy4xEzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTAwLgYDVQQDDCdB\n' +
+ 'bWF6b24gUkRTIHNhLWVhc3QtMSBSb290IENBIFJTQTIwNDggRzExEDAOBgNVBAcM\n' +
+ 'B1NlYXR0bGUwIBcNMjEwNTE5MTgwNjI2WhgPMjA2MTA1MTkxOTA2MjZaMIGXMQsw\n' +
+ 'CQYDVQQGEwJVUzEiMCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywgSW5jLjET\n' +
+ 'MBEGA1UECwwKQW1hem9uIFJEUzELMAkGA1UECAwCV0ExMDAuBgNVBAMMJ0FtYXpv\n' +
+ 'biBSRFMgc2EtZWFzdC0xIFJvb3QgQ0EgUlNBMjA0OCBHMTEQMA4GA1UEBwwHU2Vh\n' +
+ 'dHRsZTCCASIwDQYJKoZIhvcNAQEBBQADggEPADCCAQoCggEBAN6ftL6w8v3dB2yW\n' +
+ 'LjCxSP1D7ZsOTeLZOSCz1Zv0Gkd0XLhil5MdHOHBvwH/DrXqFU2oGzCRuAy+aZis\n' +
+ 'DardJU6ChyIQIciXCO37f0K23edhtpXuruTLLwUwzeEPdcnLPCX+sWEn9Y5FPnVm\n' +
+ 'pCd6J8edH2IfSGoa9LdErkpuESXdidLym/w0tWG/O2By4TabkNSmpdrCL00cqI+c\n' +
+ 'prA8Bx1jX8/9sY0gpAovtuFaRN+Ivg3PAnWuhqiSYyQ5nC2qDparOWuDiOhpY56E\n' +
+ 'EgmTvjwqMMjNtExfYx6Rv2Ndu50TriiNKEZBzEtkekwXInTupmYTvc7U83P/959V\n' +
+ 'UiQ+WSMCAwEAAaNCMEAwDwYDVR0TAQH/BAUwAwEB/zAdBgNVHQ4EFgQU4uYHdH0+\n' +
+ 'bUeh81Eq2l5/RJbW+vswDgYDVR0PAQH/BAQDAgGGMA0GCSqGSIb3DQEBCwUAA4IB\n' +
+ 'AQBhxcExJ+w74bvDknrPZDRgTeMLYgbVJjx2ExH7/Ac5FZZWcpUpFwWMIJJxtewI\n' +
+ 'AnhryzM3tQYYd4CG9O+Iu0+h/VVfW7e4O3joWVkxNMb820kQSEwvZfA78aItGwOY\n' +
+ 'WSaFNVRyloVicZRNJSyb1UL9EiJ9ldhxm4LTT0ax+4ontI7zTx6n6h8Sr6r/UOvX\n' +
+ 'd9T5aUUENWeo6M9jGupHNn3BobtL7BZm2oS8wX8IVYj4tl0q5T89zDi2x0MxbsIV\n' +
+ '5ZjwqBQ5JWKv7ASGPb+z286RjPA9R2knF4lJVZrYuNV90rHvI/ECyt/JrDqeljGL\n' +
+ 'BLl1W/UsvZo6ldLIpoMbbrb5\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIEBDCCAuygAwIBAgIQUfVbqapkLYpUqcLajpTJWzANBgkqhkiG9w0BAQsFADCB\n' +
+ 'mjELMAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIElu\n' +
+ 'Yy4xEzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTMwMQYDVQQDDCpB\n' +
+ 'bWF6b24gUkRTIG1lLWNlbnRyYWwtMSBSb290IENBIFJTQTIwNDggRzExEDAOBgNV\n' +
+ 'BAcMB1NlYXR0bGUwIBcNMjIwNTA2MjMyMDA5WhgPMjA2MjA1MDcwMDIwMDlaMIGa\n' +
+ 'MQswCQYDVQQGEwJVUzEiMCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywgSW5j\n' +
+ 'LjETMBEGA1UECwwKQW1hem9uIFJEUzELMAkGA1UECAwCV0ExMzAxBgNVBAMMKkFt\n' +
+ 'YXpvbiBSRFMgbWUtY2VudHJhbC0xIFJvb3QgQ0EgUlNBMjA0OCBHMTEQMA4GA1UE\n' +
+ 'BwwHU2VhdHRsZTCCASIwDQYJKoZIhvcNAQEBBQADggEPADCCAQoCggEBAJIeovu3\n' +
+ 'ewI9FVitXMQzvkh34aQ6WyI4NO3YepfJaePiv3cnyFGYHN2S1cR3UQcLWgypP5va\n' +
+ 'j6bfroqwGbCbZZcb+6cyOB4ceKO9Ws1UkcaGHnNDcy5gXR7aCW2OGTUfinUuhd2d\n' +
+ '5bOGgV7JsPbpw0bwJ156+MwfOK40OLCWVbzy8B1kITs4RUPNa/ZJnvIbiMu9rdj4\n' +
+ '8y7GSFJLnKCjlOFUkNI5LcaYvI1+ybuNgphT3nuu5ZirvTswGakGUT/Q0J3dxP0J\n' +
+ 'pDfg5Sj/2G4gXiaM0LppVOoU5yEwVewhQ250l0eQAqSrwPqAkdTg9ng360zqCFPE\n' +
+ 'JPPcgI1tdGUgneECAwEAAaNCMEAwDwYDVR0TAQH/BAUwAwEB/zAdBgNVHQ4EFgQU\n' +
+ '/2AJVxWdZxc8eJgdpbwpW7b0f7IwDgYDVR0PAQH/BAQDAgGGMA0GCSqGSIb3DQEB\n' +
+ 'CwUAA4IBAQBYm63jTu2qYKJ94gKnqc+oUgqmb1mTXmgmp/lXDbxonjszJDOXFbri\n' +
+ '3CCO7xB2sg9bd5YWY8sGKHaWmENj3FZpCmoefbUx++8D7Mny95Cz8R32rNcwsPTl\n' +
+ 'ebpd9A/Oaw5ug6M0x/cNr0qzF8Wk9Dx+nFEimp8RYQdKvLDfNFZHjPa1itnTiD8M\n' +
+ 'TorAqj+VwnUGHOYBsT/0NY12tnwXdD+ATWfpEHdOXV+kTMqFFwDyhfgRVNpTc+os\n' +
+ 'ygr8SwhnSCpJPB/EYl2S7r+tgAbJOkuwUvGT4pTqrzDQEhwE7swgepnHC87zhf6l\n' +
+ 'qN6mVpSnQKQLm6Ob5TeCEFgcyElsF5bH\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIICrjCCAjSgAwIBAgIRAOxu0I1QuMAhIeszB3fJIlkwCgYIKoZIzj0EAwMwgZYx\n' +
+ 'CzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMu\n' +
+ 'MRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTEvMC0GA1UEAwwmQW1h\n' +
+ 'em9uIFJEUyB1cy13ZXN0LTIgUm9vdCBDQSBFQ0MzODQgRzExEDAOBgNVBAcMB1Nl\n' +
+ 'YXR0bGUwIBcNMjEwNTI0MjIwNjU5WhgPMjEyMTA1MjQyMzA2NTlaMIGWMQswCQYD\n' +
+ 'VQQGEwJVUzEiMCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywgSW5jLjETMBEG\n' +
+ 'A1UECwwKQW1hem9uIFJEUzELMAkGA1UECAwCV0ExLzAtBgNVBAMMJkFtYXpvbiBS\n' +
+ 'RFMgdXMtd2VzdC0yIFJvb3QgQ0EgRUNDMzg0IEcxMRAwDgYDVQQHDAdTZWF0dGxl\n' +
+ 'MHYwEAYHKoZIzj0CAQYFK4EEACIDYgAEz4bylRcGqqDWdP7gQIIoTHdBK6FNtKH1\n' +
+ '4SkEIXRXkYDmRvL9Bci1MuGrwuvrka5TDj4b7e+csY0llEzHpKfq6nJPFljoYYP9\n' +
+ 'uqHFkv77nOpJJ633KOr8IxmeHW5RXgrZo0IwQDAPBgNVHRMBAf8EBTADAQH/MB0G\n' +
+ 'A1UdDgQWBBQQikVz8wmjd9eDFRXzBIU8OseiGzAOBgNVHQ8BAf8EBAMCAYYwCgYI\n' +
+ 'KoZIzj0EAwMDaAAwZQIwf06Mcrpw1O0EBLBBrp84m37NYtOkE/0Z0O+C7D41wnXi\n' +
+ 'EQdn6PXUVgdD23Gj82SrAjEAklhKs+liO1PtN15yeZR1Io98nFve+lLptaLakZcH\n' +
+ '+hfFuUtCqMbaI8CdvJlKnPqT\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIGCTCCA/GgAwIBAgIRALyWMTyCebLZOGcZZQmkmfcwDQYJKoZIhvcNAQEMBQAw\n' +
+ 'gZwxCzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJ\n' +
+ 'bmMuMRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTE1MDMGA1UEAwws\n' +
+ 'QW1hem9uIFJEUyBhcC1ub3J0aGVhc3QtMyBSb290IENBIFJTQTQwOTYgRzExEDAO\n' +
+ 'BgNVBAcMB1NlYXR0bGUwIBcNMjEwNTI0MjAyODAzWhgPMjEyMTA1MjQyMTI4MDNa\n' +
+ 'MIGcMQswCQYDVQQGEwJVUzEiMCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywg\n' +
+ 'SW5jLjETMBEGA1UECwwKQW1hem9uIFJEUzELMAkGA1UECAwCV0ExNTAzBgNVBAMM\n' +
+ 'LEFtYXpvbiBSRFMgYXAtbm9ydGhlYXN0LTMgUm9vdCBDQSBSU0E0MDk2IEcxMRAw\n' +
+ 'DgYDVQQHDAdTZWF0dGxlMIICIjANBgkqhkiG9w0BAQEFAAOCAg8AMIICCgKCAgEA\n' +
+ 'wGFiyDyCrGqgdn4fXG12cxKAAfVvhMea1mw5h9CVRoavkPqhzQpAitSOuMB9DeiP\n' +
+ 'wQyqcsiGl/cTEau4L+AUBG8b9v26RlY48exUYBXj8CieYntOT9iNw5WtdYJa3kF/\n' +
+ 'JxgI+HDMzE9cmHDs5DOO3S0uwZVyra/xE1ymfSlpOeUIOTpHRJv97CBUEpaZMUW5\n' +
+ 'Sr6GruuOwFVpO5FX3A/jQlcS+UN4GjSRgDUJuqg6RRQldEZGCVCCmodbByvI2fGm\n' +
+ 'reGpsPJD54KkmAX08nOR8e5hkGoHxq0m2DLD4SrOFmt65vG47qnuwplWJjtk9B3Z\n' +
+ '9wDoopwZLBOtlkPIkUllWm1P8EuHC1IKOA+wSP6XdT7cy8S77wgyHzR0ynxv7q/l\n' +
+ 'vlZtH30wnNqFI0y9FeogD0TGMCHcnGqfBSicJXPy9T4fU6f0r1HwqKwPp2GArwe7\n' +
+ 'dnqLTj2D7M9MyVtFjEs6gfGWXmu1y5uDrf+CszurE8Cycoma+OfjjuVQgWOCy7Nd\n' +
+ 'jJswPxAroTzVfpgoxXza4ShUY10woZu0/J+HmNmqK7lh4NS75q1tz75in8uTZDkV\n' +
+ 'be7GK+SEusTrRgcf3tlgPjSTWG3veNzFDF2Vn1GLJXmuZfhdlVQDBNXW4MNREExS\n' +
+ 'dG57kJjICpT+r8X+si+5j51gRzkSnMYs7VHulpxfcwECAwEAAaNCMEAwDwYDVR0T\n' +
+ 'AQH/BAUwAwEB/zAdBgNVHQ4EFgQU4JWOpDBmUBuWKvGPZelw87ezhL8wDgYDVR0P\n' +
+ 'AQH/BAQDAgGGMA0GCSqGSIb3DQEBDAUAA4ICAQBRNLMql7itvXSEFQRAnyOjivHz\n' +
+ 'l5IlWVQjAbOUr6ogZcwvK6YpxNAFW5zQr8F+fdkiypLz1kk5irx9TIpff0BWC9hQ\n' +
+ '/odMPO8Gxn8+COlSvc+dLsF2Dax3Hvz0zLeKMo+cYisJOzpdR/eKd0/AmFdkvQoM\n' +
+ 'AOK9n0yYvVJU2IrSgeJBiiCarpKSeAktEVQ4rvyacQGr+QAPkkjRwm+5LHZKK43W\n' +
+ 'nNnggRli9N/27qYtc5bgr3AaQEhEXMI4RxPRXCLsod0ehMGWyRRK728a+6PMMJAJ\n' +
+ 'WHOU0x7LCEMPP/bvpLj3BdvSGqNor4ZtyXEbwREry1uzsgODeRRns5acPwTM6ff+\n' +
+ 'CmxO2NZ0OktIUSYRmf6H/ZFlZrIhV8uWaIwEJDz71qvj7buhQ+RFDZ9CNL64C0X6\n' +
+ 'mf0zJGEpddjANHaaVky+F4gYMtEy2K2Lcm4JGTdyIzUoIe+atzCnRp0QeIcuWtF+\n' +
+ 's8AjDYCVFNypcMmqbRmNpITSnOoCHSRuVkY3gutVoYyMLbp8Jm9SJnCIlEWTA6Rm\n' +
+ 'wADOMGZJVn5/XRTRuetVOB3KlQDjs9OO01XN5NzGSZO2KT9ngAUfh9Eqhf1iRWSP\n' +
+ 'nZlRbQ2NRCuY/oJ5N59mLGxnNJSE7giEKEBRhTQ/XEPIUYAUPD5fca0arKRJwbol\n' +
+ 'l9Se1Hsq0ZU5f+OZKQ==\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIGATCCA+mgAwIBAgIRAK7vlRrGVEePJpW1VHMXdlIwDQYJKoZIhvcNAQEMBQAw\n' +
+ 'gZgxCzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJ\n' +
+ 'bmMuMRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTExMC8GA1UEAwwo\n' +
+ 'QW1hem9uIFJEUyBhZi1zb3V0aC0xIFJvb3QgQ0EgUlNBNDA5NiBHMTEQMA4GA1UE\n' +
+ 'BwwHU2VhdHRsZTAgFw0yMTA1MTkxOTI4NDNaGA8yMTIxMDUxOTIwMjg0M1owgZgx\n' +
+ 'CzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMu\n' +
+ 'MRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTExMC8GA1UEAwwoQW1h\n' +
+ 'em9uIFJEUyBhZi1zb3V0aC0xIFJvb3QgQ0EgUlNBNDA5NiBHMTEQMA4GA1UEBwwH\n' +
+ 'U2VhdHRsZTCCAiIwDQYJKoZIhvcNAQEBBQADggIPADCCAgoCggIBAMZiHOQC6x4o\n' +
+ 'eC7vVOMCGiN5EuLqPYHdceFPm4h5k/ZejXTf7kryk6aoKZKsDIYihkaZwXVS7Y/y\n' +
+ '7Ig1F1ABi2jD+CYprj7WxXbhpysmN+CKG7YC3uE4jSvfvUnpzionkQbjJsRJcrPO\n' +
+ 'cZJM4FVaVp3mlHHtvnM+K3T+ni4a38nAd8xrv1na4+B8ZzZwWZXarfg8lJoGskSn\n' +
+ 'ou+3rbGQ0r+XlUP03zWujHoNlVK85qUIQvDfTB7n3O4s1XNGvkfv3GNBhYRWJYlB\n' +
+ '4p8T+PFN8wG+UOByp1gV7BD64RnpuZ8V3dRAlO6YVAmINyG5UGrPzkIbLtErUNHO\n' +
+ '4iSp4UqYvztDqJWWHR/rA84ef+I9RVwwZ8FQbjKq96OTnPrsr63A5mXTC9dXKtbw\n' +
+ 'XNJPQY//FEdyM3K8sqM0IdCzxCA1MXZ8+QapWVjwyTjUwFvL69HYky9H8eAER59K\n' +
+ '5I7u/CWWeCy2R1SYUBINc3xxLr0CGGukcWPEZW2aPo5ibW5kepU1P/pzdMTaTfao\n' +
+ 'F42jSFXbc7gplLcSqUgWwzBnn35HLTbiZOFBPKf6vRRu8aRX9atgHw/EjCebi2xP\n' +
+ 'xIYr5Ub8u0QVHIqcnF1/hVzO/Xz0chj3E6VF/yTXnsakm+W1aM2QkZbFGpga+LMy\n' +
+ 'mFCtdPrELjea2CfxgibaJX1Q4rdEpc8DAgMBAAGjQjBAMA8GA1UdEwEB/wQFMAMB\n' +
+ 'Af8wHQYDVR0OBBYEFDSaycEyuspo/NOuzlzblui8KotFMA4GA1UdDwEB/wQEAwIB\n' +
+ 'hjANBgkqhkiG9w0BAQwFAAOCAgEAbosemjeTRsL9o4v0KadBUNS3V7gdAH+X4vH2\n' +
+ 'Ee1Jc91VOGLdd/s1L9UX6bhe37b9WjUD69ur657wDW0RzxMYgQdZ27SUl0tEgGGp\n' +
+ 'cCmVs1ky3zEN+Hwnhkz+OTmIg1ufq0W2hJgJiluAx2r1ib1GB+YI3Mo3rXSaBYUk\n' +
+ 'bgQuujYPctf0PA153RkeICE5GI3OaJ7u6j0caYEixBS3PDHt2MJWexITvXGwHWwc\n' +
+ 'CcrC05RIrTUNOJaetQw8smVKYOfRImEzLLPZ5kf/H3Cbj8BNAFNsa10wgvlPuGOW\n' +
+ 'XLXqzNXzrG4V3sjQU5YtisDMagwYaN3a6bBf1wFwFIHQoAPIgt8q5zaQ9WI+SBns\n' +
+ 'Il6rd4zfvjq/BPmt0uI7rVg/cgbaEg/JDL2neuM9CJAzmKxYxLQuHSX2i3Fy4Y1B\n' +
+ 'cnxnRQETCRZNPGd00ADyxPKVoYBC45/t+yVusArFt+2SVLEGiFBr23eG2CEZu+HS\n' +
+ 'nDEgIfQ4V3YOTUNa86wvbAss1gbbnT/v1XCnNGClEWCWNCSRjwV2ZmQ/IVTmNHPo\n' +
+ '7axTTBBJbKJbKzFndCnuxnDXyytdYRgFU7Ly3sa27WS2KFyFEDebLFRHQEfoYqCu\n' +
+ 'IupSqBSbXsR3U10OTjc9z6EPo1nuV6bdz+gEDthmxKa1NI+Qb1kvyliXQHL2lfhr\n' +
+ '5zT5+Bs=\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIF/zCCA+egAwIBAgIRAOLV6zZcL4IV2xmEneN1GwswDQYJKoZIhvcNAQEMBQAw\n' +
+ 'gZcxCzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJ\n' +
+ 'bmMuMRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTEwMC4GA1UEAwwn\n' +
+ 'QW1hem9uIFJEUyB1cy13ZXN0LTEgUm9vdCBDQSBSU0E0MDk2IEcxMRAwDgYDVQQH\n' +
+ 'DAdTZWF0dGxlMCAXDTIxMDUxOTE5MDg1OFoYDzIxMjEwNTE5MjAwODU4WjCBlzEL\n' +
+ 'MAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4x\n' +
+ 'EzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTAwLgYDVQQDDCdBbWF6\n' +
+ 'b24gUkRTIHVzLXdlc3QtMSBSb290IENBIFJTQTQwOTYgRzExEDAOBgNVBAcMB1Nl\n' +
+ 'YXR0bGUwggIiMA0GCSqGSIb3DQEBAQUAA4ICDwAwggIKAoICAQC7koAKGXXlLixN\n' +
+ 'fVjhuqvz0WxDeTQfhthPK60ekRpftkfE5QtnYGzeovaUAiS58MYVzqnnTACDwcJs\n' +
+ 'IGTFE6Wd7sB6r8eI/3CwI1pyJfxepubiQNVAQG0zJETOVkoYKe/5KnteKtnEER3X\n' +
+ 'tCBRdV/rfbxEDG9ZAsYfMl6zzhEWKF88G6xhs2+VZpDqwJNNALvQuzmTx8BNbl5W\n' +
+ 'RUWGq9CQ9GK9GPF570YPCuURW7kl35skofudE9bhURNz51pNoNtk2Z3aEeRx3ouT\n' +
+ 'ifFJlzh+xGJRHqBG7nt5NhX8xbg+vw4xHCeq1aAe6aVFJ3Uf9E2HzLB4SfIT9bRp\n' +
+ 'P7c9c0ySGt+3n+KLSHFf/iQ3E4nft75JdPjeSt0dnyChi1sEKDi0tnWGiXaIg+J+\n' +
+ 'r1ZtcHiyYpCB7l29QYMAdD0TjfDwwPayLmq//c20cPmnSzw271VwqjUT0jYdrNAm\n' +
+ 'gV+JfW9t4ixtE3xF2jaUh/NzL3bAmN5v8+9k/aqPXlU1BgE3uPwMCjrfn7V0I7I1\n' +
+ 'WLpHyd9jF3U/Ysci6H6i8YKgaPiOfySimQiDu1idmPld659qerutUSemQWmPD3bE\n' +
+ 'dcjZolmzS9U0Ujq/jDF1YayN3G3xvry1qWkTci0qMRMu2dZu30Herugh9vsdTYkf\n' +
+ '00EqngPbqtIVLDrDjEQLqPcb8QvWFQIDAQABo0IwQDAPBgNVHRMBAf8EBTADAQH/\n' +
+ 'MB0GA1UdDgQWBBQBqg8Za/L0YMHURGExHfvPyfLbOTAOBgNVHQ8BAf8EBAMCAYYw\n' +
+ 'DQYJKoZIhvcNAQEMBQADggIBACAGPMa1QL7P/FIO7jEtMelJ0hQlQepKnGtbKz4r\n' +
+ 'Xq1bUX1jnLvnAieR9KZmeQVuKi3g3CDU6b0mDgygS+FL1KDDcGRCSPh238Ou8KcG\n' +
+ 'HIxtt3CMwMHMa9gmdcMlR5fJF9vhR0C56KM2zvyelUY51B/HJqHwGvWuexryXUKa\n' +
+ 'wq1/iK2/d9mNeOcjDvEIj0RCMI8dFQCJv3PRCTC36XS36Tzr6F47TcTw1c3mgKcs\n' +
+ 'xpcwt7ezrXMUunzHS4qWAA5OGdzhYlcv+P5GW7iAA7TDNrBF+3W4a/6s9v2nQAnX\n' +
+ 'UvXd9ul0ob71377UhZbJ6SOMY56+I9cJOOfF5QvaL83Sz29Ij1EKYw/s8TYdVqAq\n' +
+ '+dCyQZBkMSnDFLVe3J1KH2SUSfm3O98jdPORQrUlORQVYCHPls19l2F6lCmU7ICK\n' +
+ 'hRt8EVSpXm4sAIA7zcnR2nU00UH8YmMQLnx5ok9YGhuh3Ehk6QlTQLJux6LYLskd\n' +
+ '9YHOLGW/t6knVtV78DgPqDeEx/Wu/5A8R0q7HunpWxr8LCPBK6hksZnOoUhhb8IP\n' +
+ 'vl46Ve5Tv/FlkyYr1RTVjETmg7lb16a8J0At14iLtpZWmwmuv4agss/1iBVMXfFk\n' +
+ '+ZGtx5vytWU5XJmsfKA51KLsMQnhrLxb3X3zC+JRCyJoyc8++F3YEcRi2pkRYE3q\n' +
+ 'Hing\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIECTCCAvGgAwIBAgIRANxgyBbnxgTEOpDul2ZnC0UwDQYJKoZIhvcNAQELBQAw\n' +
+ 'gZwxCzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJ\n' +
+ 'bmMuMRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTE1MDMGA1UEAwws\n' +
+ 'QW1hem9uIFJEUyBhcC1zb3V0aGVhc3QtMyBSb290IENBIFJTQTIwNDggRzExEDAO\n' +
+ 'BgNVBAcMB1NlYXR0bGUwIBcNMjEwNjEwMTgxOTA3WhgPMjA2MTA2MTAxOTE5MDda\n' +
+ 'MIGcMQswCQYDVQQGEwJVUzEiMCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywg\n' +
+ 'SW5jLjETMBEGA1UECwwKQW1hem9uIFJEUzELMAkGA1UECAwCV0ExNTAzBgNVBAMM\n' +
+ 'LEFtYXpvbiBSRFMgYXAtc291dGhlYXN0LTMgUm9vdCBDQSBSU0EyMDQ4IEcxMRAw\n' +
+ 'DgYDVQQHDAdTZWF0dGxlMIIBIjANBgkqhkiG9w0BAQEFAAOCAQ8AMIIBCgKCAQEA\n' +
+ 'xnwSDAChrMkfk5TA4Dk8hKzStDlSlONzmd3fTG0Wqr5+x3EmFT6Ksiu/WIwEl9J2\n' +
+ 'K98UI7vYyuZfCxUKb1iMPeBdVGqk0zb92GpURd+Iz/+K1ps9ZLeGBkzR8mBmAi1S\n' +
+ 'OfpwKiTBzIv6E8twhEn4IUpHsdcuX/2Y78uESpJyM8O5CpkG0JaV9FNEbDkJeBUQ\n' +
+ 'Ao2qqNcH4R0Qcr5pyeqA9Zto1RswgL06BQMI9dTpfwSP5VvkvcNUaLl7Zv5WzLQE\n' +
+ 'JzORWePvdPzzvWEkY/3FPjxBypuYwssKaERW0fkPDmPtykktP9W/oJolKUFI6pXp\n' +
+ 'y+Y6p6/AVdnQD2zZjW5FhQIDAQABo0IwQDAPBgNVHRMBAf8EBTADAQH/MB0GA1Ud\n' +
+ 'DgQWBBT+jEKs96LC+/X4BZkUYUkzPfXdqTAOBgNVHQ8BAf8EBAMCAYYwDQYJKoZI\n' +
+ 'hvcNAQELBQADggEBAIGQqgqcQ6XSGkmNebzR6DhadTbfDmbYeN5N0Vuzv+Tdmufb\n' +
+ 'tMGjdjnYMg4B+IVnTKQb+Ox3pL9gbX6KglGK8HupobmIRtwKVth+gYYz3m0SL/Nk\n' +
+ 'haWPYzOm0x3tJm8jSdufJcEob4/ATce9JwseLl76pSWdl5A4lLjnhPPKudUDfH+1\n' +
+ 'BLNUi3lxpp6GkC8aWUPtupnhZuXddolTLOuA3GwTZySI44NfaFRm+o83N1jp+EwD\n' +
+ '6e94M4cTRzjUv6J3MZmSbdtQP/Tk1uz2K4bQZGP0PZC3bVpqiesdE/xr+wbu8uHr\n' +
+ 'cM1JXH0AmXf1yIkTgyWzmvt0k1/vgcw5ixAqvvE=\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIEATCCAumgAwIBAgIRAMhw98EQU18mIji+unM2YH8wDQYJKoZIhvcNAQELBQAw\n' +
+ 'gZgxCzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJ\n' +
+ 'bmMuMRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTExMC8GA1UEAwwo\n' +
+ 'QW1hem9uIFJEUyBhcC1zb3V0aC0yIFJvb3QgQ0EgUlNBMjA0OCBHMTEQMA4GA1UE\n' +
+ 'BwwHU2VhdHRsZTAgFw0yMjA2MDYyMTQyMjJaGA8yMDYyMDYwNjIyNDIyMlowgZgx\n' +
+ 'CzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMu\n' +
+ 'MRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTExMC8GA1UEAwwoQW1h\n' +
+ 'em9uIFJEUyBhcC1zb3V0aC0yIFJvb3QgQ0EgUlNBMjA0OCBHMTEQMA4GA1UEBwwH\n' +
+ 'U2VhdHRsZTCCASIwDQYJKoZIhvcNAQEBBQADggEPADCCAQoCggEBAIeeRoLfTm+7\n' +
+ 'vqm7ZlFSx+1/CGYHyYrOOryM4/Z3dqYVHFMgWTR7V3ziO8RZ6yUanrRcWVX3PZbF\n' +
+ 'AfX0KFE8OgLsXEZIX8odSrq86+/Th5eZOchB2fDBsUB7GuN2rvFBbM8lTI9ivVOU\n' +
+ 'lbuTnYyb55nOXN7TpmH2bK+z5c1y9RVC5iQsNAl6IJNvSN8VCqXh31eK5MlKB4DT\n' +
+ '+Y3OivCrSGsjM+UR59uZmwuFB1h+icE+U0p9Ct3Mjq3MzSX5tQb6ElTNGlfmyGpW\n' +
+ 'Kh7GQ5XU1KaKNZXoJ37H53woNSlq56bpVrKI4uv7ATpdpFubOnSLtpsKlpLdR3sy\n' +
+ 'Ws245200pC8CAwEAAaNCMEAwDwYDVR0TAQH/BAUwAwEB/zAdBgNVHQ4EFgQUp0ki\n' +
+ '6+eWvsnBjQhMxwMW5pwn7DgwDgYDVR0PAQH/BAQDAgGGMA0GCSqGSIb3DQEBCwUA\n' +
+ 'A4IBAQB2V8lv0aqbYQpj/bmVv/83QfE4vOxKCJAHv7DQ35cJsTyBdF+8pBczzi3t\n' +
+ '3VNL5IUgW6WkyuUOWnE0eqAFOUVj0yTS1jSAtfl3vOOzGJZmWBbqm9BKEdu1D8O6\n' +
+ 'sB8bnomwiab2tNDHPmUslpdDqdabbkWwNWzLJ97oGFZ7KNODMEPXWKWNxg33iHfS\n' +
+ '/nlmnrTVI3XgaNK9qLZiUrxu9Yz5gxi/1K+sG9/Dajd32ZxjRwDipOLiZbiXQrsd\n' +
+ 'qzIMY4GcWf3g1gHL5mCTfk7dG22h/rhPyGV0svaDnsb+hOt6sv1McMN6Y3Ou0mtM\n' +
+ '/UaAXojREmJmTSCNvs2aBny3/2sy\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIICrjCCAjSgAwIBAgIRAMnRxsKLYscJV8Qv5pWbL7swCgYIKoZIzj0EAwMwgZYx\n' +
+ 'CzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMu\n' +
+ 'MRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTEvMC0GA1UEAwwmQW1h\n' +
+ 'em9uIFJEUyBzYS1lYXN0LTEgUm9vdCBDQSBFQ0MzODQgRzExEDAOBgNVBAcMB1Nl\n' +
+ 'YXR0bGUwIBcNMjEwNTE5MTgxNjAxWhgPMjEyMTA1MTkxOTE2MDFaMIGWMQswCQYD\n' +
+ 'VQQGEwJVUzEiMCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywgSW5jLjETMBEG\n' +
+ 'A1UECwwKQW1hem9uIFJEUzELMAkGA1UECAwCV0ExLzAtBgNVBAMMJkFtYXpvbiBS\n' +
+ 'RFMgc2EtZWFzdC0xIFJvb3QgQ0EgRUNDMzg0IEcxMRAwDgYDVQQHDAdTZWF0dGxl\n' +
+ 'MHYwEAYHKoZIzj0CAQYFK4EEACIDYgAEjFOCZgTNVKxLKhUxffiDEvTLFhrmIqdO\n' +
+ 'dKqVdgDoELEzIHWDdC+19aDPitbCYtBVHl65ITu/9pn6mMUl5hhUNtfZuc6A+Iw1\n' +
+ 'sBe0v0qI3y9Q9HdQYrGgeHDh8M5P7E2ho0IwQDAPBgNVHRMBAf8EBTADAQH/MB0G\n' +
+ 'A1UdDgQWBBS5L7/8M0TzoBZk39Ps7BkfTB4yJTAOBgNVHQ8BAf8EBAMCAYYwCgYI\n' +
+ 'KoZIzj0EAwMDaAAwZQIwI43O0NtWKTgnVv9z0LO5UMZYgSve7GvGTwqktZYCMObE\n' +
+ 'rUI4QerXM9D6JwLy09mqAjEAypfkdLyVWtaElVDUyHFkihAS1I1oUxaaDrynLNQK\n' +
+ 'Ou/Ay+ns+J+GyvyDUjBpVVW1\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIF/jCCA+agAwIBAgIQR71Z8lTO5Sj+as2jB7IWXzANBgkqhkiG9w0BAQwFADCB\n' +
+ 'lzELMAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIElu\n' +
+ 'Yy4xEzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTAwLgYDVQQDDCdB\n' +
+ 'bWF6b24gUkRTIHVzLXdlc3QtMiBSb290IENBIFJTQTQwOTYgRzExEDAOBgNVBAcM\n' +
+ 'B1NlYXR0bGUwIBcNMjEwNTI0MjIwMzIwWhgPMjEyMTA1MjQyMzAzMjBaMIGXMQsw\n' +
+ 'CQYDVQQGEwJVUzEiMCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywgSW5jLjET\n' +
+ 'MBEGA1UECwwKQW1hem9uIFJEUzELMAkGA1UECAwCV0ExMDAuBgNVBAMMJ0FtYXpv\n' +
+ 'biBSRFMgdXMtd2VzdC0yIFJvb3QgQ0EgUlNBNDA5NiBHMTEQMA4GA1UEBwwHU2Vh\n' +
+ 'dHRsZTCCAiIwDQYJKoZIhvcNAQEBBQADggIPADCCAgoCggIBAM977bHIs1WJijrS\n' +
+ 'XQMfUOhmlJjr2v0K0UjPl52sE1TJ76H8umo1yR4T7Whkd9IwBHNGKXCJtJmMr9zp\n' +
+ 'fB38eLTu+5ydUAXdFuZpRMKBWwPVe37AdJRKqn5beS8HQjd3JXAgGKUNNuE92iqF\n' +
+ 'qi2fIqFMpnJXWo0FIW6s2Dl2zkORd7tH0DygcRi7lgVxCsw1BJQhFJon3y+IV8/F\n' +
+ 'bnbUXSNSDUnDW2EhvWSD8L+t4eiXYsozhDAzhBvojpxhPH9OB7vqFYw5qxFx+G0t\n' +
+ 'lSLX5iWi1jzzc3XyGnB6WInZDVbvnvJ4BGZ+dTRpOCvsoMIn9bz4EQTvu243c7aU\n' +
+ 'HbS/kvnCASNt+zk7C6lbmaq0AGNztwNj85Opn2enFciWZVnnJ/4OeefUWQxD0EPp\n' +
+ 'SjEd9Cn2IHzkBZrHCg+lWZJQBKbUVS0lLIMSsLQQ6WvR38jY7D2nxM1A93xWxwpt\n' +
+ 'ZtQnYRCVXH6zt2OwDAFePInWwxUjR5t/wu3XxPgpSfrmTi3WYtr1wFypAJ811e/P\n' +
+ 'yBtswWUQ6BNJQvy+KnOEeGfOwmtdDFYR+GOCfvCihzrKJrxOtHIieehR5Iw3cbXG\n' +
+ 'sm4pDzfMUVvDDz6C2M6PRlJhhClbatHCjik9hxFYEsAlqtVVK9pxaz9i8hOqSFQq\n' +
+ 'kJSQsgWw+oM/B2CyjcSqkSQEu8RLAgMBAAGjQjBAMA8GA1UdEwEB/wQFMAMBAf8w\n' +
+ 'HQYDVR0OBBYEFPmrdxpRRgu3IcaB5BTqlprcKdTsMA4GA1UdDwEB/wQEAwIBhjAN\n' +
+ 'BgkqhkiG9w0BAQwFAAOCAgEAVdlxWjPvVKky3kn8ZizeM4D+EsLw9dWLau2UD/ls\n' +
+ 'zwDCFoT6euagVeCknrn+YEl7g20CRYT9iaonGoMUPuMR/cdtPL1W/Rf40PSrGf9q\n' +
+ 'QuxavWiHLEXOQTCtCaVZMokkvjuuLNDXyZnstgECuiZECTwhexUF4oiuhyGk9o01\n' +
+ 'QMaiz4HX4lgk0ozALUvEzaNd9gWEwD2qe+rq9cQMTVq3IArUkvTIftZUaVUMzr0O\n' +
+ 'ed1+zAsNa9nJhURJ/6anJPJjbQgb5qA1asFcp9UaMT1ku36U3gnR1T/BdgG2jX3X\n' +
+ 'Um0UcaGNVPrH1ukInWW743pxWQb7/2sumEEMVh+jWbB18SAyLI4WIh4lkurdifzS\n' +
+ 'IuTFp8TEx+MouISFhz/vJDWZ84tqoLVjkEcP6oDypq9lFoEzHDJv3V1CYcIgOusT\n' +
+ 'k1jm9P7BXdTG7TYzUaTb9USb6bkqkD9EwJAOSs7DI94aE6rsSws2yAHavjAMfuMZ\n' +
+ 'sDAZvkqS2Qg2Z2+CI6wUZn7mzkJXbZoqRjDvChDXEB1mIhzVXhiNW/CR5WKVDvlj\n' +
+ '9v1sdGByh2pbxcLQtVaq/5coM4ANgphoNz3pOYUPWHS+JUrIivBZ+JobjXcxr3SN\n' +
+ '9iDzcu5/FVVNbq7+KN/nvPMngT+gduEN5m+EBjm8GukJymFG0m6BENRA0QSDqZ7k\n' +
+ 'zDY=\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIECTCCAvGgAwIBAgIRAK5EYG3iHserxMqgg+0EFjgwDQYJKoZIhvcNAQELBQAw\n' +
+ 'gZwxCzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJ\n' +
+ 'bmMuMRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTE1MDMGA1UEAwws\n' +
+ 'QW1hem9uIFJEUyBhcC1ub3J0aGVhc3QtMyBSb290IENBIFJTQTIwNDggRzExEDAO\n' +
+ 'BgNVBAcMB1NlYXR0bGUwIBcNMjEwNTI0MjAyMzE2WhgPMjA2MTA1MjQyMTIzMTZa\n' +
+ 'MIGcMQswCQYDVQQGEwJVUzEiMCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywg\n' +
+ 'SW5jLjETMBEGA1UECwwKQW1hem9uIFJEUzELMAkGA1UECAwCV0ExNTAzBgNVBAMM\n' +
+ 'LEFtYXpvbiBSRFMgYXAtbm9ydGhlYXN0LTMgUm9vdCBDQSBSU0EyMDQ4IEcxMRAw\n' +
+ 'DgYDVQQHDAdTZWF0dGxlMIIBIjANBgkqhkiG9w0BAQEFAAOCAQ8AMIIBCgKCAQEA\n' +
+ 's1L6TtB84LGraLHVC+rGPhLBW2P0oN/91Rq3AnYwqDOuTom7agANwEjvLq7dSRG/\n' +
+ 'sIfZsSV/ABTgArZ5sCmLjHFZAo8Kd45yA9byx20RcYtAG8IZl+q1Cri+s0XefzyO\n' +
+ 'U6mlfXZkVe6lzjlfXBkrlE/+5ifVbJK4dqOS1t9cWIpgKqv5fbE6Qbq4LVT+5/WM\n' +
+ 'Vd2BOljuBMGMzdZubqFKFq4mzTuIYfnBm7SmHlZfTdfBYPP1ScNuhpjuzw4n3NCR\n' +
+ 'EdU6dQv04Q6th4r7eiOCwbWI9LkmVbvBe3ylhH63lApC7MiiPYLlB13xBubVHVhV\n' +
+ 'q1NHoNTi+zA3MN9HWicRxQIDAQABo0IwQDAPBgNVHRMBAf8EBTADAQH/MB0GA1Ud\n' +
+ 'DgQWBBSuxoqm0/wjNiZLvqv+JlQwsDvTPDAOBgNVHQ8BAf8EBAMCAYYwDQYJKoZI\n' +
+ 'hvcNAQELBQADggEBAFfTK/j5kv90uIbM8VaFdVbr/6weKTwehafT0pAk1bfLVX+7\n' +
+ 'uf8oHgYiyKTTl0DFQicXejghXTeyzwoEkWSR8c6XkhD5vYG3oESqmt/RGvvoxz11\n' +
+ 'rHHy7yHYu7RIUc3VQG60c4qxXv/1mWySGwVwJrnuyNT9KZXPevu3jVaWOVHEILaK\n' +
+ 'HvzQ2YEcWBPmde/zEseO2QeeGF8FL45Q1d66wqIP4nNUd2pCjeTS5SpB0MMx7yi9\n' +
+ 'ki1OH1pv8tOuIdimtZ7wkdB8+JSZoaJ81b8sRrydRwJyvB88rftuI3YB4WwGuONT\n' +
+ 'ZezUPsmaoK69B0RChB0ofDpAaviF9V3xOWvVZfo=\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIGDzCCA/egAwIBAgIRAI0sMNG2XhaBMRN3zD7ZyoEwDQYJKoZIhvcNAQEMBQAw\n' +
+ 'gZ8xCzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJ\n' +
+ 'bmMuMRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTE4MDYGA1UEAwwv\n' +
+ 'QW1hem9uIFJEUyBQcmV2aWV3IHVzLWVhc3QtMiBSb290IENBIFJTQTQwOTYgRzEx\n' +
+ 'EDAOBgNVBAcMB1NlYXR0bGUwIBcNMjEwNTE4MjA1NzUwWhgPMjEyMTA1MTgyMTU3\n' +
+ 'NTBaMIGfMQswCQYDVQQGEwJVUzEiMCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNl\n' +
+ 'cywgSW5jLjETMBEGA1UECwwKQW1hem9uIFJEUzELMAkGA1UECAwCV0ExODA2BgNV\n' +
+ 'BAMML0FtYXpvbiBSRFMgUHJldmlldyB1cy1lYXN0LTIgUm9vdCBDQSBSU0E0MDk2\n' +
+ 'IEcxMRAwDgYDVQQHDAdTZWF0dGxlMIICIjANBgkqhkiG9w0BAQEFAAOCAg8AMIIC\n' +
+ 'CgKCAgEAh/otSiCu4Uw3hu7OJm0PKgLsLRqBmUS6jihcrkxfN2SHmp2zuRflkweU\n' +
+ 'BhMkebzL+xnNvC8okzbgPWtUxSmDnIRhE8J7bvSKFlqs/tmEdiI/LMqe/YIKcdsI\n' +
+ '20UYmvyLIjtDaJIh598SHHlF9P8DB5jD8snJfhxWY+9AZRN+YVTltgQAAgayxkWp\n' +
+ 'M1BbvxpOnz4CC00rE0eqkguXIUSuobb1vKqdKIenlYBNxm2AmtgvQfpsBIQ0SB+8\n' +
+ '8Zip8Ef5rtjSw5J3s2Rq0aYvZPfCVIsKYepIboVwXtD7E9J31UkB5onLBQlaHaA6\n' +
+ 'XlH4srsMmrew5d2XejQGy/lGZ1nVWNsKO0x/Az2QzY5Kjd6AlXZ8kq6H68hscA5i\n' +
+ 'OMbNlXzeEQsZH0YkId3+UsEns35AAjZv4qfFoLOu8vDotWhgVNT5DfdbIWZW3ZL8\n' +
+ 'qbmra3JnCHuaTwXMnc25QeKgVq7/rG00YB69tCIDwcf1P+tFJWxvaGtV0g2NthtB\n' +
+ 'a+Xo09eC0L53gfZZ3hZw1pa3SIF5dIZ6RFRUQ+lFOux3Q/I3u+rYstYw7Zxc4Zeo\n' +
+ 'Y8JiedpQXEAnbw2ECHix/L6mVWgiWCiDzBnNLLdbmXjJRnafNSndSfFtHCnY1SiP\n' +
+ 'aCrNpzwZIJejoV1zDlWAMO+gyS28EqzuIq3WJK/TFE7acHkdKIcCAwEAAaNCMEAw\n' +
+ 'DwYDVR0TAQH/BAUwAwEB/zAdBgNVHQ4EFgQUrmV1YASnuudfmqAZP4sKGTvScaEw\n' +
+ 'DgYDVR0PAQH/BAQDAgGGMA0GCSqGSIb3DQEBDAUAA4ICAQBGpEKeQoPvE85tN/25\n' +
+ 'qHFkys9oHDl93DZ62EnOqAUKLd6v0JpCyEiop4nlrJe+4KrBYVBPyKOJDcIqE2Sp\n' +
+ '3cvgJXLhY4i46VM3Qxe8yuYF1ElqBpg3jJVj/sCQnYz9dwoAMWIJFaDWOvmU2E7M\n' +
+ 'MRaKx+sPXFkIjiDA6Bv0m+VHef7aedSYIY7IDltEQHuXoqNacGrYo3I50R+fZs88\n' +
+ '/mB3e/V7967e99D6565yf9Lcjw4oQf2Hy7kl/6P9AuMz0LODnGITwh2TKk/Zo3RU\n' +
+ 'Vgq25RDrT4xJK6nFHyjUF6+4cOBxVpimmFw/VP1zaXT8DN5r4HyJ9p4YuSK8ha5N\n' +
+ '2pJc/exvU8Nv2+vS/efcDZWyuEdZ7eh1IJWQZlOZKIAONfRDRTpeQHJ3zzv3QVYy\n' +
+ 't78pYp/eWBHyVIfEE8p2lFKD4279WYe+Uvdb8c4Jm4TJwqkSJV8ifID7Ub80Lsir\n' +
+ 'lPAU3OCVTBeVRFPXT2zpC4PB4W6KBSuj6OOcEu2y/HgWcoi7Cnjvp0vFTUhDFdus\n' +
+ 'Wz3ucmJjfVsrkEO6avDKu4SwdbVHsk30TVAwPd6srIdi9U6MOeOQSOSE4EsrrS7l\n' +
+ 'SVmu2QIDUVFpm8QAHYplkyWIyGkupyl3ashH9mokQhixIU/Pzir0byePxHLHrwLu\n' +
+ '1axqeKpI0F5SBUPsaVNYY2uNFg==\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIECDCCAvCgAwIBAgIQCREfzzVyDTMcNME+gWnTCTANBgkqhkiG9w0BAQsFADCB\n' +
+ 'nDELMAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIElu\n' +
+ 'Yy4xEzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTUwMwYDVQQDDCxB\n' +
+ 'bWF6b24gUkRTIGFwLXNvdXRoZWFzdC0yIFJvb3QgQ0EgUlNBMjA0OCBHMTEQMA4G\n' +
+ 'A1UEBwwHU2VhdHRsZTAgFw0yMTA1MjQyMDQyMzNaGA8yMDYxMDUyNDIxNDIzM1ow\n' +
+ 'gZwxCzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJ\n' +
+ 'bmMuMRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTE1MDMGA1UEAwws\n' +
+ 'QW1hem9uIFJEUyBhcC1zb3V0aGVhc3QtMiBSb290IENBIFJTQTIwNDggRzExEDAO\n' +
+ 'BgNVBAcMB1NlYXR0bGUwggEiMA0GCSqGSIb3DQEBAQUAA4IBDwAwggEKAoIBAQDL\n' +
+ '1MT6br3L/4Pq87DPXtcjlXN3cnbNk2YqRAZHJayStTz8VtsFcGPJOpk14geRVeVk\n' +
+ 'e9uKFHRbcyr/RM4owrJTj5X4qcEuATYZbo6ou/rW2kYzuWFZpFp7lqm0vasV4Z9F\n' +
+ 'fChlhwkNks0UbM3G+psCSMNSoF19ERunj7w2c4E62LwujkeYLvKGNepjnaH10TJL\n' +
+ '2krpERd+ZQ4jIpObtRcMH++bTrvklc+ei8W9lqrVOJL+89v2piN3Ecdd389uphst\n' +
+ 'qQdb1BBVXbhUrtuGHgVf7zKqN1SkCoktoWxVuOprVWhSvr7akaWeq0UmlvbEsujU\n' +
+ 'vADqxGMcJFyCzxx3CkJjAgMBAAGjQjBAMA8GA1UdEwEB/wQFMAMBAf8wHQYDVR0O\n' +
+ 'BBYEFFk8UJmlhoxFT3PP12PvhvazHjT4MA4GA1UdDwEB/wQEAwIBhjANBgkqhkiG\n' +
+ '9w0BAQsFAAOCAQEAfFtr2lGoWVXmWAsIo2NYre7kzL8Xb9Tx7desKxCCz5HOOvIr\n' +
+ '8JMB1YK6A7IOvQsLJQ/f1UnKRh3X3mJZjKIywfrMSh0FiDf+rjcEzXxw2dGtUem4\n' +
+ 'A+WMvIA3jwxnJ90OQj5rQ8bg3iPtE6eojzo9vWQGw/Vu48Dtw1DJo9210Lq/6hze\n' +
+ 'hPhNkFh8fMXNT7Q1Wz/TJqJElyAQGNOXhyGpHKeb0jHMMhsy5UNoW5hLeMS5ffao\n' +
+ 'TBFWEJ1gVfxIU9QRxSh+62m46JIg+dwDlWv8Aww14KgepspRbMqDuaM2cinoejv6\n' +
+ 't3dyOyHHrsOyv3ffZUKtQhQbQr+sUcL89lARsg==\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIID/zCCAuegAwIBAgIRAIJLTMpzGNxqHZ4t+c1MlCIwDQYJKoZIhvcNAQELBQAw\n' +
+ 'gZcxCzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJ\n' +
+ 'bmMuMRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTEwMC4GA1UEAwwn\n' +
+ 'QW1hem9uIFJEUyBhcC1lYXN0LTEgUm9vdCBDQSBSU0EyMDQ4IEcxMRAwDgYDVQQH\n' +
+ 'DAdTZWF0dGxlMCAXDTIxMDUyNTIxMzAzM1oYDzIwNjEwNTI1MjIzMDMzWjCBlzEL\n' +
+ 'MAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4x\n' +
+ 'EzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTAwLgYDVQQDDCdBbWF6\n' +
+ 'b24gUkRTIGFwLWVhc3QtMSBSb290IENBIFJTQTIwNDggRzExEDAOBgNVBAcMB1Nl\n' +
+ 'YXR0bGUwggEiMA0GCSqGSIb3DQEBAQUAA4IBDwAwggEKAoIBAQDtdHut0ZhJ9Nn2\n' +
+ 'MpVafFcwHdoEzx06okmmhjJsNy4l9QYVeh0UUoek0SufRNMRF4d5ibzpgZol0Y92\n' +
+ '/qKWNe0jNxhEj6sXyHsHPeYtNBPuDMzThfbvsLK8z7pBP7vVyGPGuppqW/6m4ZBB\n' +
+ 'lcc9fsf7xpZ689iSgoyjiT6J5wlVgmCx8hFYc/uvcRtfd8jAHvheug7QJ3zZmIye\n' +
+ 'V4htOW+fRVWnBjf40Q+7uTv790UAqs0Zboj4Yil+hER0ibG62y1g71XcCyvcVpto\n' +
+ '2/XW7Y9NCgMNqQ7fGN3wR1gjtSYPd7DO32LTzYhutyvfbpAZjsAHnoObmoljcgXI\n' +
+ 'QjfBcCFpAgMBAAGjQjBAMA8GA1UdEwEB/wQFMAMBAf8wHQYDVR0OBBYEFJI3aWLg\n' +
+ 'CS5xqU5WYVaeT5s8lpO0MA4GA1UdDwEB/wQEAwIBhjANBgkqhkiG9w0BAQsFAAOC\n' +
+ 'AQEAUwATpJOcGVOs3hZAgJwznWOoTzOVJKfrqBum7lvkVH1vBwxBl9CahaKj3ZOt\n' +
+ 'YYp2qJzhDUWludL164DL4ZjS6eRedLRviyy5cRy0581l1MxPWTThs27z+lCC14RL\n' +
+ 'PJZNVYYdl7Jy9Q5NsQ0RBINUKYlRY6OqGDySWyuMPgno2GPbE8aynMdKP+f6G/uE\n' +
+ 'YHOf08gFDqTsbyfa70ztgVEJaRooVf5JJq4UQtpDvVswW2reT96qi6tXPKHN5qp3\n' +
+ '3wI0I1Mp4ePmiBKku2dwYzPfrJK/pQlvu0Gu5lKOQ65QdotwLAAoaFqrf9za1yYs\n' +
+ 'INUkHLWIxDds+4OHNYcerGp5Dw==\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIGCTCCA/GgAwIBAgIRAIO6ldra1KZvNWJ0TA1ihXEwDQYJKoZIhvcNAQEMBQAw\n' +
+ 'gZwxCzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJ\n' +
+ 'bmMuMRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTE1MDMGA1UEAwws\n' +
+ 'QW1hem9uIFJEUyBhcC1zb3V0aGVhc3QtMSBSb290IENBIFJTQTQwOTYgRzExEDAO\n' +
+ 'BgNVBAcMB1NlYXR0bGUwIBcNMjEwNTIxMjE0NTA1WhgPMjEyMTA1MjEyMjQ1MDVa\n' +
+ 'MIGcMQswCQYDVQQGEwJVUzEiMCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywg\n' +
+ 'SW5jLjETMBEGA1UECwwKQW1hem9uIFJEUzELMAkGA1UECAwCV0ExNTAzBgNVBAMM\n' +
+ 'LEFtYXpvbiBSRFMgYXAtc291dGhlYXN0LTEgUm9vdCBDQSBSU0E0MDk2IEcxMRAw\n' +
+ 'DgYDVQQHDAdTZWF0dGxlMIICIjANBgkqhkiG9w0BAQEFAAOCAg8AMIICCgKCAgEA\n' +
+ 'sDN52Si9pFSyZ1ruh3xAN0nVqEs960o2IK5CPu/ZfshFmzAwnx/MM8EHt/jMeZtj\n' +
+ 'SM58LADAsNDL01ELpFZATjgZQ6xNAyXRXE7RiTRUvNkK7O3o2qAGbLnJq/UqF7Sw\n' +
+ 'LRnB8V6hYOv+2EjVnohtGCn9SUFGZtYDjWXsLd4ML4Zpxv0a5LK7oEC7AHzbUR7R\n' +
+ 'jsjkrXqSv7GE7bvhSOhMkmgxgj1F3J0b0jdQdtyyj109aO0ATUmIvf+Bzadg5AI2\n' +
+ 'A9UA+TUcGeebhpHu8AP1Hf56XIlzPpaQv3ZJ4vzoLaVNUC7XKzAl1dlvCl7Klg/C\n' +
+ '84qmbD/tjZ6GHtzpLKgg7kQEV7mRoXq8X4wDX2AFPPQl2fv+Kbe+JODqm5ZjGegm\n' +
+ 'uskABBi8IFv1hYx9jEulZPxC6uD/09W2+niFm3pirnlWS83BwVDTUBzF+CooUIMT\n' +
+ 'jhWkIIZGDDgMJTzouBHfoSJtS1KpUZi99m2WyVs21MNKHeWAbs+zmI6TO5iiMC+T\n' +
+ 'uB8spaOiHFO1573Fmeer4sy3YA6qVoqVl6jjTQqOdy3frAMbCkwH22/crV8YA+08\n' +
+ 'hLeHXrMK+6XUvU+EtHAM3VzcrLbuYJUI2XJbzTj5g0Eb8I8JWsHvWHR5K7Z7gceR\n' +
+ '78AzxQmoGEfV6KABNWKsgoCQnfb1BidDJIe3BsI0A6UCAwEAAaNCMEAwDwYDVR0T\n' +
+ 'AQH/BAUwAwEB/zAdBgNVHQ4EFgQUABp0MlB14MSHgAcuNSOhs3MOlUcwDgYDVR0P\n' +
+ 'AQH/BAQDAgGGMA0GCSqGSIb3DQEBDAUAA4ICAQCv4CIOBSQi/QR9NxdRgVAG/pAh\n' +
+ 'tFJhV7OWb/wqwsNKFDtg6tTxwaahdCfWpGWId15OUe7G9LoPiKiwM9C92n0ZeHRz\n' +
+ '4ewbrQVo7Eu1JI1wf0rnZJISL72hVYKmlvaWaacHhWxvsbKLrB7vt6Cknxa+S993\n' +
+ 'Kf8i2Psw8j5886gaxhiUtzMTBwoDWak8ZaK7m3Y6C6hXQk08+3pnIornVSFJ9dlS\n' +
+ 'PAqt5UPwWmrEfF+0uIDORlT+cvrAwgSp7nUF1q8iasledycZ/BxFgQqzNwnkBDwQ\n' +
+ 'Z/aM52ArGsTzfMhkZRz9HIEhz1/0mJw8gZtDVQroD8778h8zsx2SrIz7eWQ6uWsD\n' +
+ 'QEeSWXpcheiUtEfzkDImjr2DLbwbA23c9LoexUD10nwohhoiQQg77LmvBVxeu7WU\n' +
+ 'E63JqaYUlOLOzEmNJp85zekIgR8UTkO7Gc+5BD7P4noYscI7pPOL5rP7YLg15ZFi\n' +
+ 'ega+G53NTckRXz4metsd8XFWloDjZJJq4FfD60VuxgXzoMNT9wpFTNSH42PR2s9L\n' +
+ 'I1vcl3w8yNccs9se2utM2nLsItZ3J0m/+QSRiw9hbrTYTcM9sXki0DtH2kyIOwYf\n' +
+ 'lOrGJDiYOIrXSQK36H0gQ+8omlrUTvUj4msvkXuQjlfgx6sgp2duOAfnGxE7uHnc\n' +
+ 'UhnJzzoe6M+LfGHkVQ==\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIICuDCCAj2gAwIBAgIQSAG6j2WHtWUUuLGJTPb1nTAKBggqhkjOPQQDAzCBmzEL\n' +
+ 'MAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4x\n' +
+ 'EzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTQwMgYDVQQDDCtBbWF6\n' +
+ 'b24gUkRTIGFwLW5vcnRoZWFzdC0yIFJvb3QgQ0EgRUNDMzg0IEcxMRAwDgYDVQQH\n' +
+ 'DAdTZWF0dGxlMCAXDTIxMDUyMDE2MzgyNloYDzIxMjEwNTIwMTczODI2WjCBmzEL\n' +
+ 'MAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4x\n' +
+ 'EzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTQwMgYDVQQDDCtBbWF6\n' +
+ 'b24gUkRTIGFwLW5vcnRoZWFzdC0yIFJvb3QgQ0EgRUNDMzg0IEcxMRAwDgYDVQQH\n' +
+ 'DAdTZWF0dGxlMHYwEAYHKoZIzj0CAQYFK4EEACIDYgAE2eqwU4FOzW8RV1W381Bd\n' +
+ 'olhDOrqoMqzWli21oDUt7y8OnXM/lmAuOS6sr8Nt61BLVbONdbr+jgCYw75KabrK\n' +
+ 'ZGg3siqvMOgabIKkKuXO14wtrGyGDt7dnKXg5ERGYOZlo0IwQDAPBgNVHRMBAf8E\n' +
+ 'BTADAQH/MB0GA1UdDgQWBBS1Acp2WYxOcblv5ikZ3ZIbRCCW+zAOBgNVHQ8BAf8E\n' +
+ 'BAMCAYYwCgYIKoZIzj0EAwMDaQAwZgIxAJL84J08PBprxmsAKPTotBuVI3MyW1r8\n' +
+ 'xQ0i8lgCQUf8GcmYjQ0jI4oZyv+TuYJAcwIxAP9Xpzq0Docxb+4N1qVhpiOfWt1O\n' +
+ 'FnemFiy9m1l+wv6p3riQMPV7mBVpklmijkIv3Q==\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIECTCCAvGgAwIBAgIRALZLcqCVIJ25maDPE3sbPCIwDQYJKoZIhvcNAQELBQAw\n' +
+ 'gZwxCzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJ\n' +
+ 'bmMuMRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTE1MDMGA1UEAwws\n' +
+ 'QW1hem9uIFJEUyBhcC1zb3V0aGVhc3QtMSBSb290IENBIFJTQTIwNDggRzExEDAO\n' +
+ 'BgNVBAcMB1NlYXR0bGUwIBcNMjEwNTIxMjEzOTM5WhgPMjA2MTA1MjEyMjM5Mzla\n' +
+ 'MIGcMQswCQYDVQQGEwJVUzEiMCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywg\n' +
+ 'SW5jLjETMBEGA1UECwwKQW1hem9uIFJEUzELMAkGA1UECAwCV0ExNTAzBgNVBAMM\n' +
+ 'LEFtYXpvbiBSRFMgYXAtc291dGhlYXN0LTEgUm9vdCBDQSBSU0EyMDQ4IEcxMRAw\n' +
+ 'DgYDVQQHDAdTZWF0dGxlMIIBIjANBgkqhkiG9w0BAQEFAAOCAQ8AMIIBCgKCAQEA\n' +
+ 'ypKc+6FfGx6Gl6fQ78WYS29QoKgQiur58oxR3zltWeg5fqh9Z85K5S3UbRSTqWWu\n' +
+ 'Xcfnkz0/FS07qHX+nWAGU27JiQb4YYqhjZNOAq8q0+ptFHJ6V7lyOqXBq5xOzO8f\n' +
+ '+0DlbJSsy7GEtJp7d7QCM3M5KVY9dENVZUKeJwa8PC5StvwPx4jcLeZRJC2rAVDG\n' +
+ 'SW7NAInbATvr9ssSh03JqjXb+HDyywiqoQ7EVLtmtXWimX+0b3/2vhqcH5jgcKC9\n' +
+ 'IGFydrjPbv4kwMrKnm6XlPZ9L0/3FMzanXPGd64LQVy51SI4d5Xymn0Mw2kMX8s6\n' +
+ 'Nf05OsWcDzJ1n6/Q1qHSxQIDAQABo0IwQDAPBgNVHRMBAf8EBTADAQH/MB0GA1Ud\n' +
+ 'DgQWBBRmaIc8eNwGP7i6P7AJrNQuK6OpFzAOBgNVHQ8BAf8EBAMCAYYwDQYJKoZI\n' +
+ 'hvcNAQELBQADggEBAIBeHfGwz3S2zwIUIpqEEI5/sMySDeS+3nJR+woWAHeO0C8i\n' +
+ 'BJdDh+kzzkP0JkWpr/4NWz84/IdYo1lqASd1Kopz9aT1+iROXaWr43CtbzjXb7/X\n' +
+ 'Zv7eZZFC8/lS5SROq42pPWl4ekbR0w8XGQElmHYcWS41LBfKeHCUwv83ATF0XQ6I\n' +
+ '4t+9YSqZHzj4vvedrvcRInzmwWJaal9s7Z6GuwTGmnMsN3LkhZ+/GD6oW3pU/Pyh\n' +
+ 'EtWqffjsLhfcdCs3gG8x9BbkcJPH5aPAVkPn4wc8wuXg6xxb9YGsQuY930GWTYRf\n' +
+ 'schbgjsuqznW4HHakq4WNhs1UdTSTKkRdZz7FUQ=\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIEDzCCAvegAwIBAgIRAM2zAbhyckaqRim63b+Tib8wDQYJKoZIhvcNAQELBQAw\n' +
+ 'gZ8xCzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJ\n' +
+ 'bmMuMRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTE4MDYGA1UEAwwv\n' +
+ 'QW1hem9uIFJEUyBQcmV2aWV3IHVzLWVhc3QtMiBSb290IENBIFJTQTIwNDggRzEx\n' +
+ 'EDAOBgNVBAcMB1NlYXR0bGUwIBcNMjEwNTE4MjA0OTQ1WhgPMjA2MTA1MTgyMTQ5\n' +
+ 'NDVaMIGfMQswCQYDVQQGEwJVUzEiMCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNl\n' +
+ 'cywgSW5jLjETMBEGA1UECwwKQW1hem9uIFJEUzELMAkGA1UECAwCV0ExODA2BgNV\n' +
+ 'BAMML0FtYXpvbiBSRFMgUHJldmlldyB1cy1lYXN0LTIgUm9vdCBDQSBSU0EyMDQ4\n' +
+ 'IEcxMRAwDgYDVQQHDAdTZWF0dGxlMIIBIjANBgkqhkiG9w0BAQEFAAOCAQ8AMIIB\n' +
+ 'CgKCAQEA1ybjQMH1MkbvfKsWJaCTXeCSN1SG5UYid+Twe+TjuSqaXWonyp4WRR5z\n' +
+ 'tlkqq+L2MWUeQQAX3S17ivo/t84mpZ3Rla0cx39SJtP3BiA2BwfUKRjhPwOjmk7j\n' +
+ '3zrcJjV5k1vSeLNOfFFSlwyDiVyLAE61lO6onBx+cRjelu0egMGq6WyFVidTdCmT\n' +
+ 'Q9Zw3W6LTrnPvPmEyjHy2yCHzH3E50KSd/5k4MliV4QTujnxYexI2eR8F8YQC4m3\n' +
+ 'DYjXt/MicbqA366SOoJA50JbgpuVv62+LSBu56FpzY12wubmDZsdn4lsfYKiWxUy\n' +
+ 'uc83a2fRXsJZ1d3whxrl20VFtLFHFQIDAQABo0IwQDAPBgNVHRMBAf8EBTADAQH/\n' +
+ 'MB0GA1UdDgQWBBRC0ytKmDYbfz0Bz0Psd4lRQV3aNTAOBgNVHQ8BAf8EBAMCAYYw\n' +
+ 'DQYJKoZIhvcNAQELBQADggEBAGv8qZu4uaeoF6zsbumauz6ea6tdcWt+hGFuwGrb\n' +
+ 'tRbI85ucAmVSX06x59DJClsb4MPhL1XmqO3RxVMIVVfRwRHWOsZQPnXm8OYQ2sny\n' +
+ 'rYuFln1COOz1U/KflZjgJmxbn8x4lYiTPZRLarG0V/OsCmnLkQLPtEl/spMu8Un7\n' +
+ 'r3K8SkbWN80gg17Q8EV5mnFwycUx9xsTAaFItuG0en9bGsMgMmy+ZsDmTRbL+lcX\n' +
+ 'Fq8r4LT4QjrFz0shrzCwuuM4GmcYtBSxlacl+HxYEtAs5k10tmzRf6OYlY33tGf6\n' +
+ '1tkYvKryxDPF/EDgGp/LiBwx6ixYMBfISoYASt4V/ylAlHA=\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIICtTCCAjqgAwIBAgIRAK9BSZU6nIe6jqfODmuVctYwCgYIKoZIzj0EAwMwgZkx\n' +
+ 'CzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMu\n' +
+ 'MRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTEyMDAGA1UEAwwpQW1h\n' +
+ 'em9uIFJEUyBjYS1jZW50cmFsLTEgUm9vdCBDQSBFQ0MzODQgRzExEDAOBgNVBAcM\n' +
+ 'B1NlYXR0bGUwIBcNMjEwNTIxMjIxMzA5WhgPMjEyMTA1MjEyMzEzMDlaMIGZMQsw\n' +
+ 'CQYDVQQGEwJVUzEiMCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywgSW5jLjET\n' +
+ 'MBEGA1UECwwKQW1hem9uIFJEUzELMAkGA1UECAwCV0ExMjAwBgNVBAMMKUFtYXpv\n' +
+ 'biBSRFMgY2EtY2VudHJhbC0xIFJvb3QgQ0EgRUNDMzg0IEcxMRAwDgYDVQQHDAdT\n' +
+ 'ZWF0dGxlMHYwEAYHKoZIzj0CAQYFK4EEACIDYgAEUkEERcgxneT5H+P+fERcbGmf\n' +
+ 'bVx+M7rNWtgWUr6w+OBENebQA9ozTkeSg4c4M+qdYSObFqjxITdYxT1z/nHz1gyx\n' +
+ 'OKAhLjWu+nkbRefqy3RwXaWT680uUaAP6ccnkZOMo0IwQDAPBgNVHRMBAf8EBTAD\n' +
+ 'AQH/MB0GA1UdDgQWBBSN6fxlg0s5Wny08uRBYZcQ3TUoyzAOBgNVHQ8BAf8EBAMC\n' +
+ 'AYYwCgYIKoZIzj0EAwMDaQAwZgIxAORaz+MBVoFBTmZ93j2G2vYTwA6T5hWzBWrx\n' +
+ 'CrI54pKn5g6At56DBrkjrwZF5T1enAIxAJe/LZ9xpDkAdxDgGJFN8gZYLRWc0NRy\n' +
+ 'Rb4hihy5vj9L+w9uKc9VfEBIFuhT7Z3ljg==\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIEADCCAuigAwIBAgIQB/57HSuaqUkLaasdjxUdPjANBgkqhkiG9w0BAQsFADCB\n' +
+ 'mDELMAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIElu\n' +
+ 'Yy4xEzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTEwLwYDVQQDDChB\n' +
+ 'bWF6b24gUkRTIGFwLXNvdXRoLTEgUm9vdCBDQSBSU0EyMDQ4IEcxMRAwDgYDVQQH\n' +
+ 'DAdTZWF0dGxlMCAXDTIxMDUxOTE3NDAzNFoYDzIwNjEwNTE5MTg0MDM0WjCBmDEL\n' +
+ 'MAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4x\n' +
+ 'EzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTEwLwYDVQQDDChBbWF6\n' +
+ 'b24gUkRTIGFwLXNvdXRoLTEgUm9vdCBDQSBSU0EyMDQ4IEcxMRAwDgYDVQQHDAdT\n' +
+ 'ZWF0dGxlMIIBIjANBgkqhkiG9w0BAQEFAAOCAQ8AMIIBCgKCAQEAtbkaoVsUS76o\n' +
+ 'TgLFmcnaB8cswBk1M3Bf4IVRcwWT3a1HeJSnaJUqWHCJ+u3ip/zGVOYl0gN1MgBb\n' +
+ 'MuQRIJiB95zGVcIa6HZtx00VezDTr3jgGWRHmRjNVCCHGmxOZWvJjsIE1xavT/1j\n' +
+ 'QYV/ph4EZEIZ/qPq7e3rHohJaHDe23Z7QM9kbyqp2hANG2JtU/iUhCxqgqUHNozV\n' +
+ 'Zd0l5K6KnltZQoBhhekKgyiHqdTrH8fWajYl5seD71bs0Axowb+Oh0rwmrws3Db2\n' +
+ 'Dh+oc2PwREnjHeca9/1C6J2vhY+V0LGaJmnnIuOANrslx2+bgMlyhf9j0Bv8AwSi\n' +
+ 'dSWsobOhNQIDAQABo0IwQDAPBgNVHRMBAf8EBTADAQH/MB0GA1UdDgQWBBQb7vJT\n' +
+ 'VciLN72yJGhaRKLn6Krn2TAOBgNVHQ8BAf8EBAMCAYYwDQYJKoZIhvcNAQELBQAD\n' +
+ 'ggEBAAxEj8N9GslReAQnNOBpGl8SLgCMTejQ6AW/bapQvzxrZrfVOZOYwp/5oV0f\n' +
+ '9S1jcGysDM+DrmfUJNzWxq2Y586R94WtpH4UpJDGqZp+FuOVJL313te4609kopzO\n' +
+ 'lDdmd+8z61+0Au93wB1rMiEfnIMkOEyt7D2eTFJfJRKNmnPrd8RjimRDlFgcLWJA\n' +
+ '3E8wca67Lz/G0eAeLhRHIXv429y8RRXDtKNNz0wA2RwURWIxyPjn1fHjA9SPDkeW\n' +
+ 'E1Bq7gZj+tBnrqz+ra3yjZ2blss6Ds3/uRY6NYqseFTZWmQWT7FolZEnT9vMUitW\n' +
+ 'I0VynUbShVpGf6946e0vgaaKw20=\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIID/jCCAuagAwIBAgIQGyUVTaVjYJvWhroVEiHPpDANBgkqhkiG9w0BAQsFADCB\n' +
+ 'lzELMAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIElu\n' +
+ 'Yy4xEzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTAwLgYDVQQDDCdB\n' +
+ 'bWF6b24gUkRTIHVzLXdlc3QtMSBSb290IENBIFJTQTIwNDggRzExEDAOBgNVBAcM\n' +
+ 'B1NlYXR0bGUwIBcNMjEwNTE5MTkwNDA2WhgPMjA2MTA1MTkyMDA0MDZaMIGXMQsw\n' +
+ 'CQYDVQQGEwJVUzEiMCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywgSW5jLjET\n' +
+ 'MBEGA1UECwwKQW1hem9uIFJEUzELMAkGA1UECAwCV0ExMDAuBgNVBAMMJ0FtYXpv\n' +
+ 'biBSRFMgdXMtd2VzdC0xIFJvb3QgQ0EgUlNBMjA0OCBHMTEQMA4GA1UEBwwHU2Vh\n' +
+ 'dHRsZTCCASIwDQYJKoZIhvcNAQEBBQADggEPADCCAQoCggEBANhyXpJ0t4nigRDZ\n' +
+ 'EwNtFOem1rM1k8k5XmziHKDvDk831p7QsX9ZOxl/BT59Pu/P+6W6SvasIyKls1sW\n' +
+ 'FJIjFF+6xRQcpoE5L5evMgN/JXahpKGeQJPOX9UEXVW5B8yi+/dyUitFT7YK5LZA\n' +
+ 'MqWBN/LtHVPa8UmE88RCDLiKkqiv229tmwZtWT7nlMTTCqiAHMFcryZHx0pf9VPh\n' +
+ 'x/iPV8p2gBJnuPwcz7z1kRKNmJ8/cWaY+9w4q7AYlAMaq/rzEqDaN2XXevdpsYAK\n' +
+ 'TMMj2kji4x1oZO50+VPNfBl5ZgJc92qz1ocF95SAwMfOUsP8AIRZkf0CILJYlgzk\n' +
+ '/6u6qZECAwEAAaNCMEAwDwYDVR0TAQH/BAUwAwEB/zAdBgNVHQ4EFgQUm5jfcS9o\n' +
+ '+LwL517HpB6hG+PmpBswDgYDVR0PAQH/BAQDAgGGMA0GCSqGSIb3DQEBCwUAA4IB\n' +
+ 'AQAcQ6lsqxi63MtpGk9XK8mCxGRLCad51+MF6gcNz6i6PAqhPOoKCoFqdj4cEQTF\n' +
+ 'F8dCfa3pvfJhxV6RIh+t5FCk/y6bWT8Ls/fYKVo6FhHj57bcemWsw/Z0XnROdVfK\n' +
+ 'Yqbc7zvjCPmwPHEqYBhjU34NcY4UF9yPmlLOL8uO1JKXa3CAR0htIoW4Pbmo6sA4\n' +
+ '6P0co/clW+3zzsQ92yUCjYmRNeSbdXbPfz3K/RtFfZ8jMtriRGuO7KNxp8MqrUho\n' +
+ 'HK8O0mlSUxGXBZMNicfo7qY8FD21GIPH9w5fp5oiAl7lqFzt3E3sCLD3IiVJmxbf\n' +
+ 'fUwpGd1XZBBSdIxysRLM6j48\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIICrTCCAjOgAwIBAgIQU+PAILXGkpoTcpF200VD/jAKBggqhkjOPQQDAzCBljEL\n' +
+ 'MAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4x\n' +
+ 'EzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMS8wLQYDVQQDDCZBbWF6\n' +
+ 'b24gUkRTIGFwLWVhc3QtMSBSb290IENBIEVDQzM4NCBHMTEQMA4GA1UEBwwHU2Vh\n' +
+ 'dHRsZTAgFw0yMTA1MjUyMTQ1MTFaGA8yMTIxMDUyNTIyNDUxMVowgZYxCzAJBgNV\n' +
+ 'BAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMuMRMwEQYD\n' +
+ 'VQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTEvMC0GA1UEAwwmQW1hem9uIFJE\n' +
+ 'UyBhcC1lYXN0LTEgUm9vdCBDQSBFQ0MzODQgRzExEDAOBgNVBAcMB1NlYXR0bGUw\n' +
+ 'djAQBgcqhkjOPQIBBgUrgQQAIgNiAAT3tFKE8Kw1sGQAvNLlLhd8OcGhlc7MiW/s\n' +
+ 'NXm3pOiCT4vZpawKvHBzD76Kcv+ZZzHRxQEmG1/muDzZGlKR32h8AAj+NNO2Wy3d\n' +
+ 'CKTtYMiVF6Z2zjtuSkZQdjuQbe4eQ7qjQjBAMA8GA1UdEwEB/wQFMAMBAf8wHQYD\n' +
+ 'VR0OBBYEFAiSQOp16Vv0Ohpvqcbd2j5RmhYNMA4GA1UdDwEB/wQEAwIBhjAKBggq\n' +
+ 'hkjOPQQDAwNoADBlAjBVsi+5Ape0kOhMt/WFkANkslD4qXA5uqhrfAtH29Xzz2NV\n' +
+ 'tR7akiA771OaIGB/6xsCMQCZt2egCtbX7J0WkuZ2KivTh66jecJr5DHvAP4X2xtS\n' +
+ 'F/5pS+AUhcKTEGjI9jDH3ew=\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIICuDCCAj2gAwIBAgIQT5mGlavQzFHsB7hV6Mmy6TAKBggqhkjOPQQDAzCBmzEL\n' +
+ 'MAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4x\n' +
+ 'EzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTQwMgYDVQQDDCtBbWF6\n' +
+ 'b24gUkRTIGFwLXNvdXRoZWFzdC0yIFJvb3QgQ0EgRUNDMzg0IEcxMRAwDgYDVQQH\n' +
+ 'DAdTZWF0dGxlMCAXDTIxMDUyNDIwNTAxNVoYDzIxMjEwNTI0MjE1MDE1WjCBmzEL\n' +
+ 'MAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4x\n' +
+ 'EzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTQwMgYDVQQDDCtBbWF6\n' +
+ 'b24gUkRTIGFwLXNvdXRoZWFzdC0yIFJvb3QgQ0EgRUNDMzg0IEcxMRAwDgYDVQQH\n' +
+ 'DAdTZWF0dGxlMHYwEAYHKoZIzj0CAQYFK4EEACIDYgAEcm4BBBjYK7clwm0HJRWS\n' +
+ 'flt3iYwoJbIXiXn9c1y3E+Vb7bmuyKhS4eO8mwO4GefUcXObRfoHY2TZLhMJLVBQ\n' +
+ '7MN2xDc0RtZNj07BbGD3VAIFRTDX0mH9UNYd0JQM3t/Oo0IwQDAPBgNVHRMBAf8E\n' +
+ 'BTADAQH/MB0GA1UdDgQWBBRrd5ITedfAwrGo4FA9UaDaGFK3rjAOBgNVHQ8BAf8E\n' +
+ 'BAMCAYYwCgYIKoZIzj0EAwMDaQAwZgIxAPBNqmVv1IIA3EZyQ6XuVf4gj79/DMO8\n' +
+ 'bkicNS1EcBpUqbSuU4Zwt2BYc8c/t7KVOQIxAOHoWkoKZPiKyCxfMtJpCZySUG+n\n' +
+ 'sXgB/LOyWE5BJcXUfm+T1ckeNoWeUUMOLmnJjg==\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIECTCCAvGgAwIBAgIRAJcDeinvdNrDQBeJ8+t38WQwDQYJKoZIhvcNAQELBQAw\n' +
+ 'gZwxCzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJ\n' +
+ 'bmMuMRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTE1MDMGA1UEAwws\n' +
+ 'QW1hem9uIFJEUyBhcC1zb3V0aGVhc3QtNCBSb290IENBIFJTQTIwNDggRzExEDAO\n' +
+ 'BgNVBAcMB1NlYXR0bGUwIBcNMjIwNTI1MTY0OTE2WhgPMjA2MjA1MjUxNzQ5MTZa\n' +
+ 'MIGcMQswCQYDVQQGEwJVUzEiMCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywg\n' +
+ 'SW5jLjETMBEGA1UECwwKQW1hem9uIFJEUzELMAkGA1UECAwCV0ExNTAzBgNVBAMM\n' +
+ 'LEFtYXpvbiBSRFMgYXAtc291dGhlYXN0LTQgUm9vdCBDQSBSU0EyMDQ4IEcxMRAw\n' +
+ 'DgYDVQQHDAdTZWF0dGxlMIIBIjANBgkqhkiG9w0BAQEFAAOCAQ8AMIIBCgKCAQEA\n' +
+ 'k8DBNkr9tMoIM0NHoFiO7cQfSX0cOMhEuk/CHt0fFx95IBytx7GHCnNzpM27O5z6\n' +
+ 'x6iRhfNnx+B6CrGyCzOjxvPizneY+h+9zfvNz9jj7L1I2uYMuiNyOKR6FkHR46CT\n' +
+ '1CiArfVLLPaTqgD/rQjS0GL2sLHS/0dmYipzynnZcs613XT0rAWdYDYgxDq7r/Yi\n' +
+ 'Xge5AkWQFkMUq3nOYDLCyGGfQqWKkwv6lZUHLCDKf+Y0Uvsrj8YGCI1O8mF0qPCQ\n' +
+ 'lmlfaDvbuBu1AV+aabmkvyFj3b8KRIlNLEtQ4N8KGYR2Jdb82S4YUGIOAt4wuuFt\n' +
+ '1B7AUDLk3V/u+HTWiwfoLQIDAQABo0IwQDAPBgNVHRMBAf8EBTADAQH/MB0GA1Ud\n' +
+ 'DgQWBBSNpcjz6ArWBtAA+Gz6kyyZxrrgdDAOBgNVHQ8BAf8EBAMCAYYwDQYJKoZI\n' +
+ 'hvcNAQELBQADggEBAGJEd7UgOzHYIcQRSF7nSYyjLROyalaIV9AX4WXW/Cqlul1c\n' +
+ 'MblP5etDZm7A/thliZIWAuyqv2bNicmS3xKvNy6/QYi1YgxZyy/qwJ3NdFl067W0\n' +
+ 't8nGo29B+EVK94IPjzFHWShuoktIgp+dmpijB7wkTIk8SmIoe9yuY4+hzgqk+bo4\n' +
+ 'ms2SOXSN1DoQ75Xv+YmztbnZM8MuWhL1T7hA4AMorzTQLJ9Pof8SpSdMHeDsHp0R\n' +
+ '01jogNFkwy25nw7cL62nufSuH2fPYGWXyNDg+y42wKsKWYXLRgUQuDVEJ2OmTFMB\n' +
+ 'T0Vf7VuNijfIA9hkN2d3K53m/9z5WjGPSdOjGhg=\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIID/jCCAuagAwIBAgIQRiwspKyrO0xoxDgSkqLZczANBgkqhkiG9w0BAQsFADCB\n' +
+ 'lzELMAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIElu\n' +
+ 'Yy4xEzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTAwLgYDVQQDDCdB\n' +
+ 'bWF6b24gUkRTIHVzLXdlc3QtMiBSb290IENBIFJTQTIwNDggRzExEDAOBgNVBAcM\n' +
+ 'B1NlYXR0bGUwIBcNMjEwNTI0MjE1OTAwWhgPMjA2MTA1MjQyMjU5MDBaMIGXMQsw\n' +
+ 'CQYDVQQGEwJVUzEiMCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywgSW5jLjET\n' +
+ 'MBEGA1UECwwKQW1hem9uIFJEUzELMAkGA1UECAwCV0ExMDAuBgNVBAMMJ0FtYXpv\n' +
+ 'biBSRFMgdXMtd2VzdC0yIFJvb3QgQ0EgUlNBMjA0OCBHMTEQMA4GA1UEBwwHU2Vh\n' +
+ 'dHRsZTCCASIwDQYJKoZIhvcNAQEBBQADggEPADCCAQoCggEBAL53Jk3GsKiu+4bx\n' +
+ 'jDfsevWbwPCNJ3H08Zp7GWhvI3Tgi39opfHYv2ku2BKFjK8N2L6RvNPSR8yplv5j\n' +
+ 'Y0tK0U+XVNl8o0ibhqRDhbTuh6KL8CFINWYzAajuxFS+CF0U6c1Q3tXLBdALxA7l\n' +
+ 'FlXJ71QrP06W31kRe7kvgrvO7qWU3/OzUf9qYw4LSiR1/VkvvRCTqcVNw09clw/M\n' +
+ 'Jbw6FSgweN65M9j7zPbjGAXSHkXyxH1Erin2fa+B9PE4ZDgX9cp2C1DHewYJQL/g\n' +
+ 'SepwwcudVNRN1ibKH7kpMrgPnaNIVNx5sXVsTjk6q2ZqYw3SVHegltJpLy/cZReP\n' +
+ 'mlivF2kCAwEAAaNCMEAwDwYDVR0TAQH/BAUwAwEB/zAdBgNVHQ4EFgQUmTcQd6o1\n' +
+ 'CuS65MjBrMwQ9JJjmBwwDgYDVR0PAQH/BAQDAgGGMA0GCSqGSIb3DQEBCwUAA4IB\n' +
+ 'AQAKSDSIzl956wVddPThf2VAzI8syw9ngSwsEHZvxVGHBvu5gg618rDyguVCYX9L\n' +
+ '4Kw/xJrk6S3qxOS2ZDyBcOpsrBskgahDFIunzoRP3a18ARQVq55LVgfwSDQiunch\n' +
+ 'Bd05cnFGLoiLkR5rrkgYaP2ftn3gRBRaf0y0S3JXZ2XB3sMZxGxavYq9mfiEcwB0\n' +
+ 'LMTMQ1NYzahIeG6Jm3LqRqR8HkzP/Ztq4dT2AtSLvFebbNMiWqeqT7OcYp94HTYT\n' +
+ 'zqrtaVdUg9bwyAUCDgy0GV9RHDIdNAOInU/4LEETovrtuBU7Z1q4tcHXvN6Hd1H8\n' +
+ 'gMb0mCG5I393qW5hFsA/diFb\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIECTCCAvGgAwIBAgIRAPQAvihfjBg/JDbj6U64K98wDQYJKoZIhvcNAQELBQAw\n' +
+ 'gZwxCzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJ\n' +
+ 'bmMuMRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTE1MDMGA1UEAwws\n' +
+ 'QW1hem9uIFJEUyBhcC1ub3J0aGVhc3QtMiBSb290IENBIFJTQTIwNDggRzExEDAO\n' +
+ 'BgNVBAcMB1NlYXR0bGUwIBcNMjEwNTIwMTYyODQxWhgPMjA2MTA1MjAxNzI4NDFa\n' +
+ 'MIGcMQswCQYDVQQGEwJVUzEiMCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywg\n' +
+ 'SW5jLjETMBEGA1UECwwKQW1hem9uIFJEUzELMAkGA1UECAwCV0ExNTAzBgNVBAMM\n' +
+ 'LEFtYXpvbiBSRFMgYXAtbm9ydGhlYXN0LTIgUm9vdCBDQSBSU0EyMDQ4IEcxMRAw\n' +
+ 'DgYDVQQHDAdTZWF0dGxlMIIBIjANBgkqhkiG9w0BAQEFAAOCAQ8AMIIBCgKCAQEA\n' +
+ 'vJ9lgyksCxkBlY40qOzI1TCj/Q0FVGuPL/Z1Mw2YN0l+41BDv0FHApjTUkIKOeIP\n' +
+ 'nwDwpXTa3NjYbk3cOZ/fpH2rYJ++Fte6PNDGPgKppVCUh6x3jiVZ1L7wOgnTdK1Q\n' +
+ 'Trw8440IDS5eLykRHvz8OmwvYDl0iIrt832V0QyOlHTGt6ZJ/aTQKl12Fy3QBLv7\n' +
+ 'stClPzvHTrgWqVU6uidSYoDtzHbU7Vda7YH0wD9IUoMBf7Tu0rqcE4uH47s2XYkc\n' +
+ 'SdLEoOg/Ngs7Y9B1y1GCyj3Ux7hnyvCoRTw014QyNB7dTatFMDvYlrRDGG14KeiU\n' +
+ 'UL7Vo/+EejWI31eXNLw84wIDAQABo0IwQDAPBgNVHRMBAf8EBTADAQH/MB0GA1Ud\n' +
+ 'DgQWBBQkgTWFsNg6wA3HbbihDQ4vpt1E2zAOBgNVHQ8BAf8EBAMCAYYwDQYJKoZI\n' +
+ 'hvcNAQELBQADggEBAGz1Asiw7hn5WYUj8RpOCzpE0h/oBZcnxP8wulzZ5Xd0YxWO\n' +
+ '0jYUcUk3tTQy1QvoY+Q5aCjg6vFv+oFBAxkib/SmZzp4xLisZIGlzpJQuAgRkwWA\n' +
+ '6BVMgRS+AaOMQ6wKPgz1x4v6T0cIELZEPq3piGxvvqkcLZKdCaeC3wCS6sxuafzZ\n' +
+ '4qA3zMwWuLOzRftgX2hQto7d/2YkRXga7jSvQl3id/EI+xrYoH6zIWgjdU1AUaNq\n' +
+ 'NGT7DIo47vVMfnd9HFZNhREsd4GJE83I+JhTqIxiKPNxrKgESzyADmNPt0gXDnHo\n' +
+ 'tbV1pMZz5HpJtjnP/qVZhEK5oB0tqlKPv9yx074=\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIICuTCCAj6gAwIBAgIRAKp1Rn3aL/g/6oiHVIXtCq8wCgYIKoZIzj0EAwMwgZsx\n' +
+ 'CzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMu\n' +
+ 'MRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTE0MDIGA1UEAwwrQW1h\n' +
+ 'em9uIFJEUyBhcC1ub3J0aGVhc3QtMyBSb290IENBIEVDQzM4NCBHMTEQMA4GA1UE\n' +
+ 'BwwHU2VhdHRsZTAgFw0yMTA1MjQyMDMyMTdaGA8yMTIxMDUyNDIxMzIxN1owgZsx\n' +
+ 'CzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMu\n' +
+ 'MRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTE0MDIGA1UEAwwrQW1h\n' +
+ 'em9uIFJEUyBhcC1ub3J0aGVhc3QtMyBSb290IENBIEVDQzM4NCBHMTEQMA4GA1UE\n' +
+ 'BwwHU2VhdHRsZTB2MBAGByqGSM49AgEGBSuBBAAiA2IABGTYWPILeBJXfcL3Dz4z\n' +
+ 'EWMUq78xB1HpjBwHoTURYfcMd5r96BTVG6yaUBWnAVCMeeD6yTG9a1eVGNhG14Hk\n' +
+ 'ZAEjgLiNB7RRbEG5JZ/XV7W/vODh09WCst2y9SLKsdgeAaNCMEAwDwYDVR0TAQH/\n' +
+ 'BAUwAwEB/zAdBgNVHQ4EFgQUoE0qZHmDCDB+Bnm8GUa/evpfPwgwDgYDVR0PAQH/\n' +
+ 'BAQDAgGGMAoGCCqGSM49BAMDA2kAMGYCMQCnil5MMwhY3qoXv0xvcKZGxGPaBV15\n' +
+ '0CCssCKn0oVtdJQfJQ3Jrf3RSaEyijXIJsoCMQC35iJi4cWoNX3N/qfgnHohW52O\n' +
+ 'B5dg0DYMqy5cNZ40+UcAanRMyqNQ6P7fy3umGco=\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIICtzCCAj2gAwIBAgIQPXnDTPegvJrI98qz8WxrMjAKBggqhkjOPQQDAzCBmzEL\n' +
+ 'MAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4x\n' +
+ 'EzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTQwMgYDVQQDDCtBbWF6\n' +
+ 'b24gUkRTIEJldGEgdXMtZWFzdC0xIFJvb3QgQ0EgRUNDMzg0IEcxMRAwDgYDVQQH\n' +
+ 'DAdTZWF0dGxlMCAXDTIxMDUxODIxNDAxMloYDzIxMjEwNTE4MjI0MDEyWjCBmzEL\n' +
+ 'MAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4x\n' +
+ 'EzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTQwMgYDVQQDDCtBbWF6\n' +
+ 'b24gUkRTIEJldGEgdXMtZWFzdC0xIFJvb3QgQ0EgRUNDMzg0IEcxMRAwDgYDVQQH\n' +
+ 'DAdTZWF0dGxlMHYwEAYHKoZIzj0CAQYFK4EEACIDYgAEI0sR7gwutK5AB46hM761\n' +
+ 'gcLTGBIYlURSEoM1jcBwy56CL+3CJKZwLLyJ7qoOKfWbu5GsVLUTWS8MV6Nw33cx\n' +
+ '2KQD2svb694wi+Px2f4n9+XHkEFQw8BbiodDD7RZA70fo0IwQDAPBgNVHRMBAf8E\n' +
+ 'BTADAQH/MB0GA1UdDgQWBBTQSioOvnVLEMXwNSDg+zgln/vAkjAOBgNVHQ8BAf8E\n' +
+ 'BAMCAYYwCgYIKoZIzj0EAwMDaAAwZQIxAMwu1hqm5Bc98uE/E0B5iMYbBQ4kpMxO\n' +
+ 'tP8FTfz5UR37HUn26nXE0puj6S/Ffj4oJgIwXI7s2c26tFQeqzq6u3lrNJHp5jC9\n' +
+ 'Uxlo/hEJOLoDj5jnpxo8dMAtCNoQPaHdfL0P\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIICrjCCAjWgAwIBAgIQGKVv+5VuzEZEBzJ+bVfx2zAKBggqhkjOPQQDAzCBlzEL\n' +
+ 'MAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4x\n' +
+ 'EzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTAwLgYDVQQDDCdBbWF6\n' +
+ 'b24gUkRTIGFwLXNvdXRoLTEgUm9vdCBDQSBFQ0MzODQgRzExEDAOBgNVBAcMB1Nl\n' +
+ 'YXR0bGUwIBcNMjEwNTE5MTc1MDU5WhgPMjEyMTA1MTkxODUwNTlaMIGXMQswCQYD\n' +
+ 'VQQGEwJVUzEiMCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywgSW5jLjETMBEG\n' +
+ 'A1UECwwKQW1hem9uIFJEUzELMAkGA1UECAwCV0ExMDAuBgNVBAMMJ0FtYXpvbiBS\n' +
+ 'RFMgYXAtc291dGgtMSBSb290IENBIEVDQzM4NCBHMTEQMA4GA1UEBwwHU2VhdHRs\n' +
+ 'ZTB2MBAGByqGSM49AgEGBSuBBAAiA2IABMqdLJ0tZF/DGFZTKZDrGRJZID8ivC2I\n' +
+ 'JRCYTWweZKCKSCAzoiuGGHzJhr5RlLHQf/QgmFcgXsdmO2n3CggzhA4tOD9Ip7Lk\n' +
+ 'P05eHd2UPInyPCHRgmGjGb0Z+RdQ6zkitKNCMEAwDwYDVR0TAQH/BAUwAwEB/zAd\n' +
+ 'BgNVHQ4EFgQUC1yhRgVqU5bR8cGzOUCIxRpl4EYwDgYDVR0PAQH/BAQDAgGGMAoG\n' +
+ 'CCqGSM49BAMDA2cAMGQCMG0c/zLGECRPzGKJvYCkpFTCUvdP4J74YP0v/dPvKojL\n' +
+ 't/BrR1Tg4xlfhaib7hPc7wIwFvgqHes20CubQnZmswbTKLUrgSUW4/lcKFpouFd2\n' +
+ 't2/ewfi/0VhkeUW+IiHhOMdU\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIGCTCCA/GgAwIBAgIRAOXxJuyXVkbfhZCkS/dOpfEwDQYJKoZIhvcNAQEMBQAw\n' +
+ 'gZwxCzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJ\n' +
+ 'bmMuMRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTE1MDMGA1UEAwws\n' +
+ 'QW1hem9uIFJEUyBhcC1ub3J0aGVhc3QtMSBSb290IENBIFJTQTQwOTYgRzExEDAO\n' +
+ 'BgNVBAcMB1NlYXR0bGUwIBcNMjEwNTI1MjE1OTEwWhgPMjEyMTA1MjUyMjU5MTBa\n' +
+ 'MIGcMQswCQYDVQQGEwJVUzEiMCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywg\n' +
+ 'SW5jLjETMBEGA1UECwwKQW1hem9uIFJEUzELMAkGA1UECAwCV0ExNTAzBgNVBAMM\n' +
+ 'LEFtYXpvbiBSRFMgYXAtbm9ydGhlYXN0LTEgUm9vdCBDQSBSU0E0MDk2IEcxMRAw\n' +
+ 'DgYDVQQHDAdTZWF0dGxlMIICIjANBgkqhkiG9w0BAQEFAAOCAg8AMIICCgKCAgEA\n' +
+ 'xiP4RDYm4tIS12hGgn1csfO8onQDmK5SZDswUpl0HIKXOUVVWkHNlINkVxbdqpqH\n' +
+ 'FhbyZmNN6F/EWopotMDKe1B+NLrjNQf4zefv2vyKvPHJXhxoKmfyuTd5Wk8k1F7I\n' +
+ 'lNwLQzznB+ElhrLIDJl9Ro8t31YBBNFRGAGEnxyACFGcdkjlsa52UwfYrwreEg2l\n' +
+ 'gW5AzqHgjFfj9QRLydeU/n4bHm0F1adMsV7P3rVwilcUlqsENDwXnWyPEyv3sw6F\n' +
+ 'wNemLEs1129mB77fwvySb+lLNGsnzr8w4wdioZ74co+T9z2ca+eUiP+EQccVw1Is\n' +
+ 'D4Fh57IjPa6Wuc4mwiUYKkKY63+38aCfEWb0Qoi+zW+mE9nek6MOQ914cN12u5LX\n' +
+ 'dBoYopphRO5YmubSN4xcBy405nIdSdbrAVWwxXnVVyjqjknmNeqQsPZaxAhdoKhV\n' +
+ 'AqxNr8AUAdOAO6Sz3MslmcLlDXFihrEEOeUbpg/m1mSUUHGbu966ajTG1FuEHHwS\n' +
+ '7WB52yxoJo/tHvt9nAWnh3uH5BHmS8zn6s6CGweWKbX5yICnZ1QFR1e4pogxX39v\n' +
+ 'XD6YcNOO+Vn+HY4nXmjgSYVC7l+eeP8eduMg1xJujzjrbmrXU+d+cBObgdTOAlpa\n' +
+ 'JFHaGwYw1osAwPCo9cZ2f04yitBfj9aPFia8ASKldakCAwEAAaNCMEAwDwYDVR0T\n' +
+ 'AQH/BAUwAwEB/zAdBgNVHQ4EFgQUqKS+ltlior0SyZKYAkJ/efv55towDgYDVR0P\n' +
+ 'AQH/BAQDAgGGMA0GCSqGSIb3DQEBDAUAA4ICAQAdElvp8bW4B+Cv+1WSN87dg6TN\n' +
+ 'wGyIjJ14/QYURgyrZiYpUmZpj+/pJmprSWXu4KNyqHftmaidu7cdjL5nCAvAfnY5\n' +
+ '/6eDDbX4j8Gt9fb/6H9y0O0dn3mUPSEKG0crR+JRFAtPhn/2FNvst2P82yguWLv0\n' +
+ 'pHjHVUVcq+HqDMtUIJsTPYjSh9Iy77Q6TOZKln9dyDOWJpCSkiUWQtMAKbCSlvzd\n' +
+ 'zTs/ahqpT+zLfGR1SR+T3snZHgQnbnemmz/XtlKl52NxccARwfcEEKaCRQyGq/pR\n' +
+ '0PVZasyJS9JY4JfQs4YOdeOt4UMZ8BmW1+BQWGSkkb0QIRl8CszoKofucAlqdPcO\n' +
+ 'IT/ZaMVhI580LFGWiQIizWFskX6lqbCyHqJB3LDl8gJISB5vNTHOHpvpMOMs5PYt\n' +
+ 'cRl5Mrksx5MKMqG7y5R734nMlZxQIHjL5FOoOxTBp9KeWIL/Ib89T2QDaLw1SQ+w\n' +
+ 'ihqWBJ4ZdrIMWYpP3WqM+MXWk7WAem+xsFJdR+MDgOOuobVQTy5dGBlPks/6gpjm\n' +
+ 'rO9TjfQ36ppJ3b7LdKUPeRfnYmlR5RU4oyYJ//uLbClI443RZAgxaCXX/nyc12lr\n' +
+ 'eVLUMNF2abLX4/VF63m2/Z9ACgMRfqGshPssn1NN33OonrotQoj4S3N9ZrjvzKt8\n' +
+ 'iHcaqd60QKpfiH2A3A==\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIICuDCCAj2gAwIBAgIQPaVGRuu86nh/ylZVCLB0MzAKBggqhkjOPQQDAzCBmzEL\n' +
+ 'MAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4x\n' +
+ 'EzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTQwMgYDVQQDDCtBbWF6\n' +
+ 'b24gUkRTIGFwLW5vcnRoZWFzdC0xIFJvb3QgQ0EgRUNDMzg0IEcxMRAwDgYDVQQH\n' +
+ 'DAdTZWF0dGxlMCAXDTIxMDUyNTIyMDMxNloYDzIxMjEwNTI1MjMwMzE2WjCBmzEL\n' +
+ 'MAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4x\n' +
+ 'EzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTQwMgYDVQQDDCtBbWF6\n' +
+ 'b24gUkRTIGFwLW5vcnRoZWFzdC0xIFJvb3QgQ0EgRUNDMzg0IEcxMRAwDgYDVQQH\n' +
+ 'DAdTZWF0dGxlMHYwEAYHKoZIzj0CAQYFK4EEACIDYgAEexNURoB9KE93MEtEAlJG\n' +
+ 'obz4LS/pD2hc8Gczix1WhVvpJ8bN5zCDXaKdnDMCebetyRQsmQ2LYlfmCwpZwSDu\n' +
+ '0zowB11Pt3I5Avu2EEcuKTlKIDMBeZ1WWuOd3Tf7MEAMo0IwQDAPBgNVHRMBAf8E\n' +
+ 'BTADAQH/MB0GA1UdDgQWBBSaYbZPBvFLikSAjpa8mRJvyArMxzAOBgNVHQ8BAf8E\n' +
+ 'BAMCAYYwCgYIKoZIzj0EAwMDaQAwZgIxAOEJkuh3Zjb7Ih/zuNRd1RBqmIYcnyw0\n' +
+ 'nwUZczKXry+9XebYj3VQxSRNadrarPWVqgIxAMg1dyGoDAYjY/L/9YElyMnvHltO\n' +
+ 'PwpJShmqHvCLc/mXMgjjYb/akK7yGthvW6j/uQ==\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIGCDCCA/CgAwIBAgIQChu3v5W1Doil3v6pgRIcVzANBgkqhkiG9w0BAQwFADCB\n' +
+ 'nDELMAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIElu\n' +
+ 'Yy4xEzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTUwMwYDVQQDDCxB\n' +
+ 'bWF6b24gUkRTIEJldGEgdXMtZWFzdC0xIFJvb3QgQ0EgUlNBNDA5NiBHMTEQMA4G\n' +
+ 'A1UEBwwHU2VhdHRsZTAgFw0yMTA1MTgyMTM0MTVaGA8yMTIxMDUxODIyMzQxNVow\n' +
+ 'gZwxCzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJ\n' +
+ 'bmMuMRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTE1MDMGA1UEAwws\n' +
+ 'QW1hem9uIFJEUyBCZXRhIHVzLWVhc3QtMSBSb290IENBIFJTQTQwOTYgRzExEDAO\n' +
+ 'BgNVBAcMB1NlYXR0bGUwggIiMA0GCSqGSIb3DQEBAQUAA4ICDwAwggIKAoICAQC1\n' +
+ 'FUGQ5tf3OwpDR6hGBxhUcrkwKZhaXP+1St1lSOQvjG8wXT3RkKzRGMvb7Ee0kzqI\n' +
+ 'mzKKe4ASIhtV3UUWdlNmP0EA3XKnif6N79MismTeGkDj75Yzp5A6tSvqByCgxIjK\n' +
+ 'JqpJrch3Dszoyn8+XhwDxMZtkUa5nQVdJgPzJ6ltsQ8E4SWLyLtTu0S63jJDkqYY\n' +
+ 'S7cQblk7y7fel+Vn+LS5dGTdRRhMvSzEnb6mkVBaVzRyVX90FNUED06e8q+gU8Ob\n' +
+ 'htvQlf9/kRzHwRAdls2YBhH40ZeyhpUC7vdtPwlmIyvW5CZ/QiG0yglixnL6xahL\n' +
+ 'pbmTuTSA/Oqz4UGQZv2WzHe1lD2gRHhtFX2poQZeNQX8wO9IcUhrH5XurW/G9Xwl\n' +
+ 'Sat9CMPERQn4KC3HSkat4ir2xaEUrjfg6c4XsGyh2Pk/LZ0gLKum0dyWYpWP4JmM\n' +
+ 'RQNjrInXPbMhzQObozCyFT7jYegS/3cppdyy+K1K7434wzQGLU1gYXDKFnXwkX8R\n' +
+ 'bRKgx2pHNbH5lUddjnNt75+e8m83ygSq/ZNBUz2Ur6W2s0pl6aBjwaDES4VfWYlI\n' +
+ 'jokcmrGvJNDfQWygb1k00eF2bzNeNCHwgWsuo3HSxVgc/WGsbcGrTlDKfz+g3ich\n' +
+ 'bXUeUidPhRiv5UQIVCLIHpHuin3bj9lQO/0t6p+tAQIDAQABo0IwQDAPBgNVHRMB\n' +
+ 'Af8EBTADAQH/MB0GA1UdDgQWBBSFmMBgm5IsRv3hLrvDPIhcPweXYTAOBgNVHQ8B\n' +
+ 'Af8EBAMCAYYwDQYJKoZIhvcNAQEMBQADggIBAAa2EuozymOsQDJlEi7TqnyA2OhT\n' +
+ 'GXPfYqCyMJVkfrqNgcnsNpCAiNEiZbb+8sIPXnT8Ay8hrwJYEObJ5b7MHXpLuyft\n' +
+ 'z0Pu1oFLKnQxKjNxrIsCvaB4CRRdYjm1q7EqGhMGv76se9stOxkOqO9it31w/LoU\n' +
+ 'ENDk7GLsSqsV1OzYLhaH8t+MaNP6rZTSNuPrHwbV3CtBFl2TAZ7iKgKOhdFz1Hh9\n' +
+ 'Pez0lG+oKi4mHZ7ajov6PD0W7njn5KqzCAkJR6OYmlNVPjir+c/vUtEs0j+owsMl\n' +
+ 'g7KE5g4ZpTRShyh5BjCFRK2tv0tkqafzNtxrKC5XNpEkqqVTCnLcKG+OplIEadtr\n' +
+ 'C7UWf4HyhCiR+xIyxFyR05p3uY/QQU/5uza7GlK0J+U1sBUytx7BZ+Fo8KQfPPqV\n' +
+ 'CqDCaYUksoJcnJE/KeoksyqNQys7sDGJhkd0NeUGDrFLKHSLhIwAMbEWnqGxvhli\n' +
+ 'E7sP2E5rI/I9Y9zTbLIiI8pfeZlFF8DBdoP/Hzg8pqsiE/yiXSFTKByDwKzGwNqz\n' +
+ 'F0VoFdIZcIbLdDbzlQitgGpJtvEL7HseB0WH7B2PMMD8KPJlYvPveO3/6OLzCsav\n' +
+ '+CAkvk47NQViKMsUTKOA0JDCW+u981YRozxa3K081snhSiSe83zIPBz1ikldXxO9\n' +
+ '6YYLNPRrj3mi9T/f\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIICrjCCAjSgAwIBAgIRAMkvdFnVDb0mWWFiXqnKH68wCgYIKoZIzj0EAwMwgZYx\n' +
+ 'CzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMu\n' +
+ 'MRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTEvMC0GA1UEAwwmQW1h\n' +
+ 'em9uIFJEUyB1cy13ZXN0LTEgUm9vdCBDQSBFQ0MzODQgRzExEDAOBgNVBAcMB1Nl\n' +
+ 'YXR0bGUwIBcNMjEwNTE5MTkxMzI0WhgPMjEyMTA1MTkyMDEzMjRaMIGWMQswCQYD\n' +
+ 'VQQGEwJVUzEiMCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywgSW5jLjETMBEG\n' +
+ 'A1UECwwKQW1hem9uIFJEUzELMAkGA1UECAwCV0ExLzAtBgNVBAMMJkFtYXpvbiBS\n' +
+ 'RFMgdXMtd2VzdC0xIFJvb3QgQ0EgRUNDMzg0IEcxMRAwDgYDVQQHDAdTZWF0dGxl\n' +
+ 'MHYwEAYHKoZIzj0CAQYFK4EEACIDYgAEy86DB+9th/0A5VcWqMSWDxIUblWTt/R0\n' +
+ 'ao6Z2l3vf2YDF2wt1A2NIOGpfQ5+WAOJO/IQmnV9LhYo+kacB8sOnXdQa6biZZkR\n' +
+ 'IyouUfikVQAKWEJnh1Cuo5YMM4E2sUt5o0IwQDAPBgNVHRMBAf8EBTADAQH/MB0G\n' +
+ 'A1UdDgQWBBQ8u3OnecANmG8OoT7KLWDuFzZwBTAOBgNVHQ8BAf8EBAMCAYYwCgYI\n' +
+ 'KoZIzj0EAwMDaAAwZQIwQ817qkb7mWJFnieRAN+m9W3E0FLVKaV3zC5aYJUk2fcZ\n' +
+ 'TaUx3oLp3jPLGvY5+wgeAjEA6wAicAki4ZiDfxvAIuYiIe1OS/7H5RA++R8BH6qG\n' +
+ 'iRzUBM/FItFpnkus7u/eTkvo\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIICrzCCAjWgAwIBAgIQS/+Ryfgb/IOVEa1pWoe8oTAKBggqhkjOPQQDAzCBlzEL\n' +
+ 'MAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4x\n' +
+ 'EzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTAwLgYDVQQDDCdBbWF6\n' +
+ 'b24gUkRTIGFwLXNvdXRoLTIgUm9vdCBDQSBFQ0MzODQgRzExEDAOBgNVBAcMB1Nl\n' +
+ 'YXR0bGUwIBcNMjIwNjA2MjE1NDQyWhgPMjEyMjA2MDYyMjU0NDJaMIGXMQswCQYD\n' +
+ 'VQQGEwJVUzEiMCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywgSW5jLjETMBEG\n' +
+ 'A1UECwwKQW1hem9uIFJEUzELMAkGA1UECAwCV0ExMDAuBgNVBAMMJ0FtYXpvbiBS\n' +
+ 'RFMgYXAtc291dGgtMiBSb290IENBIEVDQzM4NCBHMTEQMA4GA1UEBwwHU2VhdHRs\n' +
+ 'ZTB2MBAGByqGSM49AgEGBSuBBAAiA2IABDsX6fhdUWBQpYTdseBD/P3s96Dtw2Iw\n' +
+ 'OrXKNToCnmX5nMkUGdRn9qKNiz1pw3EPzaPxShbYwQ7LYP09ENK/JN4QQjxMihxC\n' +
+ 'jLFxS85nhBQQQGRCWikDAe38mD8fSvREQKNCMEAwDwYDVR0TAQH/BAUwAwEB/zAd\n' +
+ 'BgNVHQ4EFgQUIh1xZiseQYFjPYKJmGbruAgRH+AwDgYDVR0PAQH/BAQDAgGGMAoG\n' +
+ 'CCqGSM49BAMDA2gAMGUCMFudS4zLy+UUGrtgNLtRMcu/DZ9BUzV4NdHxo0bkG44O\n' +
+ 'thnjl4+wTKI6VbyAbj2rkgIxAOHps8NMITU5DpyiMnKTxV8ubb/WGHrLl0BjB8Lw\n' +
+ 'ETVJk5DNuZvsIIcm7ykk6iL4Tw==\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIGBDCCA+ygAwIBAgIQDcEmNIAVrDpUw5cH5ynutDANBgkqhkiG9w0BAQwFADCB\n' +
+ 'mjELMAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIElu\n' +
+ 'Yy4xEzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTMwMQYDVQQDDCpB\n' +
+ 'bWF6b24gUkRTIG1lLWNlbnRyYWwtMSBSb290IENBIFJTQTQwOTYgRzExEDAOBgNV\n' +
+ 'BAcMB1NlYXR0bGUwIBcNMjIwNTA3MDA0MDIzWhgPMjEyMjA1MDcwMTQwMjNaMIGa\n' +
+ 'MQswCQYDVQQGEwJVUzEiMCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywgSW5j\n' +
+ 'LjETMBEGA1UECwwKQW1hem9uIFJEUzELMAkGA1UECAwCV0ExMzAxBgNVBAMMKkFt\n' +
+ 'YXpvbiBSRFMgbWUtY2VudHJhbC0xIFJvb3QgQ0EgUlNBNDA5NiBHMTEQMA4GA1UE\n' +
+ 'BwwHU2VhdHRsZTCCAiIwDQYJKoZIhvcNAQEBBQADggIPADCCAgoCggIBAKvADk8t\n' +
+ 'Fl9bFlU5sajLPPDSOUpPAkKs6iPlz+27o1GJC88THcOvf3x0nVAcu9WYe9Qaas+4\n' +
+ 'j4a0vv51agqyODRD/SNi2HnqW7DbtLPAm6KBHe4twl28ItB/JD5g7u1oPAHFoXMS\n' +
+ 'cH1CZEAs5RtlZGzJhcBXLFsHNv/7+SCLyZ7+2XFh9OrtgU4wMzkHoRNndhfwV5bu\n' +
+ '17bPTwuH+VxH37zXf1mQ/KjhuJos0C9dL0FpjYBAuyZTAWhZKs8dpSe4DI544z4w\n' +
+ 'gkwUB4bC2nA1TBzsywEAHyNuZ/xRjNpWvx0ToWAA2iFJqC3VO3iKcnBplMvaUuMt\n' +
+ 'jwzVSNBnKcoabXCZL2XDLt4YTZR8FSwz05IvsmwcPB7uNTBXq3T9sjejW8QQK3vT\n' +
+ 'tzyfLq4jKmQE7PoS6cqYm+hEPm2hDaC/WP9bp3FdEJxZlPH26fq1b7BWYWhQ9pBA\n' +
+ 'Nv9zTnzdR1xohTyOJBUFQ81ybEzabqXqVXUIANqIOaNcTB09/sLJ7+zuMhp3mwBu\n' +
+ 'LtjfJv8PLuT1r63bU3seROhKA98b5KfzjvbvPSg3vws78JQyoYGbqNyDfyjVjg3U\n' +
+ 'v//AdVuPie6PNtdrW3upZY4Qti5IjP9e3kimaJ+KAtTgMRG56W0WxD3SP7+YGGbG\n' +
+ 'KhntDOkKsN39hLpn9UOafTIqFu7kIaueEy/NAgMBAAGjQjBAMA8GA1UdEwEB/wQF\n' +
+ 'MAMBAf8wHQYDVR0OBBYEFHAems86dTwdZbLe8AaPy3kfIUVoMA4GA1UdDwEB/wQE\n' +
+ 'AwIBhjANBgkqhkiG9w0BAQwFAAOCAgEAOBHpp0ICx81kmeoBcZTrMdJs2gnhcd85\n' +
+ 'FoSCjXx9H5XE5rmN/lQcxxOgj8hr3uPuLdLHu+i6THAyzjrl2NA1FWiqpfeECGmy\n' +
+ '0jm7iZsYORgGQYp/VKnDrwnKNSqlZvOuRr0kfUexwFlr34Y4VmupvEOK/RdGsd3S\n' +
+ '+3hiemcHse9ST/sJLHx962AWMkN86UHPscJEe4+eT3f2Wyzg6La8ARwdWZSNS+WH\n' +
+ 'ZfybrncMmuiXuUdHv9XspPsqhKgtHhcYeXOGUtrwQPLe3+VJZ0LVxhlTWr9951GZ\n' +
+ 'GfmWwTV/9VsyKVaCFIXeQ6L+gjcKyEzYF8wpMtQlSc7FFqwgC4bKxvMBSaRy88Nr\n' +
+ 'lV2+tJD/fr8zGUeBK44Emon0HKDBWGX+/Hq1ZIv0Da0S+j6LbA4fusWxtGfuGha+\n' +
+ 'luhHgVInCpALIOamiBEdGhILkoTtx7JrYppt3/Raqg9gUNCOOYlCvGhqX7DXeEfL\n' +
+ 'DGabooiY2FNWot6h04JE9nqGj5QqT8D6t/TL1nzxhRPzbcSDIHUd/b5R+a0bAA+7\n' +
+ 'YTU6JqzEVCWKEIEynYmqikgLMGB/OzWsgyEL6822QW6hJAQ78XpbNeCzrICF4+GC\n' +
+ '7KShLnwuWoWpAb26268lvOEvCTFM47VC6jNQl97md+2SA9Ma81C9wflid2M83Wle\n' +
+ 'cuLMVcQZceE=\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIEADCCAuigAwIBAgIQAhAteLRCvizAElaWORFU2zANBgkqhkiG9w0BAQsFADCB\n' +
+ 'mDELMAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIElu\n' +
+ 'Yy4xEzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTEwLwYDVQQDDChB\n' +
+ 'bWF6b24gUkRTIG1lLXNvdXRoLTEgUm9vdCBDQSBSU0EyMDQ4IEcxMRAwDgYDVQQH\n' +
+ 'DAdTZWF0dGxlMCAXDTIxMDUyMDE3MDkxNloYDzIwNjEwNTIwMTgwOTE2WjCBmDEL\n' +
+ 'MAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4x\n' +
+ 'EzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTEwLwYDVQQDDChBbWF6\n' +
+ 'b24gUkRTIG1lLXNvdXRoLTEgUm9vdCBDQSBSU0EyMDQ4IEcxMRAwDgYDVQQHDAdT\n' +
+ 'ZWF0dGxlMIIBIjANBgkqhkiG9w0BAQEFAAOCAQ8AMIIBCgKCAQEA+qg7JAcOVKjh\n' +
+ 'N83SACnBFZPyB63EusfDr/0V9ZdL8lKcmZX9sv/CqoBo3N0EvBqHQqUUX6JvFb7F\n' +
+ 'XrMUZ740kr28gSRALfXTFgNODjXeDsCtEkKRTkac/UM8xXHn+hR7UFRPHS3e0GzI\n' +
+ 'iLiwQWDkr0Op74W8aM0CfaVKvh2bp4BI1jJbdDnQ9OKXpOxNHGUf0ZGb7TkNPkgI\n' +
+ 'b2CBAc8J5o3H9lfw4uiyvl6Fz5JoP+A+zPELAioYBXDrbE7wJeqQDJrETWqR9VEK\n' +
+ 'BXURCkVnHeaJy123MpAX2ozf4pqk0V0LOEOZRS29I+USF5DcWr7QIXR/w2I8ws1Q\n' +
+ '7ys+qbE+kQIDAQABo0IwQDAPBgNVHRMBAf8EBTADAQH/MB0GA1UdDgQWBBQFJ16n\n' +
+ '1EcCMOIhoZs/F9sR+Jy++zAOBgNVHQ8BAf8EBAMCAYYwDQYJKoZIhvcNAQELBQAD\n' +
+ 'ggEBAOc5nXbT3XTDEZsxX2iD15YrQvmL5m13B3ImZWpx/pqmObsgx3/dg75rF2nQ\n' +
+ 'qS+Vl+f/HLh516pj2BPP/yWCq12TRYigGav8UH0qdT3CAClYy2o+zAzUJHm84oiB\n' +
+ 'ud+6pFVGkbqpsY+QMpJUbZWu52KViBpJMYsUEy+9cnPSFRVuRAHjYynSiLk2ZEjb\n' +
+ 'Wkdc4x0nOZR5tP0FgrX0Ve2KcjFwVQJVZLgOUqmFYQ/G0TIIGTNh9tcmR7yp+xJR\n' +
+ 'A2tbPV2Z6m9Yxx4E8lLEPNuoeouJ/GR4CkMEmF8cLwM310t174o3lKKUXJ4Vs2HO\n' +
+ 'Wj2uN6R9oI+jGLMSswTzCNV1vgc=\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIICuDCCAj6gAwIBAgIRAOocLeZWjYkG/EbHmscuy8gwCgYIKoZIzj0EAwMwgZsx\n' +
+ 'CzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMu\n' +
+ 'MRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTE0MDIGA1UEAwwrQW1h\n' +
+ 'em9uIFJEUyBhcC1zb3V0aGVhc3QtMSBSb290IENBIEVDQzM4NCBHMTEQMA4GA1UE\n' +
+ 'BwwHU2VhdHRsZTAgFw0yMTA1MjEyMTUwMDFaGA8yMTIxMDUyMTIyNTAwMVowgZsx\n' +
+ 'CzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMu\n' +
+ 'MRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTE0MDIGA1UEAwwrQW1h\n' +
+ 'em9uIFJEUyBhcC1zb3V0aGVhc3QtMSBSb290IENBIEVDQzM4NCBHMTEQMA4GA1UE\n' +
+ 'BwwHU2VhdHRsZTB2MBAGByqGSM49AgEGBSuBBAAiA2IABCEr3jq1KtRncnZfK5cq\n' +
+ 'btY0nW6ZG3FMbh7XwBIR6Ca0f8llGZ4vJEC1pXgiM/4Dh045B9ZIzNrR54rYOIfa\n' +
+ '2NcYZ7mk06DjIQML64hbAxbQzOAuNzLPx268MrlL2uW2XaNCMEAwDwYDVR0TAQH/\n' +
+ 'BAUwAwEB/zAdBgNVHQ4EFgQUln75pChychwN4RfHl+tOinMrfVowDgYDVR0PAQH/\n' +
+ 'BAQDAgGGMAoGCCqGSM49BAMDA2gAMGUCMGiyPINRU1mwZ4Crw01vpuPvxZxb2IOr\n' +
+ 'yX3RNlOIu4We1H+5dQk5tIvH8KGYFbWEpAIxAO9NZ6/j9osMhLgZ0yj0WVjb+uZx\n' +
+ 'YlZR9fyFisY/jNfX7QhSk+nrc3SFLRUNtpXrng==\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIEBTCCAu2gAwIBAgIRAKiaRZatN8eiz9p0s0lu0rQwDQYJKoZIhvcNAQELBQAw\n' +
+ 'gZoxCzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJ\n' +
+ 'bmMuMRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTEzMDEGA1UEAwwq\n' +
+ 'QW1hem9uIFJEUyBjYS1jZW50cmFsLTEgUm9vdCBDQSBSU0EyMDQ4IEcxMRAwDgYD\n' +
+ 'VQQHDAdTZWF0dGxlMCAXDTIxMDUyMTIyMDIzNVoYDzIwNjEwNTIxMjMwMjM1WjCB\n' +
+ 'mjELMAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIElu\n' +
+ 'Yy4xEzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTMwMQYDVQQDDCpB\n' +
+ 'bWF6b24gUkRTIGNhLWNlbnRyYWwtMSBSb290IENBIFJTQTIwNDggRzExEDAOBgNV\n' +
+ 'BAcMB1NlYXR0bGUwggEiMA0GCSqGSIb3DQEBAQUAA4IBDwAwggEKAoIBAQCygVMf\n' +
+ 'qB865IR9qYRBRFHn4eAqGJOCFx+UbraQZmjr/mnRqSkY+nhbM7Pn/DWOrRnxoh+w\n' +
+ 'q5F9ZxdZ5D5T1v6kljVwxyfFgHItyyyIL0YS7e2h7cRRscCM+75kMedAP7icb4YN\n' +
+ 'LfWBqfKHbHIOqvvQK8T6+Emu/QlG2B5LvuErrop9K0KinhITekpVIO4HCN61cuOe\n' +
+ 'CADBKF/5uUJHwS9pWw3uUbpGUwsLBuhJzCY/OpJlDqC8Y9aToi2Ivl5u3/Q/sKjr\n' +
+ '6AZb9lx4q3J2z7tJDrm5MHYwV74elGSXoeoG8nODUqjgklIWAPrt6lQ3WJpO2kug\n' +
+ '8RhCdSbWkcXHfX95AgMBAAGjQjBAMA8GA1UdEwEB/wQFMAMBAf8wHQYDVR0OBBYE\n' +
+ 'FOIxhqTPkKVqKBZvMWtKewKWDvDBMA4GA1UdDwEB/wQEAwIBhjANBgkqhkiG9w0B\n' +
+ 'AQsFAAOCAQEAqoItII89lOl4TKvg0I1EinxafZLXIheLcdGCxpjRxlZ9QMQUN3yb\n' +
+ 'y/8uFKBL0otbQgJEoGhxm4h0tp54g28M6TN1U0332dwkjYxUNwvzrMaV5Na55I2Z\n' +
+ '1hq4GB3NMXW+PvdtsgVOZbEN+zOyOZ5MvJHEQVkT3YRnf6avsdntltcRzHJ16pJc\n' +
+ 'Y8rR7yWwPXh1lPaPkxddrCtwayyGxNbNmRybjR48uHRhwu7v2WuAMdChL8H8bp89\n' +
+ 'TQLMrMHgSbZfee9hKhO4Zebelf1/cslRSrhkG0ESq6G5MUINj6lMg2g6F0F7Xz2v\n' +
+ 'ncD/vuRN5P+vT8th/oZ0Q2Gc68Pun0cn/g==\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIID/zCCAuegAwIBAgIRAJYlnmkGRj4ju/2jBQsnXJYwDQYJKoZIhvcNAQELBQAw\n' +
+ 'gZcxCzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJ\n' +
+ 'bmMuMRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTEwMC4GA1UEAwwn\n' +
+ 'QW1hem9uIFJEUyB1cy1lYXN0LTIgUm9vdCBDQSBSU0EyMDQ4IEcxMRAwDgYDVQQH\n' +
+ 'DAdTZWF0dGxlMCAXDTIxMDUyMTIzMDQ0NFoYDzIwNjEwNTIyMDAwNDQ0WjCBlzEL\n' +
+ 'MAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4x\n' +
+ 'EzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTAwLgYDVQQDDCdBbWF6\n' +
+ 'b24gUkRTIHVzLWVhc3QtMiBSb290IENBIFJTQTIwNDggRzExEDAOBgNVBAcMB1Nl\n' +
+ 'YXR0bGUwggEiMA0GCSqGSIb3DQEBAQUAA4IBDwAwggEKAoIBAQC74V3eigv+pCj5\n' +
+ 'nqDBqplY0Jp16pTeNB06IKbzb4MOTvNde6QjsZxrE1xUmprT8LxQqN9tI3aDYEYk\n' +
+ 'b9v4F99WtQVgCv3Y34tYKX9NwWQgwS1vQwnIR8zOFBYqsAsHEkeJuSqAB12AYUSd\n' +
+ 'Zv2RVFjiFmYJho2X30IrSLQfS/IE3KV7fCyMMm154+/K1Z2IJlcissydEAwgsUHw\n' +
+ 'edrE6CxJVkkJ3EvIgG4ugK/suxd8eEMztaQYJwSdN8TdfT59LFuSPl7zmF3fIBdJ\n' +
+ '//WexcQmGabaJ7Xnx+6o2HTfkP8Zzzzaq8fvjAcvA7gyFH5EP26G2ZqMG+0y4pTx\n' +
+ 'SPVTrQEXAgMBAAGjQjBAMA8GA1UdEwEB/wQFMAMBAf8wHQYDVR0OBBYEFIWWuNEF\n' +
+ 'sUMOC82XlfJeqazzrkPDMA4GA1UdDwEB/wQEAwIBhjANBgkqhkiG9w0BAQsFAAOC\n' +
+ 'AQEAgClmxcJaQTGpEZmjElL8G2Zc8lGc+ylGjiNlSIw8X25/bcLRptbDA90nuP+q\n' +
+ 'zXAMhEf0ccbdpwxG/P5a8JipmHgqQLHfpkvaXx+0CuP++3k+chAJ3Gk5XtY587jX\n' +
+ '+MJfrPgjFt7vmMaKmynndf+NaIJAYczjhJj6xjPWmGrjM3MlTa9XesmelMwP3jep\n' +
+ 'bApIWAvCYVjGndbK9byyMq1nyj0TUzB8oJZQooaR3MMjHTmADuVBylWzkRMxbKPl\n' +
+ '4Nlsk4Ef1JvIWBCzsMt+X17nuKfEatRfp3c9tbpGlAE/DSP0W2/Lnayxr4RpE9ds\n' +
+ 'ICF35uSis/7ZlsftODUe8wtpkQ==\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIF/zCCA+egAwIBAgIRAPvvd+MCcp8E36lHziv0xhMwDQYJKoZIhvcNAQEMBQAw\n' +
+ 'gZcxCzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJ\n' +
+ 'bmMuMRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTEwMC4GA1UEAwwn\n' +
+ 'QW1hem9uIFJEUyB1cy1lYXN0LTIgUm9vdCBDQSBSU0E0MDk2IEcxMRAwDgYDVQQH\n' +
+ 'DAdTZWF0dGxlMCAXDTIxMDUyMTIzMTEwNloYDzIxMjEwNTIyMDAxMTA2WjCBlzEL\n' +
+ 'MAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4x\n' +
+ 'EzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTAwLgYDVQQDDCdBbWF6\n' +
+ 'b24gUkRTIHVzLWVhc3QtMiBSb290IENBIFJTQTQwOTYgRzExEDAOBgNVBAcMB1Nl\n' +
+ 'YXR0bGUwggIiMA0GCSqGSIb3DQEBAQUAA4ICDwAwggIKAoICAQDbvwekKIKGcV/s\n' +
+ 'lDU96a71ZdN2pTYkev1X2e2/ICb765fw/i1jP9MwCzs8/xHBEQBJSxdfO4hPeNx3\n' +
+ 'ENi0zbM+TrMKliS1kFVe1trTTEaHYjF8BMK9yTY0VgSpWiGxGwg4tshezIA5lpu8\n' +
+ 'sF6XMRxosCEVCxD/44CFqGZTzZaREIvvFPDTXKJ6yOYnuEkhH3OcoOajHN2GEMMQ\n' +
+ 'ShuyRFDQvYkqOC/Q5icqFbKg7eGwfl4PmimdV7gOVsxSlw2s/0EeeIILXtHx22z3\n' +
+ '8QBhX25Lrq2rMuaGcD3IOMBeBo2d//YuEtd9J+LGXL9AeOXHAwpvInywJKAtXTMq\n' +
+ 'Wsy3LjhuANFrzMlzjR2YdjkGVzeQVx3dKUzJ2//Qf7IXPSPaEGmcgbxuatxjnvfT\n' +
+ 'H85oeKr3udKnXm0Kh7CLXeqJB5ITsvxI+Qq2iXtYCc+goHNR01QJwtGDSzuIMj3K\n' +
+ 'f+YMrqBXZgYBwU2J/kCNTH31nfw96WTbOfNGwLwmVRDgguzFa+QzmQsJW4FTDMwc\n' +
+ '7cIjwdElQQVA+Gqa67uWmyDKAnoTkudmgAP+OTBkhnmc6NJuZDcy6f/iWUdl0X0u\n' +
+ '/tsfgXXR6ZovnHonM13ANiN7VmEVqFlEMa0VVmc09m+2FYjjlk8F9sC7Rc4wt214\n' +
+ '7u5YvCiCsFZwx44baP5viyRZgkJVpQIDAQABo0IwQDAPBgNVHRMBAf8EBTADAQH/\n' +
+ 'MB0GA1UdDgQWBBQgCZCsc34nVTRbWsniXBPjnUTQ2DAOBgNVHQ8BAf8EBAMCAYYw\n' +
+ 'DQYJKoZIhvcNAQEMBQADggIBAAQas3x1G6OpsIvQeMS9BbiHG3+kU9P/ba6Rrg+E\n' +
+ 'lUz8TmL04Bcd+I+R0IyMBww4NznT+K60cFdk+1iSmT8Q55bpqRekyhcdWda1Qu0r\n' +
+ 'JiTi7zz+3w2v66akofOnGevDpo/ilXGvCUJiLOBnHIF0izUqzvfczaMZGJT6xzKq\n' +
+ 'PcEVRyAN1IHHf5KnGzUlVFv9SGy47xJ9I1vTk24JU0LWkSLzMMoxiUudVmHSqJtN\n' +
+ 'u0h+n/x3Q6XguZi1/C1KOntH56ewRh8n5AF7c+9LJJSRM9wunb0Dzl7BEy21Xe9q\n' +
+ '03xRYjf5wn8eDELB8FZPa1PrNKXIOLYM9egdctbKEcpSsse060+tkyBrl507+SJT\n' +
+ '04lvJ4tcKjZFqxn+bUkDQvXYj0D3WK+iJ7a8kZJPRvz8BDHfIqancY8Tgw+69SUn\n' +
+ 'WqIb+HNZqFuRs16WFSzlMksqzXv6wcDSyI7aZOmCGGEcYW9NHk8EuOnOQ+1UMT9C\n' +
+ 'Qb1GJcipjRzry3M4KN/t5vN3hIetB+/PhmgTO4gKhBETTEyPC3HC1QbdVfRndB6e\n' +
+ 'U/NF2U/t8U2GvD26TTFLK4pScW7gyw4FQyXWs8g8FS8f+R2yWajhtS9++VDJQKom\n' +
+ 'fAUISoCH+PlPRJpu/nHd1Zrddeiiis53rBaLbXu2J1Q3VqjWOmtj0HjxJJxWnYmz\n' +
+ 'Pqj2\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIGATCCA+mgAwIBAgIRAI/U4z6+GF8/znpHM8Dq8G0wDQYJKoZIhvcNAQEMBQAw\n' +
+ 'gZgxCzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJ\n' +
+ 'bmMuMRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTExMC8GA1UEAwwo\n' +
+ 'QW1hem9uIFJEUyBhcC1zb3V0aC0yIFJvb3QgQ0EgUlNBNDA5NiBHMTEQMA4GA1UE\n' +
+ 'BwwHU2VhdHRsZTAgFw0yMjA2MDYyMTQ4MThaGA8yMTIyMDYwNjIyNDgxOFowgZgx\n' +
+ 'CzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMu\n' +
+ 'MRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTExMC8GA1UEAwwoQW1h\n' +
+ 'em9uIFJEUyBhcC1zb3V0aC0yIFJvb3QgQ0EgUlNBNDA5NiBHMTEQMA4GA1UEBwwH\n' +
+ 'U2VhdHRsZTCCAiIwDQYJKoZIhvcNAQEBBQADggIPADCCAgoCggIBAK5WqMvyq888\n' +
+ '3uuOtEj1FcP6iZhqO5kJurdJF59Otp2WCg+zv6I+QwaAspEWHQsKD405XfFsTGKV\n' +
+ 'SKTCwoMxwBniuChSmyhlagQGKSnRY9+znOWq0v7hgmJRwp6FqclTbubmr+K6lzPy\n' +
+ 'hs86mEp68O5TcOTYWUlPZDqfKwfNTbtCl5YDRr8Gxb5buHmkp6gUSgDkRsXiZ5VV\n' +
+ 'b3GBmXRqbnwo5ZRNAzQeM6ylXCn4jKs310lQGUrFbrJqlyxUdfxzqdlaIRn2X+HY\n' +
+ 'xRSYbHox3LVNPpJxYSBRvpQVFSy9xbX8d1v6OM8+xluB31cbLBtm08KqPFuqx+cO\n' +
+ 'I2H5F0CYqYzhyOSKJsiOEJT6/uH4ewryskZzncx9ae62SC+bB5n3aJLmOSTkKLFY\n' +
+ 'YS5IsmDT2m3iMgzsJNUKVoCx2zihAzgBanFFBsG+Xmoq0aKseZUI6vd2qpd5tUST\n' +
+ '/wS1sNk0Ph7teWB2ACgbFE6etnJ6stwjHFZOj/iTYhlnR2zDRU8akunFdGb6CB4/\n' +
+ 'hMxGJxaqXSJeGtHm7FpadlUTf+2ESbYcVW+ui/F8sdBJseQdKZf3VdZZMgM0bcaX\n' +
+ 'NE47cauDTy72WdU9YJX/YXKYMLDE0iFHTnGpfVGsuWGPYhlwZ3dFIO07mWnCRM6X\n' +
+ 'u5JXRB1oy5n5HRluMsmpSN/R92MeBxKFAgMBAAGjQjBAMA8GA1UdEwEB/wQFMAMB\n' +
+ 'Af8wHQYDVR0OBBYEFNtH0F0xfijSLHEyIkRGD9gW6NazMA4GA1UdDwEB/wQEAwIB\n' +
+ 'hjANBgkqhkiG9w0BAQwFAAOCAgEACo+5jFeY3ygxoDDzL3xpfe5M0U1WxdKk+az4\n' +
+ '/OfjZvkoma7WfChi3IIMtwtKLYC2/seKWA4KjlB3rlTsCVNPnK6D+gAnybcfTKk/\n' +
+ 'IRSPk92zagwQkSUWtAk80HpVfWJzpkSU16ejiajhedzOBRtg6BwsbSqLCDXb8hXr\n' +
+ 'eXWC1S9ZceGc+LcKRHewGWPu31JDhHE9bNcl9BFSAS0lYVZqxIRWxivZ+45j5uQv\n' +
+ 'wPrC8ggqsdU3K8quV6dblUQzzA8gKbXJpCzXZihkPrYpQHTH0szvXvgebh+CNUAG\n' +
+ 'rUxm8+yTS0NFI3U+RLbcLFVzSvjMOnEwCX0SPj5XZRYYXs5ajtQCoZhTUkkwpDV8\n' +
+ 'RxXk8qGKiXwUxDO8GRvmvM82IOiXz5w2jy/h7b7soyIgdYiUydMq4Ja4ogB/xPZa\n' +
+ 'gf4y0o+bremO15HFf1MkaU2UxPK5FFVUds05pKvpSIaQWbF5lw4LHHj4ZtVup7zF\n' +
+ 'CLjPWs4Hs/oUkxLMqQDw0FBwlqa4uot8ItT8uq5BFpz196ZZ+4WXw5PVzfSxZibI\n' +
+ 'C/nwcj0AS6qharXOs8yPnPFLPSZ7BbmWzFDgo3tpglRqo3LbSPsiZR+sLeivqydr\n' +
+ '0w4RK1btRda5Ws88uZMmW7+2aufposMKcbAdrApDEAVzHijbB/nolS5nsnFPHZoA\n' +
+ 'KDPtFEk=\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIICtzCCAj2gAwIBAgIQVZ5Y/KqjR4XLou8MCD5pOjAKBggqhkjOPQQDAzCBmzEL\n' +
+ 'MAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4x\n' +
+ 'EzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTQwMgYDVQQDDCtBbWF6\n' +
+ 'b24gUkRTIGFwLXNvdXRoZWFzdC00IFJvb3QgQ0EgRUNDMzg0IEcxMRAwDgYDVQQH\n' +
+ 'DAdTZWF0dGxlMCAXDTIyMDUyNTE2NTgzM1oYDzIxMjIwNTI1MTc1ODMzWjCBmzEL\n' +
+ 'MAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4x\n' +
+ 'EzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTQwMgYDVQQDDCtBbWF6\n' +
+ 'b24gUkRTIGFwLXNvdXRoZWFzdC00IFJvb3QgQ0EgRUNDMzg0IEcxMRAwDgYDVQQH\n' +
+ 'DAdTZWF0dGxlMHYwEAYHKoZIzj0CAQYFK4EEACIDYgAEbo473OmpD5vkckdJajXg\n' +
+ 'brhmNFyoSa0WCY1njuZC2zMFp3zP6rX4I1r3imrYnJd9pFH/aSiV/r6L5ACE5RPx\n' +
+ '4qdg5SQ7JJUaZc3DWsTOiOed7BCZSzM+KTYK/2QzDMApo0IwQDAPBgNVHRMBAf8E\n' +
+ 'BTADAQH/MB0GA1UdDgQWBBTmogc06+1knsej1ltKUOdWFvwgsjAOBgNVHQ8BAf8E\n' +
+ 'BAMCAYYwCgYIKoZIzj0EAwMDaAAwZQIxAIs7TlLMbGTWNXpGiKf9DxaM07d/iDHe\n' +
+ 'F/Vv/wyWSTGdobxBL6iArQNVXz0Gr4dvPAIwd0rsoa6R0x5mtvhdRPtM37FYrbHJ\n' +
+ 'pbV+OMusQqcSLseunLBoCHenvJW0QOCQ8EDY\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIICvTCCAkOgAwIBAgIQCIY7E/bFvFN2lK9Kckb0dTAKBggqhkjOPQQDAzCBnjEL\n' +
+ 'MAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4x\n' +
+ 'EzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTcwNQYDVQQDDC5BbWF6\n' +
+ 'b24gUkRTIFByZXZpZXcgdXMtZWFzdC0yIFJvb3QgQ0EgRUNDMzg0IEcxMRAwDgYD\n' +
+ 'VQQHDAdTZWF0dGxlMCAXDTIxMDUxODIxMDUxMFoYDzIxMjEwNTE4MjIwNTEwWjCB\n' +
+ 'njELMAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIElu\n' +
+ 'Yy4xEzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTcwNQYDVQQDDC5B\n' +
+ 'bWF6b24gUkRTIFByZXZpZXcgdXMtZWFzdC0yIFJvb3QgQ0EgRUNDMzg0IEcxMRAw\n' +
+ 'DgYDVQQHDAdTZWF0dGxlMHYwEAYHKoZIzj0CAQYFK4EEACIDYgAEMI0hzf1JCEOI\n' +
+ 'Eue4+DmcNnSs2i2UaJxHMrNGGfU7b42a7vwP53F7045ffHPBGP4jb9q02/bStZzd\n' +
+ 'VHqfcgqkSRI7beBKjD2mfz82hF/wJSITTgCLs+NRpS6zKMFOFHUNo0IwQDAPBgNV\n' +
+ 'HRMBAf8EBTADAQH/MB0GA1UdDgQWBBS8uF/6hk5mPLH4qaWv9NVZaMmyTjAOBgNV\n' +
+ 'HQ8BAf8EBAMCAYYwCgYIKoZIzj0EAwMDaAAwZQIxAO7Pu9wzLyM0X7Q08uLIL+vL\n' +
+ 'qaxe3UFuzFTWjM16MLJHbzLf1i9IDFKz+Q4hXCSiJwIwClMBsqT49BPUxVsJnjGr\n' +
+ 'EbyEk6aOOVfY1p2yQL649zh3M4h8okLnwf+bYIb1YpeU\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIEADCCAuigAwIBAgIQY+JhwFEQTe36qyRlUlF8ozANBgkqhkiG9w0BAQsFADCB\n' +
+ 'mDELMAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIElu\n' +
+ 'Yy4xEzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTEwLwYDVQQDDChB\n' +
+ 'bWF6b24gUkRTIGFmLXNvdXRoLTEgUm9vdCBDQSBSU0EyMDQ4IEcxMRAwDgYDVQQH\n' +
+ 'DAdTZWF0dGxlMCAXDTIxMDUxOTE5MjQxNloYDzIwNjEwNTE5MjAyNDE2WjCBmDEL\n' +
+ 'MAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4x\n' +
+ 'EzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTEwLwYDVQQDDChBbWF6\n' +
+ 'b24gUkRTIGFmLXNvdXRoLTEgUm9vdCBDQSBSU0EyMDQ4IEcxMRAwDgYDVQQHDAdT\n' +
+ 'ZWF0dGxlMIIBIjANBgkqhkiG9w0BAQEFAAOCAQ8AMIIBCgKCAQEAnIye77j6ev40\n' +
+ '8wRPyN2OdKFSUfI9jB20Or2RLO+RDoL43+USXdrze0Wv4HMRLqaen9BcmCfaKMp0\n' +
+ 'E4SFo47bXK/O17r6G8eyq1sqnHE+v288mWtYH9lAlSamNFRF6YwA7zncmE/iKL8J\n' +
+ '0vePHMHP/B6svw8LULZCk+nZk3tgxQn2+r0B4FOz+RmpkoVddfqqUPMbKUxhM2wf\n' +
+ 'fO7F6bJaUXDNMBPhCn/3ayKCjYr49ErmnpYV2ZVs1i34S+LFq39J7kyv6zAgbHv9\n' +
+ '+/MtRMoRB1CjpqW0jIOZkHBdYcd1o9p1zFn591Do1wPkmMsWdjIYj+6e7UXcHvOB\n' +
+ '2+ScIRAcnwIDAQABo0IwQDAPBgNVHRMBAf8EBTADAQH/MB0GA1UdDgQWBBQGtq2W\n' +
+ 'YSyMMxpdQ3IZvcGE+nyZqTAOBgNVHQ8BAf8EBAMCAYYwDQYJKoZIhvcNAQELBQAD\n' +
+ 'ggEBAEgoP3ixJsKSD5FN8dQ01RNHERl/IFbA7TRXfwC+L1yFocKnQh4Mp/msPRSV\n' +
+ '+OeHIvemPW/wtZDJzLTOFJ6eTolGekHK1GRTQ6ZqsWiU2fmiOP8ks4oSpI+tQ9Lw\n' +
+ 'VrfZqTiEcS5wEIqyfUAZZfKDo7W1xp+dQWzfczSBuZJZwI5iaha7+ILM0r8Ckden\n' +
+ 'TVTapc5pLSoO15v0ziRuQ2bT3V3nwu/U0MRK44z+VWOJdSiKxdnOYDs8hFNnKhfe\n' +
+ 'klbTZF7kW7WbiNYB43OaAQBJ6BALZsIskEaqfeZT8FD71uN928TcEQyBDXdZpRN+\n' +
+ 'iGQZDGhht0r0URGMDSs9waJtTfA=\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIF/jCCA+agAwIBAgIQXY/dmS+72lZPranO2JM9jjANBgkqhkiG9w0BAQwFADCB\n' +
+ 'lzELMAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIElu\n' +
+ 'Yy4xEzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTAwLgYDVQQDDCdB\n' +
+ 'bWF6b24gUkRTIGFwLWVhc3QtMSBSb290IENBIFJTQTQwOTYgRzExEDAOBgNVBAcM\n' +
+ 'B1NlYXR0bGUwIBcNMjEwNTI1MjEzNDUxWhgPMjEyMTA1MjUyMjM0NTFaMIGXMQsw\n' +
+ 'CQYDVQQGEwJVUzEiMCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywgSW5jLjET\n' +
+ 'MBEGA1UECwwKQW1hem9uIFJEUzELMAkGA1UECAwCV0ExMDAuBgNVBAMMJ0FtYXpv\n' +
+ 'biBSRFMgYXAtZWFzdC0xIFJvb3QgQ0EgUlNBNDA5NiBHMTEQMA4GA1UEBwwHU2Vh\n' +
+ 'dHRsZTCCAiIwDQYJKoZIhvcNAQEBBQADggIPADCCAgoCggIBAMyW9kBJjD/hx8e8\n' +
+ 'b5E1sF42bp8TXsz1htSYE3Tl3T1Aq379DfEhB+xa/ASDZxt7/vwa81BkNo4M6HYq\n' +
+ 'okYIXeE7cu5SnSgjWXqcERhgPevtAwgmhdE3yREe8oz2DyOi2qKKZqah+1gpPaIQ\n' +
+ 'fK0uAqoeQlyHosye3KZZKkDHBatjBsQ5kf8lhuf7wVulEZVRHY2bP2X7N98PfbpL\n' +
+ 'QdH7mWXzDtJJ0LiwFwds47BrkgK1pkHx2p1mTo+HMkfX0P6Fq1atkVC2RHHtbB/X\n' +
+ 'iYyH7paaHBzviFrhr679zNqwXIOKlbf74w3mS11P76rFn9rS1BAH2Qm6eY5S/Fxe\n' +
+ 'HEKXm4kjPN63Zy0p3yE5EjPt54yPkvumOnT+RqDGJ2HCI9k8Ehcbve0ogfdRKNqQ\n' +
+ 'VHWYTy8V33ndQRHZlx/CuU1yN61TH4WSoMly1+q1ihTX9sApmlQ14B2pJi/9DnKW\n' +
+ 'cwECrPy1jAowC2UJ45RtC8UC05CbP9yrIy/7Noj8gQDiDOepm+6w1g6aNlWoiuQS\n' +
+ 'kyI6nzz1983GcnOHya73ga7otXo0Qfg9jPghlYiMomrgshlSLDHZG0Ib/3hb8cnR\n' +
+ '1OcN9FpzNmVK2Ll1SmTMLrIhuCkyNYX9O/bOknbcf706XeESxGduSkHEjIw/k1+2\n' +
+ 'Atteoq5dT6cwjnJ9hyhiueVlVkiDAgMBAAGjQjBAMA8GA1UdEwEB/wQFMAMBAf8w\n' +
+ 'HQYDVR0OBBYEFLUI+DD7RJs+0nRnjcwIVWzzYSsFMA4GA1UdDwEB/wQEAwIBhjAN\n' +
+ 'BgkqhkiG9w0BAQwFAAOCAgEAb1mcCHv4qMQetLGTBH9IxsB2YUUhr5dda0D2BcHr\n' +
+ 'UtDbfd0VQs4tux6h/6iKwHPx0Ew8fuuYj99WknG0ffgJfNc5/fMspxR/pc1jpdyU\n' +
+ '5zMQ+B9wi0lOZPO9uH7/pr+d2odcNEy8zAwqdv/ihsTwLmGP54is9fVbsgzNW1cm\n' +
+ 'HKAVL2t/Ope+3QnRiRilKCN1lzhav4HHdLlN401TcWRWKbEuxF/FgxSO2Hmx86pj\n' +
+ 'e726lweCTMmnq/cTsPOVY0WMjs0or3eHDVlyLgVeV5ldyN+ptg3Oit60T05SRa58\n' +
+ 'AJPTaVKIcGQ/gKkKZConpu7GDofT67P/ox0YNY57LRbhsx9r5UY4ROgz7WMQ1yoS\n' +
+ 'Y+19xizm+mBm2PyjMUbfwZUyCxsdKMwVdOq5/UmTmdms+TR8+m1uBHPOTQ2vKR0s\n' +
+ 'Pd/THSzPuu+d3dbzRyDSLQbHFFneG760CUlD/ZmzFlQjJ89/HmAmz8IyENq+Sjhx\n' +
+ 'Jgzy+FjVZb8aRUoYLlnffpUpej1n87Ynlr1GrvC4GsRpNpOHlwuf6WD4W0qUTsC/\n' +
+ 'C9JO+fBzUj/aWlJzNcLEW6pte1SB+EdkR2sZvWH+F88TxemeDrV0jKJw5R89CDf8\n' +
+ 'ZQNfkxJYjhns+YeV0moYjqQdc7tq4i04uggEQEtVzEhRLU5PE83nlh/K2NZZm8Kj\n' +
+ 'dIA=\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIID/zCCAuegAwIBAgIRAPVSMfFitmM5PhmbaOFoGfUwDQYJKoZIhvcNAQELBQAw\n' +
+ 'gZcxCzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJ\n' +
+ 'bmMuMRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTEwMC4GA1UEAwwn\n' +
+ 'QW1hem9uIFJEUyB1cy1lYXN0LTEgUm9vdCBDQSBSU0EyMDQ4IEcxMRAwDgYDVQQH\n' +
+ 'DAdTZWF0dGxlMCAXDTIxMDUyNTIyMzQ1N1oYDzIwNjEwNTI1MjMzNDU3WjCBlzEL\n' +
+ 'MAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4x\n' +
+ 'EzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTAwLgYDVQQDDCdBbWF6\n' +
+ 'b24gUkRTIHVzLWVhc3QtMSBSb290IENBIFJTQTIwNDggRzExEDAOBgNVBAcMB1Nl\n' +
+ 'YXR0bGUwggEiMA0GCSqGSIb3DQEBAQUAA4IBDwAwggEKAoIBAQDu9H7TBeGoDzMr\n' +
+ 'dxN6H8COntJX4IR6dbyhnj5qMD4xl/IWvp50lt0VpmMd+z2PNZzx8RazeGC5IniV\n' +
+ '5nrLg0AKWRQ2A/lGGXbUrGXCSe09brMQCxWBSIYe1WZZ1iU1IJ/6Bp4D2YEHpXrW\n' +
+ 'bPkOq5x3YPcsoitgm1Xh8ygz6vb7PsvJvPbvRMnkDg5IqEThapPjmKb8ZJWyEFEE\n' +
+ 'QRrkCIRueB1EqQtJw0fvP4PKDlCJAKBEs/y049FoOqYpT3pRy0WKqPhWve+hScMd\n' +
+ '6obq8kxTFy1IHACjHc51nrGII5Bt76/MpTWhnJIJrCnq1/Uc3Qs8IVeb+sLaFC8K\n' +
+ 'DI69Sw6bAgMBAAGjQjBAMA8GA1UdEwEB/wQFMAMBAf8wHQYDVR0OBBYEFE7PCopt\n' +
+ 'lyOgtXX0Y1lObBUxuKaCMA4GA1UdDwEB/wQEAwIBhjANBgkqhkiG9w0BAQsFAAOC\n' +
+ 'AQEAFj+bX8gLmMNefr5jRJfHjrL3iuZCjf7YEZgn89pS4z8408mjj9z6Q5D1H7yS\n' +
+ 'jNETVV8QaJip1qyhh5gRzRaArgGAYvi2/r0zPsy+Tgf7v1KGL5Lh8NT8iCEGGXwF\n' +
+ 'g3Ir+Nl3e+9XUp0eyyzBIjHtjLBm6yy8rGk9p6OtFDQnKF5OxwbAgip42CD75r/q\n' +
+ 'p421maEDDvvRFR4D+99JZxgAYDBGqRRceUoe16qDzbMvlz0A9paCZFclxeftAxv6\n' +
+ 'QlR5rItMz/XdzpBJUpYhdzM0gCzAzdQuVO5tjJxmXhkSMcDP+8Q+Uv6FA9k2VpUV\n' +
+ 'E/O5jgpqUJJ2Hc/5rs9VkAPXeA==\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIICrzCCAjWgAwIBAgIQW0yuFCle3uj4vWiGU0SaGzAKBggqhkjOPQQDAzCBlzEL\n' +
+ 'MAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4x\n' +
+ 'EzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTAwLgYDVQQDDCdBbWF6\n' +
+ 'b24gUkRTIGFmLXNvdXRoLTEgUm9vdCBDQSBFQ0MzODQgRzExEDAOBgNVBAcMB1Nl\n' +
+ 'YXR0bGUwIBcNMjEwNTE5MTkzNTE2WhgPMjEyMTA1MTkyMDM1MTZaMIGXMQswCQYD\n' +
+ 'VQQGEwJVUzEiMCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywgSW5jLjETMBEG\n' +
+ 'A1UECwwKQW1hem9uIFJEUzELMAkGA1UECAwCV0ExMDAuBgNVBAMMJ0FtYXpvbiBS\n' +
+ 'RFMgYWYtc291dGgtMSBSb290IENBIEVDQzM4NCBHMTEQMA4GA1UEBwwHU2VhdHRs\n' +
+ 'ZTB2MBAGByqGSM49AgEGBSuBBAAiA2IABDPiKNZSaXs3Un/J/v+LTsFDANHpi7en\n' +
+ 'oL2qh0u0DoqNzEBTbBjvO23bLN3k599zh6CY3HKW0r2k1yaIdbWqt4upMCRCcUFi\n' +
+ 'I4iedAmubgzh56wJdoMZztjXZRwDthTkJKNCMEAwDwYDVR0TAQH/BAUwAwEB/zAd\n' +
+ 'BgNVHQ4EFgQUWbYkcrvVSnAWPR5PJhIzppcAnZIwDgYDVR0PAQH/BAQDAgGGMAoG\n' +
+ 'CCqGSM49BAMDA2gAMGUCMCESGqpat93CjrSEjE7z+Hbvz0psZTHwqaxuiH64GKUm\n' +
+ 'mYynIiwpKHyBrzjKBmeDoQIxANGrjIo6/b8Jl6sdIZQI18V0pAyLfLiZjlHVOnhM\n' +
+ 'MOTVgr82ZuPoEHTX78MxeMnYlw==\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIECTCCAvGgAwIBAgIRAIbsx8XOl0sgTNiCN4O+18QwDQYJKoZIhvcNAQELBQAw\n' +
+ 'gZwxCzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJ\n' +
+ 'bmMuMRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTE1MDMGA1UEAwws\n' +
+ 'QW1hem9uIFJEUyBhcC1ub3J0aGVhc3QtMSBSb290IENBIFJTQTIwNDggRzExEDAO\n' +
+ 'BgNVBAcMB1NlYXR0bGUwIBcNMjEwNTI1MjE1NDU4WhgPMjA2MTA1MjUyMjU0NTha\n' +
+ 'MIGcMQswCQYDVQQGEwJVUzEiMCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywg\n' +
+ 'SW5jLjETMBEGA1UECwwKQW1hem9uIFJEUzELMAkGA1UECAwCV0ExNTAzBgNVBAMM\n' +
+ 'LEFtYXpvbiBSRFMgYXAtbm9ydGhlYXN0LTEgUm9vdCBDQSBSU0EyMDQ4IEcxMRAw\n' +
+ 'DgYDVQQHDAdTZWF0dGxlMIIBIjANBgkqhkiG9w0BAQEFAAOCAQ8AMIIBCgKCAQEA\n' +
+ 'tROxwXWCgn5R9gI/2Ivjzaxc0g95ysBjoJsnhPdJEHQb7w3y2kWrVWU3Y9fOitgb\n' +
+ 'CEsnEC3PrhRnzNVW0fPsK6kbvOeCmjvY30rdbxbc8h+bjXfGmIOgAkmoULEr6Hc7\n' +
+ 'G1Q/+tvv4lEwIs7bEaf+abSZxRJbZ0MBxhbHn7UHHDiMZYvzK+SV1MGCxx7JVhrm\n' +
+ 'xWu3GC1zZCsGDhB9YqY9eR6PmjbqA5wy8vqbC57dZZa1QVtWIQn3JaRXn+faIzHx\n' +
+ 'nLMN5CEWihsdmHBXhnRboXprE/OS4MFv1UrQF/XM/h5RBeCywpHePpC+Oe1T3LNC\n' +
+ 'iP8KzRFrjC1MX/WXJnmOVQIDAQABo0IwQDAPBgNVHRMBAf8EBTADAQH/MB0GA1Ud\n' +
+ 'DgQWBBS33XbXAUMs1znyZo4B0+B3D68WFTAOBgNVHQ8BAf8EBAMCAYYwDQYJKoZI\n' +
+ 'hvcNAQELBQADggEBADuadd2EmlpueY2VlrIIPC30QkoA1EOSoCmZgN6124apkoY1\n' +
+ 'HiV4r+QNPljN4WP8gmcARnNkS7ZeR4fvWi8xPh5AxQCpiaBMw4gcbTMCuKDV68Pw\n' +
+ 'P2dZCTMspvR3CDfM35oXCufdtFnxyU6PAyINUqF/wyTHguO3owRFPz64+sk3r2pT\n' +
+ 'WHmJjG9E7V+KOh0s6REgD17Gqn6C5ijLchSrPUHB0wOIkeLJZndHxN/76h7+zhMt\n' +
+ 'fFeNxPWHY2MfpcaLjz4UREzZPSB2U9k+y3pW1omCIcl6MQU9itGx/LpQE+H3ZeX2\n' +
+ 'M2bdYd5L+ow+bdbGtsVKOuN+R9Dm17YpswF+vyQ=\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIGATCCA+mgAwIBAgIRAKlQ+3JX9yHXyjP/Ja6kZhkwDQYJKoZIhvcNAQEMBQAw\n' +
+ 'gZgxCzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJ\n' +
+ 'bmMuMRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTExMC8GA1UEAwwo\n' +
+ 'QW1hem9uIFJEUyBhcC1zb3V0aC0xIFJvb3QgQ0EgUlNBNDA5NiBHMTEQMA4GA1UE\n' +
+ 'BwwHU2VhdHRsZTAgFw0yMTA1MTkxNzQ1MjBaGA8yMTIxMDUxOTE4NDUyMFowgZgx\n' +
+ 'CzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMu\n' +
+ 'MRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTExMC8GA1UEAwwoQW1h\n' +
+ 'em9uIFJEUyBhcC1zb3V0aC0xIFJvb3QgQ0EgUlNBNDA5NiBHMTEQMA4GA1UEBwwH\n' +
+ 'U2VhdHRsZTCCAiIwDQYJKoZIhvcNAQEBBQADggIPADCCAgoCggIBAKtahBrpUjQ6\n' +
+ 'H2mni05BAKU6Z5USPZeSKmBBJN3YgD17rJ93ikJxSgzJ+CupGy5rvYQ0xznJyiV0\n' +
+ '91QeQN4P+G2MjGQR0RGeUuZcfcZitJro7iAg3UBvw8WIGkcDUg+MGVpRv/B7ry88\n' +
+ '7E4OxKb8CPNoa+a9j6ABjOaaxaI22Bb7j3OJ+JyMICs6CU2bgkJaj3VUV9FCNUOc\n' +
+ 'h9PxD4jzT9yyGYm/sK9BAT1WOTPG8XQUkpcFqy/IerZDfiQkf1koiSd4s5VhBkUn\n' +
+ 'aQHOdri/stldT7a+HJFVyz2AXDGPDj+UBMOuLq0K6GAT6ThpkXCb2RIf4mdTy7ox\n' +
+ 'N5BaJ+ih+Ro3ZwPkok60egnt/RN98jgbm+WstgjJWuLqSNInnMUgkuqjyBWwePqX\n' +
+ 'Kib+wdpyx/LOzhKPEFpeMIvHQ3A0sjlulIjnh+j+itezD+dp0UNxMERlW4Bn/IlS\n' +
+ 'sYQVNfYutWkRPRLErXOZXtlxxkI98JWQtLjvGzQr+jywxTiw644FSLWdhKa6DtfU\n' +
+ '2JWBHqQPJicMElfZpmfaHZjtXuCZNdZQXWg7onZYohe281ZrdFPOqC4rUq7gYamL\n' +
+ 'T+ZB+2P+YCPOLJ60bj/XSvcB7mesAdg8P0DNddPhHUFWx2dFqOs1HxIVB4FZVA9U\n' +
+ 'Ppbv4a484yxjTgG7zFZNqXHKTqze6rBBAgMBAAGjQjBAMA8GA1UdEwEB/wQFMAMB\n' +
+ 'Af8wHQYDVR0OBBYEFCEAqjighncv/UnWzBjqu1Ka2Yb4MA4GA1UdDwEB/wQEAwIB\n' +
+ 'hjANBgkqhkiG9w0BAQwFAAOCAgEAYyvumblckIXlohzi3QiShkZhqFzZultbFIu9\n' +
+ 'GhA5CDar1IFMhJ9vJpO9nUK/camKs1VQRs8ZsBbXa0GFUM2p8y2cgUfLwFULAiC/\n' +
+ 'sWETyW5lcX/xc4Pyf6dONhqFJt/ovVBxNZtcmMEWv/1D6Tf0nLeEb0P2i/pnSRR4\n' +
+ 'Oq99LVFjossXtyvtaq06OSiUUZ1zLPvV6AQINg8dWeBOWRcQYhYcEcC2wQ06KShZ\n' +
+ '0ahuu7ar5Gym3vuLK6nH+eQrkUievVomN/LpASrYhK32joQ5ypIJej3sICIgJUEP\n' +
+ 'UoeswJ+Z16f3ECoL1OSnq4A0riiLj1ZGmVHNhM6m/gotKaHNMxsK9zsbqmuU6IT/\n' +
+ 'P6cR0S+vdigQG8ZNFf5vEyVNXhl8KcaJn6lMD/gMB2rY0qpaeTg4gPfU5wcg8S4Y\n' +
+ 'C9V//tw3hv0f2n+8kGNmqZrylOQDQWSSo8j8M2SRSXiwOHDoTASd1fyBEIqBAwzn\n' +
+ 'LvXVg8wQd1WlmM3b0Vrsbzltyh6y4SuKSkmgufYYvC07NknQO5vqvZcNoYbLNea3\n' +
+ '76NkFaMHUekSbwVejZgG5HGwbaYBgNdJEdpbWlA3X4yGRVxknQSUyt4dZRnw/HrX\n' +
+ 'k8x6/wvtw7wht0/DOqz1li7baSsMazqxx+jDdSr1h9xML416Q4loFCLgqQhil8Jq\n' +
+ 'Em4Hy3A=\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIGBTCCA+2gAwIBAgIRAJfKe4Zh4aWNt3bv6ZjQwogwDQYJKoZIhvcNAQEMBQAw\n' +
+ 'gZoxCzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJ\n' +
+ 'bmMuMRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTEzMDEGA1UEAwwq\n' +
+ 'QW1hem9uIFJEUyBjYS1jZW50cmFsLTEgUm9vdCBDQSBSU0E0MDk2IEcxMRAwDgYD\n' +
+ 'VQQHDAdTZWF0dGxlMCAXDTIxMDUyMTIyMDg1M1oYDzIxMjEwNTIxMjMwODUzWjCB\n' +
+ 'mjELMAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIElu\n' +
+ 'Yy4xEzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTMwMQYDVQQDDCpB\n' +
+ 'bWF6b24gUkRTIGNhLWNlbnRyYWwtMSBSb290IENBIFJTQTQwOTYgRzExEDAOBgNV\n' +
+ 'BAcMB1NlYXR0bGUwggIiMA0GCSqGSIb3DQEBAQUAA4ICDwAwggIKAoICAQCpgUH6\n' +
+ 'Crzd8cOw9prAh2rkQqAOx2vtuI7xX4tmBG4I/um28eBjyVmgwQ1fpq0Zg2nCKS54\n' +
+ 'Nn0pCmT7f3h6Bvopxn0J45AzXEtajFqXf92NQ3iPth95GVfAJSD7gk2LWMhpmID9\n' +
+ 'JGQyoGuDPg+hYyr292X6d0madzEktVVGO4mKTF989qEg+tY8+oN0U2fRTrqa2tZp\n' +
+ 'iYsmg350ynNopvntsJAfpCO/srwpsqHHLNFZ9jvhTU8uW90wgaKO9i31j/mHggCE\n' +
+ '+CAOaJCM3g+L8DPl/2QKsb6UkBgaaIwKyRgKSj1IlgrK+OdCBCOgM9jjId4Tqo2j\n' +
+ 'ZIrrPBGl6fbn1+etZX+2/tf6tegz+yV0HHQRAcKCpaH8AXF44bny9andslBoNjGx\n' +
+ 'H6R/3ib4FhPrnBMElzZ5i4+eM/cuPC2huZMBXb/jKgRC/QN1Wm3/nah5FWq+yn+N\n' +
+ 'tiAF10Ga0BYzVhHDEwZzN7gn38bcY5yi/CjDUNpY0OzEe2+dpaBKPlXTaFfn9Nba\n' +
+ 'CBmXPRF0lLGGtPeTAgjcju+NEcVa82Ht1pqxyu2sDtbu3J5bxp4RKtj+ShwN8nut\n' +
+ 'Tkf5Ea9rSmHEY13fzgibZlQhXaiFSKA2ASUwgJP19Putm0XKlBCNSGCoECemewxL\n' +
+ '+7Y8FszS4Uu4eaIwvXVqUEE2yf+4ex0hqQ1acQIDAQABo0IwQDAPBgNVHRMBAf8E\n' +
+ 'BTADAQH/MB0GA1UdDgQWBBSeUnXIRxNbYsZLtKomIz4Y1nOZEzAOBgNVHQ8BAf8E\n' +
+ 'BAMCAYYwDQYJKoZIhvcNAQEMBQADggIBAIpRvxVS0dzoosBh/qw65ghPUGSbP2D4\n' +
+ 'dm6oYCv5g/zJr4fR7NzEbHOXX5aOQnHbQL4M/7veuOCLNPOW1uXwywMg6gY+dbKe\n' +
+ 'YtPVA1as8G9sUyadeXyGh2uXGsziMFXyaESwiAXZyiYyKChS3+g26/7jwECFo5vC\n' +
+ 'XGhWpIO7Hp35Yglp8AnwnEAo/PnuXgyt2nvyTSrxlEYa0jus6GZEZd77pa82U1JH\n' +
+ 'qFhIgmKPWWdvELA3+ra1nKnvpWM/xX0pnMznMej5B3RT3Y+k61+kWghJE81Ix78T\n' +
+ '+tG4jSotgbaL53BhtQWBD1yzbbilqsGE1/DXPXzHVf9yD73fwh2tGWSaVInKYinr\n' +
+ 'a4tcrB3KDN/PFq0/w5/21lpZjVFyu/eiPj6DmWDuHW73XnRwZpHo/2OFkei5R7cT\n' +
+ 'rn/YdDD6c1dYtSw5YNnS6hdCQ3sOiB/xbPRN9VWJa6se79uZ9NLz6RMOr73DNnb2\n' +
+ 'bhIR9Gf7XAA5lYKqQk+A+stoKbIT0F65RnkxrXi/6vSiXfCh/bV6B41cf7MY/6YW\n' +
+ 'ehserSdjhQamv35rTFdM+foJwUKz1QN9n9KZhPxeRmwqPitAV79PloksOnX25ElN\n' +
+ 'SlyxdndIoA1wia1HRd26EFm2pqfZ2vtD2EjU3wD42CXX4H8fKVDna30nNFSYF0yn\n' +
+ 'jGKc3k6UNxpg\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIF/jCCA+agAwIBAgIQaRHaEqqacXN20e8zZJtmDDANBgkqhkiG9w0BAQwFADCB\n' +
+ 'lzELMAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIElu\n' +
+ 'Yy4xEzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTAwLgYDVQQDDCdB\n' +
+ 'bWF6b24gUkRTIHVzLWVhc3QtMSBSb290IENBIFJTQTQwOTYgRzExEDAOBgNVBAcM\n' +
+ 'B1NlYXR0bGUwIBcNMjEwNTI1MjIzODM1WhgPMjEyMTA1MjUyMzM4MzVaMIGXMQsw\n' +
+ 'CQYDVQQGEwJVUzEiMCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywgSW5jLjET\n' +
+ 'MBEGA1UECwwKQW1hem9uIFJEUzELMAkGA1UECAwCV0ExMDAuBgNVBAMMJ0FtYXpv\n' +
+ 'biBSRFMgdXMtZWFzdC0xIFJvb3QgQ0EgUlNBNDA5NiBHMTEQMA4GA1UEBwwHU2Vh\n' +
+ 'dHRsZTCCAiIwDQYJKoZIhvcNAQEBBQADggIPADCCAgoCggIBAInfBCaHuvj6Rb5c\n' +
+ 'L5Wmn1jv2PHtEGMHm+7Z8dYosdwouG8VG2A+BCYCZfij9lIGszrTXkY4O7vnXgru\n' +
+ 'JUNdxh0Q3M83p4X+bg+gODUs3jf+Z3Oeq7nTOk/2UYvQLcxP4FEXILxDInbQFcIx\n' +
+ 'yen1ESHggGrjEodgn6nbKQNRfIhjhW+TKYaewfsVWH7EF2pfj+cjbJ6njjgZ0/M9\n' +
+ 'VZifJFBgat6XUTOf3jwHwkCBh7T6rDpgy19A61laImJCQhdTnHKvzTpxcxiLRh69\n' +
+ 'ZObypR7W04OAUmFS88V7IotlPmCL8xf7kwxG+gQfvx31+A9IDMsiTqJ1Cc4fYEKg\n' +
+ 'bL+Vo+2Ii4W2esCTGVYmHm73drznfeKwL+kmIC/Bq+DrZ+veTqKFYwSkpHRyJCEe\n' +
+ 'U4Zym6POqQ/4LBSKwDUhWLJIlq99bjKX+hNTJykB+Lbcx0ScOP4IAZQoxmDxGWxN\n' +
+ 'S+lQj+Cx2pwU3S/7+OxlRndZAX/FKgk7xSMkg88HykUZaZ/ozIiqJqSnGpgXCtED\n' +
+ 'oQ4OJw5ozAr+/wudOawaMwUWQl5asD8fuy/hl5S1nv9XxIc842QJOtJFxhyeMIXt\n' +
+ 'LVECVw/dPekhMjS3Zo3wwRgYbnKG7YXXT5WMxJEnHu8+cYpMiRClzq2BEP6/MtI2\n' +
+ 'AZQQUFu2yFjRGL2OZA6IYjxnXYiRAgMBAAGjQjBAMA8GA1UdEwEB/wQFMAMBAf8w\n' +
+ 'HQYDVR0OBBYEFADCcQCPX2HmkqQcmuHfiQ2jjqnrMA4GA1UdDwEB/wQEAwIBhjAN\n' +
+ 'BgkqhkiG9w0BAQwFAAOCAgEASXkGQ2eUmudIKPeOIF7RBryCoPmMOsqP0+1qxF8l\n' +
+ 'pGkwmrgNDGpmd9s0ArfIVBTc1jmpgB3oiRW9c6n2OmwBKL4UPuQ8O3KwSP0iD2sZ\n' +
+ 'KMXoMEyphCEzW1I2GRvYDugL3Z9MWrnHkoaoH2l8YyTYvszTvdgxBPpM2x4pSkp+\n' +
+ '76d4/eRpJ5mVuQ93nC+YG0wXCxSq63hX4kyZgPxgCdAA+qgFfKIGyNqUIqWgeyTP\n' +
+ 'n5OgKaboYk2141Rf2hGMD3/hsGm0rrJh7g3C0ZirPws3eeJfulvAOIy2IZzqHUSY\n' +
+ 'jkFzraz6LEH3IlArT3jUPvWKqvh2lJWnnp56aqxBR7qHH5voD49UpJWY1K0BjGnS\n' +
+ 'OHcurpp0Yt/BIs4VZeWdCZwI7JaSeDcPMaMDBvND3Ia5Fga0thgYQTG6dE+N5fgF\n' +
+ 'z+hRaujXO2nb0LmddVyvE8prYlWRMuYFv+Co8hcMdJ0lEZlfVNu0jbm9/GmwAZ+l\n' +
+ '9umeYO9yz/uC7edC8XJBglMAKUmVK9wNtOckUWAcCfnPWYLbYa/PqtXBYcxrso5j\n' +
+ 'iaS/A7iEW51uteHBGrViCy1afGG+hiUWwFlesli+Rq4dNstX3h6h2baWABaAxEVJ\n' +
+ 'y1RnTQSz6mROT1VmZSgSVO37rgIyY0Hf0872ogcTS+FfvXgBxCxsNWEbiQ/XXva4\n' +
+ '0Ws=\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIICtDCCAjqgAwIBAgIRAMyaTlVLN0ndGp4ffwKAfoMwCgYIKoZIzj0EAwMwgZkx\n' +
+ 'CzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMu\n' +
+ 'MRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTEyMDAGA1UEAwwpQW1h\n' +
+ 'em9uIFJEUyBtZS1jZW50cmFsLTEgUm9vdCBDQSBFQ0MzODQgRzExEDAOBgNVBAcM\n' +
+ 'B1NlYXR0bGUwIBcNMjIwNTA3MDA0NDM3WhgPMjEyMjA1MDcwMTQ0MzdaMIGZMQsw\n' +
+ 'CQYDVQQGEwJVUzEiMCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywgSW5jLjET\n' +
+ 'MBEGA1UECwwKQW1hem9uIFJEUzELMAkGA1UECAwCV0ExMjAwBgNVBAMMKUFtYXpv\n' +
+ 'biBSRFMgbWUtY2VudHJhbC0xIFJvb3QgQ0EgRUNDMzg0IEcxMRAwDgYDVQQHDAdT\n' +
+ 'ZWF0dGxlMHYwEAYHKoZIzj0CAQYFK4EEACIDYgAE19nCV1nsI6CohSor13+B25cr\n' +
+ 'zg+IHdi9Y3L7ziQnHWI6yjBazvnKD+oC71aRRlR8b5YXsYGUQxWzPLHN7EGPcSGv\n' +
+ 'bzA9SLG1KQYCJaQ0m9Eg/iGrwKWOgylbhVw0bCxoo0IwQDAPBgNVHRMBAf8EBTAD\n' +
+ 'AQH/MB0GA1UdDgQWBBS4KsknsJXM9+QPEkBdZxUPaLr11zAOBgNVHQ8BAf8EBAMC\n' +
+ 'AYYwCgYIKoZIzj0EAwMDaAAwZQIxAJaRgrYIEfXQMZQQDxMTYS0azpyWSseQooXo\n' +
+ 'L3nYq4OHGBgYyQ9gVjvRYWU85PXbfgIwdi82DtANQFkCu+j+BU0JBY/uRKPEeYzo\n' +
+ 'JG92igKIcXPqCoxIJ7lJbbzmuf73gQu5\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIGATCCA+mgAwIBAgIRAJwCobx0Os8F7ihbJngxrR8wDQYJKoZIhvcNAQEMBQAw\n' +
+ 'gZgxCzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJ\n' +
+ 'bmMuMRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTExMC8GA1UEAwwo\n' +
+ 'QW1hem9uIFJEUyBtZS1zb3V0aC0xIFJvb3QgQ0EgUlNBNDA5NiBHMTEQMA4GA1UE\n' +
+ 'BwwHU2VhdHRsZTAgFw0yMTA1MjAxNzE1MzNaGA8yMTIxMDUyMDE4MTUzM1owgZgx\n' +
+ 'CzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMu\n' +
+ 'MRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTExMC8GA1UEAwwoQW1h\n' +
+ 'em9uIFJEUyBtZS1zb3V0aC0xIFJvb3QgQ0EgUlNBNDA5NiBHMTEQMA4GA1UEBwwH\n' +
+ 'U2VhdHRsZTCCAiIwDQYJKoZIhvcNAQEBBQADggIPADCCAgoCggIBANukKwlm+ZaI\n' +
+ 'Y5MkWGbEVLApEyLmlrHLEg8PfiiEa9ts7jssQcin3bzEPdTqGr5jo91ONoZ3ccWq\n' +
+ 'xJgg1W3bLu5CAO2CqIOXTXHRyCO/u0Ch1FGgWB8xETPSi3UHt/Vn1ltdO6DYdbDU\n' +
+ 'mYgwzYrvLBdRCwxsb9o+BuYQHVFzUYonqk/y9ujz3gotzFq7r55UwDTA1ita3vb4\n' +
+ 'eDKjIb4b1M4Wr81M23WHonpje+9qkkrAkdQcHrkgvSCV046xsq/6NctzwCUUNsgF\n' +
+ '7Q1a8ut5qJEYpz5ta8vI1rqFqAMBqCbFjRYlmAoTTpFPOmzAVxV+YoqTrW5A16su\n' +
+ '/2SXlMYfJ/n/ad/QfBNPPAAQMpyOr2RCL/YiL/PFZPs7NxYjnZHNWxMLSPgFyI+/\n' +
+ 't2klnn5jR76KJK2qimmaXedB90EtFsMRUU1e4NxH9gDuyrihKPJ3aVnZ35mSipvR\n' +
+ '/1KB8t8gtFXp/VQaz2sg8+uxPMKB81O37fL4zz6Mg5K8+aq3ejBiyHucpFGnsnVB\n' +
+ '3kQWeD36ONkybngmgWoyPceuSWm1hQ0Z7VRAQX+KlxxSaHmSaIk1XxZu9h9riQHx\n' +
+ 'fMuev6KXjRn/CjCoUTn+7eFrt0dT5GryQEIZP+nA0oq0LKxogigHNZlwAT4flrqb\n' +
+ 'JUfZJrqgoce5HjZSXl10APbtPjJi0fW9AgMBAAGjQjBAMA8GA1UdEwEB/wQFMAMB\n' +
+ 'Af8wHQYDVR0OBBYEFEfV+LztI29OVDRm0tqClP3NrmEWMA4GA1UdDwEB/wQEAwIB\n' +
+ 'hjANBgkqhkiG9w0BAQwFAAOCAgEAvSNe+0wuk53KhWlRlRf2x/97H2Q76X3anzF0\n' +
+ '5fOSVm022ldALzXMzqOfdnoKIhAu2oVKiHHKs7mMas+T6TL+Mkphx0CYEVxFE3PG\n' +
+ '061q3CqJU+wMm9W9xsB79oB2XG47r1fIEywZZ3GaRsatAbjcNOT8uBaATPQAfJFN\n' +
+ 'zjFe4XyN+rA4cFrYNvfHTeu5ftrYmvks7JlRaJgEGWsz+qXux7uvaEEVPqEumd2H\n' +
+ 'uYeaRNOZ2V23R009X5lbgBFx9tq5VDTnKhQiTQ2SeT0rc1W3Dz5ik6SbQQNP3nSR\n' +
+ '0Ywy7r/sZ3fcDyfFiqnrVY4Ympfvb4YW2PZ6OsQJbzH6xjdnTG2HtzEU30ngxdp1\n' +
+ 'WUEF4zt6rjJCp7QBUqXgdlHvJqYu6949qtWjEPiFN9uSsRV2i1YDjJqN52dLjAPn\n' +
+ 'AipJKo8x1PHTwUzuITqnB9BdP+5TlTl8biJfkEf/+08eWDTLlDHr2VrZLOLompTh\n' +
+ 'bS5OrhDmqA2Q+O+EWrTIhMflwwlCpR9QYM/Xwvlbad9H0FUHbJsCVNaru3wGOgWo\n' +
+ 'tt3dNSK9Lqnv/Ej9K9v6CRr36in4ylJKivhJ5B9E7ABHg7EpBJ1xi7O5eNDkNoJG\n' +
+ '+pFyphJq3AkBR2U4ni2tUaTAtSW2tks7IaiDV+UMtqZyGabT5ISQfWLLtLHSWn2F\n' +
+ 'Tspdjbg=\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIECTCCAvGgAwIBAgIRAJZFh4s9aZGzKaTMLrSb4acwDQYJKoZIhvcNAQELBQAw\n' +
+ 'gZwxCzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJ\n' +
+ 'bmMuMRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTE1MDMGA1UEAwws\n' +
+ 'QW1hem9uIFJEUyBCZXRhIHVzLWVhc3QtMSBSb290IENBIFJTQTIwNDggRzExEDAO\n' +
+ 'BgNVBAcMB1NlYXR0bGUwIBcNMjEwNTE4MjEyODQxWhgPMjA2MTA1MTgyMjI4NDFa\n' +
+ 'MIGcMQswCQYDVQQGEwJVUzEiMCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywg\n' +
+ 'SW5jLjETMBEGA1UECwwKQW1hem9uIFJEUzELMAkGA1UECAwCV0ExNTAzBgNVBAMM\n' +
+ 'LEFtYXpvbiBSRFMgQmV0YSB1cy1lYXN0LTEgUm9vdCBDQSBSU0EyMDQ4IEcxMRAw\n' +
+ 'DgYDVQQHDAdTZWF0dGxlMIIBIjANBgkqhkiG9w0BAQEFAAOCAQ8AMIIBCgKCAQEA\n' +
+ '17i2yoU6diep+WrqxIn2CrDEO2NdJVwWTSckx4WMZlLpkQDoymSmkNHjq9ADIApD\n' +
+ 'A31Cx+843apL7wub8QkFZD0Tk7/ThdHWJOzcAM3ov98QBPQfOC1W5zYIIRP2F+vQ\n' +
+ 'TRETHQnLcW3rLv0NMk5oQvIKpJoC9ett6aeVrzu+4cU4DZVWYlJUoC/ljWzCluau\n' +
+ '8blfW0Vwin6OB7s0HCG5/wijQWJBU5SrP/KAIPeQi1GqG5efbqAXDr/ple0Ipwyo\n' +
+ 'Xjjl73LenGUgqpANlC9EAT4i7FkJcllLPeK3NcOHjuUG0AccLv1lGsHAxZLgjk/x\n' +
+ 'z9ZcnVV9UFWZiyJTKxeKPwIDAQABo0IwQDAPBgNVHRMBAf8EBTADAQH/MB0GA1Ud\n' +
+ 'DgQWBBRWyMuZUo4gxCR3Luf9/bd2AqZ7CjAOBgNVHQ8BAf8EBAMCAYYwDQYJKoZI\n' +
+ 'hvcNAQELBQADggEBAIqN2DlIKlvDFPO0QUZQVFbsi/tLdYM98/vvzBpttlTGVMyD\n' +
+ 'gJuQeHVz+MnhGIwoCGOlGU3OOUoIlLAut0+WG74qYczn43oA2gbMd7HoD7oL/IGg\n' +
+ 'njorBwJVcuuLv2G//SqM3nxGcLRtkRnQ+lvqPxMz9+0fKFUn6QcIDuF0QSfthLs2\n' +
+ 'WSiGEPKO9c9RSXdRQ4pXA7c3hXng8P4A2ZmdciPne5Nu4I4qLDGZYRrRLRkNTrOi\n' +
+ 'TyS6r2HNGUfgF7eOSeKt3NWL+mNChcYj71/Vycf5edeczpUgfnWy9WbPrK1svKyl\n' +
+ 'aAs2xg+X6O8qB+Mnj2dNBzm+lZIS3sIlm+nO9sg=\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIICrjCCAjSgAwIBAgIRAPAlEk8VJPmEzVRRaWvTh2AwCgYIKoZIzj0EAwMwgZYx\n' +
+ 'CzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMu\n' +
+ 'MRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTEvMC0GA1UEAwwmQW1h\n' +
+ 'em9uIFJEUyB1cy1lYXN0LTEgUm9vdCBDQSBFQ0MzODQgRzExEDAOBgNVBAcMB1Nl\n' +
+ 'YXR0bGUwIBcNMjEwNTI1MjI0MTU1WhgPMjEyMTA1MjUyMzQxNTVaMIGWMQswCQYD\n' +
+ 'VQQGEwJVUzEiMCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywgSW5jLjETMBEG\n' +
+ 'A1UECwwKQW1hem9uIFJEUzELMAkGA1UECAwCV0ExLzAtBgNVBAMMJkFtYXpvbiBS\n' +
+ 'RFMgdXMtZWFzdC0xIFJvb3QgQ0EgRUNDMzg0IEcxMRAwDgYDVQQHDAdTZWF0dGxl\n' +
+ 'MHYwEAYHKoZIzj0CAQYFK4EEACIDYgAEx5xjrup8II4HOJw15NTnS3H5yMrQGlbj\n' +
+ 'EDA5MMGnE9DmHp5dACIxmPXPMe/99nO7wNdl7G71OYPCgEvWm0FhdvVUeTb3LVnV\n' +
+ 'BnaXt32Ek7/oxGk1T+Df03C+W0vmuJ+wo0IwQDAPBgNVHRMBAf8EBTADAQH/MB0G\n' +
+ 'A1UdDgQWBBTGXmqBWN/1tkSea4pNw0oHrjk2UDAOBgNVHQ8BAf8EBAMCAYYwCgYI\n' +
+ 'KoZIzj0EAwMDaAAwZQIxAIqqZWCSrIkZ7zsv/FygtAusW6yvlL935YAWYPVXU30m\n' +
+ 'jkMFLM+/RJ9GMvnO8jHfCgIwB+whlkcItzE9CRQ6CsMo/d5cEHDUu/QW6jSIh9BR\n' +
+ 'OGh9pTYPVkUbBiKPA7lVVhre\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIF/zCCA+egAwIBAgIRAJGY9kZITwfSRaAS/bSBOw8wDQYJKoZIhvcNAQEMBQAw\n' +
+ 'gZcxCzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJ\n' +
+ 'bmMuMRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTEwMC4GA1UEAwwn\n' +
+ 'QW1hem9uIFJEUyBzYS1lYXN0LTEgUm9vdCBDQSBSU0E0MDk2IEcxMRAwDgYDVQQH\n' +
+ 'DAdTZWF0dGxlMCAXDTIxMDUxOTE4MTEyMFoYDzIxMjEwNTE5MTkxMTIwWjCBlzEL\n' +
+ 'MAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4x\n' +
+ 'EzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTAwLgYDVQQDDCdBbWF6\n' +
+ 'b24gUkRTIHNhLWVhc3QtMSBSb290IENBIFJTQTQwOTYgRzExEDAOBgNVBAcMB1Nl\n' +
+ 'YXR0bGUwggIiMA0GCSqGSIb3DQEBAQUAA4ICDwAwggIKAoICAQDe2vlDp6Eo4WQi\n' +
+ 'Wi32YJOgdXHhxTFrLjB9SRy22DYoMaWfginJIwJcSR8yse8ZDQuoNhERB9LRggAE\n' +
+ 'eng23mhrfvtL1yQkMlZfBu4vG1nOb22XiPFzk7X2wqz/WigdYNBCqa1kK3jrLqPx\n' +
+ 'YUy7jk2oZle4GLVRTNGuMfcid6S2hs3UCdXfkJuM2z2wc3WUlvHoVNk37v2/jzR/\n' +
+ 'hSCHZv5YHAtzL/kLb/e64QkqxKll5QmKhyI6d7vt6Lr1C0zb+DmwxUoJhseAS0hI\n' +
+ 'dRk5DklMb4Aqpj6KN0ss0HAYqYERGRIQM7KKA4+hxDMUkJmt8KqWKZkAlCZgflzl\n' +
+ 'm8NZ31o2cvBzf6g+VFHx+6iVrSkohVQydkCxx7NJ743iPKsh8BytSM4qU7xx4OnD\n' +
+ 'H2yNXcypu+D5bZnVZr4Pywq0w0WqbTM2bpYthG9IC4JeVUvZ2mDc01lqOlbMeyfT\n' +
+ 'og5BRPLDXdZK8lapo7se2teh64cIfXtCmM2lDSwm1wnH2iSK+AWZVIM3iE45WSGc\n' +
+ 'vZ+drHfVgjJJ5u1YrMCWNL5C2utFbyF9Obw9ZAwm61MSbPQL9JwznhNlCh7F2ANW\n' +
+ 'ZHWQPNcOAJqzE4uVcJB1ZeVl28ORYY1668lx+s9yYeMXk3QQdj4xmdnvoBFggqRB\n' +
+ 'ZR6Z0D7ZohADXe024RzEo1TukrQgKQIDAQABo0IwQDAPBgNVHRMBAf8EBTADAQH/\n' +
+ 'MB0GA1UdDgQWBBT7Vs4Y5uG/9aXnYGNMEs6ycPUT3jAOBgNVHQ8BAf8EBAMCAYYw\n' +
+ 'DQYJKoZIhvcNAQEMBQADggIBACN4Htp2PvGcQA0/sAS+qUVWWJoAXSsu8Pgc6Gar\n' +
+ '7tKVlNJ/4W/a6pUV2Xo/Tz3msg4yiE8sMESp2k+USosD5n9Alai5s5qpWDQjrqrh\n' +
+ '76AGyF2nzve4kIN19GArYhm4Mz/EKEG1QHYvBDGgXi3kNvL/a2Zbybp+3LevG+q7\n' +
+ 'xtx4Sz9yIyMzuT/6Y7ijtiMZ9XbuxGf5wab8UtwT3Xq1UradJy0KCkzRJAz/Wy/X\n' +
+ 'HbTkEvKSaYKExH6sLo0jqdIjV/d2Io31gt4e0Ly1ER2wPyFa+pc/swu7HCzrN+iz\n' +
+ 'A2ZM4+KX9nBvFyfkHLix4rALg+WTYJa/dIsObXkdZ3z8qPf5A9PXlULiaa1mcP4+\n' +
+ 'rokw74IyLEYooQ8iSOjxumXhnkTS69MAdGzXYE5gnHokABtGD+BB5qLhtLt4fqAp\n' +
+ '8AyHpQWMyV42M9SJLzQ+iOz7kAgJOBOaVtJI3FV/iAg/eqWVm3yLuUTWDxSHrKuL\n' +
+ 'N19+pSjF6TNvUSFXwEa2LJkfDqIOCE32iOuy85QY//3NsgrSQF6UkSPa95eJrSGI\n' +
+ '3hTRYYh3Up2GhBGl1KUy7/o0k3KRZTk4s38fylY8bZ3TakUOH5iIGoHyFVVcp361\n' +
+ 'Pyy25SzFSmNalWoQd9wZVc/Cps2ldxhcttM+WLkFNzprd0VJa8qTz8vYtHP0ouDN\n' +
+ 'nWS0\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIGCTCCA/GgAwIBAgIRAOY7gfcBZgR2tqfBzMbFQCUwDQYJKoZIhvcNAQEMBQAw\n' +
+ 'gZwxCzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJ\n' +
+ 'bmMuMRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTE1MDMGA1UEAwws\n' +
+ 'QW1hem9uIFJEUyBhcC1zb3V0aGVhc3QtNCBSb290IENBIFJTQTQwOTYgRzExEDAO\n' +
+ 'BgNVBAcMB1NlYXR0bGUwIBcNMjIwNTI1MTY1NDU5WhgPMjEyMjA1MjUxNzU0NTla\n' +
+ 'MIGcMQswCQYDVQQGEwJVUzEiMCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywg\n' +
+ 'SW5jLjETMBEGA1UECwwKQW1hem9uIFJEUzELMAkGA1UECAwCV0ExNTAzBgNVBAMM\n' +
+ 'LEFtYXpvbiBSRFMgYXAtc291dGhlYXN0LTQgUm9vdCBDQSBSU0E0MDk2IEcxMRAw\n' +
+ 'DgYDVQQHDAdTZWF0dGxlMIICIjANBgkqhkiG9w0BAQEFAAOCAg8AMIICCgKCAgEA\n' +
+ 'lfxER43FuLRdL08bddF0YhbCP+XXKj1A/TFMXmd2My8XDei8rPXFYyyjMig9+xZw\n' +
+ 'uAsIxLwz8uiA26CKA8bCZKg5VG2kTeOJAfvBJaLv1CZefs3Z4Uf1Sjvm6MF2yqEj\n' +
+ 'GoORfyfL9HiZFTDuF/hcjWoKYCfMuG6M/wO8IbdICrX3n+BiYQJu/pFO660Mg3h/\n' +
+ '8YBBWYDbHoCiH/vkqqJugQ5BM3OI5nsElW51P1icEEqti4AZ7JmtSv9t7fIFBVyR\n' +
+ 'oaEyOgpp0sm193F/cDJQdssvjoOnaubsSYm1ep3awZAUyGN/X8MBrPY95d0hLhfH\n' +
+ 'Ehc5Icyg+hsosBljlAyksmt4hFQ9iBnWIz/ZTfGMck+6p3HVL9RDgvluez+rWv59\n' +
+ '8q7omUGsiPApy5PDdwI/Wt/KtC34/2sjslIJfvgifdAtkRPkhff1WEwER00ADrN9\n' +
+ 'eGGInaCpJfb1Rq8cV2n00jxg7DcEd65VR3dmIRb0bL+jWK62ni/WdEyomAOMfmGj\n' +
+ 'aWf78S/4rasHllWJ+QwnaUYY3u6N8Cgio0/ep4i34FxMXqMV3V0/qXdfhyabi/LM\n' +
+ 'wCxNo1Dwt+s6OtPJbwO92JL+829QAxydfmaMTeHBsgMPkG7RwAekeuatKGHNsc2Z\n' +
+ 'x2Q4C2wVvOGAhcHwxfM8JfZs3nDSZJndtVVnFlUY0UECAwEAAaNCMEAwDwYDVR0T\n' +
+ 'AQH/BAUwAwEB/zAdBgNVHQ4EFgQUpnG7mWazy6k97/tb5iduRB3RXgQwDgYDVR0P\n' +
+ 'AQH/BAQDAgGGMA0GCSqGSIb3DQEBDAUAA4ICAQCDLqq1Wwa9Tkuv7vxBnIeVvvFF\n' +
+ 'ecTn+P+wJxl9Qa2ortzqTHZsBDyJO62d04AgBwiDXkJ9a+bthgG0H1J7Xee8xqv1\n' +
+ 'xyX2yKj24ygHjspLotKP4eDMdDi5TYq+gdkbPmm9Q69B1+W6e049JVGXvWG8/7kU\n' +
+ 'igxeuCYwtCCdUPRLf6D8y+1XMGgVv3/DSOHWvTg3MJ1wJ3n3+eve3rjGdRYWZeJu\n' +
+ 'k21HLSZYzVrCtUsh2YAeLnUbSxVuT2Xr4JehYe9zW5HEQ8Je/OUfnCy9vzoN/ITw\n' +
+ 'osAH+EBJQey7RxEDqMwCaRefH0yeHFcnOll0OXg/urnQmwbEYzQ1uutJaBPsjU0J\n' +
+ 'Qf06sMxI7GiB5nPE+CnI2sM6A9AW9kvwexGXpNJiLxF8dvPQthpOKGcYu6BFvRmt\n' +
+ '6ctfXd9b7JJoVqMWuf5cCY6ihpk1e9JTlAqu4Eb/7JNyGiGCR40iSLvV28un9wiE\n' +
+ 'plrdYxwcNYq851BEu3r3AyYWw/UW1AKJ5tM+/Gtok+AphMC9ywT66o/Kfu44mOWm\n' +
+ 'L3nSLSWEcgfUVgrikpnyGbUnGtgCmHiMlUtNVexcE7OtCIZoVAlCGKNu7tyuJf10\n' +
+ 'Qlk8oIIzfSIlcbHpOYoN79FkLoDNc2er4Gd+7w1oPQmdAB0jBJnA6t0OUBPKdDdE\n' +
+ 'Ufff2jrbfbzECn1ELg==\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIGCDCCA/CgAwIBAgIQIuO1A8LOnmc7zZ/vMm3TrDANBgkqhkiG9w0BAQwFADCB\n' +
+ 'nDELMAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIElu\n' +
+ 'Yy4xEzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTUwMwYDVQQDDCxB\n' +
+ 'bWF6b24gUkRTIGFwLXNvdXRoZWFzdC0yIFJvb3QgQ0EgUlNBNDA5NiBHMTEQMA4G\n' +
+ 'A1UEBwwHU2VhdHRsZTAgFw0yMTA1MjQyMDQ2MThaGA8yMTIxMDUyNDIxNDYxOFow\n' +
+ 'gZwxCzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJ\n' +
+ 'bmMuMRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTE1MDMGA1UEAwws\n' +
+ 'QW1hem9uIFJEUyBhcC1zb3V0aGVhc3QtMiBSb290IENBIFJTQTQwOTYgRzExEDAO\n' +
+ 'BgNVBAcMB1NlYXR0bGUwggIiMA0GCSqGSIb3DQEBAQUAA4ICDwAwggIKAoICAQDq\n' +
+ 'qRHKbG8ZK6/GkGm2cenznEF06yHwI1gD5sdsHjTgekDZ2Dl9RwtDmUH2zFuIQwGj\n' +
+ 'SeC7E2iKwrJRA5wYzL9/Vk8NOILEKQOP8OIKUHbc7q8rEtjs401KcU6pFBBEdO9G\n' +
+ 'CTiRhogq+8mhC13AM/UriZJbKhwgM2UaDOzAneGMhQAGjH8z83NsNcPxpYVE7tqM\n' +
+ 'sch5yLtIJLkJRusrmQQTeHUev16YNqyUa+LuFclFL0FzFCimkcxUhXlbfEKXbssS\n' +
+ 'yPzjiv8wokGyo7+gA0SueceMO2UjfGfute3HlXZDcNvBbkSY+ver41jPydyRD6Qq\n' +
+ 'oEkh0tyIbPoa3oU74kwipJtz6KBEA3u3iq61OUR0ENhR2NeP7CSKrC24SnQJZ/92\n' +
+ 'qxusrbyV/0w+U4m62ug/o4hWNK1lUcc2AqiBOvCSJ7qpdteTFxcEIzDwYfERDx6a\n' +
+ 'd9+3IPvzMb0ZCxBIIUFMxLTF7yAxI9s6KZBBXSZ6tDcCCYIgEysEPRWMRAcG+ye/\n' +
+ 'fZVn9Vnzsj4/2wchC2eQrYpb1QvG4eMXA4M5tFHKi+/8cOPiUzJRgwS222J8YuDj\n' +
+ 'yEBval874OzXk8H8Mj0JXJ/jH66WuxcBbh5K7Rp5oJn7yju9yqX6qubY8gVeMZ1i\n' +
+ 'u4oXCopefDqa35JplQNUXbWwSebi0qJ4EK0V8F9Q+QIDAQABo0IwQDAPBgNVHRMB\n' +
+ 'Af8EBTADAQH/MB0GA1UdDgQWBBT4ysqCxaPe7y+g1KUIAenqu8PAgzAOBgNVHQ8B\n' +
+ 'Af8EBAMCAYYwDQYJKoZIhvcNAQEMBQADggIBALU8WN35KAjPZEX65tobtCDQFkIO\n' +
+ 'uJjv0alD7qLB0i9eY80C+kD87HKqdMDJv50a5fZdqOta8BrHutgFtDm+xo5F/1M3\n' +
+ 'u5/Vva5lV4xy5DqPajcF4Mw52czYBmeiLRTnyPJsU93EQIC2Bp4Egvb6LI4cMOgm\n' +
+ '4pY2hL8DojOC5PXt4B1/7c1DNcJX3CMzHDm4SMwiv2MAxSuC/cbHXcWMk+qXdrVx\n' +
+ '+ayLUSh8acaAOy3KLs1MVExJ6j9iFIGsDVsO4vr4ZNsYQiyHjp+L8ops6YVBO5AT\n' +
+ 'k/pI+axHIVsO5qiD4cFWvkGqmZ0gsVtgGUchZaacboyFsVmo6QPrl28l6LwxkIEv\n' +
+ 'GGJYvIBW8sfqtGRspjfX5TlNy5IgW/VOwGBdHHsvg/xpRo31PR3HOFw7uPBi7cAr\n' +
+ 'FiZRLJut7af98EB2UvovZnOh7uIEGPeecQWeOTQfJeWet2FqTzFYd0NUMgqPuJx1\n' +
+ 'vLKferP+ajAZLJvVnW1J7Vccx/pm0rMiUJEf0LRb/6XFxx7T2RGjJTi0EzXODTYI\n' +
+ 'gnLfBBjnolQqw+emf4pJ4pAtly0Gq1KoxTG2QN+wTd4lsCMjnelklFDjejwnl7Uy\n' +
+ 'vtxzRBAu/hi/AqDkDFf94m6j+edIrjbi9/JDFtQ9EDlyeqPgw0qwi2fwtJyMD45V\n' +
+ 'fejbXelUSJSzDIdY\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIGCTCCA/GgAwIBAgIRAN7Y9G9i4I+ZaslPobE7VL4wDQYJKoZIhvcNAQEMBQAw\n' +
+ 'gZwxCzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJ\n' +
+ 'bmMuMRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTE1MDMGA1UEAwws\n' +
+ 'QW1hem9uIFJEUyBhcC1ub3J0aGVhc3QtMiBSb290IENBIFJTQTQwOTYgRzExEDAO\n' +
+ 'BgNVBAcMB1NlYXR0bGUwIBcNMjEwNTIwMTYzMzIzWhgPMjEyMTA1MjAxNzMzMjNa\n' +
+ 'MIGcMQswCQYDVQQGEwJVUzEiMCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywg\n' +
+ 'SW5jLjETMBEGA1UECwwKQW1hem9uIFJEUzELMAkGA1UECAwCV0ExNTAzBgNVBAMM\n' +
+ 'LEFtYXpvbiBSRFMgYXAtbm9ydGhlYXN0LTIgUm9vdCBDQSBSU0E0MDk2IEcxMRAw\n' +
+ 'DgYDVQQHDAdTZWF0dGxlMIICIjANBgkqhkiG9w0BAQEFAAOCAg8AMIICCgKCAgEA\n' +
+ '4BEPCiIfiK66Q/qa8k+eqf1Q3qsa6Xuu/fPkpuStXVBShhtXd3eqrM0iT4Xxs420\n' +
+ 'Va0vSB3oZ7l86P9zYfa60n6PzRxdYFckYX330aI7L/oFIdaodB/C9szvROI0oLG+\n' +
+ '6RwmIF2zcprH0cTby8MiM7G3v9ykpq27g4WhDC1if2j8giOQL3oHpUaByekZNIHF\n' +
+ 'dIllsI3RkXmR3xmmxoOxJM1B9MZi7e1CvuVtTGOnSGpNCQiqofehTGwxCN2wFSK8\n' +
+ 'xysaWlw48G0VzZs7cbxoXMH9QbMpb4tpk0d+T8JfAPu6uWO9UwCLWWydf0CkmA/+\n' +
+ 'D50/xd1t33X9P4FEaPSg5lYbHXzSLWn7oLbrN2UqMLaQrkoEBg/VGvzmfN0mbflw\n' +
+ '+T87bJ/VEOVNlG+gepyCTf89qIQVWOjuYMox4sK0PjzZGsYEuYiq1+OUT3vk/e5K\n' +
+ 'ag1fCcq2Isy4/iwB2xcXrsQ6ljwdk1fc+EmOnjGKrhuOHJY3S+RFv4ToQBsVyYhC\n' +
+ 'XGaC3EkqIX0xaCpDimxYhFjWhpDXAjG/zJ+hRLDAMCMhl/LPGRk/D1kzSbPmdjpl\n' +
+ 'lEMK5695PeBvEBTQdBQdOiYgOU3vWU6tzwwHfiM2/wgvess/q0FDAHfJhppbgbb9\n' +
+ '3vgsIUcsvoC5o29JvMsUxsDRvsAfEmMSDGkJoA/X6GECAwEAAaNCMEAwDwYDVR0T\n' +
+ 'AQH/BAUwAwEB/zAdBgNVHQ4EFgQUgEWm1mZCbGD6ytbwk2UU1aLaOUUwDgYDVR0P\n' +
+ 'AQH/BAQDAgGGMA0GCSqGSIb3DQEBDAUAA4ICAQBb4+ABTGBGwxK1U/q4g8JDqTQM\n' +
+ '1Wh8Oz8yAk4XtPJMAmCctxbd81cRnSnePWw/hxViLVtkZ/GsemvXfqAQyOn1coN7\n' +
+ 'QeYSw+ZOlu0j2jEJVynmgsR7nIRqE7QkCyZAU+d2FTJUfmee+IiBiGyFGgxz9n7A\n' +
+ 'JhBZ/eahBbiuoOik/APW2JWLh0xp0W0GznfJ8lAlaQTyDa8iDXmVtbJg9P9qzkvl\n' +
+ 'FgPXQttzEOyooF8Pb2LCZO4kUz+1sbU7tHdr2YE+SXxt6D3SBv+Yf0FlvyWLiqVk\n' +
+ 'GDEOlPPTDSjAWgKnqST8UJ0RDcZK/v1ixs7ayqQJU0GUQm1I7LGTErWXHMnCuHKe\n' +
+ 'UKYuiSZwmTcJ06NgdhcCnGZgPq13ryMDqxPeltQc3n5eO7f1cL9ERYLDLOzm6A9P\n' +
+ 'oQ3MfcVOsbHgGHZWaPSeNrQRN9xefqBXH0ZPasgcH9WJdsLlEjVUXoultaHOKx3b\n' +
+ 'UCCb+d3EfqF6pRT488ippOL6bk7zNubwhRa/+y4wjZtwe3kAX78ACJVcjPobH9jZ\n' +
+ 'ErySads5zdQeaoee5wRKdp3TOfvuCe4bwLRdhOLCHWzEcXzY3g/6+ppLvNom8o+h\n' +
+ 'Bh5X26G6KSfr9tqhQ3O9IcbARjnuPbvtJnoPY0gz3EHHGPhy0RNW8i2gl3nUp0ah\n' +
+ 'PtjwbKW0hYAhIttT0Q==\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIICtzCCAj2gAwIBAgIQQRBQTs6Y3H1DDbpHGta3lzAKBggqhkjOPQQDAzCBmzEL\n' +
+ 'MAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4x\n' +
+ 'EzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTQwMgYDVQQDDCtBbWF6\n' +
+ 'b24gUkRTIGFwLXNvdXRoZWFzdC0zIFJvb3QgQ0EgRUNDMzg0IEcxMRAwDgYDVQQH\n' +
+ 'DAdTZWF0dGxlMCAXDTIxMDYxMTAwMTI0M1oYDzIxMjEwNjExMDExMjQzWjCBmzEL\n' +
+ 'MAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4x\n' +
+ 'EzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTQwMgYDVQQDDCtBbWF6\n' +
+ 'b24gUkRTIGFwLXNvdXRoZWFzdC0zIFJvb3QgQ0EgRUNDMzg0IEcxMRAwDgYDVQQH\n' +
+ 'DAdTZWF0dGxlMHYwEAYHKoZIzj0CAQYFK4EEACIDYgAEs0942Xj4m/gKA+WA6F5h\n' +
+ 'AHYuek9eGpzTRoLJddM4rEV1T3eSueytMVKOSlS3Ub9IhyQrH2D8EHsLYk9ktnGR\n' +
+ 'pATk0kCYTqFbB7onNo070lmMJmGT/Q7NgwC8cySChFxbo0IwQDAPBgNVHRMBAf8E\n' +
+ 'BTADAQH/MB0GA1UdDgQWBBQ20iKBKiNkcbIZRu0y1uoF1yJTEzAOBgNVHQ8BAf8E\n' +
+ 'BAMCAYYwCgYIKoZIzj0EAwMDaAAwZQIwYv0wTSrpQTaPaarfLN8Xcqrqu3hzl07n\n' +
+ 'FrESIoRw6Cx77ZscFi2/MV6AFyjCV/TlAjEAhpwJ3tpzPXpThRML8DMJYZ3YgMh3\n' +
+ 'CMuLqhPpla3cL0PhybrD27hJWl29C4el6aMO\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIICrDCCAjOgAwIBAgIQGcztRyV40pyMKbNeSN+vXTAKBggqhkjOPQQDAzCBljEL\n' +
+ 'MAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4x\n' +
+ 'EzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMS8wLQYDVQQDDCZBbWF6\n' +
+ 'b24gUkRTIHVzLWVhc3QtMiBSb290IENBIEVDQzM4NCBHMTEQMA4GA1UEBwwHU2Vh\n' +
+ 'dHRsZTAgFw0yMTA1MjEyMzE1NTZaGA8yMTIxMDUyMjAwMTU1NlowgZYxCzAJBgNV\n' +
+ 'BAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMuMRMwEQYD\n' +
+ 'VQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTEvMC0GA1UEAwwmQW1hem9uIFJE\n' +
+ 'UyB1cy1lYXN0LTIgUm9vdCBDQSBFQ0MzODQgRzExEDAOBgNVBAcMB1NlYXR0bGUw\n' +
+ 'djAQBgcqhkjOPQIBBgUrgQQAIgNiAAQfDcv+GGRESD9wT+I5YIPRsD3L+/jsiIis\n' +
+ 'Tr7t9RSbFl+gYpO7ZbDXvNbV5UGOC5lMJo/SnqFRTC6vL06NF7qOHfig3XO8QnQz\n' +
+ '6T5uhhrhnX2RSY3/10d2kTyHq3ZZg3+jQjBAMA8GA1UdEwEB/wQFMAMBAf8wHQYD\n' +
+ 'VR0OBBYEFLDyD3PRyNXpvKHPYYxjHXWOgfPnMA4GA1UdDwEB/wQEAwIBhjAKBggq\n' +
+ 'hkjOPQQDAwNnADBkAjB20HQp6YL7CqYD82KaLGzgw305aUKw2aMrdkBR29J183jY\n' +
+ '6Ocj9+Wcif9xnRMS+7oCMAvrt03rbh4SU9BohpRUcQ2Pjkh7RoY0jDR4Xq4qzjNr\n' +
+ '5UFr3BXpFvACxXF51BksGQ==\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIICrjCCAjWgAwIBAgIQeKbS5zvtqDvRtwr5H48cAjAKBggqhkjOPQQDAzCBlzEL\n' +
+ 'MAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4x\n' +
+ 'EzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTAwLgYDVQQDDCdBbWF6\n' +
+ 'b24gUkRTIG1lLXNvdXRoLTEgUm9vdCBDQSBFQ0MzODQgRzExEDAOBgNVBAcMB1Nl\n' +
+ 'YXR0bGUwIBcNMjEwNTIwMTcxOTU1WhgPMjEyMTA1MjAxODE5NTVaMIGXMQswCQYD\n' +
+ 'VQQGEwJVUzEiMCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywgSW5jLjETMBEG\n' +
+ 'A1UECwwKQW1hem9uIFJEUzELMAkGA1UECAwCV0ExMDAuBgNVBAMMJ0FtYXpvbiBS\n' +
+ 'RFMgbWUtc291dGgtMSBSb290IENBIEVDQzM4NCBHMTEQMA4GA1UEBwwHU2VhdHRs\n' +
+ 'ZTB2MBAGByqGSM49AgEGBSuBBAAiA2IABEKjgUaAPmUlRMEQdBC7BScAGosJ1zRV\n' +
+ 'LDd38qTBjzgmwBfQJ5ZfGIvyEK5unB09MB4e/3qqK5I/L6Qn5Px/n5g4dq0c7MQZ\n' +
+ 'u7G9GBYm90U3WRJBf7lQrPStXaRnS4A/O6NCMEAwDwYDVR0TAQH/BAUwAwEB/zAd\n' +
+ 'BgNVHQ4EFgQUNKcAbGEIn03/vkwd8g6jNyiRdD4wDgYDVR0PAQH/BAQDAgGGMAoG\n' +
+ 'CCqGSM49BAMDA2cAMGQCMHIeTrjenCSYuGC6txuBt/0ZwnM/ciO9kHGWVCoK8QLs\n' +
+ 'jGghb5/YSFGZbmQ6qpGlSAIwVOQgdFfTpEfe5i+Vs9frLJ4QKAfc27cTNYzRIM0I\n' +
+ 'E+AJgK4C4+DiyyMzOpiCfmvq\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIGCDCCA/CgAwIBAgIQSFkEUzu9FYgC5dW+5lnTgjANBgkqhkiG9w0BAQwFADCB\n' +
+ 'nDELMAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIElu\n' +
+ 'Yy4xEzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTUwMwYDVQQDDCxB\n' +
+ 'bWF6b24gUkRTIGFwLXNvdXRoZWFzdC0zIFJvb3QgQ0EgUlNBNDA5NiBHMTEQMA4G\n' +
+ 'A1UEBwwHU2VhdHRsZTAgFw0yMTA2MTEwMDA4MzZaGA8yMTIxMDYxMTAxMDgzNlow\n' +
+ 'gZwxCzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJ\n' +
+ 'bmMuMRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTE1MDMGA1UEAwws\n' +
+ 'QW1hem9uIFJEUyBhcC1zb3V0aGVhc3QtMyBSb290IENBIFJTQTQwOTYgRzExEDAO\n' +
+ 'BgNVBAcMB1NlYXR0bGUwggIiMA0GCSqGSIb3DQEBAQUAA4ICDwAwggIKAoICAQDx\n' +
+ 'my5Qmd8zdwaI/KOKV9Xar9oNbhJP5ED0JCiigkuvCkg5qM36klszE8JhsUj40xpp\n' +
+ 'vQw9wkYW4y+C8twBpzKGBvakqMnoaVUV7lOCKx0RofrnNwkZCboTBB4X/GCZ3fIl\n' +
+ 'YTybS7Ehi1UuiaZspIT5A2jidoA8HiBPk+mTg1UUkoWS9h+MEAPa8L4DY6fGf4pO\n' +
+ 'J1Gk2cdePuNzzIrpm2yPto+I8MRROwZ3ha7ooyymOXKtz2c7jEHHJ314boCXAv9G\n' +
+ 'cdo27WiebewZkHHH7Zx9iTIVuuk2abyVSzvLVeGv7Nuy4lmSqa5clWYqWsGXxvZ2\n' +
+ '0fZC5Gd+BDUMW1eSpW7QDTk3top6x/coNoWuLSfXiC5ZrJkIKimSp9iguULgpK7G\n' +
+ 'abMMN4PR+O+vhcB8E879hcwmS2yd3IwcPTl3QXxufqeSV58/h2ibkqb/W4Bvggf6\n' +
+ '5JMHQPlPHOqMCVFIHP1IffIo+Of7clb30g9FD2j3F4qgV3OLwEDNg/zuO1DiAvH1\n' +
+ 'L+OnmGHkfbtYz+AVApkAZrxMWwoYrwpauyBusvSzwRE24vLTd2i80ZDH422QBLXG\n' +
+ 'rN7Zas8rwIiBKacJLYtBYETw8mfsNt8gb72aIQX6cZOsphqp6hUtKaiMTVgGazl7\n' +
+ 'tBXqbB+sIv3S9X6bM4cZJKkMJOXbnyCCLZFYv8TurwIDAQABo0IwQDAPBgNVHRMB\n' +
+ 'Af8EBTADAQH/MB0GA1UdDgQWBBTOVtaS1b/lz6yJDvNk65vEastbQTAOBgNVHQ8B\n' +
+ 'Af8EBAMCAYYwDQYJKoZIhvcNAQEMBQADggIBABEONg+TmMZM/PrYGNAfB4S41zp1\n' +
+ '3CVjslZswh/pC4kgXSf8cPJiUOzMwUevuFQj7tCqxQtJEygJM2IFg4ViInIah2kh\n' +
+ 'xlRakEGGw2dEVlxZAmmLWxlL1s1lN1565t5kgVwM0GVfwYM2xEvUaby6KDVJIkD3\n' +
+ 'aM6sFDBshvVA70qOggM6kU6mwTbivOROzfoIQDnVaT+LQjHqY/T+ok6IN0YXXCWl\n' +
+ 'Favai8RDjzLDFwXSRvgIK+1c49vlFFY4W9Efp7Z9tPSZU1TvWUcKdAtV8P2fPHAS\n' +
+ 'vAZ+g9JuNfeawhEibjXkwg6Z/yFUueQCQOs9TRXYogzp5CMMkfdNJF8byKYqHscs\n' +
+ 'UosIcETnHwqwban99u35sWcoDZPr6aBIrz7LGKTJrL8Nis8qHqnqQBXu/fsQEN8u\n' +
+ 'zJ2LBi8sievnzd0qI0kaWmg8GzZmYH1JCt1GXSqOFkI8FMy2bahP7TUQR1LBUKQ3\n' +
+ 'hrOSqldkhN+cSAOnvbQcFzLr+iEYEk34+NhcMIFVE+51KJ1n6+zISOinr6mI3ckX\n' +
+ '6p2tmiCD4Shk2Xx/VTY/KGvQWKFcQApWezBSvDNlGe0yV71LtLf3dr1pr4ofo7cE\n' +
+ 'rYucCJ40bfxEU/fmzYdBF32xP7AOD9U0FbOR3Mcthc6Z6w20WFC+zru8FGY08gPf\n' +
+ 'WT1QcNdw7ntUJP/w\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIICrzCCAjWgAwIBAgIQARky6+5PNFRkFVOp3Ob1CTAKBggqhkjOPQQDAzCBlzEL\n' +
+ 'MAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4x\n' +
+ 'EzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTAwLgYDVQQDDCdBbWF6\n' +
+ 'b24gUkRTIGV1LXNvdXRoLTIgUm9vdCBDQSBFQ0MzODQgRzExEDAOBgNVBAcMB1Nl\n' +
+ 'YXR0bGUwIBcNMjIwNTIzMTg0MTI4WhgPMjEyMjA1MjMxOTQxMjdaMIGXMQswCQYD\n' +
+ 'VQQGEwJVUzEiMCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywgSW5jLjETMBEG\n' +
+ 'A1UECwwKQW1hem9uIFJEUzELMAkGA1UECAwCV0ExMDAuBgNVBAMMJ0FtYXpvbiBS\n' +
+ 'RFMgZXUtc291dGgtMiBSb290IENBIEVDQzM4NCBHMTEQMA4GA1UEBwwHU2VhdHRs\n' +
+ 'ZTB2MBAGByqGSM49AgEGBSuBBAAiA2IABNVGL5oF7cfIBxKyWd2PVK/S5yQfaJY3\n' +
+ 'QFHWvEdt6951n9JhiiPrHzfVHsxZp1CBjILRMzjgRbYWmc8qRoLkgGE7htGdwudJ\n' +
+ 'Fa/WuKzO574Prv4iZXUnVGTboC7JdvKbh6NCMEAwDwYDVR0TAQH/BAUwAwEB/zAd\n' +
+ 'BgNVHQ4EFgQUgDeIIEKynwUbNXApdIPnmRWieZwwDgYDVR0PAQH/BAQDAgGGMAoG\n' +
+ 'CCqGSM49BAMDA2gAMGUCMEOOJfucrST+FxuqJkMZyCM3gWGZaB+/w6+XUAJC6hFM\n' +
+ 'uSTY0F44/bERkA4XhH+YGAIxAIpJQBakCA1/mXjsTnQ+0El9ty+LODp8ibkn031c\n' +
+ '8DKDS7pR9UK7ZYdR6zFg3ZCjQw==\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIICrjCCAjOgAwIBAgIQJvkWUcYLbnxtuwnyjMmntDAKBggqhkjOPQQDAzCBljEL\n' +
+ 'MAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4x\n' +
+ 'EzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMS8wLQYDVQQDDCZBbWF6\n' +
+ 'b24gUkRTIGV1LXdlc3QtMyBSb290IENBIEVDQzM4NCBHMTEQMA4GA1UEBwwHU2Vh\n' +
+ 'dHRsZTAgFw0yMTA1MjUyMjI2MTJaGA8yMTIxMDUyNTIzMjYxMlowgZYxCzAJBgNV\n' +
+ 'BAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMuMRMwEQYD\n' +
+ 'VQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTEvMC0GA1UEAwwmQW1hem9uIFJE\n' +
+ 'UyBldS13ZXN0LTMgUm9vdCBDQSBFQ0MzODQgRzExEDAOBgNVBAcMB1NlYXR0bGUw\n' +
+ 'djAQBgcqhkjOPQIBBgUrgQQAIgNiAARENn8uHCyjn1dFax4OeXxvbV861qsXFD9G\n' +
+ 'DshumTmFzWWHN/69WN/AOsxy9XN5S7Cgad4gQgeYYYgZ5taw+tFo/jQvCLY//uR5\n' +
+ 'uihcLuLJ78opvRPvD9kbWZ6oXfBtFkWjQjBAMA8GA1UdEwEB/wQFMAMBAf8wHQYD\n' +
+ 'VR0OBBYEFKiK3LpoF+gDnqPldGSwChBPCYciMA4GA1UdDwEB/wQEAwIBhjAKBggq\n' +
+ 'hkjOPQQDAwNpADBmAjEA+7qfvRlnvF1Aosyp9HzxxCbN7VKu+QXXPhLEBWa5oeWW\n' +
+ 'UOcifunf/IVLC4/FGCsLAjEAte1AYp+iJyOHDB8UYkhBE/1sxnFaTiEPbvQBU0wZ\n' +
+ 'SuwWVLhu2wWDuSW+K7tTuL8p\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIID/zCCAuegAwIBAgIRAKeDpqX5WFCGNo94M4v69sUwDQYJKoZIhvcNAQELBQAw\n' +
+ 'gZcxCzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJ\n' +
+ 'bmMuMRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTEwMC4GA1UEAwwn\n' +
+ 'QW1hem9uIFJEUyBldS13ZXN0LTMgUm9vdCBDQSBSU0EyMDQ4IEcxMRAwDgYDVQQH\n' +
+ 'DAdTZWF0dGxlMCAXDTIxMDUyNTIyMTgzM1oYDzIwNjEwNTI1MjMxODMzWjCBlzEL\n' +
+ 'MAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4x\n' +
+ 'EzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTAwLgYDVQQDDCdBbWF6\n' +
+ 'b24gUkRTIGV1LXdlc3QtMyBSb290IENBIFJTQTIwNDggRzExEDAOBgNVBAcMB1Nl\n' +
+ 'YXR0bGUwggEiMA0GCSqGSIb3DQEBAQUAA4IBDwAwggEKAoIBAQCcKOTEMTfzvs4H\n' +
+ 'WtJR8gI7GXN6xesulWtZPv21oT+fLGwJ+9Bv8ADCGDDrDxfeH/HxJmzG9hgVAzVn\n' +
+ '4g97Bn7q07tGZM5pVi96/aNp11velZT7spOJKfJDZTlGns6DPdHmx48whpdO+dOb\n' +
+ '6+eR0VwCIv+Vl1fWXgoACXYCoKjhxJs+R+fwY//0JJ1YG8yjZ+ghLCJmvlkOJmE1\n' +
+ 'TCPUyIENaEONd6T+FHGLVYRRxC2cPO65Jc4yQjsXvvQypoGgx7FwD5voNJnFMdyY\n' +
+ '754JGPOOe/SZdepN7Tz7UEq8kn7NQSbhmCsgA/Hkjkchz96qN/YJ+H/okiQUTNB0\n' +
+ 'eG9ogiVFAgMBAAGjQjBAMA8GA1UdEwEB/wQFMAMBAf8wHQYDVR0OBBYEFFjayw9Y\n' +
+ 'MjbxfF14XAhMM2VPl0PfMA4GA1UdDwEB/wQEAwIBhjANBgkqhkiG9w0BAQsFAAOC\n' +
+ 'AQEAAtmx6d9+9CWlMoU0JCirtp4dSS41bBfb9Oor6GQ8WIr2LdfZLL6uES/ubJPE\n' +
+ '1Sh5Vu/Zon5/MbqLMVrfniv3UpQIof37jKXsjZJFE1JVD/qQfRzG8AlBkYgHNEiS\n' +
+ 'VtD4lFxERmaCkY1tjKB4Dbd5hfhdrDy29618ZjbSP7NwAfnwb96jobCmMKgxVGiH\n' +
+ 'UqsLSiEBZ33b2hI7PJ6iTJnYBWGuiDnsWzKRmheA4nxwbmcQSfjbrNwa93w3caL2\n' +
+ 'v/4u54Kcasvcu3yFsUwJygt8z43jsGAemNZsS7GWESxVVlW93MJRn6M+MMakkl9L\n' +
+ 'tWaXdHZ+KUV7LhfYLb0ajvb40w==\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIEBDCCAuygAwIBAgIQJ5oxPEjefCsaESSwrxk68DANBgkqhkiG9w0BAQsFADCB\n' +
+ 'mjELMAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIElu\n' +
+ 'Yy4xEzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTMwMQYDVQQDDCpB\n' +
+ 'bWF6b24gUkRTIGV1LWNlbnRyYWwtMiBSb290IENBIFJTQTIwNDggRzExEDAOBgNV\n' +
+ 'BAcMB1NlYXR0bGUwIBcNMjIwNjA2MjExNzA1WhgPMjA2MjA2MDYyMjE3MDVaMIGa\n' +
+ 'MQswCQYDVQQGEwJVUzEiMCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywgSW5j\n' +
+ 'LjETMBEGA1UECwwKQW1hem9uIFJEUzELMAkGA1UECAwCV0ExMzAxBgNVBAMMKkFt\n' +
+ 'YXpvbiBSRFMgZXUtY2VudHJhbC0yIFJvb3QgQ0EgUlNBMjA0OCBHMTEQMA4GA1UE\n' +
+ 'BwwHU2VhdHRsZTCCASIwDQYJKoZIhvcNAQEBBQADggEPADCCAQoCggEBALTQt5eX\n' +
+ 'g+VP3BjO9VBkWJhE0GfLrU/QIk32I6WvrnejayTrlup9H1z4QWlXF7GNJrqScRMY\n' +
+ 'KhJHlcP05aPsx1lYco6pdFOf42ybXyWHHJdShj4A5glU81GTT+VrXGzHSarLmtua\n' +
+ 'eozkQgPpDsSlPt0RefyTyel7r3Cq+5K/4vyjCTcIqbfgaGwTU36ffjM1LaPCuE4O\n' +
+ 'nINMeD6YuImt2hU/mFl20FZ+IZQUIFZZU7pxGLqTRz/PWcH8tDDxnkYg7tNuXOeN\n' +
+ 'JbTpXrw7St50/E9ZQ0llGS+MxJD8jGRAa/oL4G/cwnV8P2OEPVVkgN9xDDQeieo0\n' +
+ '3xkzolkDkmeKOnUCAwEAAaNCMEAwDwYDVR0TAQH/BAUwAwEB/zAdBgNVHQ4EFgQU\n' +
+ 'bwu8635iQGQMRanekesORM8Hkm4wDgYDVR0PAQH/BAQDAgGGMA0GCSqGSIb3DQEB\n' +
+ 'CwUAA4IBAQAgN6LE9mUgjsj6xGCX1afYE69fnmCjjb0rC6eEe1mb/QZNcyw4XBIW\n' +
+ '6+zTXo4mjZ4ffoxb//R0/+vdTE7IvaLgfAZgFsLKJCtYDDstXZj8ujQnGR9Pig3R\n' +
+ 'W+LpNacvOOSJSawNQq0Xrlcu55AU4buyD5VjcICnfF1dqBMnGTnh27m/scd/ZMx/\n' +
+ 'kapHZ/fMoK2mAgSX/NvUKF3UkhT85vSSM2BTtET33DzCPDQTZQYxFBa4rFRmFi4c\n' +
+ 'BLlmIReiCGyh3eJhuUUuYAbK6wLaRyPsyEcIOLMQmZe1+gAFm1+1/q5Ke9ugBmjf\n' +
+ 'PbTWjsi/lfZ5CdVAhc5lmZj/l5aKqwaS\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIICrjCCAjSgAwIBAgIRAKKPTYKln9L4NTx9dpZGUjowCgYIKoZIzj0EAwMwgZYx\n' +
+ 'CzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMu\n' +
+ 'MRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTEvMC0GA1UEAwwmQW1h\n' +
+ 'em9uIFJEUyBldS13ZXN0LTIgUm9vdCBDQSBFQ0MzODQgRzExEDAOBgNVBAcMB1Nl\n' +
+ 'YXR0bGUwIBcNMjEwNTIxMjI1NTIxWhgPMjEyMTA1MjEyMzU1MjFaMIGWMQswCQYD\n' +
+ 'VQQGEwJVUzEiMCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywgSW5jLjETMBEG\n' +
+ 'A1UECwwKQW1hem9uIFJEUzELMAkGA1UECAwCV0ExLzAtBgNVBAMMJkFtYXpvbiBS\n' +
+ 'RFMgZXUtd2VzdC0yIFJvb3QgQ0EgRUNDMzg0IEcxMRAwDgYDVQQHDAdTZWF0dGxl\n' +
+ 'MHYwEAYHKoZIzj0CAQYFK4EEACIDYgAE/owTReDvaRqdmbtTzXbyRmEpKCETNj6O\n' +
+ 'hZMKH0F8oU9Tmn8RU7kQQj6xUKEyjLPrFBN7c+26TvrVO1KmJAvbc8bVliiJZMbc\n' +
+ 'C0yV5PtJTalvlMZA1NnciZuhxaxrzlK1o0IwQDAPBgNVHRMBAf8EBTADAQH/MB0G\n' +
+ 'A1UdDgQWBBT4i5HaoHtrs7Mi8auLhMbKM1XevDAOBgNVHQ8BAf8EBAMCAYYwCgYI\n' +
+ 'KoZIzj0EAwMDaAAwZQIxAK9A+8/lFdX4XJKgfP+ZLy5ySXC2E0Spoy12Gv2GdUEZ\n' +
+ 'p1G7c1KbWVlyb1d6subzkQIwKyH0Naf/3usWfftkmq8SzagicKz5cGcEUaULq4tO\n' +
+ 'GzA/AMpr63IDBAqkZbMDTCmH\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIICrzCCAjWgAwIBAgIQTgIvwTDuNWQo0Oe1sOPQEzAKBggqhkjOPQQDAzCBlzEL\n' +
+ 'MAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4x\n' +
+ 'EzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTAwLgYDVQQDDCdBbWF6\n' +
+ 'b24gUkRTIGV1LW5vcnRoLTEgUm9vdCBDQSBFQ0MzODQgRzExEDAOBgNVBAcMB1Nl\n' +
+ 'YXR0bGUwIBcNMjEwNTI0MjEwNjM4WhgPMjEyMTA1MjQyMjA2MzhaMIGXMQswCQYD\n' +
+ 'VQQGEwJVUzEiMCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywgSW5jLjETMBEG\n' +
+ 'A1UECwwKQW1hem9uIFJEUzELMAkGA1UECAwCV0ExMDAuBgNVBAMMJ0FtYXpvbiBS\n' +
+ 'RFMgZXUtbm9ydGgtMSBSb290IENBIEVDQzM4NCBHMTEQMA4GA1UEBwwHU2VhdHRs\n' +
+ 'ZTB2MBAGByqGSM49AgEGBSuBBAAiA2IABJuzXLU8q6WwSKXBvx8BbdIi3mPhb7Xo\n' +
+ 'rNJBfuMW1XRj5BcKH1ZoGaDGw+BIIwyBJg8qNmCK8kqIb4cH8/Hbo3Y+xBJyoXq/\n' +
+ 'cuk8aPrxiNoRsKWwiDHCsVxaK9L7GhHHAqNCMEAwDwYDVR0TAQH/BAUwAwEB/zAd\n' +
+ 'BgNVHQ4EFgQUYgcsdU4fm5xtuqLNppkfTHM2QMYwDgYDVR0PAQH/BAQDAgGGMAoG\n' +
+ 'CCqGSM49BAMDA2gAMGUCMQDz/Rm89+QJOWJecYAmYcBWCcETASyoK1kbr4vw7Hsg\n' +
+ '7Ew3LpLeq4IRmTyuiTMl0gMCMAa0QSjfAnxBKGhAnYxcNJSntUyyMpaXzur43ec0\n' +
+ '3D8npJghwC4DuICtKEkQiI5cSg==\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIGATCCA+mgAwIBAgIRAORIGqQXLTcbbYT2upIsSnQwDQYJKoZIhvcNAQEMBQAw\n' +
+ 'gZgxCzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJ\n' +
+ 'bmMuMRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTExMC8GA1UEAwwo\n' +
+ 'QW1hem9uIFJEUyBldS1zb3V0aC0yIFJvb3QgQ0EgUlNBNDA5NiBHMTEQMA4GA1UE\n' +
+ 'BwwHU2VhdHRsZTAgFw0yMjA1MjMxODM0MjJaGA8yMTIyMDUyMzE5MzQyMlowgZgx\n' +
+ 'CzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMu\n' +
+ 'MRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTExMC8GA1UEAwwoQW1h\n' +
+ 'em9uIFJEUyBldS1zb3V0aC0yIFJvb3QgQ0EgUlNBNDA5NiBHMTEQMA4GA1UEBwwH\n' +
+ 'U2VhdHRsZTCCAiIwDQYJKoZIhvcNAQEBBQADggIPADCCAgoCggIBAPKukwsW2s/h\n' +
+ '1k+Hf65pOP0knVBnOnMQyT1mopp2XHGdXznj9xS49S30jYoUnWccyXgD983A1bzu\n' +
+ 'w4fuJRHg4MFdz/NWTgXvy+zy0Roe83OPIJjUmXnnzwUHQcBa9vl6XUO65iQ3pbSi\n' +
+ 'fQfNDFXD8cvuXbkezeADoy+iFAlzhXTzV9MD44GTuo9Z3qAXNGHQCrgRSCL7uRYt\n' +
+ 't1nfwboCbsVRnElopn2cTigyVXE62HzBUmAw1GTbAZeFAqCn5giBWYAfHwTUldRL\n' +
+ '6eEa6atfsS2oPNus4ZENa1iQxXq7ft+pMdNt0qKXTCZiiCZjmLkY0V9kWwHTRRF8\n' +
+ 'r+75oSL//3di43QnuSCgjwMRIeWNtMud5jf3eQzSBci+9njb6DrrSUbx7blP0srg\n' +
+ '94/C/fYOp/0/EHH34w99Th14VVuGWgDgKahT9/COychLOubXUT6vD1As47S9KxTv\n' +
+ 'yYleVKwJnF9cVjepODN72fNlEf74BwzgSIhUmhksmZSeJBabrjSUj3pdyo/iRZN/\n' +
+ 'CiYz9YPQ29eXHPQjBZVIUqWbOVfdwsx0/Xu5T1e7yyXByQ3/oDulahtcoKPAFQ3J\n' +
+ 'ee6NJK655MdS7pM9hJnU2Rzu3qZ/GkM6YK7xTlMXVouPUZov/VbiaCKbqYDs8Dg+\n' +
+ 'UKdeNXAT6+BMleGQzly1X7vjhgeA8ugVAgMBAAGjQjBAMA8GA1UdEwEB/wQFMAMB\n' +
+ 'Af8wHQYDVR0OBBYEFJdaPwpCf78UolFTEn6GO85/QwUIMA4GA1UdDwEB/wQEAwIB\n' +
+ 'hjANBgkqhkiG9w0BAQwFAAOCAgEAWkxHIT3mers5YnZRSVjmpxCLivGj1jMB9VYC\n' +
+ 'iKqTAeIvD0940L0YaZgivQll5pue8UUcQ6M2uCdVVAsNJdmQ5XHIYiGOknYPtxzO\n' +
+ 'aO+bnZp7VIZw/vJ49hvH6RreA2bbxYMZO/ossYdcWsWbOKHFrRmAw0AhtK/my51g\n' +
+ 'obV7eQg+WmlE5Iqc75ycUsoZdc3NimkjBi7LQoNP1HMvlLHlF71UZhQDdq+/WdV7\n' +
+ '0zmg+epkki1LjgMmuPyb+xWuYkFKT1/faX+Xs62hIm5BY+aI4if4RuQ+J//0pOSs\n' +
+ 'UajrjTo+jLGB8A96jAe8HaFQenbwMjlaHRDAF0wvbkYrMr5a6EbneAB37V05QD0Y\n' +
+ 'Rh4L4RrSs9DX2hbSmS6iLDuPEjanHKzglF5ePEvnItbRvGGkynqDVlwF+Bqfnw8l\n' +
+ '0i8Hr1f1/LP1c075UjkvsHlUnGgPbLqA0rDdcxF8Fdlv1BunUjX0pVlz10Ha5M6P\n' +
+ 'AdyWUOneOfaA5G7jjv7i9qg3r99JNs1/Lmyg/tV++gnWTAsSPFSSEte81kmPhlK3\n' +
+ '2UtAO47nOdTtk+q4VIRAwY1MaOR7wTFZPfer1mWs4RhKNu/odp8urEY87iIzbMWT\n' +
+ 'QYO/4I6BGj9rEWNGncvR5XTowwIthMCj2KWKM3Z/JxvjVFylSf+s+FFfO1bNIm6h\n' +
+ 'u3UBpZI=\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIICtDCCAjmgAwIBAgIQenQbcP/Zbj9JxvZ+jXbRnTAKBggqhkjOPQQDAzCBmTEL\n' +
+ 'MAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4x\n' +
+ 'EzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTIwMAYDVQQDDClBbWF6\n' +
+ 'b24gUkRTIGV1LWNlbnRyYWwtMSBSb290IENBIEVDQzM4NCBHMTEQMA4GA1UEBwwH\n' +
+ 'U2VhdHRsZTAgFw0yMTA1MjEyMjMzMjRaGA8yMTIxMDUyMTIzMzMyNFowgZkxCzAJ\n' +
+ 'BgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMuMRMw\n' +
+ 'EQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTEyMDAGA1UEAwwpQW1hem9u\n' +
+ 'IFJEUyBldS1jZW50cmFsLTEgUm9vdCBDQSBFQ0MzODQgRzExEDAOBgNVBAcMB1Nl\n' +
+ 'YXR0bGUwdjAQBgcqhkjOPQIBBgUrgQQAIgNiAATlBHiEM9LoEb1Hdnd5j2VpCDOU\n' +
+ '5nGuFoBD8ROUCkFLFh5mHrHfPXwBc63heW9WrP3qnDEm+UZEUvW7ROvtWCTPZdLz\n' +
+ 'Z4XaqgAlSqeE2VfUyZOZzBSgUUJk7OlznXfkCMOjQjBAMA8GA1UdEwEB/wQFMAMB\n' +
+ 'Af8wHQYDVR0OBBYEFDT/ThjQZl42Nv/4Z/7JYaPNMly2MA4GA1UdDwEB/wQEAwIB\n' +
+ 'hjAKBggqhkjOPQQDAwNpADBmAjEAnZWmSgpEbmq+oiCa13l5aGmxSlfp9h12Orvw\n' +
+ 'Dq/W5cENJz891QD0ufOsic5oGq1JAjEAp5kSJj0MxJBTHQze1Aa9gG4sjHBxXn98\n' +
+ '4MP1VGsQuhfndNHQb4V0Au7OWnOeiobq\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIID/zCCAuegAwIBAgIRAMgnyikWz46xY6yRgiYwZ3swDQYJKoZIhvcNAQELBQAw\n' +
+ 'gZcxCzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJ\n' +
+ 'bmMuMRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTEwMC4GA1UEAwwn\n' +
+ 'QW1hem9uIFJEUyBldS13ZXN0LTEgUm9vdCBDQSBSU0EyMDQ4IEcxMRAwDgYDVQQH\n' +
+ 'DAdTZWF0dGxlMCAXDTIxMDUyMDE2NDkxMloYDzIwNjEwNTIwMTc0OTEyWjCBlzEL\n' +
+ 'MAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4x\n' +
+ 'EzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTAwLgYDVQQDDCdBbWF6\n' +
+ 'b24gUkRTIGV1LXdlc3QtMSBSb290IENBIFJTQTIwNDggRzExEDAOBgNVBAcMB1Nl\n' +
+ 'YXR0bGUwggEiMA0GCSqGSIb3DQEBAQUAA4IBDwAwggEKAoIBAQCi8JYOc9cYSgZH\n' +
+ 'gYPxLk6Xcc7HqzamvsnjYU98Dcb98y6iDqS46Ra2Ne02MITtU5MDL+qjxb8WGDZV\n' +
+ 'RUA9ZS69tkTO3gldW8QdiSh3J6hVNJQW81F0M7ZWgV0gB3n76WCmfT4IWos0AXHM\n' +
+ '5v7M/M4tqVmCPViQnZb2kdVlM3/Xc9GInfSMCgNfwHPTXl+PXX+xCdNBePaP/A5C\n' +
+ '5S0oK3HiXaKGQAy3K7VnaQaYdiv32XUatlM4K2WS4AMKt+2cw3hTCjlmqKRHvYFQ\n' +
+ 'veWCXAuc+U5PQDJ9SuxB1buFJZhT4VP3JagOuZbh5NWpIbOTxlAJOb5pGEDuJTKi\n' +
+ '1gQQQVEFAgMBAAGjQjBAMA8GA1UdEwEB/wQFMAMBAf8wHQYDVR0OBBYEFNXm+N87\n' +
+ 'OFxK9Af/bjSxDCiulGUzMA4GA1UdDwEB/wQEAwIBhjANBgkqhkiG9w0BAQsFAAOC\n' +
+ 'AQEAkqIbkgZ45spvrgRQ6n9VKzDLvNg+WciLtmVrqyohwwJbj4pYvWwnKQCkVc7c\n' +
+ 'hUOSBmlSBa5REAPbH5o8bdt00FPRrD6BdXLXhaECKgjsHe1WW08nsequRKD8xVmc\n' +
+ '8bEX6sw/utBeBV3mB+3Zv7ejYAbDFM4vnRsWtO+XqgReOgrl+cwdA6SNQT9oW3e5\n' +
+ 'rSQ+VaXgJtl9NhkiIysq9BeYigxqS/A13pHQp0COMwS8nz+kBPHhJTsajHCDc8F4\n' +
+ 'HfLi6cgs9G0gaRhT8FCH66OdGSqn196sE7Y3bPFFFs/3U+vxvmQgoZC6jegQXAg5\n' +
+ 'Prxd+VNXtNI/azitTysQPumH7A==\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIEBTCCAu2gAwIBAgIRAO8bekN7rUReuNPG8pSTKtEwDQYJKoZIhvcNAQELBQAw\n' +
+ 'gZoxCzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJ\n' +
+ 'bmMuMRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTEzMDEGA1UEAwwq\n' +
+ 'QW1hem9uIFJEUyBldS1jZW50cmFsLTEgUm9vdCBDQSBSU0EyMDQ4IEcxMRAwDgYD\n' +
+ 'VQQHDAdTZWF0dGxlMCAXDTIxMDUyMTIyMjM0N1oYDzIwNjEwNTIxMjMyMzQ3WjCB\n' +
+ 'mjELMAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIElu\n' +
+ 'Yy4xEzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTMwMQYDVQQDDCpB\n' +
+ 'bWF6b24gUkRTIGV1LWNlbnRyYWwtMSBSb290IENBIFJTQTIwNDggRzExEDAOBgNV\n' +
+ 'BAcMB1NlYXR0bGUwggEiMA0GCSqGSIb3DQEBAQUAA4IBDwAwggEKAoIBAQCTTYds\n' +
+ 'Tray+Q9VA5j5jTh5TunHKFQzn68ZbOzdqaoi/Rq4ohfC0xdLrxCpfqn2TGDHN6Zi\n' +
+ '2qGK1tWJZEd1H0trhzd9d1CtGK+3cjabUmz/TjSW/qBar7e9MA67/iJ74Gc+Ww43\n' +
+ 'A0xPNIWcL4aLrHaLm7sHgAO2UCKsrBUpxErOAACERScVYwPAfu79xeFcX7DmcX+e\n' +
+ 'lIqY16pQAvK2RIzrekSYfLFxwFq2hnlgKHaVgZ3keKP+nmXcXmRSHQYUUr72oYNZ\n' +
+ 'HcNYl2+gxCc9ccPEHM7xncVEKmb5cWEWvVoaysgQ+osi5f5aQdzgC2X2g2daKbyA\n' +
+ 'XL/z5FM9GHpS5BJjAgMBAAGjQjBAMA8GA1UdEwEB/wQFMAMBAf8wHQYDVR0OBBYE\n' +
+ 'FBDAiJ7Py9/A9etNa/ebOnx5l5MGMA4GA1UdDwEB/wQEAwIBhjANBgkqhkiG9w0B\n' +
+ 'AQsFAAOCAQEALMh/+81fFPdJV/RrJUeoUvFCGMp8iaANu97NpeJyKitNOv7RoeVP\n' +
+ 'WjivS0KcCqZaDBs+p6IZ0sLI5ZH098LDzzytcfZg0PsGqUAb8a0MiU/LfgDCI9Ee\n' +
+ 'jsOiwaFB8k0tfUJK32NPcIoQYApTMT2e26lPzYORSkfuntme2PTHUnuC7ikiQrZk\n' +
+ 'P+SZjWgRuMcp09JfRXyAYWIuix4Gy0eZ4rpRuaTK6mjAb1/LYoNK/iZ/gTeIqrNt\n' +
+ 'l70OWRsWW8jEmSyNTIubGK/gGGyfuZGSyqoRX6OKHESkP6SSulbIZHyJ5VZkgtXo\n' +
+ '2XvyRyJ7w5pFyoofrL3Wv0UF8yt/GDszmg==\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIF/zCCA+egAwIBAgIRAMDk/F+rrhdn42SfE+ghPC8wDQYJKoZIhvcNAQEMBQAw\n' +
+ 'gZcxCzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJ\n' +
+ 'bmMuMRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTEwMC4GA1UEAwwn\n' +
+ 'QW1hem9uIFJEUyBldS13ZXN0LTIgUm9vdCBDQSBSU0E0MDk2IEcxMRAwDgYDVQQH\n' +
+ 'DAdTZWF0dGxlMCAXDTIxMDUyMTIyNTEyMloYDzIxMjEwNTIxMjM1MTIyWjCBlzEL\n' +
+ 'MAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4x\n' +
+ 'EzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTAwLgYDVQQDDCdBbWF6\n' +
+ 'b24gUkRTIGV1LXdlc3QtMiBSb290IENBIFJTQTQwOTYgRzExEDAOBgNVBAcMB1Nl\n' +
+ 'YXR0bGUwggIiMA0GCSqGSIb3DQEBAQUAA4ICDwAwggIKAoICAQC2twMALVg9vRVu\n' +
+ 'VNqsr6N8thmp3Dy8jEGTsm3GCQ+C5P2YcGlD/T/5icfWW84uF7Sx3ezcGlvsqFMf\n' +
+ 'Ukj9sQyqtz7qfFFugyy7pa/eH9f48kWFHLbQYm9GEgbYBIrWMp1cy3vyxuMCwQN4\n' +
+ 'DCncqU+yNpy0CprQJEha3PzY+3yJOjDQtc3zr99lyECCFJTDUucxHzyQvX89eL74\n' +
+ 'uh8la0lKH3v9wPpnEoftbrwmm5jHNFdzj7uXUHUJ41N7af7z7QUfghIRhlBDiKtx\n' +
+ '5lYZemPCXajTc3ryDKUZC/b+B6ViXZmAeMdmQoPE0jwyEp/uaUcdp+FlUQwCfsBk\n' +
+ 'ayPFEApTWgPiku2isjdeTVmEgL8bJTDUZ6FYFR7ZHcYAsDzcwHgIu3GGEMVRS3Uf\n' +
+ 'ILmioiyly9vcK4Sa01ondARmsi/I0s7pWpKflaekyv5boJKD/xqwz9lGejmJHelf\n' +
+ '8Od2TyqJScMpB7Q8c2ROxBwqwB72jMCEvYigB+Wnbb8RipliqNflIGx938FRCzKL\n' +
+ 'UQUBmNAznR/yRRL0wHf9UAE/8v9a09uZABeiznzOFAl/frHpgdAbC00LkFlnwwgX\n' +
+ 'g8YfEFlkp4fLx5B7LtoO6uVNFVimLxtwirpyKoj3G4M/kvSTux8bTw0heBCmWmKR\n' +
+ '57MS6k7ODzbv+Kpeht2hqVZCNFMxoQIDAQABo0IwQDAPBgNVHRMBAf8EBTADAQH/\n' +
+ 'MB0GA1UdDgQWBBRuMnDhJjoj7DcKALj+HbxEqj3r6jAOBgNVHQ8BAf8EBAMCAYYw\n' +
+ 'DQYJKoZIhvcNAQEMBQADggIBALSnXfx72C3ldhBP5kY4Mo2DDaGQ8FGpTOOiD95d\n' +
+ '0rf7I9LrsBGVqu/Nir+kqqP80PB70+Jy9fHFFigXwcPBX3MpKGxK8Cel7kVf8t1B\n' +
+ '4YD6A6bqlzP+OUL0uGWfZpdpDxwMDI2Flt4NEldHgXWPjvN1VblEKs0+kPnKowyg\n' +
+ 'jhRMgBbD/y+8yg0fIcjXUDTAw/+INcp21gWaMukKQr/8HswqC1yoqW9in2ijQkpK\n' +
+ '2RB9vcQ0/gXR0oJUbZQx0jn0OH8Agt7yfMAnJAdnHO4M3gjvlJLzIC5/4aGrRXZl\n' +
+ 'JoZKfJ2fZRnrFMi0nhAYDeInoS+Rwx+QzaBk6fX5VPyCj8foZ0nmqvuYoydzD8W5\n' +
+ 'mMlycgxFqS+DUmO+liWllQC4/MnVBlHGB1Cu3wTj5kgOvNs/k+FW3GXGzD3+rpv0\n' +
+ 'QTLuwSbMr+MbEThxrSZRSXTCQzKfehyC+WZejgLb+8ylLJUA10e62o7H9PvCrwj+\n' +
+ 'ZDVmN7qj6amzvndCP98sZfX7CFZPLfcBd4wVIjHsFjSNEwWHOiFyLPPG7cdolGKA\n' +
+ 'lOFvonvo4A1uRc13/zFeP0Xi5n5OZ2go8aOOeGYdI2vB2sgH9R2IASH/jHmr0gvY\n' +
+ '0dfBCcfXNgrS0toq0LX/y+5KkKOxh52vEYsJLdhqrveuZhQnsFEm/mFwjRXkyO7c\n' +
+ '2jpC\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIGADCCA+igAwIBAgIQYe0HgSuFFP9ivYM2vONTrTANBgkqhkiG9w0BAQwFADCB\n' +
+ 'mDELMAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIElu\n' +
+ 'Yy4xEzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTEwLwYDVQQDDChB\n' +
+ 'bWF6b24gUkRTIGV1LXNvdXRoLTEgUm9vdCBDQSBSU0E0MDk2IEcxMRAwDgYDVQQH\n' +
+ 'DAdTZWF0dGxlMCAXDTIxMDUxOTE4MzMyMVoYDzIxMjEwNTE5MTkzMzIxWjCBmDEL\n' +
+ 'MAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4x\n' +
+ 'EzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTEwLwYDVQQDDChBbWF6\n' +
+ 'b24gUkRTIGV1LXNvdXRoLTEgUm9vdCBDQSBSU0E0MDk2IEcxMRAwDgYDVQQHDAdT\n' +
+ 'ZWF0dGxlMIICIjANBgkqhkiG9w0BAQEFAAOCAg8AMIICCgKCAgEAuO7QPKfPMTo2\n' +
+ 'POQWvzDLwi5f++X98hGjORI1zkN9kotCYH5pAzSBwBPoMNaIfedgmsIxGHj2fq5G\n' +
+ '4oXagNhNuGP79Zl6uKW5H7S74W7aWM8C0s8zuxMOI4GZy5h2IfQk3m/3AzZEX5w8\n' +
+ 'UtNPkzo2feDVOkerHT+j+vjXgAxZ4wHnuMDcRT+K4r9EXlAH6X9b/RO0JlfEwmNz\n' +
+ 'xlqqGxocq9qRC66N6W0HF2fNEAKP84n8H80xcZBOBthQORRi8HSmKcPdmrvwCuPz\n' +
+ 'M+L+j18q6RAVaA0ABbD0jMWcTf0UvjUfBStn5mvu/wGlLjmmRkZsppUTRukfwqXK\n' +
+ 'yltUsTq0tOIgCIpne5zA4v+MebbR5JBnsvd4gdh5BI01QH470yB7BkUefZ9bobOm\n' +
+ 'OseAAVXcYFJKe4DAA6uLDrqOfFSxV+CzVvEp3IhLRaik4G5MwI/h2c/jEYDqkg2J\n' +
+ 'HMflxc2gcSMdk7E5ByLz5f6QrFfSDFk02ZJTs4ssbbUEYohht9znPMQEaWVqATWE\n' +
+ '3n0VspqZyoBNkH/agE5GiGZ/k/QyeqzMNj+c9kr43Upu8DpLrz8v2uAp5xNj3YVg\n' +
+ 'ihaeD6GW8+PQoEjZ3mrCmH7uGLmHxh7Am59LfEyNrDn+8Rq95WvkmbyHSVxZnBmo\n' +
+ 'h/6O3Jk+0/QhIXZ2hryMflPcYWeRGH0CAwEAAaNCMEAwDwYDVR0TAQH/BAUwAwEB\n' +
+ '/zAdBgNVHQ4EFgQU2eFK7+R3x/me8roIBNxBrplkM6EwDgYDVR0PAQH/BAQDAgGG\n' +
+ 'MA0GCSqGSIb3DQEBDAUAA4ICAQB5gWFe5s7ObQFj1fTO9L6gYgtFhnwdmxU0q8Ke\n' +
+ 'HWCrdFmyXdC39qdAFOwM5/7fa9zKmiMrZvy9HNvCXEp4Z7z9mHhBmuqPZQx0qPgU\n' +
+ 'uLdP8wGRuWryzp3g2oqkX9t31Z0JnkbIdp7kfRT6ME4I4VQsaY5Y3mh+hIHOUvcy\n' +
+ 'p+98i3UuEIcwJnVAV9wTTzrWusZl9iaQ1nSYbmkX9bBssJ2GmtW+T+VS/1hJ/Q4f\n' +
+ 'AlE3dOQkLFoPPb3YRWBHr2n1LPIqMVwDNAuWavRA2dSfaLl+kzbn/dua7HTQU5D4\n' +
+ 'b2Fu2vLhGirwRJe+V7zdef+tI7sngXqjgObyOeG5O2BY3s+um6D4fS0Th3QchMO7\n' +
+ '0+GwcIgSgcjIjlrt6/xJwJLE8cRkUUieYKq1C4McpZWTF30WnzOPUzRzLHkcNzNA\n' +
+ '0A7sKMK6QoYWo5Rmo8zewUxUqzc9oQSrYADP7PEwGncLtFe+dlRFx+PA1a+lcIgo\n' +
+ '1ZGfXigYtQ3VKkcknyYlJ+hN4eCMBHtD81xDy9iP2MLE41JhLnoB2rVEtewO5diF\n' +
+ '7o95Mwl84VMkLhhHPeGKSKzEbBtYYBifHNct+Bst8dru8UumTltgfX6urH3DN+/8\n' +
+ 'JF+5h3U8oR2LL5y76cyeb+GWDXXy9zoQe2QvTyTy88LwZq1JzujYi2k8QiLLhFIf\n' +
+ 'FEv9Bg==\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIICsDCCAjagAwIBAgIRAMgApnfGYPpK/fD0dbN2U4YwCgYIKoZIzj0EAwMwgZcx\n' +
+ 'CzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMu\n' +
+ 'MRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTEwMC4GA1UEAwwnQW1h\n' +
+ 'em9uIFJEUyBldS1zb3V0aC0xIFJvb3QgQ0EgRUNDMzg0IEcxMRAwDgYDVQQHDAdT\n' +
+ 'ZWF0dGxlMCAXDTIxMDUxOTE4MzgxMVoYDzIxMjEwNTE5MTkzODExWjCBlzELMAkG\n' +
+ 'A1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4xEzAR\n' +
+ 'BgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTAwLgYDVQQDDCdBbWF6b24g\n' +
+ 'UkRTIGV1LXNvdXRoLTEgUm9vdCBDQSBFQ0MzODQgRzExEDAOBgNVBAcMB1NlYXR0\n' +
+ 'bGUwdjAQBgcqhkjOPQIBBgUrgQQAIgNiAAQfEWl6d4qSuIoECdZPp+39LaKsfsX7\n' +
+ 'THs3/RrtT0+h/jl3bjZ7Qc68k16x+HGcHbaayHfqD0LPdzH/kKtNSfQKqemdxDQh\n' +
+ 'Z4pwkixJu8T1VpXZ5zzCvBXCl75UqgEFS92jQjBAMA8GA1UdEwEB/wQFMAMBAf8w\n' +
+ 'HQYDVR0OBBYEFFPrSNtWS5JU+Tvi6ABV231XbjbEMA4GA1UdDwEB/wQEAwIBhjAK\n' +
+ 'BggqhkjOPQQDAwNoADBlAjEA+a7hF1IrNkBd2N/l7IQYAQw8chnRZDzh4wiGsZsC\n' +
+ '6A83maaKFWUKIb3qZYXFSi02AjAbp3wxH3myAmF8WekDHhKcC2zDvyOiKLkg9Y6v\n' +
+ 'ZVmyMR043dscQbcsVoacOYv198c=\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIICtDCCAjqgAwIBAgIRAPhVkIsQ51JFhD2kjFK5uAkwCgYIKoZIzj0EAwMwgZkx\n' +
+ 'CzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMu\n' +
+ 'MRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTEyMDAGA1UEAwwpQW1h\n' +
+ 'em9uIFJEUyBldS1jZW50cmFsLTIgUm9vdCBDQSBFQ0MzODQgRzExEDAOBgNVBAcM\n' +
+ 'B1NlYXR0bGUwIBcNMjIwNjA2MjEyOTE3WhgPMjEyMjA2MDYyMjI5MTdaMIGZMQsw\n' +
+ 'CQYDVQQGEwJVUzEiMCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywgSW5jLjET\n' +
+ 'MBEGA1UECwwKQW1hem9uIFJEUzELMAkGA1UECAwCV0ExMjAwBgNVBAMMKUFtYXpv\n' +
+ 'biBSRFMgZXUtY2VudHJhbC0yIFJvb3QgQ0EgRUNDMzg0IEcxMRAwDgYDVQQHDAdT\n' +
+ 'ZWF0dGxlMHYwEAYHKoZIzj0CAQYFK4EEACIDYgAEA5xnIEBtG5b2nmbj49UEwQza\n' +
+ 'yX0844fXjccYzZ8xCDUe9dS2XOUi0aZlGblgSe/3lwjg8fMcKXLObGGQfgIx1+5h\n' +
+ 'AIBjORis/dlyN5q/yH4U5sjS8tcR0GDGVHrsRUZCo0IwQDAPBgNVHRMBAf8EBTAD\n' +
+ 'AQH/MB0GA1UdDgQWBBRK+lSGutXf4DkTjR3WNfv4+KeNFTAOBgNVHQ8BAf8EBAMC\n' +
+ 'AYYwCgYIKoZIzj0EAwMDaAAwZQIxAJ4NxQ1Gerqr70ZrnUqc62Vl8NNqTzInamCG\n' +
+ 'Kce3FTsMWbS9qkgrjZkO9QqOcGIw/gIwSLrwUT+PKr9+H9eHyGvpq9/3AIYSnFkb\n' +
+ 'Cf3dyWPiLKoAtLFwjzB/CkJlsAS1c8dS\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIF/jCCA+agAwIBAgIQGZH12Q7x41qIh9vDu9ikTjANBgkqhkiG9w0BAQwFADCB\n' +
+ 'lzELMAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIElu\n' +
+ 'Yy4xEzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTAwLgYDVQQDDCdB\n' +
+ 'bWF6b24gUkRTIGV1LXdlc3QtMyBSb290IENBIFJTQTQwOTYgRzExEDAOBgNVBAcM\n' +
+ 'B1NlYXR0bGUwIBcNMjEwNTI1MjIyMjMzWhgPMjEyMTA1MjUyMzIyMzNaMIGXMQsw\n' +
+ 'CQYDVQQGEwJVUzEiMCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywgSW5jLjET\n' +
+ 'MBEGA1UECwwKQW1hem9uIFJEUzELMAkGA1UECAwCV0ExMDAuBgNVBAMMJ0FtYXpv\n' +
+ 'biBSRFMgZXUtd2VzdC0zIFJvb3QgQ0EgUlNBNDA5NiBHMTEQMA4GA1UEBwwHU2Vh\n' +
+ 'dHRsZTCCAiIwDQYJKoZIhvcNAQEBBQADggIPADCCAgoCggIBAMqE47sHXWzdpuqj\n' +
+ 'JHb+6jM9tDbQLDFnYjDWpq4VpLPZhb7xPNh9gnYYTPKG4avG421EblAHqzy9D2pN\n' +
+ '1z90yKbIfUb/Sy2MhQbmZomsObhONEra06fJ0Dydyjswf1iYRp2kwpx5AgkVoNo7\n' +
+ '3dlws73zFjD7ImKvUx2C7B75bhnw2pJWkFnGcswl8fZt9B5Yt95sFOKEz2MSJE91\n' +
+ 'kZlHtya19OUxZ/cSGci4MlOySzqzbGwUqGxEIDlY8I39VMwXaYQ8uXUN4G780VcL\n' +
+ 'u46FeyRGxZGz2n3hMc805WAA1V5uir87vuirTvoSVREET97HVRGVVNJJ/FM6GXr1\n' +
+ 'VKtptybbo81nefYJg9KBysxAa2Ao2x2ry/2ZxwhS6VZ6v1+90bpZA1BIYFEDXXn/\n' +
+ 'dW07HSCFnYSlgPtSc+Muh15mdr94LspYeDqNIierK9i4tB6ep7llJAnq0BU91fM2\n' +
+ 'JPeqyoTtc3m06QhLf68ccSxO4l8Hmq9kLSHO7UXgtdjfRVaffngopTNk8qK7bIb7\n' +
+ 'LrgkqhiQw/PRCZjUdyXL153/fUcsj9nFNe25gM4vcFYwH6c5trd2tUl31NTi1MfG\n' +
+ 'Mgp3d2dqxQBIYANkEjtBDMy3SqQLIo9EymqmVP8xx2A/gCBgaxvMAsI6FSWRoC7+\n' +
+ 'hqJ8XH4mFnXSHKtYMe6WPY+/XZgtAgMBAAGjQjBAMA8GA1UdEwEB/wQFMAMBAf8w\n' +
+ 'HQYDVR0OBBYEFIkXqTnllT/VJnI2NqipA4XV8rh1MA4GA1UdDwEB/wQEAwIBhjAN\n' +
+ 'BgkqhkiG9w0BAQwFAAOCAgEAKjSle8eenGeHgT8pltWCw/HzWyQruVKhfYIBfKJd\n' +
+ 'MhV4EnH5BK7LxBIvpXGsFUrb0ThzSw0fn0zoA9jBs3i/Sj6KyeZ9qUF6b8ycDXd+\n' +
+ 'wHonmJiQ7nk7UuMefaYAfs06vosgl1rI7eBHC0itexIQmKh0aX+821l4GEgEoSMf\n' +
+ 'loMFTLXv2w36fPHHCsZ67ODldgcZbKNnpCTX0YrCwEYO3Pz/L398btiRcWGrewrK\n' +
+ 'jdxAAyietra8DRno1Zl87685tfqc6HsL9v8rVw58clAo9XAQvT+fmSOFw/PogRZ7\n' +
+ 'OMHUat3gu/uQ1M5S64nkLLFsKu7jzudBuoNmcJysPlzIbqJ7vYc82OUGe9ucF3wi\n' +
+ '3tbKQ983hdJiTExVRBLX/fYjPsGbG3JtPTv89eg2tjWHlPhCDMMxyRKl6isu2RTq\n' +
+ '6VT489Z2zQrC33MYF8ZqO1NKjtyMAMIZwxVu4cGLkVsqFmEV2ScDHa5RadDyD3Ok\n' +
+ 'm+mqybhvEVm5tPgY6p0ILPMN3yvJsMSPSvuBXhO/X5ppNnpw9gnxpwbjQKNhkFaG\n' +
+ 'M5pkADZ14uRguOLM4VthSwUSEAr5VQYCFZhEwK+UOyJAGiB/nJz6IxL5XBNUXmRM\n' +
+ 'Hl8Xvz4riq48LMQbjcVQj0XvH941yPh+P8xOi00SGaQRaWp55Vyr4YKGbV0mEDz1\n' +
+ 'r1o=\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIF/zCCA+egAwIBAgIRAKwYju1QWxUZpn6D1gOtwgQwDQYJKoZIhvcNAQEMBQAw\n' +
+ 'gZcxCzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJ\n' +
+ 'bmMuMRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTEwMC4GA1UEAwwn\n' +
+ 'QW1hem9uIFJEUyBldS13ZXN0LTEgUm9vdCBDQSBSU0E0MDk2IEcxMRAwDgYDVQQH\n' +
+ 'DAdTZWF0dGxlMCAXDTIxMDUyMDE2NTM1NFoYDzIxMjEwNTIwMTc1MzU0WjCBlzEL\n' +
+ 'MAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4x\n' +
+ 'EzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTAwLgYDVQQDDCdBbWF6\n' +
+ 'b24gUkRTIGV1LXdlc3QtMSBSb290IENBIFJTQTQwOTYgRzExEDAOBgNVBAcMB1Nl\n' +
+ 'YXR0bGUwggIiMA0GCSqGSIb3DQEBAQUAA4ICDwAwggIKAoICAQCKdBP1U4lqWWkc\n' +
+ 'Cb25/BKRTsvNVnISiKocva8GAzJyKfcGRa85gmgu41U+Hz6+39K+XkRfM0YS4BvQ\n' +
+ 'F1XxWT0bNyypuvwCvmYShSTjN1TY0ltncDddahTajE/4MdSOZb/c98u0yt03cH+G\n' +
+ 'hVwRyT50h0v/UEol50VfwcVAEZEgcQQYhf1IFUFlIvKpmDOqLuFakOnc7c9akK+i\n' +
+ 'ivST+JO1tgowbnNkn2iLlSSgUWgb1gjaOsNfysagv1RXdlyPw3EyfwkFifAQvF2P\n' +
+ 'Q0ayYZfYS640cccv7efM1MSVyFHR9PrrDsF/zr2S2sGPbeHr7R/HwLl+S5J/l9N9\n' +
+ 'y0rk6IHAWV4dEkOvgpnuJKURwA48iu1Hhi9e4moNS6eqoK2KmY3VFpuiyWcA73nH\n' +
+ 'GSmyaH+YuMrF7Fnuu7GEHZL/o6+F5cL3mj2SJJhL7sz0ryf5Cs5R4yN9BIEj/f49\n' +
+ 'wh84pM6nexoI0Q4wiSFCxWiBpjSmOK6h7z6+2utaB5p20XDZHhxAlmlx4vMuWtjh\n' +
+ 'XckgRFxc+ZpVMU3cAHUpVEoO49e/+qKEpPzp8Xg4cToKw2+AfTk3cmyyXQfGwXMQ\n' +
+ 'ZUHNZ3w9ILMWihGCM2aGUsLcGDRennvNmnmin/SENsOQ8Ku0/a3teEzwV9cmmdYz\n' +
+ '5iYs1YtgPvKFobY6+T2RXXh+A5kprwIDAQABo0IwQDAPBgNVHRMBAf8EBTADAQH/\n' +
+ 'MB0GA1UdDgQWBBSyUrsQVnKmA8z6/2Ech0rCvqpNmTAOBgNVHQ8BAf8EBAMCAYYw\n' +
+ 'DQYJKoZIhvcNAQEMBQADggIBAFlj3IFmgiFz5lvTzFTRizhVofhTJsGr14Yfkuc7\n' +
+ 'UrXPuXOwJomd4uot2d/VIeGJpfnuS84qGdmQyGewGTJ9inatHsGZgHl9NHNWRwKZ\n' +
+ 'lTKTbBiq7aqgtUSFa06v202wpzU+1kadxJJePrbABxiXVfOmIW/a1a4hPNcT3syH\n' +
+ 'FIEg1+CGsp71UNjBuwg3JTKWna0sLSKcxLOSOvX1fzxK5djzVpEsvQMB4PSAzXca\n' +
+ 'vENgg2ErTwgTA+4s6rRtiBF9pAusN1QVuBahYP3ftrY6f3ycS4K65GnqscyfvKt5\n' +
+ 'YgjtEKO3ZeeX8NpubMbzC+0Z6tVKfPFk/9TXuJtwvVeqow0YMrLLyRiYvK7EzJ97\n' +
+ 'rrkxoKnHYQSZ+rH2tZ5SE392/rfk1PJL0cdHnkpDkUDO+8cKsFjjYKAQSNC52sKX\n' +
+ '74AVh6wMwxYwVZZJf2/2XxkjMWWhKNejsZhUkTISSmiLs+qPe3L67IM7GyKm9/m6\n' +
+ 'R3r8x6NGjhTsKH64iYJg7AeKeax4b2e4hBb6GXFftyOs7unpEOIVkJJgM6gh3mwn\n' +
+ 'R7v4gwFbLKADKt1vHuerSZMiTuNTGhSfCeDM53XI/mjZl2HeuCKP1mCDLlaO+gZR\n' +
+ 'Q/G+E0sBKgEX4xTkAc3kgkuQGfExdGtnN2U2ehF80lBHB8+2y2E+xWWXih/ZyIcW\n' +
+ 'wOx+\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIGBDCCA+ygAwIBAgIQM4C8g5iFRucSWdC8EdqHeDANBgkqhkiG9w0BAQwFADCB\n' +
+ 'mjELMAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIElu\n' +
+ 'Yy4xEzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTMwMQYDVQQDDCpB\n' +
+ 'bWF6b24gUkRTIGV1LWNlbnRyYWwtMSBSb290IENBIFJTQTQwOTYgRzExEDAOBgNV\n' +
+ 'BAcMB1NlYXR0bGUwIBcNMjEwNTIxMjIyODI2WhgPMjEyMTA1MjEyMzI4MjZaMIGa\n' +
+ 'MQswCQYDVQQGEwJVUzEiMCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywgSW5j\n' +
+ 'LjETMBEGA1UECwwKQW1hem9uIFJEUzELMAkGA1UECAwCV0ExMzAxBgNVBAMMKkFt\n' +
+ 'YXpvbiBSRFMgZXUtY2VudHJhbC0xIFJvb3QgQ0EgUlNBNDA5NiBHMTEQMA4GA1UE\n' +
+ 'BwwHU2VhdHRsZTCCAiIwDQYJKoZIhvcNAQEBBQADggIPADCCAgoCggIBANeTsD/u\n' +
+ '6saPiY4Sg0GlJlMXMBltnrcGAEkwq34OKQ0bCXqcoNJ2rcAMmuFC5x9Ho1Y3YzB7\n' +
+ 'NO2GpIh6bZaO76GzSv4cnimcv9n/sQSYXsGbPD+bAtnN/RvNW1avt4C0q0/ghgF1\n' +
+ 'VFS8JihIrgPYIArAmDtGNEdl5PUrdi9y6QGggbRfidMDdxlRdZBe1C18ZdgERSEv\n' +
+ 'UgSTPRlVczONG5qcQkUGCH83MMqL5MKQiby/Br5ZyPq6rxQMwRnQ7tROuElzyYzL\n' +
+ '7d6kke+PNzG1mYy4cbYdjebwANCtZ2qYRSUHAQsOgybRcSoarv2xqcjO9cEsDiRU\n' +
+ 'l97ToadGYa4VVERuTaNZxQwrld4mvzpyKuirqZltOqg0eoy8VUsaRPL3dc5aChR0\n' +
+ 'dSrBgRYmSAClcR2/2ZCWpXemikwgt031Dsc0A/+TmVurrsqszwbr0e5xqMow9LzO\n' +
+ 'MI/JtLd0VFtoOkL/7GG2tN8a+7gnLFxpv+AQ0DH5n4k/BY/IyS+H1erqSJhOTQ11\n' +
+ 'vDOFTM5YplB9hWV9fp5PRs54ILlHTlZLpWGs3I2BrJwzRtg/rOlvsosqcge9ryai\n' +
+ 'AKm2j+JBg5wJ19R8oxRy8cfrNTftZePpISaLTyV2B16w/GsSjqixjTQe9LRN2DHk\n' +
+ 'cC+HPqYyzW2a3pUVyTGHhW6a7YsPBs9yzt6hAgMBAAGjQjBAMA8GA1UdEwEB/wQF\n' +
+ 'MAMBAf8wHQYDVR0OBBYEFIqA8QkOs2cSirOpCuKuOh9VDfJfMA4GA1UdDwEB/wQE\n' +
+ 'AwIBhjANBgkqhkiG9w0BAQwFAAOCAgEAOUI90mEIsa+vNJku0iUwdBMnHiO4gm7E\n' +
+ '5JloP7JG0xUr7d0hypDorMM3zVDAL+aZRHsq8n934Cywj7qEp1304UF6538ByGdz\n' +
+ 'tkfacJsUSYfdlNJE9KbA4T+U+7SNhj9jvePpVjdQbhgzxITE9f8CxY/eM40yluJJ\n' +
+ 'PhbaWvOiRagzo74wttlcDerzLT6Y/JrVpWhnB7IY8HvzK+BwAdaCsBUPC3HF+kth\n' +
+ 'CIqLq7J3YArTToejWZAp5OOI6DLPM1MEudyoejL02w0jq0CChmZ5i55ElEMnapRX\n' +
+ '7GQTARHmjgAOqa95FjbHEZzRPqZ72AtZAWKFcYFNk+grXSeWiDgPFOsq6mDg8DDB\n' +
+ '0kfbYwKLFFCC9YFmYzR2YrWw2NxAScccUc2chOWAoSNHiqBbHR8ofrlJSWrtmKqd\n' +
+ 'YRCXzn8wqXnTS3NNHNccqJ6dN+iMr9NGnytw8zwwSchiev53Fpc1mGrJ7BKTWH0t\n' +
+ 'ZrA6m32wzpMymtKozlOPYoE5mtZEzrzHEXfa44Rns7XIHxVQSXVWyBHLtIsZOrvW\n' +
+ 'U5F41rQaFEpEeUQ7sQvqUoISfTUVRNDn6GK6YaccEhCji14APLFIvhRQUDyYMIiM\n' +
+ '4vll0F/xgVRHTgDVQ8b8sxdhSYlqB4Wc2Ym41YRz+X2yPqk3typEZBpc4P5Tt1/N\n' +
+ '89cEIGdbjsA=\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIEADCCAuigAwIBAgIQYjbPSg4+RNRD3zNxO1fuKDANBgkqhkiG9w0BAQsFADCB\n' +
+ 'mDELMAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIElu\n' +
+ 'Yy4xEzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTEwLwYDVQQDDChB\n' +
+ 'bWF6b24gUkRTIGV1LW5vcnRoLTEgUm9vdCBDQSBSU0EyMDQ4IEcxMRAwDgYDVQQH\n' +
+ 'DAdTZWF0dGxlMCAXDTIxMDUyNDIwNTkyMVoYDzIwNjEwNTI0MjE1OTIxWjCBmDEL\n' +
+ 'MAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4x\n' +
+ 'EzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTEwLwYDVQQDDChBbWF6\n' +
+ 'b24gUkRTIGV1LW5vcnRoLTEgUm9vdCBDQSBSU0EyMDQ4IEcxMRAwDgYDVQQHDAdT\n' +
+ 'ZWF0dGxlMIIBIjANBgkqhkiG9w0BAQEFAAOCAQ8AMIIBCgKCAQEA179eQHxcV0YL\n' +
+ 'XMkqEmhSBazHhnRVd8yICbMq82PitE3BZcnv1Z5Zs/oOgNmMkOKae4tCXO/41JCX\n' +
+ 'wAgbs/eWWi+nnCfpQ/FqbLPg0h3dqzAgeszQyNl9IzTzX4Nd7JFRBVJXPIIKzlRf\n' +
+ '+GmFsAhi3rYgDgO27pz3ciahVSN+CuACIRYnA0K0s9lhYdddmrW/SYeWyoB7jPa2\n' +
+ 'LmWpAs7bDOgS4LlP2H3eFepBPgNufRytSQUVA8f58lsE5w25vNiUSnrdlvDrIU5n\n' +
+ 'Qwzc7NIZCx4qJpRbSKWrUtbyJriWfAkGU7i0IoainHLn0eHp9bWkwb9D+C/tMk1X\n' +
+ 'ERZw2PDGkwIDAQABo0IwQDAPBgNVHRMBAf8EBTADAQH/MB0GA1UdDgQWBBSFmR7s\n' +
+ 'dAblusFN+xhf1ae0KUqhWTAOBgNVHQ8BAf8EBAMCAYYwDQYJKoZIhvcNAQELBQAD\n' +
+ 'ggEBAHsXOpjPMyH9lDhPM61zYdja1ebcMVgfUvsDvt+w0xKMKPhBzYDMs/cFOi1N\n' +
+ 'Q8LV79VNNfI2NuvFmGygcvTIR+4h0pqqZ+wjWl3Kk5jVxCrbHg3RBX02QLumKd/i\n' +
+ 'kwGcEtTUvTssn3SM8bgM0/1BDXgImZPC567ciLvWDo0s/Fe9dJJC3E0G7d/4s09n\n' +
+ 'OMdextcxFuWBZrBm/KK3QF0ByA8MG3//VXaGO9OIeeOJCpWn1G1PjT1UklYhkg61\n' +
+ 'EbsTiZVA2DLd1BGzfU4o4M5mo68l0msse/ndR1nEY6IywwpgIFue7+rEleDh6b9d\n' +
+ 'PYkG1rHVw2I0XDG4o17aOn5E94I=\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIEADCCAuigAwIBAgIQC6W4HFghUkkgyQw14a6JljANBgkqhkiG9w0BAQsFADCB\n' +
+ 'mDELMAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIElu\n' +
+ 'Yy4xEzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTEwLwYDVQQDDChB\n' +
+ 'bWF6b24gUkRTIGV1LXNvdXRoLTIgUm9vdCBDQSBSU0EyMDQ4IEcxMRAwDgYDVQQH\n' +
+ 'DAdTZWF0dGxlMCAXDTIyMDUyMzE4MTYzMloYDzIwNjIwNTIzMTkxNjMyWjCBmDEL\n' +
+ 'MAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4x\n' +
+ 'EzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTEwLwYDVQQDDChBbWF6\n' +
+ 'b24gUkRTIGV1LXNvdXRoLTIgUm9vdCBDQSBSU0EyMDQ4IEcxMRAwDgYDVQQHDAdT\n' +
+ 'ZWF0dGxlMIIBIjANBgkqhkiG9w0BAQEFAAOCAQ8AMIIBCgKCAQEAiM/t4FV2R9Nx\n' +
+ 'UQG203UY83jInTa/6TMq0SPyg617FqYZxvz2kkx09x3dmxepUg9ttGMlPgjsRZM5\n' +
+ 'LCFEi1FWk+hxHzt7vAdhHES5tdjwds3aIkgNEillmRDVrUsbrDwufLaa+MMDO2E1\n' +
+ 'wQ/JYFXw16WBCCi2g1EtyQ2Xp+tZDX5IWOTnvhZpW8vVDptZ2AcJ5rMhfOYO3OsK\n' +
+ '5EF0GGA5ldzuezP+BkrBYGJ4wVKGxeaq9+5AT8iVZrypjwRkD7Y5CurywK3+aBwm\n' +
+ 's9Q5Nd8t45JCOUzYp92rFKsCriD86n/JnEvgDfdP6Hvtm0/DkwXK40Wz2q0Zrd0k\n' +
+ 'mjP054NRPwIDAQABo0IwQDAPBgNVHRMBAf8EBTADAQH/MB0GA1UdDgQWBBRR7yqd\n' +
+ 'SfKcX2Q8GzhcVucReIpewTAOBgNVHQ8BAf8EBAMCAYYwDQYJKoZIhvcNAQELBQAD\n' +
+ 'ggEBAEszBRDwXcZyNm07VcFwI1Im94oKwKccuKYeJEsizTBsVon8VpEiMwDs+yGu\n' +
+ '3p8kBhvkLwWybkD/vv6McH7T5b9jDX2DoOudqYnnaYeypsPH/00Vh3LvKagqzQza\n' +
+ 'orWLx+0tLo8xW4BtU+Wrn3JId8LvAhxyYXTn9bm+EwPcStp8xGLwu53OPD1RXYuy\n' +
+ 'uu+3ps/2piP7GVfou7H6PRaqbFHNfiGg6Y+WA0HGHiJzn8uLmrRJ5YRdIOOG9/xi\n' +
+ 'qTmAZloUNM7VNuurcMM2hWF494tQpsQ6ysg2qPjbBqzlGoOt3GfBTOZmqmwmqtam\n' +
+ 'K7juWM/mdMQAJ3SMlE5wI8nVdx4=\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIICrjCCAjSgAwIBAgIRAL9SdzVPcpq7GOpvdGoM80IwCgYIKoZIzj0EAwMwgZYx\n' +
+ 'CzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMu\n' +
+ 'MRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTEvMC0GA1UEAwwmQW1h\n' +
+ 'em9uIFJEUyBldS13ZXN0LTEgUm9vdCBDQSBFQ0MzODQgRzExEDAOBgNVBAcMB1Nl\n' +
+ 'YXR0bGUwIBcNMjEwNTIwMTY1ODA3WhgPMjEyMTA1MjAxNzU4MDdaMIGWMQswCQYD\n' +
+ 'VQQGEwJVUzEiMCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywgSW5jLjETMBEG\n' +
+ 'A1UECwwKQW1hem9uIFJEUzELMAkGA1UECAwCV0ExLzAtBgNVBAMMJkFtYXpvbiBS\n' +
+ 'RFMgZXUtd2VzdC0xIFJvb3QgQ0EgRUNDMzg0IEcxMRAwDgYDVQQHDAdTZWF0dGxl\n' +
+ 'MHYwEAYHKoZIzj0CAQYFK4EEACIDYgAEJWDgXebvwjR+Ce+hxKOLbnsfN5W5dOlP\n' +
+ 'Zn8kwWnD+SLkU81Eac/BDJsXGrMk6jFD1vg16PEkoSevsuYWlC8xR6FmT6F6pmeh\n' +
+ 'fsMGOyJpfK4fyoEPhKeQoT23lFIc5Orjo0IwQDAPBgNVHRMBAf8EBTADAQH/MB0G\n' +
+ 'A1UdDgQWBBSVNAN1CHAz0eZ77qz2adeqjm31TzAOBgNVHQ8BAf8EBAMCAYYwCgYI\n' +
+ 'KoZIzj0EAwMDaAAwZQIxAMlQeHbcjor49jqmcJ9gRLWdEWpXG8thIf6zfYQ/OEAg\n' +
+ 'd7GDh4fR/OUk0VfjsBUN/gIwZB0bGdXvK38s6AAE/9IT051cz/wMe9GIrX1MnL1T\n' +
+ '1F5OqnXJdiwfZRRTHsRQ/L00\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIGBDCCA+ygAwIBAgIQalr16vDfX4Rsr+gfQ4iVFDANBgkqhkiG9w0BAQwFADCB\n' +
+ 'mjELMAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIElu\n' +
+ 'Yy4xEzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTMwMQYDVQQDDCpB\n' +
+ 'bWF6b24gUkRTIGV1LWNlbnRyYWwtMiBSb290IENBIFJTQTQwOTYgRzExEDAOBgNV\n' +
+ 'BAcMB1NlYXR0bGUwIBcNMjIwNjA2MjEyNTIzWhgPMjEyMjA2MDYyMjI1MjNaMIGa\n' +
+ 'MQswCQYDVQQGEwJVUzEiMCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywgSW5j\n' +
+ 'LjETMBEGA1UECwwKQW1hem9uIFJEUzELMAkGA1UECAwCV0ExMzAxBgNVBAMMKkFt\n' +
+ 'YXpvbiBSRFMgZXUtY2VudHJhbC0yIFJvb3QgQ0EgUlNBNDA5NiBHMTEQMA4GA1UE\n' +
+ 'BwwHU2VhdHRsZTCCAiIwDQYJKoZIhvcNAQEBBQADggIPADCCAgoCggIBANbHbFg7\n' +
+ '2VhZor1YNtez0VlNFaobS3PwOMcEn45BE3y7HONnElIIWXGQa0811M8V2FnyqnE8\n' +
+ 'Z5aO1EuvijvWf/3D8DPZkdmAkIfh5hlZYY6Aatr65kEOckwIAm7ZZzrwFogYuaFC\n' +
+ 'z/q0CW+8gxNK+98H/zeFx+IxiVoPPPX6UlrLvn+R6XYNERyHMLNgoZbbS5gGHk43\n' +
+ 'KhENVv3AWCCcCc85O4rVd+DGb2vMVt6IzXdTQt6Kih28+RGph+WDwYmf+3txTYr8\n' +
+ 'xMcCBt1+whyCPlMbC+Yn/ivtCO4LRf0MPZDRQrqTTrFf0h/V0BGEUmMGwuKgmzf5\n' +
+ 'Kl9ILdWv6S956ioZin2WgAxhcn7+z//sN++zkqLreSf90Vgv+A7xPRqIpTdJ/nWG\n' +
+ 'JaAOUofBfsDsk4X4SUFE7xJa1FZAiu2lqB/E+y7jnWOvFRalzxVJ2Y+D/ZfUfrnK\n' +
+ '4pfKtyD1C6ni1celrZrAwLrJ3PoXPSg4aJKh8+CHex477SRsGj8KP19FG8r0P5AG\n' +
+ '8lS1V+enFCNvT5KqEBpDZ/Y5SQAhAYFUX+zH4/n4ql0l/emS+x23kSRrF+yMkB9q\n' +
+ 'lhC/fMk6Pi3tICBjrDQ8XAxv56hfud9w6+/ljYB2uQ1iUYtlE3JdIiuE+3ws26O8\n' +
+ 'i7PLMD9zQmo+sVi12pLHfBHQ6RRHtdVRXbXRAgMBAAGjQjBAMA8GA1UdEwEB/wQF\n' +
+ 'MAMBAf8wHQYDVR0OBBYEFBFot08ipEL9ZUXCG4lagmF53C0/MA4GA1UdDwEB/wQE\n' +
+ 'AwIBhjANBgkqhkiG9w0BAQwFAAOCAgEAi2mcZi6cpaeqJ10xzMY0F3L2eOKYnlEQ\n' +
+ 'h6QyhmNKCUF05q5u+cok5KtznzqMwy7TFOZtbVHl8uUX+xvgq/MQCxqFAnuStBXm\n' +
+ 'gr2dg1h509ZwvTdk7TDxGdftvPCfnPNJBFbMSq4CZtNcOFBg9Rj8c3Yj+Qvwd56V\n' +
+ 'zWs65BUkDNJrXmxdvhJZjUkMa9vi/oFN+M84xXeZTaC5YDYNZZeW9706QqDbAVES\n' +
+ '5ulvKLavB8waLI/lhRBK5/k0YykCMl0A8Togt8D1QsQ0eWWbIM8/HYJMPVFhJ8Wj\n' +
+ 'vT1p/YVeDA3Bo1iKDOttgC5vILf5Rw1ZEeDxjf/r8A7VS13D3OLjBmc31zxRTs3n\n' +
+ 'XvHKP9MieQHn9GE44tEYPjK3/yC6BDFzCBlvccYHmqGb+jvDEXEBXKzimdC9mcDl\n' +
+ 'f4BBQWGJBH5jkbU9p6iti19L/zHhz7qU6UJWbxY40w92L9jS9Utljh4A0LCTjlnR\n' +
+ 'NQUgjnGC6K+jkw8hj0LTC5Ip87oqoT9w7Av5EJ3VJ4hcnmNMXJJ1DkWYdnytcGpO\n' +
+ 'DMVITQzzDZRwhbitCVPHagTN2wdi9TEuYE33J0VmFeTc6FSI50wP2aOAZ0Q1/8Aj\n' +
+ 'bxeM5jS25eaHc2CQAuhrc/7GLnxOcPwdWQb2XWT8eHudhMnoRikVv/KSK3mf6om4\n' +
+ '1YfpdH2jp30=\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIID/jCCAuagAwIBAgIQTDc+UgTRtYO7ZGTQ8UWKDDANBgkqhkiG9w0BAQsFADCB\n' +
+ 'lzELMAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIElu\n' +
+ 'Yy4xEzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTAwLgYDVQQDDCdB\n' +
+ 'bWF6b24gUkRTIGV1LXdlc3QtMiBSb290IENBIFJTQTIwNDggRzExEDAOBgNVBAcM\n' +
+ 'B1NlYXR0bGUwIBcNMjEwNTIxMjI0NjI0WhgPMjA2MTA1MjEyMzQ2MjRaMIGXMQsw\n' +
+ 'CQYDVQQGEwJVUzEiMCAGA1UECgwZQW1hem9uIFdlYiBTZXJ2aWNlcywgSW5jLjET\n' +
+ 'MBEGA1UECwwKQW1hem9uIFJEUzELMAkGA1UECAwCV0ExMDAuBgNVBAMMJ0FtYXpv\n' +
+ 'biBSRFMgZXUtd2VzdC0yIFJvb3QgQ0EgUlNBMjA0OCBHMTEQMA4GA1UEBwwHU2Vh\n' +
+ 'dHRsZTCCASIwDQYJKoZIhvcNAQEBBQADggEPADCCAQoCggEBAM1oGtthQ1YiVIC2\n' +
+ 'i4u4swMAGxAjc/BZp0yq0eP5ZQFaxnxs7zFAPabEWsrjeDzrRhdVO0h7zskrertP\n' +
+ 'gblGhfD20JfjvCHdP1RUhy/nzG+T+hn6Takan/GIgs8grlBMRHMgBYHW7tklhjaH\n' +
+ '3F7LujhceAHhhgp6IOrpb6YTaTTaJbF3GTmkqxSJ3l1LtEoWz8Al/nL/Ftzxrtez\n' +
+ 'Vs6ebpvd7sw37sxmXBWX2OlvUrPCTmladw9OrllGXtCFw4YyLe3zozBlZ3cHzQ0q\n' +
+ 'lINhpRcajTMfZrsiGCkQtoJT+AqVJPS2sHjqsEH8yiySW9Jbq4zyMbM1yqQ2vnnx\n' +
+ 'MJgoYMcCAwEAAaNCMEAwDwYDVR0TAQH/BAUwAwEB/zAdBgNVHQ4EFgQUaQG88UnV\n' +
+ 'JPTI+Pcti1P+q3H7pGYwDgYDVR0PAQH/BAQDAgGGMA0GCSqGSIb3DQEBCwUAA4IB\n' +
+ 'AQBAkgr75V0sEJimC6QRiTVWEuj2Khy7unjSfudbM6zumhXEU2/sUaVLiYy6cA/x\n' +
+ '3v0laDle6T07x9g64j5YastE/4jbzrGgIINFlY0JnaYmR3KZEjgi1s1fkRRf3llL\n' +
+ 'PJm9u4Q1mbwAMQK/ZjLuuRcL3uRIHJek18nRqT5h43GB26qXyvJqeYYpYfIjL9+/\n' +
+ 'YiZAbSRRZG+Li23cmPWrbA1CJY121SB+WybCbysbOXzhD3Sl2KSZRwSw4p2HrFtV\n' +
+ '1Prk0dOBtZxCG9luf87ultuDZpfS0w6oNBAMXocgswk24ylcADkkFxBWW+7BETn1\n' +
+ 'EpK+t1Lm37mU4sxtuha00XAi\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIEADCCAuigAwIBAgIQcY44/8NUvBwr6LlHfRy7KjANBgkqhkiG9w0BAQsFADCB\n' +
+ 'mDELMAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIElu\n' +
+ 'Yy4xEzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTEwLwYDVQQDDChB\n' +
+ 'bWF6b24gUkRTIGV1LXNvdXRoLTEgUm9vdCBDQSBSU0EyMDQ4IEcxMRAwDgYDVQQH\n' +
+ 'DAdTZWF0dGxlMCAXDTIxMDUxOTE4MjcxOFoYDzIwNjEwNTE5MTkyNzE4WjCBmDEL\n' +
+ 'MAkGA1UEBhMCVVMxIjAgBgNVBAoMGUFtYXpvbiBXZWIgU2VydmljZXMsIEluYy4x\n' +
+ 'EzARBgNVBAsMCkFtYXpvbiBSRFMxCzAJBgNVBAgMAldBMTEwLwYDVQQDDChBbWF6\n' +
+ 'b24gUkRTIGV1LXNvdXRoLTEgUm9vdCBDQSBSU0EyMDQ4IEcxMRAwDgYDVQQHDAdT\n' +
+ 'ZWF0dGxlMIIBIjANBgkqhkiG9w0BAQEFAAOCAQ8AMIIBCgKCAQEA0UaBeC+Usalu\n' +
+ 'EtXnV7+PnH+gi7/71tI/jkKVGKuhD2JDVvqLVoqbMHRh3+wGMvqKCjbHPcC2XMWv\n' +
+ '566fpAj4UZ9CLB5fVzss+QVNTl+FH2XhEzigopp+872ajsNzcZxrMkifxGb4i0U+\n' +
+ 't0Zi+UrbL5tsfP2JonKR1crOrbS6/DlzHBjIiJazGOQcMsJjNuTOItLbMohLpraA\n' +
+ '/nApa3kOvI7Ufool1/34MG0+wL3UUA4YkZ6oBJVxjZvvs6tI7Lzz/SnhK2widGdc\n' +
+ 'snbLqBpHNIZQSorVoiwcFaRBGYX/uzYkiw44Yfa4cK2V/B5zgu1Fbr0gbI2am4eh\n' +
+ 'yVYyg4jPawIDAQABo0IwQDAPBgNVHRMBAf8EBTADAQH/MB0GA1UdDgQWBBS9gM1m\n' +
+ 'IIjyh9O5H/7Vj0R/akI7UzAOBgNVHQ8BAf8EBAMCAYYwDQYJKoZIhvcNAQELBQAD\n' +
+ 'ggEBAF0Sm9HC2AUyedBVnwgkVXMibnYChOzz7T+0Y+fOLXYAEXex2s8oqGeZdGYX\n' +
+ 'JHkjBn7JXu7LM+TpTbPbFFDoc1sgMguD/ls+8XsqAl1CssW+amryIL+jfcfbgQ+P\n' +
+ 'ICwEUD9hGdjBgJ5WcuS+qqxHsEIlFNci3HxcxfBa9VsWs5TjI7Vsl4meL5lf7ZyL\n' +
+ 'wDV7dHRuU+cImqG1MIvPRIlvPnT7EghrCYi2VCPhP2pM/UvShuwVnkz4MJ29ebIk\n' +
+ 'WR9kpblFxFdE92D5UUvMCjC2kmtgzNiErvTcwIvOO9YCbBHzRB1fFiWrXUHhJWq9\n' +
+ 'IkaxR5icb/IpAV0A1lYZEWMVsfQ=\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIGATCCA+mgAwIBAgIRAMa0TPL+QgbWfUPpYXQkf8wwDQYJKoZIhvcNAQEMBQAw\n' +
+ 'gZgxCzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJ\n' +
+ 'bmMuMRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTExMC8GA1UEAwwo\n' +
+ 'QW1hem9uIFJEUyBldS1ub3J0aC0xIFJvb3QgQ0EgUlNBNDA5NiBHMTEQMA4GA1UE\n' +
+ 'BwwHU2VhdHRsZTAgFw0yMTA1MjQyMTAzMjBaGA8yMTIxMDUyNDIyMDMyMFowgZgx\n' +
+ 'CzAJBgNVBAYTAlVTMSIwIAYDVQQKDBlBbWF6b24gV2ViIFNlcnZpY2VzLCBJbmMu\n' +
+ 'MRMwEQYDVQQLDApBbWF6b24gUkRTMQswCQYDVQQIDAJXQTExMC8GA1UEAwwoQW1h\n' +
+ 'em9uIFJEUyBldS1ub3J0aC0xIFJvb3QgQ0EgUlNBNDA5NiBHMTEQMA4GA1UEBwwH\n' +
+ 'U2VhdHRsZTCCAiIwDQYJKoZIhvcNAQEBBQADggIPADCCAgoCggIBANhS9LJVJyWp\n' +
+ '6Rudy9t47y6kzvgnFYDrvJVtgEK0vFn5ifdlHE7xqMz4LZqWBFTnS+3oidwVRqo7\n' +
+ 'tqsuuElsouStO8m315/YUzKZEPmkw8h5ufWt/lg3NTCoUZNkB4p4skr7TspyMUwE\n' +
+ 'VdlKQuWTCOLtofwmWT+BnFF3To6xTh3XPlT3ssancw27Gob8kJegD7E0TSMVsecP\n' +
+ 'B8je65+3b8CGwcD3QB3kCTGLy87tXuS2+07pncHvjMRMBdDQQQqhXWsRSeUNg0IP\n' +
+ 'xdHTWcuwMldYPWK5zus9M4dCNBDlmZjKdcZZVUOKeBBAm7Uo7CbJCk8r/Fvfr6mw\n' +
+ 'nXXDtuWhqn/WhJiI/y0QU27M+Hy5CQMxBwFsfAjJkByBpdXmyYxUgTmMpLf43p7H\n' +
+ 'oWfH1xN0cT0OQEVmAQjMakauow4AQLNkilV+X6uAAu3STQVFRSrpvMen9Xx3EPC3\n' +
+ 'G9flHueTa71bU65Xe8ZmEmFhGeFYHY0GrNPAFhq9RThPRY0IPyCZe0Th8uGejkek\n' +
+ 'jQjm0FHPOqs5jc8CD8eJs4jSEFt9lasFLVDcAhx0FkacLKQjGHvKAnnbRwhN/dF3\n' +
+ 'xt4oL8Z4JGPCLau056gKnYaEyviN7PgO+IFIVOVIdKEBu2ASGE8/+QJB5bcHefNj\n' +
+ '04hEkDW0UYJbSfPpVbGAR0gFI/QpycKnAgMBAAGjQjBAMA8GA1UdEwEB/wQFMAMB\n' +
+ 'Af8wHQYDVR0OBBYEFFMXvvjoaGGUcul8GA3FT05DLbZcMA4GA1UdDwEB/wQEAwIB\n' +
+ 'hjANBgkqhkiG9w0BAQwFAAOCAgEAQLwFhd2JKn4K/6salLyIA4mP58qbA/9BTB/r\n' +
+ 'D9l0bEwDlVPSdY7R3gZCe6v7SWLfA9RjE5tdWDrQMi5IU6W2OVrVsZS/yGJfwnwe\n' +
+ 'a/9iUAYprA5QYKDg37h12XhVsDKlYCekHdC+qa5WwB1SL3YUprDLPWeaIQdg+Uh2\n' +
+ '+LxvpZGoxoEbca0fc7flwq9ke/3sXt/3V4wJDyY6AL2YNdjFzC+FtYjHHx8rYxHs\n' +
+ 'aesP7yunuN17KcfOZBBnSFRrx96k+Xm95VReTEEpwiBqAECqEpMbd+R0mFAayMb1\n' +
+ 'cE77GaK5yeC2f67NLYGpkpIoPbO9p9rzoXLE5GpSizMjimnz6QCbXPFAFBDfSzim\n' +
+ 'u6azp40kEUO6kWd7rBhqRwLc43D3TtNWQYxMve5mTRG4Od+eMKwYZmQz89BQCeqm\n' +
+ 'aZiJP9y9uwJw4p/A5V3lYHTDQqzmbOyhGUk6OdpdE8HXs/1ep1xTT20QDYOx3Ekt\n' +
+ 'r4mmNYfH/8v9nHNRlYJOqFhmoh1i85IUl5IHhg6OT5ZTTwsGTSxvgQQXrmmHVrgZ\n' +
+ 'rZIqyBKllCgVeB9sMEsntn4bGLig7CS/N1y2mYdW/745yCLZv2gj0NXhPqgEIdVV\n' +
+ 'f9DhFD4ohE1C63XP0kOQee+LYg/MY5vH8swpCSWxQgX5icv5jVDz8YTdCKgUc5u8\n' +
+ 'rM2p0kk=\n' +
+ '-----END CERTIFICATE-----\n',
+];
diff --git a/node_modules/aws-ssl-profiles/lib/profiles/ca/proxies.d.ts b/node_modules/aws-ssl-profiles/lib/profiles/ca/proxies.d.ts
new file mode 100644
index 0000000..da2b76b
--- /dev/null
+++ b/node_modules/aws-ssl-profiles/lib/profiles/ca/proxies.d.ts
@@ -0,0 +1,8 @@
+import type { CA } from '../../@types/profiles.js';
+/**
+ * CA Certificates for **Amazon RDS Proxy** (2024)
+ *
+ * - https://docs.aws.amazon.com/AmazonRDS/latest/UserGuide/rds-proxy.howitworks.html#rds-proxy-security.tls
+ * - https://www.amazontrust.com/repository/
+ */
+export declare const proxies: CA;
diff --git a/node_modules/aws-ssl-profiles/lib/profiles/ca/proxies.js b/node_modules/aws-ssl-profiles/lib/profiles/ca/proxies.js
new file mode 100644
index 0000000..367a4c3
--- /dev/null
+++ b/node_modules/aws-ssl-profiles/lib/profiles/ca/proxies.js
@@ -0,0 +1,111 @@
+"use strict";
+Object.defineProperty(exports, "__esModule", { value: true });
+exports.proxies = void 0;
+/**
+ * CA Certificates for **Amazon RDS Proxy** (2024)
+ *
+ * - https://docs.aws.amazon.com/AmazonRDS/latest/UserGuide/rds-proxy.howitworks.html#rds-proxy-security.tls
+ * - https://www.amazontrust.com/repository/
+ */
+exports.proxies = [
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIDQTCCAimgAwIBAgITBmyfz5m/jAo54vB4ikPmljZbyjANBgkqhkiG9w0BAQsF\n' +
+ 'ADA5MQswCQYDVQQGEwJVUzEPMA0GA1UEChMGQW1hem9uMRkwFwYDVQQDExBBbWF6\n' +
+ 'b24gUm9vdCBDQSAxMB4XDTE1MDUyNjAwMDAwMFoXDTM4MDExNzAwMDAwMFowOTEL\n' +
+ 'MAkGA1UEBhMCVVMxDzANBgNVBAoTBkFtYXpvbjEZMBcGA1UEAxMQQW1hem9uIFJv\n' +
+ 'b3QgQ0EgMTCCASIwDQYJKoZIhvcNAQEBBQADggEPADCCAQoCggEBALJ4gHHKeNXj\n' +
+ 'ca9HgFB0fW7Y14h29Jlo91ghYPl0hAEvrAIthtOgQ3pOsqTQNroBvo3bSMgHFzZM\n' +
+ '9O6II8c+6zf1tRn4SWiw3te5djgdYZ6k/oI2peVKVuRF4fn9tBb6dNqcmzU5L/qw\n' +
+ 'IFAGbHrQgLKm+a/sRxmPUDgH3KKHOVj4utWp+UhnMJbulHheb4mjUcAwhmahRWa6\n' +
+ 'VOujw5H5SNz/0egwLX0tdHA114gk957EWW67c4cX8jJGKLhD+rcdqsq08p8kDi1L\n' +
+ '93FcXmn/6pUCyziKrlA4b9v7LWIbxcceVOF34GfID5yHI9Y/QCB/IIDEgEw+OyQm\n' +
+ 'jgSubJrIqg0CAwEAAaNCMEAwDwYDVR0TAQH/BAUwAwEB/zAOBgNVHQ8BAf8EBAMC\n' +
+ 'AYYwHQYDVR0OBBYEFIQYzIU07LwMlJQuCFmcx7IQTgoIMA0GCSqGSIb3DQEBCwUA\n' +
+ 'A4IBAQCY8jdaQZChGsV2USggNiMOruYou6r4lK5IpDB/G/wkjUu0yKGX9rbxenDI\n' +
+ 'U5PMCCjjmCXPI6T53iHTfIUJrU6adTrCC2qJeHZERxhlbI1Bjjt/msv0tadQ1wUs\n' +
+ 'N+gDS63pYaACbvXy8MWy7Vu33PqUXHeeE6V/Uq2V8viTO96LXFvKWlJbYK8U90vv\n' +
+ 'o/ufQJVtMVT8QtPHRh8jrdkPSHCa2XV4cdFyQzR1bldZwgJcJmApzyMZFo6IQ6XU\n' +
+ '5MsI+yMRQ+hDKXJioaldXgjUkK642M4UwtBV8ob2xJNDd2ZhwLnoQdeXeGADbkpy\n' +
+ 'rqXRfboQnoZsG4q5WTP468SQvvG5\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIFQTCCAymgAwIBAgITBmyf0pY1hp8KD+WGePhbJruKNzANBgkqhkiG9w0BAQwF\n' +
+ 'ADA5MQswCQYDVQQGEwJVUzEPMA0GA1UEChMGQW1hem9uMRkwFwYDVQQDExBBbWF6\n' +
+ 'b24gUm9vdCBDQSAyMB4XDTE1MDUyNjAwMDAwMFoXDTQwMDUyNjAwMDAwMFowOTEL\n' +
+ 'MAkGA1UEBhMCVVMxDzANBgNVBAoTBkFtYXpvbjEZMBcGA1UEAxMQQW1hem9uIFJv\n' +
+ 'b3QgQ0EgMjCCAiIwDQYJKoZIhvcNAQEBBQADggIPADCCAgoCggIBAK2Wny2cSkxK\n' +
+ 'gXlRmeyKy2tgURO8TW0G/LAIjd0ZEGrHJgw12MBvIITplLGbhQPDW9tK6Mj4kHbZ\n' +
+ 'W0/jTOgGNk3Mmqw9DJArktQGGWCsN0R5hYGCrVo34A3MnaZMUnbqQ523BNFQ9lXg\n' +
+ '1dKmSYXpN+nKfq5clU1Imj+uIFptiJXZNLhSGkOQsL9sBbm2eLfq0OQ6PBJTYv9K\n' +
+ '8nu+NQWpEjTj82R0Yiw9AElaKP4yRLuH3WUnAnE72kr3H9rN9yFVkE8P7K6C4Z9r\n' +
+ '2UXTu/Bfh+08LDmG2j/e7HJV63mjrdvdfLC6HM783k81ds8P+HgfajZRRidhW+me\n' +
+ 'z/CiVX18JYpvL7TFz4QuK/0NURBs+18bvBt+xa47mAExkv8LV/SasrlX6avvDXbR\n' +
+ '8O70zoan4G7ptGmh32n2M8ZpLpcTnqWHsFcQgTfJU7O7f/aS0ZzQGPSSbtqDT6Zj\n' +
+ 'mUyl+17vIWR6IF9sZIUVyzfpYgwLKhbcAS4y2j5L9Z469hdAlO+ekQiG+r5jqFoz\n' +
+ '7Mt0Q5X5bGlSNscpb/xVA1wf+5+9R+vnSUeVC06JIglJ4PVhHvG/LopyboBZ/1c6\n' +
+ '+XUyo05f7O0oYtlNc/LMgRdg7c3r3NunysV+Ar3yVAhU/bQtCSwXVEqY0VThUWcI\n' +
+ '0u1ufm8/0i2BWSlmy5A5lREedCf+3euvAgMBAAGjQjBAMA8GA1UdEwEB/wQFMAMB\n' +
+ 'Af8wDgYDVR0PAQH/BAQDAgGGMB0GA1UdDgQWBBSwDPBMMPQFWAJI/TPlUq9LhONm\n' +
+ 'UjANBgkqhkiG9w0BAQwFAAOCAgEAqqiAjw54o+Ci1M3m9Zh6O+oAA7CXDpO8Wqj2\n' +
+ 'LIxyh6mx/H9z/WNxeKWHWc8w4Q0QshNabYL1auaAn6AFC2jkR2vHat+2/XcycuUY\n' +
+ '+gn0oJMsXdKMdYV2ZZAMA3m3MSNjrXiDCYZohMr/+c8mmpJ5581LxedhpxfL86kS\n' +
+ 'k5Nrp+gvU5LEYFiwzAJRGFuFjWJZY7attN6a+yb3ACfAXVU3dJnJUH/jWS5E4ywl\n' +
+ '7uxMMne0nxrpS10gxdr9HIcWxkPo1LsmmkVwXqkLN1PiRnsn/eBG8om3zEK2yygm\n' +
+ 'btmlyTrIQRNg91CMFa6ybRoVGld45pIq2WWQgj9sAq+uEjonljYE1x2igGOpm/Hl\n' +
+ 'urR8FLBOybEfdF849lHqm/osohHUqS0nGkWxr7JOcQ3AWEbWaQbLU8uz/mtBzUF+\n' +
+ 'fUwPfHJ5elnNXkoOrJupmHN5fLT0zLm4BwyydFy4x2+IoZCn9Kr5v2c69BoVYh63\n' +
+ 'n749sSmvZ6ES8lgQGVMDMBu4Gon2nL2XA46jCfMdiyHxtN/kHNGfZQIG6lzWE7OE\n' +
+ '76KlXIx3KadowGuuQNKotOrN8I1LOJwZmhsoVLiJkO/KdYE+HvJkJMcYr07/R54H\n' +
+ '9jVlpNMKVv/1F2Rs76giJUmTtt8AF9pYfl3uxRuw0dFfIRDH+fO6AgonB8Xx1sfT\n' +
+ '4PsJYGw=\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIBtjCCAVugAwIBAgITBmyf1XSXNmY/Owua2eiedgPySjAKBggqhkjOPQQDAjA5\n' +
+ 'MQswCQYDVQQGEwJVUzEPMA0GA1UEChMGQW1hem9uMRkwFwYDVQQDExBBbWF6b24g\n' +
+ 'Um9vdCBDQSAzMB4XDTE1MDUyNjAwMDAwMFoXDTQwMDUyNjAwMDAwMFowOTELMAkG\n' +
+ 'A1UEBhMCVVMxDzANBgNVBAoTBkFtYXpvbjEZMBcGA1UEAxMQQW1hem9uIFJvb3Qg\n' +
+ 'Q0EgMzBZMBMGByqGSM49AgEGCCqGSM49AwEHA0IABCmXp8ZBf8ANm+gBG1bG8lKl\n' +
+ 'ui2yEujSLtf6ycXYqm0fc4E7O5hrOXwzpcVOho6AF2hiRVd9RFgdszflZwjrZt6j\n' +
+ 'QjBAMA8GA1UdEwEB/wQFMAMBAf8wDgYDVR0PAQH/BAQDAgGGMB0GA1UdDgQWBBSr\n' +
+ 'ttvXBp43rDCGB5Fwx5zEGbF4wDAKBggqhkjOPQQDAgNJADBGAiEA4IWSoxe3jfkr\n' +
+ 'BqWTrBqYaGFy+uGh0PsceGCmQ5nFuMQCIQCcAu/xlJyzlvnrxir4tiz+OpAUFteM\n' +
+ 'YyRIHN8wfdVoOw==\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIIB8jCCAXigAwIBAgITBmyf18G7EEwpQ+Vxe3ssyBrBDjAKBggqhkjOPQQDAzA5\n' +
+ 'MQswCQYDVQQGEwJVUzEPMA0GA1UEChMGQW1hem9uMRkwFwYDVQQDExBBbWF6b24g\n' +
+ 'Um9vdCBDQSA0MB4XDTE1MDUyNjAwMDAwMFoXDTQwMDUyNjAwMDAwMFowOTELMAkG\n' +
+ 'A1UEBhMCVVMxDzANBgNVBAoTBkFtYXpvbjEZMBcGA1UEAxMQQW1hem9uIFJvb3Qg\n' +
+ 'Q0EgNDB2MBAGByqGSM49AgEGBSuBBAAiA2IABNKrijdPo1MN/sGKe0uoe0ZLY7Bi\n' +
+ '9i0b2whxIdIA6GO9mif78DluXeo9pcmBqqNbIJhFXRbb/egQbeOc4OO9X4Ri83Bk\n' +
+ 'M6DLJC9wuoihKqB1+IGuYgbEgds5bimwHvouXKNCMEAwDwYDVR0TAQH/BAUwAwEB\n' +
+ '/zAOBgNVHQ8BAf8EBAMCAYYwHQYDVR0OBBYEFNPsxzplbszh2naaVvuc84ZtV+WB\n' +
+ 'MAoGCCqGSM49BAMDA2gAMGUCMDqLIfG9fhGt0O9Yli/W651+kI0rz2ZVwyzjKKlw\n' +
+ 'CkcO8DdZEv8tmZQoTipPNU0zWgIxAOp1AE47xDqUEpHJWEadIRNyp4iciuRMStuW\n' +
+ '1KyLa2tJElMzrdfkviT8tQp21KW8EA==\n' +
+ '-----END CERTIFICATE-----\n',
+ '-----BEGIN CERTIFICATE-----\n' +
+ 'MIID7zCCAtegAwIBAgIBADANBgkqhkiG9w0BAQsFADCBmDELMAkGA1UEBhMCVVMx\n' +
+ 'EDAOBgNVBAgTB0FyaXpvbmExEzARBgNVBAcTClNjb3R0c2RhbGUxJTAjBgNVBAoT\n' +
+ 'HFN0YXJmaWVsZCBUZWNobm9sb2dpZXMsIEluYy4xOzA5BgNVBAMTMlN0YXJmaWVs\n' +
+ 'ZCBTZXJ2aWNlcyBSb290IENlcnRpZmljYXRlIEF1dGhvcml0eSAtIEcyMB4XDTA5\n' +
+ 'MDkwMTAwMDAwMFoXDTM3MTIzMTIzNTk1OVowgZgxCzAJBgNVBAYTAlVTMRAwDgYD\n' +
+ 'VQQIEwdBcml6b25hMRMwEQYDVQQHEwpTY290dHNkYWxlMSUwIwYDVQQKExxTdGFy\n' +
+ 'ZmllbGQgVGVjaG5vbG9naWVzLCBJbmMuMTswOQYDVQQDEzJTdGFyZmllbGQgU2Vy\n' +
+ 'dmljZXMgUm9vdCBDZXJ0aWZpY2F0ZSBBdXRob3JpdHkgLSBHMjCCASIwDQYJKoZI\n' +
+ 'hvcNAQEBBQADggEPADCCAQoCggEBANUMOsQq+U7i9b4Zl1+OiFOxHz/Lz58gE20p\n' +
+ 'OsgPfTz3a3Y4Y9k2YKibXlwAgLIvWX/2h/klQ4bnaRtSmpDhcePYLQ1Ob/bISdm2\n' +
+ '8xpWriu2dBTrz/sm4xq6HZYuajtYlIlHVv8loJNwU4PahHQUw2eeBGg6345AWh1K\n' +
+ 'Ts9DkTvnVtYAcMtS7nt9rjrnvDH5RfbCYM8TWQIrgMw0R9+53pBlbQLPLJGmpufe\n' +
+ 'hRhJfGZOozptqbXuNC66DQO4M99H67FrjSXZm86B0UVGMpZwh94CDklDhbZsc7tk\n' +
+ '6mFBrMnUVN+HL8cisibMn1lUaJ/8viovxFUcdUBgF4UCVTmLfwUCAwEAAaNCMEAw\n' +
+ 'DwYDVR0TAQH/BAUwAwEB/zAOBgNVHQ8BAf8EBAMCAQYwHQYDVR0OBBYEFJxfAN+q\n' +
+ 'AdcwKziIorhtSpzyEZGDMA0GCSqGSIb3DQEBCwUAA4IBAQBLNqaEd2ndOxmfZyMI\n' +
+ 'bw5hyf2E3F/YNoHN2BtBLZ9g3ccaaNnRbobhiCPPE95Dz+I0swSdHynVv/heyNXB\n' +
+ 've6SbzJ08pGCL72CQnqtKrcgfU28elUSwhXqvfdqlS5sdJ/PHLTyxQGjhdByPq1z\n' +
+ 'qwubdQxtRbeOlKyWN7Wg0I8VRw7j6IPdj/3vQQF3zCepYoUz8jcI73HPdwbeyBkd\n' +
+ 'iEDPfUYd/x7H4c7/I9vG+o1VTqkC50cRRj70/b17KSa7qWFiNyi2LSr2EIZkyXCn\n' +
+ '0q23KXB56jzaYyWf/Wi3MOxw+3WKt21gZ7IeyLnp2KhvAotnDU0mV3HaIPzBSlCN\n' +
+ 'sSi6\n' +
+ '-----END CERTIFICATE-----\n',
+];
diff --git a/node_modules/aws-ssl-profiles/package.json b/node_modules/aws-ssl-profiles/package.json
new file mode 100644
index 0000000..0856ad9
--- /dev/null
+++ b/node_modules/aws-ssl-profiles/package.json
@@ -0,0 +1,52 @@
+{
+ "name": "aws-ssl-profiles",
+ "version": "1.1.2",
+ "main": "lib/index.js",
+ "author": "https://github.com/wellwelwel",
+ "description": "AWS RDS SSL certificates bundles.",
+ "license": "MIT",
+ "repository": {
+ "type": "git",
+ "url": "https://github.com/mysqljs/aws-ssl-profiles"
+ },
+ "bugs": {
+ "url": "https://github.com/mysqljs/aws-ssl-profiles/issues"
+ },
+ "devDependencies": {
+ "@biomejs/biome": "^1.8.3",
+ "@types/node": "^22.5.1",
+ "@types/x509.js": "^1.0.3",
+ "poku": "^2.5.0",
+ "prettier": "^3.3.3",
+ "tsx": "^4.19.0",
+ "typescript": "^5.5.4",
+ "x509.js": "^1.0.0"
+ },
+ "files": [
+ "lib"
+ ],
+ "engines": {
+ "node": ">= 6.0.0"
+ },
+ "keywords": [
+ "mysql",
+ "mysql2",
+ "pg",
+ "postgres",
+ "aws",
+ "rds",
+ "ssl",
+ "certificates",
+ "ca",
+ "bundle"
+ ],
+ "scripts": {
+ "build": "npx tsc",
+ "postbuild": "cp src/index.d.ts lib/index.d.ts",
+ "lint": "npx @biomejs/biome lint && prettier --check .",
+ "lint:fix": "npx @biomejs/biome lint --write . && prettier --write .",
+ "pretest": "npm run build",
+ "test": "poku --parallel ./test",
+ "test:ci": "npm run lint && npm run test"
+ }
+}
diff --git a/node_modules/bagpipe/.jshintrc b/node_modules/bagpipe/.jshintrc
new file mode 100644
index 0000000..ca14586
--- /dev/null
+++ b/node_modules/bagpipe/.jshintrc
@@ -0,0 +1,43 @@
+{
+ "predef": [
+ "document",
+ "module",
+ "require",
+ "__dirname",
+ "process",
+ "console",
+ "it",
+ "xit",
+ "describe",
+ "xdescribe",
+ "before",
+ "beforeEach",
+ "after",
+ "afterEach"
+ ],
+ "node": true,
+ "es5": true,
+ "bitwise": true,
+ "curly": true,
+ "eqeqeq": true,
+ "forin": false,
+ "immed": true,
+ "latedef": true,
+ "newcap": true,
+ "noarg": true,
+ "noempty": true,
+ "nonew": true,
+ "plusplus": false,
+ "undef": true,
+ "strict": false,
+ "trailing": false,
+ "globalstrict": true,
+ "nonstandard": true,
+ "white": true,
+ "indent": 2,
+ "expr": true,
+ "multistr": true,
+ "onevar": false,
+ "unused": "vars",
+ "swindent": false
+}
diff --git a/node_modules/bagpipe/.npmignore b/node_modules/bagpipe/.npmignore
new file mode 100644
index 0000000..ecf9d89
--- /dev/null
+++ b/node_modules/bagpipe/.npmignore
@@ -0,0 +1,16 @@
+lib-cov
+*.seed
+*.log
+*.csv
+*.dat
+*.out
+*.pid
+*.gz
+
+pids
+logs
+results
+
+node_modules
+npm-debug.log
+coverage.html
diff --git a/node_modules/bagpipe/.travis.yml b/node_modules/bagpipe/.travis.yml
new file mode 100644
index 0000000..cc4dba2
--- /dev/null
+++ b/node_modules/bagpipe/.travis.yml
@@ -0,0 +1,4 @@
+language: node_js
+node_js:
+ - "0.8"
+ - "0.10"
diff --git a/node_modules/bagpipe/MIT-License b/node_modules/bagpipe/MIT-License
new file mode 100644
index 0000000..bd54ce4
--- /dev/null
+++ b/node_modules/bagpipe/MIT-License
@@ -0,0 +1,23 @@
+Copyright (c) 2012 Jackson Tian
+http://weibo.com/shyvo
+
+The MIT License
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+"Software"), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND
+NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE
+LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION
+OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION
+WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/node_modules/bagpipe/Makefile b/node_modules/bagpipe/Makefile
new file mode 100644
index 0000000..c3e31b7
--- /dev/null
+++ b/node_modules/bagpipe/Makefile
@@ -0,0 +1,23 @@
+TESTS = test/*.test.js
+REPORTER = spec
+TIMEOUT = 2000
+JSCOVERAGE = ./node_modules/.bin/jscover
+
+test:
+ @NODE_ENV=test ./node_modules/mocha/bin/mocha \
+ --reporter $(REPORTER) \
+ --timeout $(TIMEOUT) \
+ $(MOCHA_OPTS) \
+ $(TESTS)
+
+test-cov:
+ @$(MAKE) test REPORTER=dot
+ @$(MAKE) test MOCHA_OPTS='--require blanket' REPORTER=html-cov > coverage.html
+ @$(MAKE) test MOCHA_OPTS='--require blanket' REPORTER=travis-cov
+
+test-all: test test-cov
+
+clean:
+ @rm -rf node_modules
+
+.PHONY: test test-cov test-all clean
diff --git a/node_modules/bagpipe/README.md b/node_modules/bagpipe/README.md
new file mode 100644
index 0000000..5e96237
--- /dev/null
+++ b/node_modules/bagpipe/README.md
@@ -0,0 +1,107 @@
+Bagpipe [中文](https://github.com/JacksonTian/bagpipe/blob/master/README_CN.md)
+=======
+You are the bagpiper.
+
+## Introduction
+It is convenient for us to use asynchronism or concurrent to promote our business speed in Node. While, if the amount of concurrent is too large, our server may not support, such that we need to limit the amount of concurrent. Though, the http module contains [http.Agent](http://nodejs.org/docs/latest/api/http.html#http_class_http_agent) to control the amount of sockets, usually, our asynchronous API has packaged in advance. It is not realistic to change the inner API agent, let’s realize it on our own logical layer.
+
+## Installation
+```
+npm install bagpipe
+```
+
+## API
+The APIs exposed by Bagpipe only include constructor and instance methods `push`.
+
+Under original status, we may execute concurrent like this, forming 100 concurrent asynchronous invokes.
+
+```
+for (var i = 0; i < 100; i++) {
+ async(function () {
+ // Asynchronous call
+ });
+}
+```
+If need to limit concurrency, what is your solution?
+Solution from Bagpipe as follows:
+
+```
+var Bagpipe = require('bagpipe');
+// Sets the max concurrency as 100
+var bagpipe = new Bagpipe(10);
+for (var i = 0; i < 100; i++) {
+ bagpipe.push(async, function () {
+ // execute asynchronous callback
+ });
+}
+```
+
+Yes, invoke method only splits method、parameter and callback, then delivery it to bagpipe through `push`.
+
+How does it like compared with your anticipated solution?
+
+### Options
+
+- `refuse`, when queue is fulled, bagpipe will refuse the new async call and execute the callback with a `TooMuchAsyncCallError` exception. default `false`.
+- `timeout`, setting global ansyn call timeout. If async call doesn't complete in time, will execute the callback with `BagpipeTimeoutError` exception. default `null`.
+
+## Principles
+Bagpipe delivers invoke into inner queue through `push`. If active invoke amount is less than max concurrent, it will be popped and executed directly, or it will stay in the queue. When an asynchronous invoke ends, a invoke in the head of the queue will be popped and executed, such that assures active asynchronous invoke amount no larger than restricted value.
+
+When the queue length is larger than 1, Bagpipe object will fire its `full` event, which delivers the queue length value. The value helps to assess business performance. For example:
+
+```
+bagpipe.on('full', function (length) {
+ console.warn('Button system cannot deal on time, queue jam, current queue length is:’+ length);
+});
+```
+
+If queue length more than limit, you can set the `refuse` option to decide continue in queue or refuse call. The `refuse` default `false`. If set as `true`, the `TooMuchAsyncCallError` exception will pass to callback directly:
+
+```
+var bagpipe = new BagPipe(10, {
+ refuse: true
+});
+```
+
+If complete the async call is unexpected, the queue will not balanced. Set the timeout, let the callback executed with the `BagpipeTimeoutError` exception:
+
+```
+var bagpipe = new BagPipe(10, {
+ timeout: 1000
+});
+```
+
+## Module status
+The unit testing status: [](http://travis-ci.org/JacksonTian/bagpipe). Unit test coverage [100%](http://html5ify.com/bagpipe/coverage.html).
+
+## Best Practices
+- Ensure that the last parameter of the asynchronous invoke is callback.
+- Listen to the `full` event, adding your business performance assessment.
+- Current asynchronous method has not supported context yet. Ensure that there is no `this` reference in asynchronous method. If there is `this` reference in asynchronous method, please use `bind` pass into correct context.
+- Asynchronous invoke should process method to deal with timeout, it should ensure the invoke will return in a certain time no matter whether the business has been finished or not.
+
+## Real case
+When you want to traverse file directories, asynchrony can ensure `full` use of IO. You can invoke thousands of file reading easily. But, system file descriptors are limited. If disobedient, read this article again when occurring errors as follows.
+
+```
+Error: EMFILE, too many open files
+```
+
+Someone may consider dealing it with synchronous method. But, when synchronous, CPU and IO cannot be used concurrently, performance is an indefeasible index under certain condition. You can enjoy concurrent easily, as well as limit concurrent with Bagpipe.
+
+```
+var bagpipe = new Bagpipe(10);
+
+var files = ['Here are many files'];
+for (var i = 0; i < files.length; i++) {
+ // fs.readFile(files[i], 'utf-8', function (err, data) {
+ bagpipe.push(fs.readFile, files[i], 'utf-8', function (err, data) {
+ // won’t occur error because of too many file descriptors
+ // well done
+ });
+}
+```
+
+## License
+Released under the license of [MIT](https://github.com/JacksonTian/bagpipe/blob/master/MIT-License), welcome to enjoy open source.
diff --git a/node_modules/bagpipe/README_CN.md b/node_modules/bagpipe/README_CN.md
new file mode 100644
index 0000000..844490c
--- /dev/null
+++ b/node_modules/bagpipe/README_CN.md
@@ -0,0 +1,107 @@
+Bagpipe(风笛) [English](https://github.com/JacksonTian/bagpipe/blob/master/README.md)
+=======
+You are the bagpiper.
+
+## 起源
+在Node中我们可以十分方便利用异步和并行来提升我们的业务速度。但是，如果并发量过大，我们的服务器却可能吃不消，我们需要限制并发量。尽管`http`模块自身有[http.Agent](http://nodejs.org/docs/latest/api/http.html#http_class_http_agent)这样的玩意，用于控制socket的数量，但是通常我们的异步API早就封装好了。改动API的内部agent是不现实的，那么我们自己在逻辑层实现吧。
+
+## 安装
+```
+npm install bagpipe
+```
+
+## API
+`Bagpipe`暴露的API只有构造器和实例方法`push`。
+
+在原始状态下，我们执行并发可能是如下这样的，这会形成100个并发异步调用。
+
+```
+for (var i = 0; i < 100; i++) {
+ async(function () {
+ // 异步调用
+ });
+}
+```
+如果需要限制并发，你的方案会是怎样？
+
+`Bagpipe`的方案是如下这样的：
+
+```
+var Bagpipe = require('bagpipe');
+// 设定最大并发数为10
+var bagpipe = new Bagpipe(10);
+for (var i = 0; i < 100; i++) {
+ bagpipe.push(async, function () {
+ // 异步回调执行
+ });
+}
+```
+
+是的，调用方式仅仅是将方法、参数、回调分拆一下通过`push`交给`bagpipe`即可。
+
+这个方案与你预想的方案相比，如何？
+
+### 选项
+
+- `refuse`，当队列填满时，拒绝新到来的异步调用。执行异步调用的回调函数，传递一个`TooMuchAsyncCallError`异常。默认为`false`。
+- `timeout`，设置全局异步调用超时时间，经过`push`后执行的异步调用，如果在超时时间内没有返回执行，将会执行异步调用的回调函数，传递一个`BagpipeTimeoutError`异常。默认为`null`不开启。
+
+## 原理
+`Bagpipe`通过`push`将调用传入内部队列。如果活跃调用小于最大并发数，将会被取出直接执行，反之则继续呆在队列中。当一个异步调用结束的时候，会从队列前取出调用执行。以此来保证异步调用的活跃量不高于限定值。
+当队列的长度大于1时，Bagpipe对象将会触发它的`full`事件，该事件传递队列长度值。该值有助于评估业务性能参数。示例如下：
+
+```
+bagpipe.on('full', function (length) {
+ console.warn('底层系统处理不能及时完成，排队中，目前队列长度为:' + length);
+});
+```
+
+如果队列的长度也超过限制值，这里可以通过`refuse`选项控制，是直接传递异常拒绝服务还是继续排队。默认情况`refuse`为`false`。如果设置为`true`，新的异步调用将会得到`TooMuchAsyncCallError`异常，而被拒绝服务。
+
+```
+var bagpipe = new BagPipe(10, {
+ refuse: true
+});
+```
+
+如果异步调用的超时不可预期，可能存在等待队列不均衡的情况，为此可以全局设置一个超时时间，对于过长的响应时间，提前返回超时状态。
+
+```
+var bagpipe = new BagPipe(10, {
+ timeout: 1000
+});
+```
+
+## 模块状态
+单元测试通过状态：[](http://travis-ci.org/JacksonTian/bagpipe)。单元测试覆盖率[100%](http://html5ify.com/bagpipe/coverage.html)。
+
+## 最佳实践
+- 确保异步调用的最后一个参数为回调参数
+- 监听`full`事件，以增加你对业务性能的评估
+- 目前异步方法未支持上下文。确保异步方法内部没有`this`引用。如果存在`this`引用，请用`bind`方法传递正确的`this`上下文
+- 异步调用应当具备timeout的业务处理，无论业务是否完成，总在一定的时间内保证返回
+
+## 实际案例
+当你需要遍历文件目录的时候，异步可以确保充分利用IO。你可以轻松发起成千上万个文件的读取。但是，系统文件描述符是有限的。不服的话，遇见下面这个错误再来重读此文。
+
+```
+Error: EMFILE, too many open files
+```
+也有人会考虑用同步方法来进行处理。但是，同步时，CPU与IO并不能并行利用，一定情况下，性能是不可弃的一项指标。用上`Bagpipe`，可以轻松享受并发，也能限制并发。
+
+```
+var bagpipe = new Bagpipe(10);
+
+var files = ['这里有很多很多文件'];
+for (var i = 0; i < files.length; i++) {
+ // fs.readFile(files[i], 'utf-8', function (err, data) {
+ bagpipe.push(fs.readFile, files[i], 'utf-8', function (err, data) {
+ // 不会因为文件描述符过多出错
+ // 妥妥的
+ });
+}
+```
+
+## License
+在[MIT](https://github.com/JacksonTian/bagpipe/blob/master/MIT-License)许可证下发布，欢迎享受开源
+
diff --git a/node_modules/bagpipe/index.js b/node_modules/bagpipe/index.js
new file mode 100644
index 0000000..ed9eddd
--- /dev/null
+++ b/node_modules/bagpipe/index.js
@@ -0,0 +1 @@
+module.exports = require('./lib/bagpipe');
diff --git a/node_modules/bagpipe/lib/bagpipe.js b/node_modules/bagpipe/lib/bagpipe.js
new file mode 100644
index 0000000..4988b6c
--- /dev/null
+++ b/node_modules/bagpipe/lib/bagpipe.js
@@ -0,0 +1,151 @@
+var util = require("util");
+var events = require("events");
+
+/**
+ * 构造器，传入限流值，设置异步调用最大并发数
+ * Examples:
+ * ```
+ * var bagpipe = new Bagpipe(100);
+ * bagpipe.push(fs.readFile, 'path', 'utf-8', function (err, data) {
+ * // TODO
+ * });
+ * ```
+ * Events:
+ * - `full`, 当活动异步达到限制值时，后续异步调用将被暂存于队列中。当队列的长度大于限制值的2倍或100的时候时候，触发`full`事件。事件传递队列长度值。
+ * - `outdated`, 超时后的异步调用异常返回。
+ * Options:
+ * - `disabled`, 禁用限流，测试时用
+ * - `refuse`, 拒绝模式，排队超过限制值时，新来的调用将会得到`TooMuchAsyncCallError`异常
+ * - `timeout`, 设置异步调用的时间上线，保证异步调用能够恒定的结束，不至于花费太长时间
+ * @param {Number} limit 并发数限制值
+ * @param {Object} options Options
+ */
+var Bagpipe = function (limit, options) {
+ events.EventEmitter.call(this);
+ this.limit = limit;
+ this.active = 0;
+ this.queue = [];
+ this.options = {
+ disabled: false,
+ refuse: false,
+ ratio: 1,
+ timeout: null
+ };
+ if (typeof options === 'boolean') {
+ options = {
+ disabled: options
+ };
+ }
+ options = options || {};
+ for (var key in this.options) {
+ if (options.hasOwnProperty(key)) {
+ this.options[key] = options[key];
+ }
+ }
+ // queue length
+ this.queueLength = Math.round(this.limit * (this.options.ratio || 1));
+};
+util.inherits(Bagpipe, events.EventEmitter);
+
+/**
+ * 推入方法，参数。最后一个参数为回调函数
+ * @param {Function} method 异步方法
+ * @param {Mix} args 参数列表，最后一个参数为回调函数。
+ */
+Bagpipe.prototype.push = function (method) {
+ var args = [].slice.call(arguments, 1);
+ var callback = args[args.length - 1];
+ if (typeof callback !== 'function') {
+ args.push(function () {});
+ }
+ if (this.options.disabled || this.limit < 1) {
+ method.apply(null, args);
+ return this;
+ }
+
+ // 队列长度也超过限制值时
+ if (this.queue.length < this.queueLength || !this.options.refuse) {
+ this.queue.push({
+ method: method,
+ args: args
+ });
+ } else {
+ var err = new Error('Too much async call in queue');
+ err.name = 'TooMuchAsyncCallError';
+ callback(err);
+ }
+
+ if (this.queue.length > 1) {
+ this.emit('full', this.queue.length);
+ }
+
+ this.next();
+ return this;
+};
+
+/*!
+ * 继续执行队列中的后续动作
+ */
+Bagpipe.prototype.next = function () {
+ var that = this;
+ if (that.active < that.limit && that.queue.length) {
+ var req = that.queue.shift();
+ that.run(req.method, req.args);
+ }
+};
+
+Bagpipe.prototype._next = function () {
+ this.active--;
+ this.next();
+};
+
+/*!
+ * 执行队列中的方法
+ */
+Bagpipe.prototype.run = function (method, args) {
+ var that = this;
+ that.active++;
+ var callback = args[args.length - 1];
+ var timer = null;
+ var called = false;
+
+ // inject logic
+ args[args.length - 1] = function (err) {
+ // anyway, clear the timer
+ if (timer) {
+ clearTimeout(timer);
+ timer = null;
+ }
+ // if timeout, don't execute
+ if (!called) {
+ that._next();
+ callback.apply(null, arguments);
+ } else {
+ // pass the outdated error
+ if (err) {
+ that.emit('outdated', err);
+ }
+ }
+ };
+
+ var timeout = that.options.timeout;
+ if (timeout) {
+ timer = setTimeout(function () {
+ // set called as true
+ called = true;
+ that._next();
+ // pass the exception
+ var err = new Error(timeout + 'ms timeout');
+ err.name = 'BagpipeTimeoutError';
+ err.data = {
+ name: method.name,
+ method: method.toString(),
+ args: args.slice(0, -1)
+ };
+ callback(err);
+ }, timeout);
+ }
+ method.apply(null, args);
+};
+
+module.exports = Bagpipe;
diff --git a/node_modules/bagpipe/package.json b/node_modules/bagpipe/package.json
new file mode 100644
index 0000000..5cbf2bd
--- /dev/null
+++ b/node_modules/bagpipe/package.json
@@ -0,0 +1,42 @@
+{
+ "name": "bagpipe",
+ "version": "0.3.5",
+ "description": "Concurrency limit",
+ "keywords": [
+ "limiter",
+ "concurrency limit",
+ "parallel limit"
+ ],
+ "main": "index.js",
+ "scripts": {
+ "test": "make test-all",
+ "blanket": {
+ "pattern": "bagpipe/lib"
+ },
+ "travis-cov": {
+ "threshold": 99
+ }
+ },
+ "author": "Jackson Tian",
+ "license": "MIT",
+ "readmeFilename": "README.md",
+ "gitHead": "75269c60fdbb897be14575e70a2b86cf43999500",
+ "directories": {
+ "doc": "doc",
+ "test": "test"
+ },
+ "devDependencies": {
+ "pedding": "*",
+ "should": "*",
+ "blanket": "*",
+ "mocha": "*",
+ "travis-cov": "*"
+ },
+ "repository": {
+ "type": "git",
+ "url": "git://github.com/JacksonTian/bagpipe.git"
+ },
+ "bugs": {
+ "url": "https://github.com/JacksonTian/bagpipe/issues"
+ }
+}
diff --git a/node_modules/bagpipe/test/bagpipe.test.js b/node_modules/bagpipe/test/bagpipe.test.js
new file mode 100644
index 0000000..e4773cd
--- /dev/null
+++ b/node_modules/bagpipe/test/bagpipe.test.js
@@ -0,0 +1,248 @@
+var should = require('should');
+var pedding = require('pedding');
+var Bagpipe = require('../');
+
+describe('bagpipe', function () {
+ var async = function (ms, callback) {
+ setTimeout(function () {
+ callback(null, {});
+ }, ms);
+ };
+
+ it('constructor', function () {
+ var bagpipe = new Bagpipe(10);
+ bagpipe.limit.should.be.equal(10);
+ bagpipe.queue.should.have.length(0);
+ bagpipe.active.should.be.equal(0);
+ bagpipe.options.disabled.should.be.equal(false);
+ });
+
+ it('constructor disabled', function () {
+ var bagpipe = new Bagpipe(10, true);
+ bagpipe.limit.should.be.equal(10);
+ bagpipe.queue.should.have.length(0);
+ bagpipe.active.should.be.equal(0);
+ bagpipe.options.disabled.should.be.equal(true);
+ });
+
+ it('constructor limit less than 1', function (done) {
+ var bagpipe = new Bagpipe(0);
+ bagpipe.push(async, 10, function () {
+ bagpipe.active.should.be.equal(0);
+ done();
+ });
+ bagpipe.active.should.be.equal(0);
+ });
+
+ it('constructor limit less than 1 for nextTick', function (done) {
+ var bagpipe = new Bagpipe(0);
+ bagpipe.push(process.nextTick, function () {
+ bagpipe.active.should.be.equal(0);
+ done();
+ });
+ bagpipe.active.should.be.equal(0);
+ });
+
+ it('constructor disabled is true', function (done) {
+ var bagpipe = new Bagpipe(10, true);
+ bagpipe.push(async, 10, function () {
+ bagpipe.active.should.be.equal(0);
+ done();
+ });
+ bagpipe.active.should.be.equal(0);
+ });
+
+ it('push', function (done) {
+ var bagpipe = new Bagpipe(5);
+ bagpipe.limit.should.be.equal(5);
+ bagpipe.queue.should.have.length(0);
+ bagpipe.active.should.be.equal(0);
+ bagpipe.push(async, 10, function () {
+ bagpipe.active.should.be.equal(0);
+ done();
+ });
+ bagpipe.active.should.be.equal(1);
+ });
+
+ it('push, async with this', function (done) {
+ var bagpipe = new Bagpipe(5);
+ bagpipe.limit.should.be.equal(5);
+ bagpipe.queue.should.have.length(0);
+ bagpipe.active.should.be.equal(0);
+ var context = {value: 10};
+ context.async = function (callback) {
+ this.value--;
+ var that = this;
+ process.nextTick(function() {
+ callback(that.value);
+ });
+ };
+
+ bagpipe.push(context.async.bind(context), function () {
+ bagpipe.active.should.be.equal(0);
+ done();
+ });
+ bagpipe.active.should.be.equal(1);
+ });
+
+ it('push, active should not be above limit', function (done) {
+ var limit = 5;
+ var bagpipe = new Bagpipe(limit);
+ bagpipe.limit.should.be.equal(limit);
+ bagpipe.queue.should.have.length(0);
+ bagpipe.active.should.be.equal(0);
+ var counter = 10;
+ for (var i = 0; i < counter; i++) {
+ bagpipe.push(async, 1 + Math.round(Math.random() * 10), function () {
+ bagpipe.active.should.not.be.above(limit);
+ counter--;
+ if (counter === 0) {
+ done();
+ }
+ });
+ bagpipe.active.should.not.be.above(limit);
+ }
+ });
+
+ it('push, disabled, active should not be above limit', function (done) {
+ var limit = 5;
+ var bagpipe = new Bagpipe(limit, true);
+ bagpipe.limit.should.be.equal(limit);
+ bagpipe.queue.should.have.length(0);
+ bagpipe.active.should.be.equal(0);
+ var counter = 10;
+ for (var i = 0; i < counter; i++) {
+ bagpipe.push(async, 10 + Math.round(Math.random() * 10), function () {
+ bagpipe.active.should.be.equal(0);
+ counter--;
+ if (counter === 0) {
+ done();
+ }
+ });
+ bagpipe.active.should.be.equal(0);
+ }
+ });
+
+ it('full event should fired when above limit', function (done) {
+ var limit = 5;
+ var bagpipe = new Bagpipe(limit);
+ bagpipe.limit.should.be.equal(limit);
+ bagpipe.queue.should.have.length(0);
+ bagpipe.active.should.be.equal(0);
+ var counter = 0;
+ bagpipe.on('full', function (length) {
+ length.should.above(1);
+ counter++;
+ });
+
+ var noop = function () {};
+ for (var i = 0; i < 100; i++) {
+ bagpipe.push(async, 10, noop);
+ }
+ counter.should.above(0);
+ done();
+ });
+
+ it('should support without callback', function (done) {
+ var limit = 5;
+ var bagpipe = new Bagpipe(limit);
+ bagpipe.limit.should.be.equal(limit);
+ bagpipe.queue.should.have.length(0);
+ bagpipe.active.should.be.equal(0);
+ bagpipe.push(async, 10);
+ bagpipe.active.should.be.equal(1);
+ done();
+ });
+
+ it('should get TooMuchAsyncCallError', function (done) {
+ done = pedding(5, done);
+ var limit = 2;
+ var bagpipe = new Bagpipe(limit, {
+ refuse: true
+ });
+ bagpipe.limit.should.be.equal(limit);
+ bagpipe.queue.should.have.length(0);
+ bagpipe.active.should.be.equal(0);
+ for (var i = 0; i < 4; i++) {
+ bagpipe.push(async, 10, function (err) {
+ should.not.exist(err);
+ done();
+ });
+ }
+ bagpipe.push(async, 10, function (err) {
+ should.exist(err);
+ done();
+ });
+ bagpipe.active.should.be.equal(2);
+ });
+
+ it('should get TooMuchAsyncCallError with ratio', function (done) {
+ done = pedding(7, done);
+ var limit = 2;
+ var bagpipe = new Bagpipe(limit, {
+ refuse: true,
+ ratio: 2
+ });
+ bagpipe.limit.should.be.equal(limit);
+ bagpipe.queue.should.have.length(0);
+ bagpipe.active.should.be.equal(0);
+ for (var i = 0; i < 2; i++) {
+ bagpipe.push(async, 10, function (err) {
+ should.not.exist(err);
+ done();
+ });
+ }
+ bagpipe.queue.should.have.length(0);
+ for (i = 0; i < 4; i++) {
+ bagpipe.push(async, 10, function (err) {
+ should.not.exist(err);
+ done();
+ });
+ }
+ bagpipe.queue.should.have.length(4);
+ bagpipe.push(async, 10, function (err) {
+ should.exist(err);
+ done();
+ });
+ bagpipe.active.should.be.equal(2);
+ bagpipe.queue.should.have.length(4);
+ });
+
+ it('should get BagpipeTimeoutError', function (done) {
+ done = pedding(3, done);
+ var _async = function _async(ms, callback) {
+ setTimeout(function () {
+ callback(null, {ms: ms});
+ }, ms);
+ };
+ var _async2 = function _async(ms, callback) {
+ setTimeout(function () {
+ callback(new Error('Timeout'));
+ }, ms);
+ };
+ var bagpipe = new Bagpipe(10, {
+ timeout: 10
+ });
+ bagpipe.on('outdated', function (err) {
+ should.exist(err);
+ done();
+ });
+
+ bagpipe.push(_async, 5, function (err, data) {
+ should.not.exist(err);
+ should.exist(data);
+ data.should.have.property('ms', 5);
+ done();
+ });
+
+ bagpipe.push(_async2, 15, function (err) {
+ should.exist(err);
+ err.name.should.eql('BagpipeTimeoutError');
+ err.message.should.eql('10ms timeout');
+ err.data.should.have.property('name', '_async');
+ err.data.should.have.property('method');
+ err.data.args.should.eql([15]);
+ done();
+ });
+ });
+});
diff --git a/node_modules/bcryptjs/.npmignore b/node_modules/bcryptjs/.npmignore
new file mode 100644
index 0000000..e14a574
--- /dev/null
+++ b/node_modules/bcryptjs/.npmignore
@@ -0,0 +1,6 @@
+node_modules/
+npm-debug.log
+debug.log
+doco/
+tests/bench.js
+*.png
diff --git a/node_modules/bcryptjs/.travis.yml b/node_modules/bcryptjs/.travis.yml
new file mode 100644
index 0000000..e2ed92d
--- /dev/null
+++ b/node_modules/bcryptjs/.travis.yml
@@ -0,0 +1,18 @@
+language: node_js
+
+node_js:
+ - 0.10
+ - 0.12
+ - 4
+ - 6
+
+before_script: npm -g install testjs
+
+env:
+ - CXX=g++-4.8
+addons:
+ apt:
+ sources:
+ - ubuntu-toolchain-r-test
+ packages:
+ - g++-4.8
diff --git a/node_modules/bcryptjs/.vscode/settings.json b/node_modules/bcryptjs/.vscode/settings.json
new file mode 100644
index 0000000..0c4a669
--- /dev/null
+++ b/node_modules/bcryptjs/.vscode/settings.json
@@ -0,0 +1,3 @@
+{
+ "vsicons.presets.angular": false
+}
\ No newline at end of file
diff --git a/node_modules/bcryptjs/LICENSE b/node_modules/bcryptjs/LICENSE
new file mode 100644
index 0000000..3f6395f
--- /dev/null
+++ b/node_modules/bcryptjs/LICENSE
@@ -0,0 +1,50 @@
+bcrypt.js
+---------
+Copyright (c) 2012 Nevins Bartolomeo
+Copyright (c) 2012 Shane Girish
+Copyright (c) 2014 Daniel Wirtz
+
+Redistribution and use in source and binary forms, with or without
+modification, are permitted provided that the following conditions
+are met:
+1. Redistributions of source code must retain the above copyright
+ notice, this list of conditions and the following disclaimer.
+2. Redistributions in binary form must reproduce the above copyright
+ notice, this list of conditions and the following disclaimer in the
+ documentation and/or other materials provided with the distribution.
+3. The name of the author may not be used to endorse or promote products
+ derived from this software without specific prior written permission.
+
+THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR
+IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES
+OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED.
+IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT,
+INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT
+NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE,
+DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY
+THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT
+(INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF
+THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
+
+isaac.js
+--------
+Copyright (c) 2012 Yves-Marie K. Rinquin
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+"Software"), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND
+NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE
+LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION
+OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION
+WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/node_modules/bcryptjs/README.md b/node_modules/bcryptjs/README.md
new file mode 100644
index 0000000..3fd7517
--- /dev/null
+++ b/node_modules/bcryptjs/README.md
@@ -0,0 +1,251 @@
+bcrypt.js
+=========
+Optimized bcrypt in JavaScript with zero dependencies. Compatible to the C++ [bcrypt](https://npmjs.org/package/bcrypt)
+binding on node.js and also working in the browser.
+
+
+ Copyright (c) 2012 Shane Girish
+ Copyright (c) 2014 Daniel Wirtz
+
+ Redistribution and use in source and binary forms, with or without
+ modification, are permitted provided that the following conditions
+ are met:
+ 1. Redistributions of source code must retain the above copyright
+ notice, this list of conditions and the following disclaimer.
+ 2. Redistributions in binary form must reproduce the above copyright
+ notice, this list of conditions and the following disclaimer in the
+ documentation and/or other materials provided with the distribution.
+ 3. The name of the author may not be used to endorse or promote products
+ derived from this software without specific prior written permission.
+
+ THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR
+ IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES
+ OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED.
+ IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT,
+ INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT
+ NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE,
+ DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY
+ THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT
+ (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF
+ THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
+ */
+
+/**
+ * @license bcrypt.js (c) 2013 Daniel Wirtz
+ * Released under the Apache License, Version 2.0
+ * see: https://github.com/dcodeIO/bcrypt.js for details
+ */
+(function(global, factory) {
+
+ /* AMD */ if (typeof define === 'function' && define["amd"])
+ define([], factory);
+ /* CommonJS */ else if (typeof require === 'function' && typeof module === "object" && module && module["exports"])
+ module["exports"] = factory();
+ /* Global */ else
+ (global["dcodeIO"] = global["dcodeIO"] || {})["bcrypt"] = factory();
+
+}(this, function() {
+ "use strict";
+
+ /**
+ * bcrypt namespace.
+ * @type {Object.}
+ */
+ var bcrypt = {};
+
+ /**
+ * The random implementation to use as a fallback.
+ * @type {?function(number):!Array.}
+ * @inner
+ */
+ var randomFallback = null;
+
+ /**
+ * Generates cryptographically secure random bytes.
+ * @function
+ * @param {number} len Bytes length
+ * @returns {!Array.} Random bytes
+ * @throws {Error} If no random implementation is available
+ * @inner
+ */
+ function random(len) {
+ /* node */ if (typeof module !== 'undefined' && module && module['exports'])
+ try {
+ return require("crypto")['randomBytes'](len);
+ } catch (e) {}
+ /* WCA */ try {
+ var a; (self['crypto']||self['msCrypto'])['getRandomValues'](a = new Uint32Array(len));
+ return Array.prototype.slice.call(a);
+ } catch (e) {}
+ /* fallback */ if (!randomFallback)
+ throw Error("Neither WebCryptoAPI nor a crypto module is available. Use bcrypt.setRandomFallback to set an alternative");
+ return randomFallback(len);
+ }
+
+ // Test if any secure randomness source is available
+ var randomAvailable = false;
+ try {
+ random(1);
+ randomAvailable = true;
+ } catch (e) {}
+
+ // Default fallback, if any
+ randomFallback = null;
+ /**
+ * Sets the pseudo random number generator to use as a fallback if neither node's `crypto` module nor the Web Crypto
+ * API is available. Please note: It is highly important that the PRNG used is cryptographically secure and that it
+ * is seeded properly!
+ * @param {?function(number):!Array.} random Function taking the number of bytes to generate as its
+ * sole argument, returning the corresponding array of cryptographically secure random byte values.
+ * @see http://nodejs.org/api/crypto.html
+ * @see http://www.w3.org/TR/WebCryptoAPI/
+ */
+ bcrypt.setRandomFallback = function(random) {
+ randomFallback = random;
+ };
+
+ /**
+ * Synchronously generates a salt.
+ * @param {number=} rounds Number of rounds to use, defaults to 10 if omitted
+ * @param {number=} seed_length Not supported.
+ * @returns {string} Resulting salt
+ * @throws {Error} If a random fallback is required but not set
+ * @expose
+ */
+ bcrypt.genSaltSync = function(rounds, seed_length) {
+ rounds = rounds || GENSALT_DEFAULT_LOG2_ROUNDS;
+ if (typeof rounds !== 'number')
+ throw Error("Illegal arguments: "+(typeof rounds)+", "+(typeof seed_length));
+ if (rounds < 4)
+ rounds = 4;
+ else if (rounds > 31)
+ rounds = 31;
+ var salt = [];
+ salt.push("$2a$");
+ if (rounds < 10)
+ salt.push("0");
+ salt.push(rounds.toString());
+ salt.push('$');
+ salt.push(base64_encode(random(BCRYPT_SALT_LEN), BCRYPT_SALT_LEN)); // May throw
+ return salt.join('');
+ };
+
+ /**
+ * Asynchronously generates a salt.
+ * @param {(number|function(Error, string=))=} rounds Number of rounds to use, defaults to 10 if omitted
+ * @param {(number|function(Error, string=))=} seed_length Not supported.
+ * @param {function(Error, string=)=} callback Callback receiving the error, if any, and the resulting salt
+ * @returns {!Promise} If `callback` has been omitted
+ * @throws {Error} If `callback` is present but not a function
+ * @expose
+ */
+ bcrypt.genSalt = function(rounds, seed_length, callback) {
+ if (typeof seed_length === 'function')
+ callback = seed_length,
+ seed_length = undefined; // Not supported.
+ if (typeof rounds === 'function')
+ callback = rounds,
+ rounds = undefined;
+ if (typeof rounds === 'undefined')
+ rounds = GENSALT_DEFAULT_LOG2_ROUNDS;
+ else if (typeof rounds !== 'number')
+ throw Error("illegal arguments: "+(typeof rounds));
+
+ function _async(callback) {
+ nextTick(function() { // Pretty thin, but salting is fast enough
+ try {
+ callback(null, bcrypt.genSaltSync(rounds));
+ } catch (err) {
+ callback(err);
+ }
+ });
+ }
+
+ if (callback) {
+ if (typeof callback !== 'function')
+ throw Error("Illegal callback: "+typeof(callback));
+ _async(callback);
+ } else
+ return new Promise(function(resolve, reject) {
+ _async(function(err, res) {
+ if (err) {
+ reject(err);
+ return;
+ }
+ resolve(res);
+ });
+ });
+ };
+
+ /**
+ * Synchronously generates a hash for the given string.
+ * @param {string} s String to hash
+ * @param {(number|string)=} salt Salt length to generate or salt to use, default to 10
+ * @returns {string} Resulting hash
+ * @expose
+ */
+ bcrypt.hashSync = function(s, salt) {
+ if (typeof salt === 'undefined')
+ salt = GENSALT_DEFAULT_LOG2_ROUNDS;
+ if (typeof salt === 'number')
+ salt = bcrypt.genSaltSync(salt);
+ if (typeof s !== 'string' || typeof salt !== 'string')
+ throw Error("Illegal arguments: "+(typeof s)+', '+(typeof salt));
+ return _hash(s, salt);
+ };
+
+ /**
+ * Asynchronously generates a hash for the given string.
+ * @param {string} s String to hash
+ * @param {number|string} salt Salt length to generate or salt to use
+ * @param {function(Error, string=)=} callback Callback receiving the error, if any, and the resulting hash
+ * @param {function(number)=} progressCallback Callback successively called with the percentage of rounds completed
+ * (0.0 - 1.0), maximally once per `MAX_EXECUTION_TIME = 100` ms.
+ * @returns {!Promise} If `callback` has been omitted
+ * @throws {Error} If `callback` is present but not a function
+ * @expose
+ */
+ bcrypt.hash = function(s, salt, callback, progressCallback) {
+
+ function _async(callback) {
+ if (typeof s === 'string' && typeof salt === 'number')
+ bcrypt.genSalt(salt, function(err, salt) {
+ _hash(s, salt, callback, progressCallback);
+ });
+ else if (typeof s === 'string' && typeof salt === 'string')
+ _hash(s, salt, callback, progressCallback);
+ else
+ nextTick(callback.bind(this, Error("Illegal arguments: "+(typeof s)+', '+(typeof salt))));
+ }
+
+ if (callback) {
+ if (typeof callback !== 'function')
+ throw Error("Illegal callback: "+typeof(callback));
+ _async(callback);
+ } else
+ return new Promise(function(resolve, reject) {
+ _async(function(err, res) {
+ if (err) {
+ reject(err);
+ return;
+ }
+ resolve(res);
+ });
+ });
+ };
+
+ /**
+ * Compares two strings of the same length in constant time.
+ * @param {string} known Must be of the correct length
+ * @param {string} unknown Must be the same length as `known`
+ * @returns {boolean}
+ * @inner
+ */
+ function safeStringCompare(known, unknown) {
+ var right = 0,
+ wrong = 0;
+ for (var i=0, k=known.length; i} UTF8 bytes
+ * @inner
+ */
+ function stringToBytes(str) {
+ var out = [],
+ i = 0;
+ utfx.encodeUTF16toUTF8(function() {
+ if (i >= str.length) return null;
+ return str.charCodeAt(i++);
+ }, function(b) {
+ out.push(b);
+ });
+ return out;
+ }
+
+ // A base64 implementation for the bcrypt algorithm. This is partly non-standard.
+
+ /**
+ * bcrypt's own non-standard base64 dictionary.
+ * @type {!Array.}
+ * @const
+ * @inner
+ **/
+ var BASE64_CODE = "./ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789".split('');
+
+ /**
+ * @type {!Array.}
+ * @const
+ * @inner
+ **/
+ var BASE64_INDEX = [-1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1,
+ -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1,
+ -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, 0,
+ 1, 54, 55, 56, 57, 58, 59, 60, 61, 62, 63, -1, -1, -1, -1, -1, -1,
+ -1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19,
+ 20, 21, 22, 23, 24, 25, 26, 27, -1, -1, -1, -1, -1, -1, 28, 29, 30,
+ 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, 41, 42, 43, 44, 45, 46, 47,
+ 48, 49, 50, 51, 52, 53, -1, -1, -1, -1, -1];
+
+ /**
+ * @type {!function(...number):string}
+ * @inner
+ */
+ var stringFromCharCode = String.fromCharCode;
+
+ /**
+ * Encodes a byte array to base64 with up to len bytes of input.
+ * @param {!Array.} b Byte array
+ * @param {number} len Maximum input length
+ * @returns {string}
+ * @inner
+ */
+ function base64_encode(b, len) {
+ var off = 0,
+ rs = [],
+ c1, c2;
+ if (len <= 0 || len > b.length)
+ throw Error("Illegal len: "+len);
+ while (off < len) {
+ c1 = b[off++] & 0xff;
+ rs.push(BASE64_CODE[(c1 >> 2) & 0x3f]);
+ c1 = (c1 & 0x03) << 4;
+ if (off >= len) {
+ rs.push(BASE64_CODE[c1 & 0x3f]);
+ break;
+ }
+ c2 = b[off++] & 0xff;
+ c1 |= (c2 >> 4) & 0x0f;
+ rs.push(BASE64_CODE[c1 & 0x3f]);
+ c1 = (c2 & 0x0f) << 2;
+ if (off >= len) {
+ rs.push(BASE64_CODE[c1 & 0x3f]);
+ break;
+ }
+ c2 = b[off++] & 0xff;
+ c1 |= (c2 >> 6) & 0x03;
+ rs.push(BASE64_CODE[c1 & 0x3f]);
+ rs.push(BASE64_CODE[c2 & 0x3f]);
+ }
+ return rs.join('');
+ }
+
+ /**
+ * Decodes a base64 encoded string to up to len bytes of output.
+ * @param {string} s String to decode
+ * @param {number} len Maximum output length
+ * @returns {!Array.}
+ * @inner
+ */
+ function base64_decode(s, len) {
+ var off = 0,
+ slen = s.length,
+ olen = 0,
+ rs = [],
+ c1, c2, c3, c4, o, code;
+ if (len <= 0)
+ throw Error("Illegal len: "+len);
+ while (off < slen - 1 && olen < len) {
+ code = s.charCodeAt(off++);
+ c1 = code < BASE64_INDEX.length ? BASE64_INDEX[code] : -1;
+ code = s.charCodeAt(off++);
+ c2 = code < BASE64_INDEX.length ? BASE64_INDEX[code] : -1;
+ if (c1 == -1 || c2 == -1)
+ break;
+ o = (c1 << 2) >>> 0;
+ o |= (c2 & 0x30) >> 4;
+ rs.push(stringFromCharCode(o));
+ if (++olen >= len || off >= slen)
+ break;
+ code = s.charCodeAt(off++);
+ c3 = code < BASE64_INDEX.length ? BASE64_INDEX[code] : -1;
+ if (c3 == -1)
+ break;
+ o = ((c2 & 0x0f) << 4) >>> 0;
+ o |= (c3 & 0x3c) >> 2;
+ rs.push(stringFromCharCode(o));
+ if (++olen >= len || off >= slen)
+ break;
+ code = s.charCodeAt(off++);
+ c4 = code < BASE64_INDEX.length ? BASE64_INDEX[code] : -1;
+ o = ((c3 & 0x03) << 6) >>> 0;
+ o |= c4;
+ rs.push(stringFromCharCode(o));
+ ++olen;
+ }
+ var res = [];
+ for (off = 0; off
+ * Released under the Apache License, Version 2.0
+ * see: https://github.com/dcodeIO/utfx for details
+ */
+ var utfx = function() {
+ "use strict";
+
+ /**
+ * utfx namespace.
+ * @inner
+ * @type {!Object.}
+ */
+ var utfx = {};
+
+ /**
+ * Maximum valid code point.
+ * @type {number}
+ * @const
+ */
+ utfx.MAX_CODEPOINT = 0x10FFFF;
+
+ /**
+ * Encodes UTF8 code points to UTF8 bytes.
+ * @param {(!function():number|null) | number} src Code points source, either as a function returning the next code point
+ * respectively `null` if there are no more code points left or a single numeric code point.
+ * @param {!function(number)} dst Bytes destination as a function successively called with the next byte
+ */
+ utfx.encodeUTF8 = function(src, dst) {
+ var cp = null;
+ if (typeof src === 'number')
+ cp = src,
+ src = function() { return null; };
+ while (cp !== null || (cp = src()) !== null) {
+ if (cp < 0x80)
+ dst(cp&0x7F);
+ else if (cp < 0x800)
+ dst(((cp>>6)&0x1F)|0xC0),
+ dst((cp&0x3F)|0x80);
+ else if (cp < 0x10000)
+ dst(((cp>>12)&0x0F)|0xE0),
+ dst(((cp>>6)&0x3F)|0x80),
+ dst((cp&0x3F)|0x80);
+ else
+ dst(((cp>>18)&0x07)|0xF0),
+ dst(((cp>>12)&0x3F)|0x80),
+ dst(((cp>>6)&0x3F)|0x80),
+ dst((cp&0x3F)|0x80);
+ cp = null;
+ }
+ };
+
+ /**
+ * Decodes UTF8 bytes to UTF8 code points.
+ * @param {!function():number|null} src Bytes source as a function returning the next byte respectively `null` if there
+ * are no more bytes left.
+ * @param {!function(number)} dst Code points destination as a function successively called with each decoded code point.
+ * @throws {RangeError} If a starting byte is invalid in UTF8
+ * @throws {Error} If the last sequence is truncated. Has an array property `bytes` holding the
+ * remaining bytes.
+ */
+ utfx.decodeUTF8 = function(src, dst) {
+ var a, b, c, d, fail = function(b) {
+ b = b.slice(0, b.indexOf(null));
+ var err = Error(b.toString());
+ err.name = "TruncatedError";
+ err['bytes'] = b;
+ throw err;
+ };
+ while ((a = src()) !== null) {
+ if ((a&0x80) === 0)
+ dst(a);
+ else if ((a&0xE0) === 0xC0)
+ ((b = src()) === null) && fail([a, b]),
+ dst(((a&0x1F)<<6) | (b&0x3F));
+ else if ((a&0xF0) === 0xE0)
+ ((b=src()) === null || (c=src()) === null) && fail([a, b, c]),
+ dst(((a&0x0F)<<12) | ((b&0x3F)<<6) | (c&0x3F));
+ else if ((a&0xF8) === 0xF0)
+ ((b=src()) === null || (c=src()) === null || (d=src()) === null) && fail([a, b, c ,d]),
+ dst(((a&0x07)<<18) | ((b&0x3F)<<12) | ((c&0x3F)<<6) | (d&0x3F));
+ else throw RangeError("Illegal starting byte: "+a);
+ }
+ };
+
+ /**
+ * Converts UTF16 characters to UTF8 code points.
+ * @param {!function():number|null} src Characters source as a function returning the next char code respectively
+ * `null` if there are no more characters left.
+ * @param {!function(number)} dst Code points destination as a function successively called with each converted code
+ * point.
+ */
+ utfx.UTF16toUTF8 = function(src, dst) {
+ var c1, c2 = null;
+ while (true) {
+ if ((c1 = c2 !== null ? c2 : src()) === null)
+ break;
+ if (c1 >= 0xD800 && c1 <= 0xDFFF) {
+ if ((c2 = src()) !== null) {
+ if (c2 >= 0xDC00 && c2 <= 0xDFFF) {
+ dst((c1-0xD800)*0x400+c2-0xDC00+0x10000);
+ c2 = null; continue;
+ }
+ }
+ }
+ dst(c1);
+ }
+ if (c2 !== null) dst(c2);
+ };
+
+ /**
+ * Converts UTF8 code points to UTF16 characters.
+ * @param {(!function():number|null) | number} src Code points source, either as a function returning the next code point
+ * respectively `null` if there are no more code points left or a single numeric code point.
+ * @param {!function(number)} dst Characters destination as a function successively called with each converted char code.
+ * @throws {RangeError} If a code point is out of range
+ */
+ utfx.UTF8toUTF16 = function(src, dst) {
+ var cp = null;
+ if (typeof src === 'number')
+ cp = src, src = function() { return null; };
+ while (cp !== null || (cp = src()) !== null) {
+ if (cp <= 0xFFFF)
+ dst(cp);
+ else
+ cp -= 0x10000,
+ dst((cp>>10)+0xD800),
+ dst((cp%0x400)+0xDC00);
+ cp = null;
+ }
+ };
+
+ /**
+ * Converts and encodes UTF16 characters to UTF8 bytes.
+ * @param {!function():number|null} src Characters source as a function returning the next char code respectively `null`
+ * if there are no more characters left.
+ * @param {!function(number)} dst Bytes destination as a function successively called with the next byte.
+ */
+ utfx.encodeUTF16toUTF8 = function(src, dst) {
+ utfx.UTF16toUTF8(src, function(cp) {
+ utfx.encodeUTF8(cp, dst);
+ });
+ };
+
+ /**
+ * Decodes and converts UTF8 bytes to UTF16 characters.
+ * @param {!function():number|null} src Bytes source as a function returning the next byte respectively `null` if there
+ * are no more bytes left.
+ * @param {!function(number)} dst Characters destination as a function successively called with each converted char code.
+ * @throws {RangeError} If a starting byte is invalid in UTF8
+ * @throws {Error} If the last sequence is truncated. Has an array property `bytes` holding the remaining bytes.
+ */
+ utfx.decodeUTF8toUTF16 = function(src, dst) {
+ utfx.decodeUTF8(src, function(cp) {
+ utfx.UTF8toUTF16(cp, dst);
+ });
+ };
+
+ /**
+ * Calculates the byte length of an UTF8 code point.
+ * @param {number} cp UTF8 code point
+ * @returns {number} Byte length
+ */
+ utfx.calculateCodePoint = function(cp) {
+ return (cp < 0x80) ? 1 : (cp < 0x800) ? 2 : (cp < 0x10000) ? 3 : 4;
+ };
+
+ /**
+ * Calculates the number of UTF8 bytes required to store UTF8 code points.
+ * @param {(!function():number|null)} src Code points source as a function returning the next code point respectively
+ * `null` if there are no more code points left.
+ * @returns {number} The number of UTF8 bytes required
+ */
+ utfx.calculateUTF8 = function(src) {
+ var cp, l=0;
+ while ((cp = src()) !== null)
+ l += utfx.calculateCodePoint(cp);
+ return l;
+ };
+
+ /**
+ * Calculates the number of UTF8 code points respectively UTF8 bytes required to store UTF16 char codes.
+ * @param {(!function():number|null)} src Characters source as a function returning the next char code respectively
+ * `null` if there are no more characters left.
+ * @returns {!Array.} The number of UTF8 code points at index 0 and the number of UTF8 bytes required at index 1.
+ */
+ utfx.calculateUTF16asUTF8 = function(src) {
+ var n=0, l=0;
+ utfx.UTF16toUTF8(src, function(cp) {
+ ++n; l += utfx.calculateCodePoint(cp);
+ });
+ return [n,l];
+ };
+
+ return utfx;
+ }();
+
+ Date.now = Date.now || function() { return +new Date; };
+
+ /**
+ * @type {number}
+ * @const
+ * @inner
+ */
+ var BCRYPT_SALT_LEN = 16;
+
+ /**
+ * @type {number}
+ * @const
+ * @inner
+ */
+ var GENSALT_DEFAULT_LOG2_ROUNDS = 10;
+
+ /**
+ * @type {number}
+ * @const
+ * @inner
+ */
+ var BLOWFISH_NUM_ROUNDS = 16;
+
+ /**
+ * @type {number}
+ * @const
+ * @inner
+ */
+ var MAX_EXECUTION_TIME = 100;
+
+ /**
+ * @type {Array.}
+ * @const
+ * @inner
+ */
+ var P_ORIG = [
+ 0x243f6a88, 0x85a308d3, 0x13198a2e, 0x03707344, 0xa4093822,
+ 0x299f31d0, 0x082efa98, 0xec4e6c89, 0x452821e6, 0x38d01377,
+ 0xbe5466cf, 0x34e90c6c, 0xc0ac29b7, 0xc97c50dd, 0x3f84d5b5,
+ 0xb5470917, 0x9216d5d9, 0x8979fb1b
+ ];
+
+ /**
+ * @type {Array.}
+ * @const
+ * @inner
+ */
+ var S_ORIG = [
+ 0xd1310ba6, 0x98dfb5ac, 0x2ffd72db, 0xd01adfb7, 0xb8e1afed,
+ 0x6a267e96, 0xba7c9045, 0xf12c7f99, 0x24a19947, 0xb3916cf7,
+ 0x0801f2e2, 0x858efc16, 0x636920d8, 0x71574e69, 0xa458fea3,
+ 0xf4933d7e, 0x0d95748f, 0x728eb658, 0x718bcd58, 0x82154aee,
+ 0x7b54a41d, 0xc25a59b5, 0x9c30d539, 0x2af26013, 0xc5d1b023,
+ 0x286085f0, 0xca417918, 0xb8db38ef, 0x8e79dcb0, 0x603a180e,
+ 0x6c9e0e8b, 0xb01e8a3e, 0xd71577c1, 0xbd314b27, 0x78af2fda,
+ 0x55605c60, 0xe65525f3, 0xaa55ab94, 0x57489862, 0x63e81440,
+ 0x55ca396a, 0x2aab10b6, 0xb4cc5c34, 0x1141e8ce, 0xa15486af,
+ 0x7c72e993, 0xb3ee1411, 0x636fbc2a, 0x2ba9c55d, 0x741831f6,
+ 0xce5c3e16, 0x9b87931e, 0xafd6ba33, 0x6c24cf5c, 0x7a325381,
+ 0x28958677, 0x3b8f4898, 0x6b4bb9af, 0xc4bfe81b, 0x66282193,
+ 0x61d809cc, 0xfb21a991, 0x487cac60, 0x5dec8032, 0xef845d5d,
+ 0xe98575b1, 0xdc262302, 0xeb651b88, 0x23893e81, 0xd396acc5,
+ 0x0f6d6ff3, 0x83f44239, 0x2e0b4482, 0xa4842004, 0x69c8f04a,
+ 0x9e1f9b5e, 0x21c66842, 0xf6e96c9a, 0x670c9c61, 0xabd388f0,
+ 0x6a51a0d2, 0xd8542f68, 0x960fa728, 0xab5133a3, 0x6eef0b6c,
+ 0x137a3be4, 0xba3bf050, 0x7efb2a98, 0xa1f1651d, 0x39af0176,
+ 0x66ca593e, 0x82430e88, 0x8cee8619, 0x456f9fb4, 0x7d84a5c3,
+ 0x3b8b5ebe, 0xe06f75d8, 0x85c12073, 0x401a449f, 0x56c16aa6,
+ 0x4ed3aa62, 0x363f7706, 0x1bfedf72, 0x429b023d, 0x37d0d724,
+ 0xd00a1248, 0xdb0fead3, 0x49f1c09b, 0x075372c9, 0x80991b7b,
+ 0x25d479d8, 0xf6e8def7, 0xe3fe501a, 0xb6794c3b, 0x976ce0bd,
+ 0x04c006ba, 0xc1a94fb6, 0x409f60c4, 0x5e5c9ec2, 0x196a2463,
+ 0x68fb6faf, 0x3e6c53b5, 0x1339b2eb, 0x3b52ec6f, 0x6dfc511f,
+ 0x9b30952c, 0xcc814544, 0xaf5ebd09, 0xbee3d004, 0xde334afd,
+ 0x660f2807, 0x192e4bb3, 0xc0cba857, 0x45c8740f, 0xd20b5f39,
+ 0xb9d3fbdb, 0x5579c0bd, 0x1a60320a, 0xd6a100c6, 0x402c7279,
+ 0x679f25fe, 0xfb1fa3cc, 0x8ea5e9f8, 0xdb3222f8, 0x3c7516df,
+ 0xfd616b15, 0x2f501ec8, 0xad0552ab, 0x323db5fa, 0xfd238760,
+ 0x53317b48, 0x3e00df82, 0x9e5c57bb, 0xca6f8ca0, 0x1a87562e,
+ 0xdf1769db, 0xd542a8f6, 0x287effc3, 0xac6732c6, 0x8c4f5573,
+ 0x695b27b0, 0xbbca58c8, 0xe1ffa35d, 0xb8f011a0, 0x10fa3d98,
+ 0xfd2183b8, 0x4afcb56c, 0x2dd1d35b, 0x9a53e479, 0xb6f84565,
+ 0xd28e49bc, 0x4bfb9790, 0xe1ddf2da, 0xa4cb7e33, 0x62fb1341,
+ 0xcee4c6e8, 0xef20cada, 0x36774c01, 0xd07e9efe, 0x2bf11fb4,
+ 0x95dbda4d, 0xae909198, 0xeaad8e71, 0x6b93d5a0, 0xd08ed1d0,
+ 0xafc725e0, 0x8e3c5b2f, 0x8e7594b7, 0x8ff6e2fb, 0xf2122b64,
+ 0x8888b812, 0x900df01c, 0x4fad5ea0, 0x688fc31c, 0xd1cff191,
+ 0xb3a8c1ad, 0x2f2f2218, 0xbe0e1777, 0xea752dfe, 0x8b021fa1,
+ 0xe5a0cc0f, 0xb56f74e8, 0x18acf3d6, 0xce89e299, 0xb4a84fe0,
+ 0xfd13e0b7, 0x7cc43b81, 0xd2ada8d9, 0x165fa266, 0x80957705,
+ 0x93cc7314, 0x211a1477, 0xe6ad2065, 0x77b5fa86, 0xc75442f5,
+ 0xfb9d35cf, 0xebcdaf0c, 0x7b3e89a0, 0xd6411bd3, 0xae1e7e49,
+ 0x00250e2d, 0x2071b35e, 0x226800bb, 0x57b8e0af, 0x2464369b,
+ 0xf009b91e, 0x5563911d, 0x59dfa6aa, 0x78c14389, 0xd95a537f,
+ 0x207d5ba2, 0x02e5b9c5, 0x83260376, 0x6295cfa9, 0x11c81968,
+ 0x4e734a41, 0xb3472dca, 0x7b14a94a, 0x1b510052, 0x9a532915,
+ 0xd60f573f, 0xbc9bc6e4, 0x2b60a476, 0x81e67400, 0x08ba6fb5,
+ 0x571be91f, 0xf296ec6b, 0x2a0dd915, 0xb6636521, 0xe7b9f9b6,
+ 0xff34052e, 0xc5855664, 0x53b02d5d, 0xa99f8fa1, 0x08ba4799,
+ 0x6e85076a, 0x4b7a70e9, 0xb5b32944, 0xdb75092e, 0xc4192623,
+ 0xad6ea6b0, 0x49a7df7d, 0x9cee60b8, 0x8fedb266, 0xecaa8c71,
+ 0x699a17ff, 0x5664526c, 0xc2b19ee1, 0x193602a5, 0x75094c29,
+ 0xa0591340, 0xe4183a3e, 0x3f54989a, 0x5b429d65, 0x6b8fe4d6,
+ 0x99f73fd6, 0xa1d29c07, 0xefe830f5, 0x4d2d38e6, 0xf0255dc1,
+ 0x4cdd2086, 0x8470eb26, 0x6382e9c6, 0x021ecc5e, 0x09686b3f,
+ 0x3ebaefc9, 0x3c971814, 0x6b6a70a1, 0x687f3584, 0x52a0e286,
+ 0xb79c5305, 0xaa500737, 0x3e07841c, 0x7fdeae5c, 0x8e7d44ec,
+ 0x5716f2b8, 0xb03ada37, 0xf0500c0d, 0xf01c1f04, 0x0200b3ff,
+ 0xae0cf51a, 0x3cb574b2, 0x25837a58, 0xdc0921bd, 0xd19113f9,
+ 0x7ca92ff6, 0x94324773, 0x22f54701, 0x3ae5e581, 0x37c2dadc,
+ 0xc8b57634, 0x9af3dda7, 0xa9446146, 0x0fd0030e, 0xecc8c73e,
+ 0xa4751e41, 0xe238cd99, 0x3bea0e2f, 0x3280bba1, 0x183eb331,
+ 0x4e548b38, 0x4f6db908, 0x6f420d03, 0xf60a04bf, 0x2cb81290,
+ 0x24977c79, 0x5679b072, 0xbcaf89af, 0xde9a771f, 0xd9930810,
+ 0xb38bae12, 0xdccf3f2e, 0x5512721f, 0x2e6b7124, 0x501adde6,
+ 0x9f84cd87, 0x7a584718, 0x7408da17, 0xbc9f9abc, 0xe94b7d8c,
+ 0xec7aec3a, 0xdb851dfa, 0x63094366, 0xc464c3d2, 0xef1c1847,
+ 0x3215d908, 0xdd433b37, 0x24c2ba16, 0x12a14d43, 0x2a65c451,
+ 0x50940002, 0x133ae4dd, 0x71dff89e, 0x10314e55, 0x81ac77d6,
+ 0x5f11199b, 0x043556f1, 0xd7a3c76b, 0x3c11183b, 0x5924a509,
+ 0xf28fe6ed, 0x97f1fbfa, 0x9ebabf2c, 0x1e153c6e, 0x86e34570,
+ 0xeae96fb1, 0x860e5e0a, 0x5a3e2ab3, 0x771fe71c, 0x4e3d06fa,
+ 0x2965dcb9, 0x99e71d0f, 0x803e89d6, 0x5266c825, 0x2e4cc978,
+ 0x9c10b36a, 0xc6150eba, 0x94e2ea78, 0xa5fc3c53, 0x1e0a2df4,
+ 0xf2f74ea7, 0x361d2b3d, 0x1939260f, 0x19c27960, 0x5223a708,
+ 0xf71312b6, 0xebadfe6e, 0xeac31f66, 0xe3bc4595, 0xa67bc883,
+ 0xb17f37d1, 0x018cff28, 0xc332ddef, 0xbe6c5aa5, 0x65582185,
+ 0x68ab9802, 0xeecea50f, 0xdb2f953b, 0x2aef7dad, 0x5b6e2f84,
+ 0x1521b628, 0x29076170, 0xecdd4775, 0x619f1510, 0x13cca830,
+ 0xeb61bd96, 0x0334fe1e, 0xaa0363cf, 0xb5735c90, 0x4c70a239,
+ 0xd59e9e0b, 0xcbaade14, 0xeecc86bc, 0x60622ca7, 0x9cab5cab,
+ 0xb2f3846e, 0x648b1eaf, 0x19bdf0ca, 0xa02369b9, 0x655abb50,
+ 0x40685a32, 0x3c2ab4b3, 0x319ee9d5, 0xc021b8f7, 0x9b540b19,
+ 0x875fa099, 0x95f7997e, 0x623d7da8, 0xf837889a, 0x97e32d77,
+ 0x11ed935f, 0x16681281, 0x0e358829, 0xc7e61fd6, 0x96dedfa1,
+ 0x7858ba99, 0x57f584a5, 0x1b227263, 0x9b83c3ff, 0x1ac24696,
+ 0xcdb30aeb, 0x532e3054, 0x8fd948e4, 0x6dbc3128, 0x58ebf2ef,
+ 0x34c6ffea, 0xfe28ed61, 0xee7c3c73, 0x5d4a14d9, 0xe864b7e3,
+ 0x42105d14, 0x203e13e0, 0x45eee2b6, 0xa3aaabea, 0xdb6c4f15,
+ 0xfacb4fd0, 0xc742f442, 0xef6abbb5, 0x654f3b1d, 0x41cd2105,
+ 0xd81e799e, 0x86854dc7, 0xe44b476a, 0x3d816250, 0xcf62a1f2,
+ 0x5b8d2646, 0xfc8883a0, 0xc1c7b6a3, 0x7f1524c3, 0x69cb7492,
+ 0x47848a0b, 0x5692b285, 0x095bbf00, 0xad19489d, 0x1462b174,
+ 0x23820e00, 0x58428d2a, 0x0c55f5ea, 0x1dadf43e, 0x233f7061,
+ 0x3372f092, 0x8d937e41, 0xd65fecf1, 0x6c223bdb, 0x7cde3759,
+ 0xcbee7460, 0x4085f2a7, 0xce77326e, 0xa6078084, 0x19f8509e,
+ 0xe8efd855, 0x61d99735, 0xa969a7aa, 0xc50c06c2, 0x5a04abfc,
+ 0x800bcadc, 0x9e447a2e, 0xc3453484, 0xfdd56705, 0x0e1e9ec9,
+ 0xdb73dbd3, 0x105588cd, 0x675fda79, 0xe3674340, 0xc5c43465,
+ 0x713e38d8, 0x3d28f89e, 0xf16dff20, 0x153e21e7, 0x8fb03d4a,
+ 0xe6e39f2b, 0xdb83adf7, 0xe93d5a68, 0x948140f7, 0xf64c261c,
+ 0x94692934, 0x411520f7, 0x7602d4f7, 0xbcf46b2e, 0xd4a20068,
+ 0xd4082471, 0x3320f46a, 0x43b7d4b7, 0x500061af, 0x1e39f62e,
+ 0x97244546, 0x14214f74, 0xbf8b8840, 0x4d95fc1d, 0x96b591af,
+ 0x70f4ddd3, 0x66a02f45, 0xbfbc09ec, 0x03bd9785, 0x7fac6dd0,
+ 0x31cb8504, 0x96eb27b3, 0x55fd3941, 0xda2547e6, 0xabca0a9a,
+ 0x28507825, 0x530429f4, 0x0a2c86da, 0xe9b66dfb, 0x68dc1462,
+ 0xd7486900, 0x680ec0a4, 0x27a18dee, 0x4f3ffea2, 0xe887ad8c,
+ 0xb58ce006, 0x7af4d6b6, 0xaace1e7c, 0xd3375fec, 0xce78a399,
+ 0x406b2a42, 0x20fe9e35, 0xd9f385b9, 0xee39d7ab, 0x3b124e8b,
+ 0x1dc9faf7, 0x4b6d1856, 0x26a36631, 0xeae397b2, 0x3a6efa74,
+ 0xdd5b4332, 0x6841e7f7, 0xca7820fb, 0xfb0af54e, 0xd8feb397,
+ 0x454056ac, 0xba489527, 0x55533a3a, 0x20838d87, 0xfe6ba9b7,
+ 0xd096954b, 0x55a867bc, 0xa1159a58, 0xcca92963, 0x99e1db33,
+ 0xa62a4a56, 0x3f3125f9, 0x5ef47e1c, 0x9029317c, 0xfdf8e802,
+ 0x04272f70, 0x80bb155c, 0x05282ce3, 0x95c11548, 0xe4c66d22,
+ 0x48c1133f, 0xc70f86dc, 0x07f9c9ee, 0x41041f0f, 0x404779a4,
+ 0x5d886e17, 0x325f51eb, 0xd59bc0d1, 0xf2bcc18f, 0x41113564,
+ 0x257b7834, 0x602a9c60, 0xdff8e8a3, 0x1f636c1b, 0x0e12b4c2,
+ 0x02e1329e, 0xaf664fd1, 0xcad18115, 0x6b2395e0, 0x333e92e1,
+ 0x3b240b62, 0xeebeb922, 0x85b2a20e, 0xe6ba0d99, 0xde720c8c,
+ 0x2da2f728, 0xd0127845, 0x95b794fd, 0x647d0862, 0xe7ccf5f0,
+ 0x5449a36f, 0x877d48fa, 0xc39dfd27, 0xf33e8d1e, 0x0a476341,
+ 0x992eff74, 0x3a6f6eab, 0xf4f8fd37, 0xa812dc60, 0xa1ebddf8,
+ 0x991be14c, 0xdb6e6b0d, 0xc67b5510, 0x6d672c37, 0x2765d43b,
+ 0xdcd0e804, 0xf1290dc7, 0xcc00ffa3, 0xb5390f92, 0x690fed0b,
+ 0x667b9ffb, 0xcedb7d9c, 0xa091cf0b, 0xd9155ea3, 0xbb132f88,
+ 0x515bad24, 0x7b9479bf, 0x763bd6eb, 0x37392eb3, 0xcc115979,
+ 0x8026e297, 0xf42e312d, 0x6842ada7, 0xc66a2b3b, 0x12754ccc,
+ 0x782ef11c, 0x6a124237, 0xb79251e7, 0x06a1bbe6, 0x4bfb6350,
+ 0x1a6b1018, 0x11caedfa, 0x3d25bdd8, 0xe2e1c3c9, 0x44421659,
+ 0x0a121386, 0xd90cec6e, 0xd5abea2a, 0x64af674e, 0xda86a85f,
+ 0xbebfe988, 0x64e4c3fe, 0x9dbc8057, 0xf0f7c086, 0x60787bf8,
+ 0x6003604d, 0xd1fd8346, 0xf6381fb0, 0x7745ae04, 0xd736fccc,
+ 0x83426b33, 0xf01eab71, 0xb0804187, 0x3c005e5f, 0x77a057be,
+ 0xbde8ae24, 0x55464299, 0xbf582e61, 0x4e58f48f, 0xf2ddfda2,
+ 0xf474ef38, 0x8789bdc2, 0x5366f9c3, 0xc8b38e74, 0xb475f255,
+ 0x46fcd9b9, 0x7aeb2661, 0x8b1ddf84, 0x846a0e79, 0x915f95e2,
+ 0x466e598e, 0x20b45770, 0x8cd55591, 0xc902de4c, 0xb90bace1,
+ 0xbb8205d0, 0x11a86248, 0x7574a99e, 0xb77f19b6, 0xe0a9dc09,
+ 0x662d09a1, 0xc4324633, 0xe85a1f02, 0x09f0be8c, 0x4a99a025,
+ 0x1d6efe10, 0x1ab93d1d, 0x0ba5a4df, 0xa186f20f, 0x2868f169,
+ 0xdcb7da83, 0x573906fe, 0xa1e2ce9b, 0x4fcd7f52, 0x50115e01,
+ 0xa70683fa, 0xa002b5c4, 0x0de6d027, 0x9af88c27, 0x773f8641,
+ 0xc3604c06, 0x61a806b5, 0xf0177a28, 0xc0f586e0, 0x006058aa,
+ 0x30dc7d62, 0x11e69ed7, 0x2338ea63, 0x53c2dd94, 0xc2c21634,
+ 0xbbcbee56, 0x90bcb6de, 0xebfc7da1, 0xce591d76, 0x6f05e409,
+ 0x4b7c0188, 0x39720a3d, 0x7c927c24, 0x86e3725f, 0x724d9db9,
+ 0x1ac15bb4, 0xd39eb8fc, 0xed545578, 0x08fca5b5, 0xd83d7cd3,
+ 0x4dad0fc4, 0x1e50ef5e, 0xb161e6f8, 0xa28514d9, 0x6c51133c,
+ 0x6fd5c7e7, 0x56e14ec4, 0x362abfce, 0xddc6c837, 0xd79a3234,
+ 0x92638212, 0x670efa8e, 0x406000e0, 0x3a39ce37, 0xd3faf5cf,
+ 0xabc27737, 0x5ac52d1b, 0x5cb0679e, 0x4fa33742, 0xd3822740,
+ 0x99bc9bbe, 0xd5118e9d, 0xbf0f7315, 0xd62d1c7e, 0xc700c47b,
+ 0xb78c1b6b, 0x21a19045, 0xb26eb1be, 0x6a366eb4, 0x5748ab2f,
+ 0xbc946e79, 0xc6a376d2, 0x6549c2c8, 0x530ff8ee, 0x468dde7d,
+ 0xd5730a1d, 0x4cd04dc6, 0x2939bbdb, 0xa9ba4650, 0xac9526e8,
+ 0xbe5ee304, 0xa1fad5f0, 0x6a2d519a, 0x63ef8ce2, 0x9a86ee22,
+ 0xc089c2b8, 0x43242ef6, 0xa51e03aa, 0x9cf2d0a4, 0x83c061ba,
+ 0x9be96a4d, 0x8fe51550, 0xba645bd6, 0x2826a2f9, 0xa73a3ae1,
+ 0x4ba99586, 0xef5562e9, 0xc72fefd3, 0xf752f7da, 0x3f046f69,
+ 0x77fa0a59, 0x80e4a915, 0x87b08601, 0x9b09e6ad, 0x3b3ee593,
+ 0xe990fd5a, 0x9e34d797, 0x2cf0b7d9, 0x022b8b51, 0x96d5ac3a,
+ 0x017da67d, 0xd1cf3ed6, 0x7c7d2d28, 0x1f9f25cf, 0xadf2b89b,
+ 0x5ad6b472, 0x5a88f54c, 0xe029ac71, 0xe019a5e6, 0x47b0acfd,
+ 0xed93fa9b, 0xe8d3c48d, 0x283b57cc, 0xf8d56629, 0x79132e28,
+ 0x785f0191, 0xed756055, 0xf7960e44, 0xe3d35e8c, 0x15056dd4,
+ 0x88f46dba, 0x03a16125, 0x0564f0bd, 0xc3eb9e15, 0x3c9057a2,
+ 0x97271aec, 0xa93a072a, 0x1b3f6d9b, 0x1e6321f5, 0xf59c66fb,
+ 0x26dcf319, 0x7533d928, 0xb155fdf5, 0x03563482, 0x8aba3cbb,
+ 0x28517711, 0xc20ad9f8, 0xabcc5167, 0xccad925f, 0x4de81751,
+ 0x3830dc8e, 0x379d5862, 0x9320f991, 0xea7a90c2, 0xfb3e7bce,
+ 0x5121ce64, 0x774fbe32, 0xa8b6e37e, 0xc3293d46, 0x48de5369,
+ 0x6413e680, 0xa2ae0810, 0xdd6db224, 0x69852dfd, 0x09072166,
+ 0xb39a460a, 0x6445c0dd, 0x586cdecf, 0x1c20c8ae, 0x5bbef7dd,
+ 0x1b588d40, 0xccd2017f, 0x6bb4e3bb, 0xdda26a7e, 0x3a59ff45,
+ 0x3e350a44, 0xbcb4cdd5, 0x72eacea8, 0xfa6484bb, 0x8d6612ae,
+ 0xbf3c6f47, 0xd29be463, 0x542f5d9e, 0xaec2771b, 0xf64e6370,
+ 0x740e0d8d, 0xe75b1357, 0xf8721671, 0xaf537d5d, 0x4040cb08,
+ 0x4eb4e2cc, 0x34d2466a, 0x0115af84, 0xe1b00428, 0x95983a1d,
+ 0x06b89fb4, 0xce6ea048, 0x6f3f3b82, 0x3520ab82, 0x011a1d4b,
+ 0x277227f8, 0x611560b1, 0xe7933fdc, 0xbb3a792b, 0x344525bd,
+ 0xa08839e1, 0x51ce794b, 0x2f32c9b7, 0xa01fbac9, 0xe01cc87e,
+ 0xbcc7d1f6, 0xcf0111c3, 0xa1e8aac7, 0x1a908749, 0xd44fbd9a,
+ 0xd0dadecb, 0xd50ada38, 0x0339c32a, 0xc6913667, 0x8df9317c,
+ 0xe0b12b4f, 0xf79e59b7, 0x43f5bb3a, 0xf2d519ff, 0x27d9459c,
+ 0xbf97222c, 0x15e6fc2a, 0x0f91fc71, 0x9b941525, 0xfae59361,
+ 0xceb69ceb, 0xc2a86459, 0x12baa8d1, 0xb6c1075e, 0xe3056a0c,
+ 0x10d25065, 0xcb03a442, 0xe0ec6e0e, 0x1698db3b, 0x4c98a0be,
+ 0x3278e964, 0x9f1f9532, 0xe0d392df, 0xd3a0342b, 0x8971f21e,
+ 0x1b0a7441, 0x4ba3348c, 0xc5be7120, 0xc37632d8, 0xdf359f8d,
+ 0x9b992f2e, 0xe60b6f47, 0x0fe3f11d, 0xe54cda54, 0x1edad891,
+ 0xce6279cf, 0xcd3e7e6f, 0x1618b166, 0xfd2c1d05, 0x848fd2c5,
+ 0xf6fb2299, 0xf523f357, 0xa6327623, 0x93a83531, 0x56cccd02,
+ 0xacf08162, 0x5a75ebb5, 0x6e163697, 0x88d273cc, 0xde966292,
+ 0x81b949d0, 0x4c50901b, 0x71c65614, 0xe6c6c7bd, 0x327a140a,
+ 0x45e1d006, 0xc3f27b9a, 0xc9aa53fd, 0x62a80f00, 0xbb25bfe2,
+ 0x35bdd2f6, 0x71126905, 0xb2040222, 0xb6cbcf7c, 0xcd769c2b,
+ 0x53113ec0, 0x1640e3d3, 0x38abbd60, 0x2547adf0, 0xba38209c,
+ 0xf746ce76, 0x77afa1c5, 0x20756060, 0x85cbfe4e, 0x8ae88dd8,
+ 0x7aaaf9b0, 0x4cf9aa7e, 0x1948c25c, 0x02fb8a8c, 0x01c36ae4,
+ 0xd6ebe1f9, 0x90d4f869, 0xa65cdea0, 0x3f09252d, 0xc208e69f,
+ 0xb74e6132, 0xce77e25b, 0x578fdfe3, 0x3ac372e6
+ ];
+
+ /**
+ * @type {Array.}
+ * @const
+ * @inner
+ */
+ var C_ORIG = [
+ 0x4f727068, 0x65616e42, 0x65686f6c, 0x64657253, 0x63727944,
+ 0x6f756274
+ ];
+
+ /**
+ * @param {Array.} lr
+ * @param {number} off
+ * @param {Array.} P
+ * @param {Array.} S
+ * @returns {Array.}
+ * @inner
+ */
+ function _encipher(lr, off, P, S) { // This is our bottleneck: 1714/1905 ticks / 90% - see profile.txt
+ var n,
+ l = lr[off],
+ r = lr[off + 1];
+
+ l ^= P[0];
+
+ /*
+ for (var i=0, k=BLOWFISH_NUM_ROUNDS-2; i<=k;)
+ // Feistel substitution on left word
+ n = S[l >>> 24],
+ n += S[0x100 | ((l >> 16) & 0xff)],
+ n ^= S[0x200 | ((l >> 8) & 0xff)],
+ n += S[0x300 | (l & 0xff)],
+ r ^= n ^ P[++i],
+ // Feistel substitution on right word
+ n = S[r >>> 24],
+ n += S[0x100 | ((r >> 16) & 0xff)],
+ n ^= S[0x200 | ((r >> 8) & 0xff)],
+ n += S[0x300 | (r & 0xff)],
+ l ^= n ^ P[++i];
+ */
+
+ //The following is an unrolled version of the above loop.
+ //Iteration 0
+ n = S[l >>> 24];
+ n += S[0x100 | ((l >> 16) & 0xff)];
+ n ^= S[0x200 | ((l >> 8) & 0xff)];
+ n += S[0x300 | (l & 0xff)];
+ r ^= n ^ P[1];
+ n = S[r >>> 24];
+ n += S[0x100 | ((r >> 16) & 0xff)];
+ n ^= S[0x200 | ((r >> 8) & 0xff)];
+ n += S[0x300 | (r & 0xff)];
+ l ^= n ^ P[2];
+ //Iteration 1
+ n = S[l >>> 24];
+ n += S[0x100 | ((l >> 16) & 0xff)];
+ n ^= S[0x200 | ((l >> 8) & 0xff)];
+ n += S[0x300 | (l & 0xff)];
+ r ^= n ^ P[3];
+ n = S[r >>> 24];
+ n += S[0x100 | ((r >> 16) & 0xff)];
+ n ^= S[0x200 | ((r >> 8) & 0xff)];
+ n += S[0x300 | (r & 0xff)];
+ l ^= n ^ P[4];
+ //Iteration 2
+ n = S[l >>> 24];
+ n += S[0x100 | ((l >> 16) & 0xff)];
+ n ^= S[0x200 | ((l >> 8) & 0xff)];
+ n += S[0x300 | (l & 0xff)];
+ r ^= n ^ P[5];
+ n = S[r >>> 24];
+ n += S[0x100 | ((r >> 16) & 0xff)];
+ n ^= S[0x200 | ((r >> 8) & 0xff)];
+ n += S[0x300 | (r & 0xff)];
+ l ^= n ^ P[6];
+ //Iteration 3
+ n = S[l >>> 24];
+ n += S[0x100 | ((l >> 16) & 0xff)];
+ n ^= S[0x200 | ((l >> 8) & 0xff)];
+ n += S[0x300 | (l & 0xff)];
+ r ^= n ^ P[7];
+ n = S[r >>> 24];
+ n += S[0x100 | ((r >> 16) & 0xff)];
+ n ^= S[0x200 | ((r >> 8) & 0xff)];
+ n += S[0x300 | (r & 0xff)];
+ l ^= n ^ P[8];
+ //Iteration 4
+ n = S[l >>> 24];
+ n += S[0x100 | ((l >> 16) & 0xff)];
+ n ^= S[0x200 | ((l >> 8) & 0xff)];
+ n += S[0x300 | (l & 0xff)];
+ r ^= n ^ P[9];
+ n = S[r >>> 24];
+ n += S[0x100 | ((r >> 16) & 0xff)];
+ n ^= S[0x200 | ((r >> 8) & 0xff)];
+ n += S[0x300 | (r & 0xff)];
+ l ^= n ^ P[10];
+ //Iteration 5
+ n = S[l >>> 24];
+ n += S[0x100 | ((l >> 16) & 0xff)];
+ n ^= S[0x200 | ((l >> 8) & 0xff)];
+ n += S[0x300 | (l & 0xff)];
+ r ^= n ^ P[11];
+ n = S[r >>> 24];
+ n += S[0x100 | ((r >> 16) & 0xff)];
+ n ^= S[0x200 | ((r >> 8) & 0xff)];
+ n += S[0x300 | (r & 0xff)];
+ l ^= n ^ P[12];
+ //Iteration 6
+ n = S[l >>> 24];
+ n += S[0x100 | ((l >> 16) & 0xff)];
+ n ^= S[0x200 | ((l >> 8) & 0xff)];
+ n += S[0x300 | (l & 0xff)];
+ r ^= n ^ P[13];
+ n = S[r >>> 24];
+ n += S[0x100 | ((r >> 16) & 0xff)];
+ n ^= S[0x200 | ((r >> 8) & 0xff)];
+ n += S[0x300 | (r & 0xff)];
+ l ^= n ^ P[14];
+ //Iteration 7
+ n = S[l >>> 24];
+ n += S[0x100 | ((l >> 16) & 0xff)];
+ n ^= S[0x200 | ((l >> 8) & 0xff)];
+ n += S[0x300 | (l & 0xff)];
+ r ^= n ^ P[15];
+ n = S[r >>> 24];
+ n += S[0x100 | ((r >> 16) & 0xff)];
+ n ^= S[0x200 | ((r >> 8) & 0xff)];
+ n += S[0x300 | (r & 0xff)];
+ l ^= n ^ P[16];
+
+ lr[off] = r ^ P[BLOWFISH_NUM_ROUNDS + 1];
+ lr[off + 1] = l;
+ return lr;
+ }
+
+ /**
+ * @param {Array.} data
+ * @param {number} offp
+ * @returns {{key: number, offp: number}}
+ * @inner
+ */
+ function _streamtoword(data, offp) {
+ for (var i = 0, word = 0; i < 4; ++i)
+ word = (word << 8) | (data[offp] & 0xff),
+ offp = (offp + 1) % data.length;
+ return { key: word, offp: offp };
+ }
+
+ /**
+ * @param {Array.} key
+ * @param {Array.} P
+ * @param {Array.} S
+ * @inner
+ */
+ function _key(key, P, S) {
+ var offset = 0,
+ lr = [0, 0],
+ plen = P.length,
+ slen = S.length,
+ sw;
+ for (var i = 0; i < plen; i++)
+ sw = _streamtoword(key, offset),
+ offset = sw.offp,
+ P[i] = P[i] ^ sw.key;
+ for (i = 0; i < plen; i += 2)
+ lr = _encipher(lr, 0, P, S),
+ P[i] = lr[0],
+ P[i + 1] = lr[1];
+ for (i = 0; i < slen; i += 2)
+ lr = _encipher(lr, 0, P, S),
+ S[i] = lr[0],
+ S[i + 1] = lr[1];
+ }
+
+ /**
+ * Expensive key schedule Blowfish.
+ * @param {Array.} data
+ * @param {Array.} key
+ * @param {Array.} P
+ * @param {Array.} S
+ * @inner
+ */
+ function _ekskey(data, key, P, S) {
+ var offp = 0,
+ lr = [0, 0],
+ plen = P.length,
+ slen = S.length,
+ sw;
+ for (var i = 0; i < plen; i++)
+ sw = _streamtoword(key, offp),
+ offp = sw.offp,
+ P[i] = P[i] ^ sw.key;
+ offp = 0;
+ for (i = 0; i < plen; i += 2)
+ sw = _streamtoword(data, offp),
+ offp = sw.offp,
+ lr[0] ^= sw.key,
+ sw = _streamtoword(data, offp),
+ offp = sw.offp,
+ lr[1] ^= sw.key,
+ lr = _encipher(lr, 0, P, S),
+ P[i] = lr[0],
+ P[i + 1] = lr[1];
+ for (i = 0; i < slen; i += 2)
+ sw = _streamtoword(data, offp),
+ offp = sw.offp,
+ lr[0] ^= sw.key,
+ sw = _streamtoword(data, offp),
+ offp = sw.offp,
+ lr[1] ^= sw.key,
+ lr = _encipher(lr, 0, P, S),
+ S[i] = lr[0],
+ S[i + 1] = lr[1];
+ }
+
+ /**
+ * Internaly crypts a string.
+ * @param {Array.} b Bytes to crypt
+ * @param {Array.} salt Salt bytes to use
+ * @param {number} rounds Number of rounds
+ * @param {function(Error, Array.=)=} callback Callback receiving the error, if any, and the resulting bytes. If
+ * omitted, the operation will be performed synchronously.
+ * @param {function(number)=} progressCallback Callback called with the current progress
+ * @returns {!Array.|undefined} Resulting bytes if callback has been omitted, otherwise `undefined`
+ * @inner
+ */
+ function _crypt(b, salt, rounds, callback, progressCallback) {
+ var cdata = C_ORIG.slice(),
+ clen = cdata.length,
+ err;
+
+ // Validate
+ if (rounds < 4 || rounds > 31) {
+ err = Error("Illegal number of rounds (4-31): "+rounds);
+ if (callback) {
+ nextTick(callback.bind(this, err));
+ return;
+ } else
+ throw err;
+ }
+ if (salt.length !== BCRYPT_SALT_LEN) {
+ err =Error("Illegal salt length: "+salt.length+" != "+BCRYPT_SALT_LEN);
+ if (callback) {
+ nextTick(callback.bind(this, err));
+ return;
+ } else
+ throw err;
+ }
+ rounds = (1 << rounds) >>> 0;
+
+ var P, S, i = 0, j;
+
+ //Use typed arrays when available - huge speedup!
+ if (Int32Array) {
+ P = new Int32Array(P_ORIG);
+ S = new Int32Array(S_ORIG);
+ } else {
+ P = P_ORIG.slice();
+ S = S_ORIG.slice();
+ }
+
+ _ekskey(salt, b, P, S);
+
+ /**
+ * Calcualtes the next round.
+ * @returns {Array.|undefined} Resulting array if callback has been omitted, otherwise `undefined`
+ * @inner
+ */
+ function next() {
+ if (progressCallback)
+ progressCallback(i / rounds);
+ if (i < rounds) {
+ var start = Date.now();
+ for (; i < rounds;) {
+ i = i + 1;
+ _key(b, P, S);
+ _key(salt, P, S);
+ if (Date.now() - start > MAX_EXECUTION_TIME)
+ break;
+ }
+ } else {
+ for (i = 0; i < 64; i++)
+ for (j = 0; j < (clen >> 1); j++)
+ _encipher(cdata, j << 1, P, S);
+ var ret = [];
+ for (i = 0; i < clen; i++)
+ ret.push(((cdata[i] >> 24) & 0xff) >>> 0),
+ ret.push(((cdata[i] >> 16) & 0xff) >>> 0),
+ ret.push(((cdata[i] >> 8) & 0xff) >>> 0),
+ ret.push((cdata[i] & 0xff) >>> 0);
+ if (callback) {
+ callback(null, ret);
+ return;
+ } else
+ return ret;
+ }
+ if (callback)
+ nextTick(next);
+ }
+
+ // Async
+ if (typeof callback !== 'undefined') {
+ next();
+
+ // Sync
+ } else {
+ var res;
+ while (true)
+ if (typeof(res = next()) !== 'undefined')
+ return res || [];
+ }
+ }
+
+ /**
+ * Internally hashes a string.
+ * @param {string} s String to hash
+ * @param {?string} salt Salt to use, actually never null
+ * @param {function(Error, string=)=} callback Callback receiving the error, if any, and the resulting hash. If omitted,
+ * hashing is perormed synchronously.
+ * @param {function(number)=} progressCallback Callback called with the current progress
+ * @returns {string|undefined} Resulting hash if callback has been omitted, otherwise `undefined`
+ * @inner
+ */
+ function _hash(s, salt, callback, progressCallback) {
+ var err;
+ if (typeof s !== 'string' || typeof salt !== 'string') {
+ err = Error("Invalid string / salt: Not a string");
+ if (callback) {
+ nextTick(callback.bind(this, err));
+ return;
+ }
+ else
+ throw err;
+ }
+
+ // Validate the salt
+ var minor, offset;
+ if (salt.charAt(0) !== '$' || salt.charAt(1) !== '2') {
+ err = Error("Invalid salt version: "+salt.substring(0,2));
+ if (callback) {
+ nextTick(callback.bind(this, err));
+ return;
+ }
+ else
+ throw err;
+ }
+ if (salt.charAt(2) === '$')
+ minor = String.fromCharCode(0),
+ offset = 3;
+ else {
+ minor = salt.charAt(2);
+ if ((minor !== 'a' && minor !== 'b' && minor !== 'y') || salt.charAt(3) !== '$') {
+ err = Error("Invalid salt revision: "+salt.substring(2,4));
+ if (callback) {
+ nextTick(callback.bind(this, err));
+ return;
+ } else
+ throw err;
+ }
+ offset = 4;
+ }
+
+ // Extract number of rounds
+ if (salt.charAt(offset + 2) > '$') {
+ err = Error("Missing salt rounds");
+ if (callback) {
+ nextTick(callback.bind(this, err));
+ return;
+ } else
+ throw err;
+ }
+ var r1 = parseInt(salt.substring(offset, offset + 1), 10) * 10,
+ r2 = parseInt(salt.substring(offset + 1, offset + 2), 10),
+ rounds = r1 + r2,
+ real_salt = salt.substring(offset + 3, offset + 25);
+ s += minor >= 'a' ? "\x00" : "";
+
+ var passwordb = stringToBytes(s),
+ saltb = base64_decode(real_salt, BCRYPT_SALT_LEN);
+
+ /**
+ * Finishes hashing.
+ * @param {Array.} bytes Byte array
+ * @returns {string}
+ * @inner
+ */
+ function finish(bytes) {
+ var res = [];
+ res.push("$2");
+ if (minor >= 'a')
+ res.push(minor);
+ res.push("$");
+ if (rounds < 10)
+ res.push("0");
+ res.push(rounds.toString());
+ res.push("$");
+ res.push(base64_encode(saltb, saltb.length));
+ res.push(base64_encode(bytes, C_ORIG.length * 4 - 1));
+ return res.join('');
+ }
+
+ // Sync
+ if (typeof callback == 'undefined')
+ return finish(_crypt(passwordb, saltb, rounds));
+
+ // Async
+ else {
+ _crypt(passwordb, saltb, rounds, function(err, bytes) {
+ if (err)
+ callback(err, null);
+ else
+ callback(null, finish(bytes));
+ }, progressCallback);
+ }
+ }
+
+ /**
+ * Encodes a byte array to base64 with up to len bytes of input, using the custom bcrypt alphabet.
+ * @function
+ * @param {!Array.} b Byte array
+ * @param {number} len Maximum input length
+ * @returns {string}
+ * @expose
+ */
+ bcrypt.encodeBase64 = base64_encode;
+
+ /**
+ * Decodes a base64 encoded string to up to len bytes of output, using the custom bcrypt alphabet.
+ * @function
+ * @param {string} s String to decode
+ * @param {number} len Maximum output length
+ * @returns {!Array.}
+ * @expose
+ */
+ bcrypt.decodeBase64 = base64_decode;
+
+ return bcrypt;
+}));
diff --git a/node_modules/bcryptjs/dist/bcrypt.min.js b/node_modules/bcryptjs/dist/bcrypt.min.js
new file mode 100644
index 0000000..0fd2f1e
--- /dev/null
+++ b/node_modules/bcryptjs/dist/bcrypt.min.js
@@ -0,0 +1,48 @@
+/*
+ bcrypt.js (c) 2013 Daniel Wirtz
+ Released under the Apache License, Version 2.0
+ see: https://github.com/dcodeIO/bcrypt.js for details
+*/
+(function(u,r){"function"===typeof define&&define.amd?define([],r):"function"===typeof require&&"object"===typeof module&&module&&module.exports?module.exports=r():(u.dcodeIO=u.dcodeIO||{}).bcrypt=r()})(this,function(){function u(e){if("undefined"!==typeof module&&module&&module.exports)try{return require("crypto").randomBytes(e)}catch(d){}try{var c;(self.crypto||self.msCrypto).getRandomValues(c=new Uint32Array(e));return Array.prototype.slice.call(c)}catch(b){}if(!w)throw Error("Neither WebCryptoAPI nor a crypto module is available. Use bcrypt.setRandomFallback to set an alternative");
+return w(e)}function r(e,d){for(var c=0,b=0,a=0,f=e.length;ac?!1:0===b}function H(e){var d=[],c=0;I.encodeUTF16toUTF8(function(){return c>=e.length?null:e.charCodeAt(c++)},function(b){d.push(b)});return d}function x(e,d){var c=0,b=[],a,f;if(0>=d||d>e.length)throw Error("Illegal len: "+d);for(;c>2&63]);a=(a&3)<<4;if(c>=d){b.push(s[a&63]);break}f=e[c++]&255;a|=f>>4&15;b.push(s[a&63]);a=(f&15)<<2;if(c>=d){b.push(s[a&
+63]);break}f=e[c++]&255;a|=f>>6&3;b.push(s[a&63]);b.push(s[f&63])}return b.join("")}function B(e,d){var c=0,b=e.length,a=0,f=[],g,m,h;if(0>=d)throw Error("Illegal len: "+d);for(;c>>0;h|=(m&48)>>4;f.push(z(h));if(++a>=d||c>=b)break;h=e.charCodeAt(c++);g=h>>0;h|=(g&60)>>2;f.push(z(h));if(++a>=d||c>=b)break;h=e.charCodeAt(c++);m=h>>0;h|=m;f.push(z(h));++a}b=[];for(c=0;c>>24];a+=b[256|f>>16&255];a^=b[512|f>>8&255];a+=b[768|f&255];g=g^a^c[1];a=b[g>>>24];a+=b[256|g>>16&255];a^=b[512|g>>8&255];a+=b[768|g&255];f=f^a^c[2];a=b[f>>>24];a+=b[256|f>>16&255];a^=b[512|f>>8&255];a+=b[768|f&255];g=g^a^c[3];a=b[g>>>24];a+=b[256|g>>16&255];a^=b[512|g>>8&255];a+=b[768|g&255];f=f^a^c[4];a=b[f>>>24];a+=b[256|f>>16&255];a^=b[512|
+f>>8&255];a+=b[768|f&255];g=g^a^c[5];a=b[g>>>24];a+=b[256|g>>16&255];a^=b[512|g>>8&255];a+=b[768|g&255];f=f^a^c[6];a=b[f>>>24];a+=b[256|f>>16&255];a^=b[512|f>>8&255];a+=b[768|f&255];g=g^a^c[7];a=b[g>>>24];a+=b[256|g>>16&255];a^=b[512|g>>8&255];a+=b[768|g&255];f=f^a^c[8];a=b[f>>>24];a+=b[256|f>>16&255];a^=b[512|f>>8&255];a+=b[768|f&255];g=g^a^c[9];a=b[g>>>24];a+=b[256|g>>16&255];a^=b[512|g>>8&255];a+=b[768|g&255];f=f^a^c[10];a=b[f>>>24];a+=b[256|f>>16&255];a^=b[512|f>>8&255];a+=b[768|f&255];g=g^a^
+c[11];a=b[g>>>24];a+=b[256|g>>16&255];a^=b[512|g>>8&255];a+=b[768|g&255];f=f^a^c[12];a=b[f>>>24];a+=b[256|f>>16&255];a^=b[512|f>>8&255];a+=b[768|f&255];g=g^a^c[13];a=b[g>>>24];a+=b[256|g>>16&255];a^=b[512|g>>8&255];a+=b[768|g&255];f=f^a^c[14];a=b[f>>>24];a+=b[256|f>>16&255];a^=b[512|f>>8&255];a+=b[768|f&255];g=g^a^c[15];a=b[g>>>24];a+=b[256|g>>16&255];a^=b[512|g>>8&255];a+=b[768|g&255];f=f^a^c[16];e[d]=g^c[17];e[d+1]=f;return e}function t(e,d){for(var c=0,b=0;4>c;++c)b=b<<8|e[d]&255,d=(d+1)%e.length;
+return{key:b,offp:d}}function C(e,d,c){for(var b=0,a=[0,0],f=d.length,g=c.length,m,h=0;hn;n++)for(y=0;y>1;y++)v(g,y<<1,l,k);h=[];for(n=0;n>24&255)>>>0),h.push((g[n]>>16&255)>>>0),h.push((g[n]>>8&255)>>>0),h.push((g[n]&255)>>>0);if(b){b(null,h);return}return h}b&&p(f)}var g=E.slice(),m=g.length,h;if(4>c||31>>0;var l,k,n=0,y;Int32Array?(l=new Int32Array(F),k=new Int32Array(G)):(l=F.slice(),k=G.slice());J(d,e,l,k);if("undefined"!==typeof b)f();else for(;;)if("undefined"!==typeof(h=f()))return h||[]}function A(e,d,c,b){function a(a){var b=[];b.push("$2");"a"<=f&&b.push(f);b.push("$");10>l&&b.push("0");b.push(l.toString());b.push("$");b.push(x(k,k.length));b.push(x(a,4*
+E.length-1));return b.join("")}if("string"!==typeof e||"string"!==typeof d){b=Error("Invalid string / salt: Not a string");if(c){p(c.bind(this,b));return}throw b;}var f,g;if("$"!==d.charAt(0)||"2"!==d.charAt(1)){b=Error("Invalid salt version: "+d.substring(0,2));if(c){p(c.bind(this,b));return}throw b;}if("$"===d.charAt(2))f=String.fromCharCode(0),g=3;else{f=d.charAt(2);if("a"!==f&&"b"!==f&&"y"!==f||"$"!==d.charAt(3)){b=Error("Invalid salt revision: "+d.substring(2,4));if(c){p(c.bind(this,b));return}throw b;
+}g=4}if("$"e?e=4:31e&&c.push("0");c.push(e.toString());c.push("$");c.push(x(u(16),16));return c.join("")};k.genSalt=function(e,d,c){function b(a){p(function(){try{a(null,k.genSaltSync(e))}catch(b){a(b)}})}"function"===typeof d&&(c=d,d=void 0);"function"===typeof e&&(c=e,e=void 0);if("undefined"===typeof e)e=10;else if("number"!==typeof e)throw Error("illegal arguments: "+typeof e);if(c){if("function"!==typeof c)throw Error("Illegal callback: "+
+typeof c);b(c)}else return new Promise(function(a,c){b(function(b,d){b?c(b):a(d)})})};k.hashSync=function(e,d){"undefined"===typeof d&&(d=10);"number"===typeof d&&(d=k.genSaltSync(d));if("string"!==typeof e||"string"!==typeof d)throw Error("Illegal arguments: "+typeof e+", "+typeof d);return A(e,d)};k.hash=function(e,d,c,b){function a(a){"string"===typeof e&&"number"===typeof d?k.genSalt(d,function(c,d){A(e,d,a,b)}):"string"===typeof e&&"string"===typeof d?A(e,d,a,b):p(a.bind(this,Error("Illegal arguments: "+
+typeof e+", "+typeof d)))}if(c){if("function"!==typeof c)throw Error("Illegal callback: "+typeof c);a(c)}else return new Promise(function(b,c){a(function(a,d){a?c(a):b(d)})})};k.compareSync=function(e,d){if("string"!==typeof e||"string"!==typeof d)throw Error("Illegal arguments: "+typeof e+", "+typeof d);return 60!==d.length?!1:r(k.hashSync(e,d.substr(0,d.length-31)),d)};k.compare=function(e,d,c,b){function a(a){"string"!==typeof e||"string"!==typeof d?p(a.bind(this,Error("Illegal arguments: "+typeof e+
+", "+typeof d))):60!==d.length?p(a.bind(this,null,!1)):k.hash(e,d.substr(0,29),function(b,c){b?a(b):a(null,r(c,d))},b)}if(c){if("function"!==typeof c)throw Error("Illegal callback: "+typeof c);a(c)}else return new Promise(function(b,c){a(function(a,d){a?c(a):b(d)})})};k.getRounds=function(e){if("string"!==typeof e)throw Error("Illegal arguments: "+typeof e);return parseInt(e.split("$")[2],10)};k.getSalt=function(e){if("string"!==typeof e)throw Error("Illegal arguments: "+typeof e);if(60!==e.length)throw Error("Illegal hash length: "+
+e.length+" != 60");return e.substring(0,29)};var p="undefined"!==typeof process&&process&&"function"===typeof process.nextTick?"function"===typeof setImmediate?setImmediate:process.nextTick:setTimeout,s="./ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789".split(""),q=[-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,0,1,54,55,56,57,58,59,60,61,62,63,-1,-1,-1,-1,-1,-1,-1,2,3,4,5,6,7,8,9,10,11,12,
+13,14,15,16,17,18,19,20,21,22,23,24,25,26,27,-1,-1,-1,-1,-1,-1,28,29,30,31,32,33,34,35,36,37,38,39,40,41,42,43,44,45,46,47,48,49,50,51,52,53,-1,-1,-1,-1,-1],z=String.fromCharCode,I=function(){var e={MAX_CODEPOINT:1114111,encodeUTF8:function(d,c){var b=null;"number"===typeof d&&(b=d,d=function(){return null});for(;null!==b||null!==(b=d());)128>b?c(b&127):(2048>b?c(b>>6&31|192):(65536>b?c(b>>12&15|224):(c(b>>18&7|240),c(b>>12&63|128)),c(b>>6&63|128)),c(b&63|128)),b=null},decodeUTF8:function(d,c){for(var b,
+a,f,e,k=function(a){a=a.slice(0,a.indexOf(null));var b=Error(a.toString());b.name="TruncatedError";b.bytes=a;throw b;};null!==(b=d());)if(0===(b&128))c(b);else if(192===(b&224))null===(a=d())&&k([b,a]),c((b&31)<<6|a&63);else if(224===(b&240))null!==(a=d())&&null!==(f=d())||k([b,a,f]),c((b&15)<<12|(a&63)<<6|f&63);else if(240===(b&248))null!==(a=d())&&null!==(f=d())&&null!==(e=d())||k([b,a,f,e]),c((b&7)<<18|(a&63)<<12|(f&63)<<6|e&63);else throw RangeError("Illegal starting byte: "+b);},UTF16toUTF8:function(d,
+c){for(var b,a=null;null!==(b=null!==a?a:d());)55296<=b&&57343>=b&&null!==(a=d())&&56320<=a&&57343>=a?(c(1024*(b-55296)+a-56320+65536),a=null):c(b);null!==a&&c(a)},UTF8toUTF16:function(d,c){var b=null;"number"===typeof d&&(b=d,d=function(){return null});for(;null!==b||null!==(b=d());)65535>=b?c(b):(b-=65536,c((b>>10)+55296),c(b%1024+56320)),b=null},encodeUTF16toUTF8:function(d,c){e.UTF16toUTF8(d,function(b){e.encodeUTF8(b,c)})},decodeUTF8toUTF16:function(d,c){e.decodeUTF8(d,function(b){e.UTF8toUTF16(b,
+c)})},calculateCodePoint:function(d){return 128>d?1:2048>d?2:65536>d?3:4},calculateUTF8:function(d){for(var c,b=0;null!==(c=d());)b+=e.calculateCodePoint(c);return b},calculateUTF16asUTF8:function(d){var c=0,b=0;e.UTF16toUTF8(d,function(a){++c;b+=e.calculateCodePoint(a)});return[c,b]}};return e}();Date.now=Date.now||function(){return+new Date};var F=[608135816,2242054355,320440878,57701188,2752067618,698298832,137296536,3964562569,1160258022,953160567,3193202383,887688300,3232508343,3380367581,1065670069,
+3041331479,2450970073,2306472731],G=[3509652390,2564797868,805139163,3491422135,3101798381,1780907670,3128725573,4046225305,614570311,3012652279,134345442,2240740374,1667834072,1901547113,2757295779,4103290238,227898511,1921955416,1904987480,2182433518,2069144605,3260701109,2620446009,720527379,3318853667,677414384,3393288472,3101374703,2390351024,1614419982,1822297739,2954791486,3608508353,3174124327,2024746970,1432378464,3864339955,2857741204,1464375394,1676153920,1439316330,715854006,3033291828,
+289532110,2706671279,2087905683,3018724369,1668267050,732546397,1947742710,3462151702,2609353502,2950085171,1814351708,2050118529,680887927,999245976,1800124847,3300911131,1713906067,1641548236,4213287313,1216130144,1575780402,4018429277,3917837745,3693486850,3949271944,596196993,3549867205,258830323,2213823033,772490370,2760122372,1774776394,2652871518,566650946,4142492826,1728879713,2882767088,1783734482,3629395816,2517608232,2874225571,1861159788,326777828,3124490320,2130389656,2716951837,967770486,
+1724537150,2185432712,2364442137,1164943284,2105845187,998989502,3765401048,2244026483,1075463327,1455516326,1322494562,910128902,469688178,1117454909,936433444,3490320968,3675253459,1240580251,122909385,2157517691,634681816,4142456567,3825094682,3061402683,2540495037,79693498,3249098678,1084186820,1583128258,426386531,1761308591,1047286709,322548459,995290223,1845252383,2603652396,3431023940,2942221577,3202600964,3727903485,1712269319,422464435,3234572375,1170764815,3523960633,3117677531,1434042557,
+442511882,3600875718,1076654713,1738483198,4213154764,2393238008,3677496056,1014306527,4251020053,793779912,2902807211,842905082,4246964064,1395751752,1040244610,2656851899,3396308128,445077038,3742853595,3577915638,679411651,2892444358,2354009459,1767581616,3150600392,3791627101,3102740896,284835224,4246832056,1258075500,768725851,2589189241,3069724005,3532540348,1274779536,3789419226,2764799539,1660621633,3471099624,4011903706,913787905,3497959166,737222580,2514213453,2928710040,3937242737,1804850592,
+3499020752,2949064160,2386320175,2390070455,2415321851,4061277028,2290661394,2416832540,1336762016,1754252060,3520065937,3014181293,791618072,3188594551,3933548030,2332172193,3852520463,3043980520,413987798,3465142937,3030929376,4245938359,2093235073,3534596313,375366246,2157278981,2479649556,555357303,3870105701,2008414854,3344188149,4221384143,3956125452,2067696032,3594591187,2921233993,2428461,544322398,577241275,1471733935,610547355,4027169054,1432588573,1507829418,2025931657,3646575487,545086370,
+48609733,2200306550,1653985193,298326376,1316178497,3007786442,2064951626,458293330,2589141269,3591329599,3164325604,727753846,2179363840,146436021,1461446943,4069977195,705550613,3059967265,3887724982,4281599278,3313849956,1404054877,2845806497,146425753,1854211946,1266315497,3048417604,3681880366,3289982499,290971E4,1235738493,2632868024,2414719590,3970600049,1771706367,1449415276,3266420449,422970021,1963543593,2690192192,3826793022,1062508698,1531092325,1804592342,2583117782,2714934279,4024971509,
+1294809318,4028980673,1289560198,2221992742,1669523910,35572830,157838143,1052438473,1016535060,1802137761,1753167236,1386275462,3080475397,2857371447,1040679964,2145300060,2390574316,1461121720,2956646967,4031777805,4028374788,33600511,2920084762,1018524850,629373528,3691585981,3515945977,2091462646,2486323059,586499841,988145025,935516892,3367335476,2599673255,2839830854,265290510,3972581182,2759138881,3795373465,1005194799,847297441,406762289,1314163512,1332590856,1866599683,4127851711,750260880,
+613907577,1450815602,3165620655,3734664991,3650291728,3012275730,3704569646,1427272223,778793252,1343938022,2676280711,2052605720,1946737175,3164576444,3914038668,3967478842,3682934266,1661551462,3294938066,4011595847,840292616,3712170807,616741398,312560963,711312465,1351876610,322626781,1910503582,271666773,2175563734,1594956187,70604529,3617834859,1007753275,1495573769,4069517037,2549218298,2663038764,504708206,2263041392,3941167025,2249088522,1514023603,1998579484,1312622330,694541497,2582060303,
+2151582166,1382467621,776784248,2618340202,3323268794,2497899128,2784771155,503983604,4076293799,907881277,423175695,432175456,1378068232,4145222326,3954048622,3938656102,3820766613,2793130115,2977904593,26017576,3274890735,3194772133,1700274565,1756076034,4006520079,3677328699,720338349,1533947780,354530856,688349552,3973924725,1637815568,332179504,3949051286,53804574,2852348879,3044236432,1282449977,3583942155,3416972820,4006381244,1617046695,2628476075,3002303598,1686838959,431878346,2686675385,
+1700445008,1080580658,1009431731,832498133,3223435511,2605976345,2271191193,2516031870,1648197032,4164389018,2548247927,300782431,375919233,238389289,3353747414,2531188641,2019080857,1475708069,455242339,2609103871,448939670,3451063019,1395535956,2413381860,1841049896,1491858159,885456874,4264095073,4001119347,1565136089,3898914787,1108368660,540939232,1173283510,2745871338,3681308437,4207628240,3343053890,4016749493,1699691293,1103962373,3625875870,2256883143,3830138730,1031889488,3479347698,1535977030,
+4236805024,3251091107,2132092099,1774941330,1199868427,1452454533,157007616,2904115357,342012276,595725824,1480756522,206960106,497939518,591360097,863170706,2375253569,3596610801,1814182875,2094937945,3421402208,1082520231,3463918190,2785509508,435703966,3908032597,1641649973,2842273706,3305899714,1510255612,2148256476,2655287854,3276092548,4258621189,236887753,3681803219,274041037,1734335097,3815195456,3317970021,1899903192,1026095262,4050517792,356393447,2410691914,3873677099,3682840055,3913112168,
+2491498743,4132185628,2489919796,1091903735,1979897079,3170134830,3567386728,3557303409,857797738,1136121015,1342202287,507115054,2535736646,337727348,3213592640,1301675037,2528481711,1895095763,1721773893,3216771564,62756741,2142006736,835421444,2531993523,1442658625,3659876326,2882144922,676362277,1392781812,170690266,3921047035,1759253602,3611846912,1745797284,664899054,1329594018,3901205900,3045908486,2062866102,2865634940,3543621612,3464012697,1080764994,553557557,3656615353,3996768171,991055499,
+499776247,1265440854,648242737,3940784050,980351604,3713745714,1749149687,3396870395,4211799374,3640570775,1161844396,3125318951,1431517754,545492359,4268468663,3499529547,1437099964,2702547544,3433638243,2581715763,2787789398,1060185593,1593081372,2418618748,4260947970,69676912,2159744348,86519011,2512459080,3838209314,1220612927,3339683548,133810670,1090789135,1078426020,1569222167,845107691,3583754449,4072456591,1091646820,628848692,1613405280,3757631651,526609435,236106946,48312990,2942717905,
+3402727701,1797494240,859738849,992217954,4005476642,2243076622,3870952857,3732016268,765654824,3490871365,2511836413,1685915746,3888969200,1414112111,2273134842,3281911079,4080962846,172450625,2569994100,980381355,4109958455,2819808352,2716589560,2568741196,3681446669,3329971472,1835478071,660984891,3704678404,4045999559,3422617507,3040415634,1762651403,1719377915,3470491036,2693910283,3642056355,3138596744,1364962596,2073328063,1983633131,926494387,3423689081,2150032023,4096667949,1749200295,3328846651,
+309677260,2016342300,1779581495,3079819751,111262694,1274766160,443224088,298511866,1025883608,3806446537,1145181785,168956806,3641502830,3584813610,1689216846,3666258015,3200248200,1692713982,2646376535,4042768518,1618508792,1610833997,3523052358,4130873264,2001055236,3610705100,2202168115,4028541809,2961195399,1006657119,2006996926,3186142756,1430667929,3210227297,1314452623,4074634658,4101304120,2273951170,1399257539,3367210612,3027628629,1190975929,2062231137,2333990788,2221543033,2438960610,
+1181637006,548689776,2362791313,3372408396,3104550113,3145860560,296247880,1970579870,3078560182,3769228297,1714227617,3291629107,3898220290,166772364,1251581989,493813264,448347421,195405023,2709975567,677966185,3703036547,1463355134,2715995803,1338867538,1343315457,2802222074,2684532164,233230375,2599980071,2000651841,3277868038,1638401717,4028070440,3237316320,6314154,819756386,300326615,590932579,1405279636,3267499572,3150704214,2428286686,3959192993,3461946742,1862657033,1266418056,963775037,
+2089974820,2263052895,1917689273,448879540,3550394620,3981727096,150775221,3627908307,1303187396,508620638,2975983352,2726630617,1817252668,1876281319,1457606340,908771278,3720792119,3617206836,2455994898,1729034894,1080033504,976866871,3556439503,2881648439,1522871579,1555064734,1336096578,3548522304,2579274686,3574697629,3205460757,3593280638,3338716283,3079412587,564236357,2993598910,1781952180,1464380207,3163844217,3332601554,1699332808,1393555694,1183702653,3581086237,1288719814,691649499,2847557200,
+2895455976,3193889540,2717570544,1781354906,1676643554,2592534050,3230253752,1126444790,2770207658,2633158820,2210423226,2615765581,2414155088,3127139286,673620729,2805611233,1269405062,4015350505,3341807571,4149409754,1057255273,2012875353,2162469141,2276492801,2601117357,993977747,3918593370,2654263191,753973209,36408145,2530585658,25011837,3520020182,2088578344,530523599,2918365339,1524020338,1518925132,3760827505,3759777254,1202760957,3985898139,3906192525,674977740,4174734889,2031300136,2019492241,
+3983892565,4153806404,3822280332,352677332,2297720250,60907813,90501309,3286998549,1016092578,2535922412,2839152426,457141659,509813237,4120667899,652014361,1966332200,2975202805,55981186,2327461051,676427537,3255491064,2882294119,3433927263,1307055953,942726286,933058658,2468411793,3933900994,4215176142,1361170020,2001714738,2830558078,3274259782,1222529897,1679025792,2729314320,3714953764,1770335741,151462246,3013232138,1682292957,1483529935,471910574,1539241949,458788160,3436315007,1807016891,
+3718408830,978976581,1043663428,3165965781,1927990952,4200891579,2372276910,3208408903,3533431907,1412390302,2931980059,4132332400,1947078029,3881505623,4168226417,2941484381,1077988104,1320477388,886195818,18198404,3786409E3,2509781533,112762804,3463356488,1866414978,891333506,18488651,661792760,1628790961,3885187036,3141171499,876946877,2693282273,1372485963,791857591,2686433993,3759982718,3167212022,3472953795,2716379847,445679433,3561995674,3504004811,3574258232,54117162,3331405415,2381918588,
+3769707343,4154350007,1140177722,4074052095,668550556,3214352940,367459370,261225585,2610173221,4209349473,3468074219,3265815641,314222801,3066103646,3808782860,282218597,3406013506,3773591054,379116347,1285071038,846784868,2669647154,3771962079,3550491691,2305946142,453669953,1268987020,3317592352,3279303384,3744833421,2610507566,3859509063,266596637,3847019092,517658769,3462560207,3443424879,370717030,4247526661,2224018117,4143653529,4112773975,2788324899,2477274417,1456262402,2901442914,1517677493,
+1846949527,2295493580,3734397586,2176403920,1280348187,1908823572,3871786941,846861322,1172426758,3287448474,3383383037,1655181056,3139813346,901632758,1897031941,2986607138,3066810236,3447102507,1393639104,373351379,950779232,625454576,3124240540,4148612726,2007998917,544563296,2244738638,2330496472,2058025392,1291430526,424198748,50039436,29584100,3605783033,2429876329,2791104160,1057563949,3255363231,3075367218,3463963227,1469046755,985887462],E=[1332899944,1700884034,1701343084,1684370003,1668446532,
+1869963892];k.encodeBase64=x;k.decodeBase64=B;return k});
diff --git a/node_modules/bcryptjs/dist/bcrypt.min.js.gz b/node_modules/bcryptjs/dist/bcrypt.min.js.gz
new file mode 100644
index 0000000..6bde4bd
Binary files /dev/null and b/node_modules/bcryptjs/dist/bcrypt.min.js.gz differ
diff --git a/node_modules/bcryptjs/dist/bcrypt.min.map b/node_modules/bcryptjs/dist/bcrypt.min.map
new file mode 100644
index 0000000..35d0f83
--- /dev/null
+++ b/node_modules/bcryptjs/dist/bcrypt.min.map
@@ -0,0 +1,8 @@
+{
+"version":3,
+"file":"",
+"lineCount":48,
+"mappings":"A;;;;;AAiCC,SAAQ,CAACA,CAAD,CAASC,CAAT,CAAkB,CAES,UAAtB,GAAI,MAAOC,OAAX,EAAoCA,MAAA,IAApC,CACNA,MAAA,CAAO,EAAP,CAAWD,CAAX,CADM,CAEiC,UAAvB,GAAI,MAAOE,QAAX,EAAuD,QAAvD,GAAqC,MAAOC,OAA5C,EAAmEA,MAAnE,EAA6EA,MAAA,QAA7E,CAChBA,MAAA,QADgB,CACIH,CAAA,EADJ,CAGhB,CAACD,CAAA,QAAD,CAAqBA,CAAA,QAArB,EAA0C,EAA1C,QAHgB,CAG0CC,CAAA,EAPvC,CAA1B,CAAA,CASC,IATD,CASO,QAAQ,EAAG,CAwBfI,QAASA,EAAM,CAACC,CAAD,CAAM,CACN,GAAsB,WAAtB,GAAI,MAAOF,OAAX,EAAqCA,MAArC,EAA+CA,MAAA,QAA/C,CACP,GAAI,CACA,MAAOD,QAAA,CAAQ,QAAR,CAAA,YAAA,CAAiCG,CAAjC,CADP,CAEF,MAAOC,CAAP,CAAU,EACN,GAAI,CACV,IAAIC,CAAG,EAACC,IAAA,OAAD,EAAiBA,IAAA,SAAjB,iBAAA,CAAsDD,CAAtD,CAA0D,IAAIE,WAAJ,CAAgBJ,CAAhB,CAA1D,CACP,OAAOK,MAAAC,UAAAC,MAAAC,KAAA,CAA2BN,CAA3B,CAFG,CAGZ,MAAOD,CAAP,CAAU,EACG,GAAKQ,CAAAA,CAAL,CACX,KAAMC,MAAA,CAAM,2GAAN,CAAN;AACJ,MAAOD,EAAA,CAAeT,CAAf,CAXU,CA6KrBW,QAASA,EAAiB,CAACC,CAAD,CAAQC,CAAR,CAAiB,CAGvC,IAHuC,IACnCC,EAAQ,CAD2B,CAEnCC,EAAQ,CAF2B,CAG9BC,EAAE,CAH4B,CAGzBC,EAAEL,CAAAM,OAAhB,CAA8BF,CAA9B,CAAgCC,CAAhC,CAAmC,EAAED,CAArC,CACQJ,CAAAO,WAAA,CAAiBH,CAAjB,CAAJ,GAA4BH,CAAAM,WAAA,CAAmBH,CAAnB,CAA5B,CACI,EAAEF,CADN,CAGI,EAAEC,CAGV,OAAY,EAAZ,CAAID,CAAJ,CACW,CAAA,CADX,CAEiB,CAFjB,GAEOC,CAZgC,CAyH3CK,QAASA,EAAa,CAACC,CAAD,CAAM,CAAA,IACpBC,EAAM,EADc,CAEpBN,EAAI,CACRO,EAAAC,kBAAA,CAAuB,QAAQ,EAAG,CAC9B,MAAIR,EAAJ,EAASK,CAAAH,OAAT,CAA4B,IAA5B,CACOG,CAAAF,WAAA,CAAeH,CAAA,EAAf,CAFuB,CAAlC,CAGG,QAAQ,CAACS,CAAD,CAAI,CACXH,CAAAI,KAAA,CAASD,CAAT,CADW,CAHf,CAMA,OAAOH,EATiB,CAiD5BK,QAASA,EAAa,CAACF,CAAD,CAAIzB,CAAJ,CAAS,CAAA,IACvB4B,EAAM,CADiB,CAEvBC,EAAK,EAFkB,CAGvBC,CAHuB,CAGnBC,CACR,IAAW,CAAX,EAAI/B,CAAJ,EAAgBA,CAAhB,CAAsByB,CAAAP,OAAtB,CACI,KAAMR,MAAA,CAAM,eAAN,CAAsBV,CAAtB,CAAN,CACJ,IAAA,CAAO4B,CAAP,CAAa5B,CAAb,CAAA,CAAkB,CACd8B,CAAA,CAAKL,CAAA,CAAEG,CAAA,EAAF,CAAL,CAAgB,GAChBC,EAAAH,KAAA,CAAQM,CAAA,CAAaF,CAAb,EAAmB,CAAnB,CAAwB,EAAxB,CAAR,CACAA,EAAA,EAAMA,CAAN,CAAW,CAAX,GAAoB,CACpB,IAAIF,CAAJ,EAAW5B,CAAX,CAAgB,CACZ6B,CAAAH,KAAA,CAAQM,CAAA,CAAYF,CAAZ,CAAiB,EAAjB,CAAR,CACA,MAFY,CAIhBC,CAAA,CAAKN,CAAA,CAAEG,CAAA,EAAF,CAAL,CAAgB,GAChBE,EAAA,EAAOC,CAAP,EAAa,CAAb,CAAkB,EAClBF,EAAAH,KAAA,CAAQM,CAAA,CAAYF,CAAZ,CAAiB,EAAjB,CAAR,CACAA,EAAA,EAAMC,CAAN,CAAW,EAAX,GAAoB,CACpB,IAAIH,CAAJ,EAAW5B,CAAX,CAAgB,CACZ6B,CAAAH,KAAA,CAAQM,CAAA,CAAYF,CAAZ;AAAiB,EAAjB,CAAR,CACA,MAFY,CAIhBC,CAAA,CAAKN,CAAA,CAAEG,CAAA,EAAF,CAAL,CAAgB,GAChBE,EAAA,EAAOC,CAAP,EAAa,CAAb,CAAkB,CAClBF,EAAAH,KAAA,CAAQM,CAAA,CAAYF,CAAZ,CAAiB,EAAjB,CAAR,CACAD,EAAAH,KAAA,CAAQM,CAAA,CAAYD,CAAZ,CAAiB,EAAjB,CAAR,CAnBc,CAqBlB,MAAOF,EAAAI,KAAA,CAAQ,EAAR,CA3BoB,CAqC/BC,QAASA,EAAa,CAACC,CAAD,CAAInC,CAAJ,CAAS,CAAA,IACvB4B,EAAM,CADiB,CAEvBQ,EAAOD,CAAAjB,OAFgB,CAGvBmB,EAAO,CAHgB,CAIvBR,EAAK,EAJkB,CAKvBC,CALuB,CAKnBC,CALmB,CAKPO,CACpB,IAAW,CAAX,EAAItC,CAAJ,CACI,KAAMU,MAAA,CAAM,eAAN,CAAsBV,CAAtB,CAAN,CACJ,IAAA,CAAO4B,CAAP,CAAaQ,CAAb,CAAoB,CAApB,EAAyBC,CAAzB,CAAgCrC,CAAhC,CAAA,CAAqC,CACjCuC,CAAA,CAAOJ,CAAAhB,WAAA,CAAaS,CAAA,EAAb,CACPE,EAAA,CAAKS,CAAA,CAAOC,CAAAtB,OAAP,CAA6BsB,CAAA,CAAaD,CAAb,CAA7B,CAAmD,EACxDA,EAAA,CAAOJ,CAAAhB,WAAA,CAAaS,CAAA,EAAb,CACPG,EAAA,CAAKQ,CAAA,CAAOC,CAAAtB,OAAP,CAA6BsB,CAAA,CAAaD,CAAb,CAA7B,CAAmD,EACxD,IAAW,EAAX,EAAIT,CAAJ,EAAuB,EAAvB,EAAgBC,CAAhB,CACI,KACJO,EAAA,CAAKR,CAAL,EAAW,CAAX,GAAkB,CAClBQ,EAAA,GAAMP,CAAN,CAAW,EAAX,GAAoB,CACpBF,EAAAH,KAAA,CAAQe,CAAA,CAAmBH,CAAnB,CAAR,CACA,IAAI,EAAED,CAAN,EAAcrC,CAAd,EAAqB4B,CAArB,EAA4BQ,CAA5B,CACI,KACJG,EAAA,CAAOJ,CAAAhB,WAAA,CAAaS,CAAA,EAAb,CACPc,EAAA,CAAKH,CAAA,CAAOC,CAAAtB,OAAP,CAA6BsB,CAAA,CAAaD,CAAb,CAA7B,CAAmD,EACxD,IAAW,EAAX,EAAIG,CAAJ,CACI,KACJJ,EAAA,EAAMP,CAAN,CAAW,EAAX,GAAoB,CAApB,GAA2B,CAC3BO,EAAA,GAAMI,CAAN,CAAW,EAAX,GAAoB,CACpBb,EAAAH,KAAA,CAAQe,CAAA,CAAmBH,CAAnB,CAAR,CACA,IAAI,EAAED,CAAN,EAAcrC,CAAd,EAAqB4B,CAArB,EAA4BQ,CAA5B,CACI,KACJG,EAAA,CAAOJ,CAAAhB,WAAA,CAAaS,CAAA,EAAb,CACPe,EAAA,CAAKJ,CAAA,CAAOC,CAAAtB,OAAP;AAA6BsB,CAAA,CAAaD,CAAb,CAA7B,CAAmD,EACxDD,EAAA,EAAMI,CAAN,CAAW,CAAX,GAAoB,CAApB,GAA2B,CAC3BJ,EAAA,EAAKK,CACLd,EAAAH,KAAA,CAAQe,CAAA,CAAmBH,CAAnB,CAAR,CACA,GAAED,CA1B+B,CA4BjCO,CAAAA,CAAM,EACV,KAAKhB,CAAL,CAAW,CAAX,CAAcA,CAAd,CAAkBS,CAAlB,CAAwBT,CAAA,EAAxB,CACIgB,CAAAlB,KAAA,CAASG,CAAA,CAAGD,CAAH,CAAAT,WAAA,CAAmB,CAAnB,CAAT,CACJ,OAAOyB,EAvCoB,CAggB/BC,QAASA,EAAS,CAACC,CAAD,CAAKlB,CAAL,CAAUmB,CAAV,CAAaC,CAAb,CAAgB,CAAA,IAC1BC,CAD0B,CAE1BC,EAAIJ,CAAA,CAAGlB,CAAH,CAFsB,CAG1BuB,EAAIL,CAAA,CAAGlB,CAAH,CAAS,CAAT,CAHsB,CAK9BsB,EAAAA,CAAAA,CAAKH,CAAA,CAAE,CAAF,CAoBLE,EAAA,CAAKD,CAAA,CAAEE,CAAF,GAAQ,EAAR,CACLD,EAAA,EAAKD,CAAA,CAAE,GAAF,CAAYE,CAAZ,EAAiB,EAAjB,CAAuB,GAAvB,CACLD,EAAA,EAAKD,CAAA,CAAE,GAAF,CAAYE,CAAZ,EAAiB,CAAjB,CAAsB,GAAtB,CACLD,EAAA,EAAKD,CAAA,CAAE,GAAF,CAAWE,CAAX,CAAe,GAAf,CACLC,EAAA,CAAAA,CAAA,CAAKF,CAAL,CAASF,CAAA,CAAE,CAAF,CACTE,EAAA,CAAKD,CAAA,CAAEG,CAAF,GAAQ,EAAR,CACLF,EAAA,EAAKD,CAAA,CAAE,GAAF,CAAYG,CAAZ,EAAiB,EAAjB,CAAuB,GAAvB,CACLF,EAAA,EAAKD,CAAA,CAAE,GAAF,CAAYG,CAAZ,EAAiB,CAAjB,CAAsB,GAAtB,CACLF,EAAA,EAAKD,CAAA,CAAE,GAAF,CAAWG,CAAX,CAAe,GAAf,CACLD,EAAA,CAAAA,CAAA,CAAKD,CAAL,CAASF,CAAA,CAAE,CAAF,CAETE,EAAA,CAAKD,CAAA,CAAEE,CAAF,GAAQ,EAAR,CACLD,EAAA,EAAKD,CAAA,CAAE,GAAF,CAAYE,CAAZ,EAAiB,EAAjB,CAAuB,GAAvB,CACLD,EAAA,EAAKD,CAAA,CAAE,GAAF,CAAYE,CAAZ,EAAiB,CAAjB,CAAsB,GAAtB,CACLD,EAAA,EAAKD,CAAA,CAAE,GAAF,CAAWE,CAAX,CAAe,GAAf,CACLC,EAAA,CAAAA,CAAA,CAAKF,CAAL,CAASF,CAAA,CAAE,CAAF,CACTE,EAAA,CAAKD,CAAA,CAAEG,CAAF,GAAQ,EAAR,CACLF,EAAA,EAAKD,CAAA,CAAE,GAAF,CAAYG,CAAZ,EAAiB,EAAjB,CAAuB,GAAvB,CACLF,EAAA,EAAKD,CAAA,CAAE,GAAF,CAAYG,CAAZ,EAAiB,CAAjB,CAAsB,GAAtB,CACLF,EAAA,EAAKD,CAAA,CAAE,GAAF,CAAWG,CAAX,CAAe,GAAf,CACLD,EAAA,CAAAA,CAAA,CAAKD,CAAL,CAASF,CAAA,CAAE,CAAF,CAETE,EAAA,CAAKD,CAAA,CAAEE,CAAF,GAAQ,EAAR,CACLD,EAAA,EAAKD,CAAA,CAAE,GAAF,CAAYE,CAAZ,EAAiB,EAAjB,CAAuB,GAAvB,CACLD,EAAA,EAAKD,CAAA,CAAE,GAAF;AAAYE,CAAZ,EAAiB,CAAjB,CAAsB,GAAtB,CACLD,EAAA,EAAKD,CAAA,CAAE,GAAF,CAAWE,CAAX,CAAe,GAAf,CACLC,EAAA,CAAAA,CAAA,CAAKF,CAAL,CAASF,CAAA,CAAE,CAAF,CACTE,EAAA,CAAKD,CAAA,CAAEG,CAAF,GAAQ,EAAR,CACLF,EAAA,EAAKD,CAAA,CAAE,GAAF,CAAYG,CAAZ,EAAiB,EAAjB,CAAuB,GAAvB,CACLF,EAAA,EAAKD,CAAA,CAAE,GAAF,CAAYG,CAAZ,EAAiB,CAAjB,CAAsB,GAAtB,CACLF,EAAA,EAAKD,CAAA,CAAE,GAAF,CAAWG,CAAX,CAAe,GAAf,CACLD,EAAA,CAAAA,CAAA,CAAKD,CAAL,CAASF,CAAA,CAAE,CAAF,CAETE,EAAA,CAAKD,CAAA,CAAEE,CAAF,GAAQ,EAAR,CACLD,EAAA,EAAKD,CAAA,CAAE,GAAF,CAAYE,CAAZ,EAAiB,EAAjB,CAAuB,GAAvB,CACLD,EAAA,EAAKD,CAAA,CAAE,GAAF,CAAYE,CAAZ,EAAiB,CAAjB,CAAsB,GAAtB,CACLD,EAAA,EAAKD,CAAA,CAAE,GAAF,CAAWE,CAAX,CAAe,GAAf,CACLC,EAAA,CAAAA,CAAA,CAAKF,CAAL,CAASF,CAAA,CAAE,CAAF,CACTE,EAAA,CAAKD,CAAA,CAAEG,CAAF,GAAQ,EAAR,CACLF,EAAA,EAAKD,CAAA,CAAE,GAAF,CAAYG,CAAZ,EAAiB,EAAjB,CAAuB,GAAvB,CACLF,EAAA,EAAKD,CAAA,CAAE,GAAF,CAAYG,CAAZ,EAAiB,CAAjB,CAAsB,GAAtB,CACLF,EAAA,EAAKD,CAAA,CAAE,GAAF,CAAWG,CAAX,CAAe,GAAf,CACLD,EAAA,CAAAA,CAAA,CAAKD,CAAL,CAASF,CAAA,CAAE,CAAF,CAETE,EAAA,CAAKD,CAAA,CAAEE,CAAF,GAAQ,EAAR,CACLD,EAAA,EAAKD,CAAA,CAAE,GAAF,CAAYE,CAAZ,EAAiB,EAAjB,CAAuB,GAAvB,CACLD,EAAA,EAAKD,CAAA,CAAE,GAAF,CAAYE,CAAZ,EAAiB,CAAjB,CAAsB,GAAtB,CACLD,EAAA,EAAKD,CAAA,CAAE,GAAF,CAAWE,CAAX,CAAe,GAAf,CACLC,EAAA,CAAAA,CAAA,CAAKF,CAAL,CAASF,CAAA,CAAE,CAAF,CACTE,EAAA,CAAKD,CAAA,CAAEG,CAAF,GAAQ,EAAR,CACLF,EAAA,EAAKD,CAAA,CAAE,GAAF,CAAYG,CAAZ,EAAiB,EAAjB,CAAuB,GAAvB,CACLF,EAAA,EAAKD,CAAA,CAAE,GAAF,CAAYG,CAAZ,EAAiB,CAAjB,CAAsB,GAAtB,CACLF,EAAA,EAAKD,CAAA,CAAE,GAAF,CAAWG,CAAX,CAAe,GAAf,CACLD,EAAA,CAAAA,CAAA,CAAKD,CAAL,CAASF,CAAA,CAAE,EAAF,CAETE,EAAA,CAAKD,CAAA,CAAEE,CAAF,GAAQ,EAAR,CACLD,EAAA,EAAKD,CAAA,CAAE,GAAF,CAAYE,CAAZ,EAAiB,EAAjB,CAAuB,GAAvB,CACLD,EAAA,EAAKD,CAAA,CAAE,GAAF,CAAYE,CAAZ,EAAiB,CAAjB,CAAsB,GAAtB,CACLD,EAAA,EAAKD,CAAA,CAAE,GAAF,CAAWE,CAAX,CAAe,GAAf,CACLC,EAAA,CAAAA,CAAA,CAAKF,CAAL;AAASF,CAAA,CAAE,EAAF,CACTE,EAAA,CAAKD,CAAA,CAAEG,CAAF,GAAQ,EAAR,CACLF,EAAA,EAAKD,CAAA,CAAE,GAAF,CAAYG,CAAZ,EAAiB,EAAjB,CAAuB,GAAvB,CACLF,EAAA,EAAKD,CAAA,CAAE,GAAF,CAAYG,CAAZ,EAAiB,CAAjB,CAAsB,GAAtB,CACLF,EAAA,EAAKD,CAAA,CAAE,GAAF,CAAWG,CAAX,CAAe,GAAf,CACLD,EAAA,CAAAA,CAAA,CAAKD,CAAL,CAASF,CAAA,CAAE,EAAF,CAETE,EAAA,CAAKD,CAAA,CAAEE,CAAF,GAAQ,EAAR,CACLD,EAAA,EAAKD,CAAA,CAAE,GAAF,CAAYE,CAAZ,EAAiB,EAAjB,CAAuB,GAAvB,CACLD,EAAA,EAAKD,CAAA,CAAE,GAAF,CAAYE,CAAZ,EAAiB,CAAjB,CAAsB,GAAtB,CACLD,EAAA,EAAKD,CAAA,CAAE,GAAF,CAAWE,CAAX,CAAe,GAAf,CACLC,EAAA,CAAAA,CAAA,CAAKF,CAAL,CAASF,CAAA,CAAE,EAAF,CACTE,EAAA,CAAKD,CAAA,CAAEG,CAAF,GAAQ,EAAR,CACLF,EAAA,EAAKD,CAAA,CAAE,GAAF,CAAYG,CAAZ,EAAiB,EAAjB,CAAuB,GAAvB,CACLF,EAAA,EAAKD,CAAA,CAAE,GAAF,CAAYG,CAAZ,EAAiB,CAAjB,CAAsB,GAAtB,CACLF,EAAA,EAAKD,CAAA,CAAE,GAAF,CAAWG,CAAX,CAAe,GAAf,CACLD,EAAA,CAAAA,CAAA,CAAKD,CAAL,CAASF,CAAA,CAAE,EAAF,CAETE,EAAA,CAAKD,CAAA,CAAEE,CAAF,GAAQ,EAAR,CACLD,EAAA,EAAKD,CAAA,CAAE,GAAF,CAAYE,CAAZ,EAAiB,EAAjB,CAAuB,GAAvB,CACLD,EAAA,EAAKD,CAAA,CAAE,GAAF,CAAYE,CAAZ,EAAiB,CAAjB,CAAsB,GAAtB,CACLD,EAAA,EAAKD,CAAA,CAAE,GAAF,CAAWE,CAAX,CAAe,GAAf,CACLC,EAAA,CAAAA,CAAA,CAAKF,CAAL,CAASF,CAAA,CAAE,EAAF,CACTE,EAAA,CAAKD,CAAA,CAAEG,CAAF,GAAQ,EAAR,CACLF,EAAA,EAAKD,CAAA,CAAE,GAAF,CAAYG,CAAZ,EAAiB,EAAjB,CAAuB,GAAvB,CACLF,EAAA,EAAKD,CAAA,CAAE,GAAF,CAAYG,CAAZ,EAAiB,CAAjB,CAAsB,GAAtB,CACLF,EAAA,EAAKD,CAAA,CAAE,GAAF,CAAWG,CAAX,CAAe,GAAf,CACLD,EAAA,CAAAA,CAAA,CAAKD,CAAL,CAASF,CAAA,CAAE,EAAF,CAETD,EAAA,CAAGlB,CAAH,CAAA,CAAUuB,CAAV,CAAcJ,CAAA,CAAE,EAAF,CACdD,EAAA,CAAGlB,CAAH,CAAS,CAAT,CAAA,CAAcsB,CACd,OAAOJ,EAnHuB,CA4HlCM,QAASA,EAAa,CAACC,CAAD,CAAOC,CAAP,CAAa,CAC/B,IAD+B,IACtBtC,EAAI,CADkB,CACfuC,EAAO,CAAvB,CAA8B,CAA9B,CAA0BvC,CAA1B,CAAiC,EAAEA,CAAnC,CACIuC,CACA,CADQA,CACR,EADgB,CAChB,CADsBF,CAAA,CAAKC,CAAL,CACtB,CADmC,GACnC,CAAAA,CAAA,EAAQA,CAAR,CAAe,CAAf,EAAoBD,CAAAnC,OACxB;MAAO,CAAEsC,IAAKD,CAAP,CAAaD,KAAMA,CAAnB,CAJwB,CAanCG,QAASA,EAAI,CAACD,CAAD,CAAMT,CAAN,CAASC,CAAT,CAAY,CAMrB,IANqB,IACjBU,EAAS,CADQ,CAEjBZ,EAAK,CAAC,CAAD,CAAI,CAAJ,CAFY,CAGjBa,EAAOZ,CAAA7B,OAHU,CAIjBkB,EAAOY,CAAA9B,OAJU,CAKjB0C,CALiB,CAMZ5C,EAAI,CAAb,CAAgBA,CAAhB,CAAoB2C,CAApB,CAA0B3C,CAAA,EAA1B,CACI4C,CAEA,CAFKR,CAAA,CAAcI,CAAd,CAAmBE,CAAnB,CAEL,CADAA,CACA,CADSE,CAAAN,KACT,CAAAP,CAAA,CAAE/B,CAAF,CAAA,EAAc4C,CAAAJ,IAClB,KAAKxC,CAAL,CAAS,CAAT,CAAYA,CAAZ,CAAgB2C,CAAhB,CAAsB3C,CAAtB,EAA2B,CAA3B,CACI8B,CAEA,CAFKD,CAAA,CAAUC,CAAV,CAAc,CAAd,CAAiBC,CAAjB,CAAoBC,CAApB,CAEL,CADAD,CAAA,CAAE/B,CAAF,CACA,CADO8B,CAAA,CAAG,CAAH,CACP,CAAAC,CAAA,CAAE/B,CAAF,CAAM,CAAN,CAAA,CAAW8B,CAAA,CAAG,CAAH,CACf,KAAK9B,CAAL,CAAS,CAAT,CAAYA,CAAZ,CAAgBoB,CAAhB,CAAsBpB,CAAtB,EAA2B,CAA3B,CACI8B,CAEA,CAFKD,CAAA,CAAUC,CAAV,CAAc,CAAd,CAAiBC,CAAjB,CAAoBC,CAApB,CAEL,CADAA,CAAA,CAAEhC,CAAF,CACA,CADO8B,CAAA,CAAG,CAAH,CACP,CAAAE,CAAA,CAAEhC,CAAF,CAAM,CAAN,CAAA,CAAW8B,CAAA,CAAG,CAAH,CAjBM,CA4BzBe,QAASA,EAAO,CAACR,CAAD,CAAOG,CAAP,CAAYT,CAAZ,CAAeC,CAAf,CAAkB,CAM9B,IAN8B,IAC1BM,EAAO,CADmB,CAE1BR,EAAK,CAAC,CAAD,CAAI,CAAJ,CAFqB,CAG1Ba,EAAOZ,CAAA7B,OAHmB,CAI1BkB,EAAOY,CAAA9B,OAJmB,CAK1B0C,CAL0B,CAMrB5C,EAAI,CAAb,CAAgBA,CAAhB,CAAoB2C,CAApB,CAA0B3C,CAAA,EAA1B,CACI4C,CAEA,CAFKR,CAAA,CAAcI,CAAd,CAAmBF,CAAnB,CAEL,CADAA,CACA,CADOM,CAAAN,KACP,CAAAP,CAAA,CAAE/B,CAAF,CAAA,EAAc4C,CAAAJ,IAElB,KAAKxC,CAAL,CADAsC,CACA,CADO,CACP,CAAYtC,CAAZ,CAAgB2C,CAAhB,CAAsB3C,CAAtB,EAA2B,CAA3B,CACI4C,CAQA,CARKR,CAAA,CAAcC,CAAd,CAAoBC,CAApB,CAQL,CAPAA,CAOA,CAPOM,CAAAN,KAOP,CANAR,CAAA,CAAG,CAAH,CAMA,EANSc,CAAAJ,IAMT,CALAI,CAKA,CALKR,CAAA,CAAcC,CAAd,CAAoBC,CAApB,CAKL,CAJAA,CAIA,CAJOM,CAAAN,KAIP,CAHAR,CAAA,CAAG,CAAH,CAGA,EAHSc,CAAAJ,IAGT,CAFAV,CAEA,CAFKD,CAAA,CAAUC,CAAV,CAAc,CAAd,CAAiBC,CAAjB,CAAoBC,CAApB,CAEL,CADAD,CAAA,CAAE/B,CAAF,CACA,CADO8B,CAAA,CAAG,CAAH,CACP,CAAAC,CAAA,CAAE/B,CAAF,CAAM,CAAN,CAAA,CAAW8B,CAAA,CAAG,CAAH,CACf,KAAK9B,CAAL,CAAS,CAAT,CAAYA,CAAZ,CAAgBoB,CAAhB,CAAsBpB,CAAtB,EAA2B,CAA3B,CACI4C,CAQA,CARKR,CAAA,CAAcC,CAAd,CAAoBC,CAApB,CAQL,CAPAA,CAOA,CAPOM,CAAAN,KAOP,CANAR,CAAA,CAAG,CAAH,CAMA,EANSc,CAAAJ,IAMT,CALAI,CAKA,CALKR,CAAA,CAAcC,CAAd;AAAoBC,CAApB,CAKL,CAJAA,CAIA,CAJOM,CAAAN,KAIP,CAHAR,CAAA,CAAG,CAAH,CAGA,EAHSc,CAAAJ,IAGT,CAFAV,CAEA,CAFKD,CAAA,CAAUC,CAAV,CAAc,CAAd,CAAiBC,CAAjB,CAAoBC,CAApB,CAEL,CADAA,CAAA,CAAEhC,CAAF,CACA,CADO8B,CAAA,CAAG,CAAH,CACP,CAAAE,CAAA,CAAEhC,CAAF,CAAM,CAAN,CAAA,CAAW8B,CAAA,CAAG,CAAH,CA9Be,CA4ClCgB,QAASA,EAAM,CAACrC,CAAD,CAAIsC,CAAJ,CAAUC,CAAV,CAAkBC,CAAlB,CAA4BC,CAA5B,CAA8C,CA0CzDC,QAASA,EAAI,EAAG,CACRD,CAAJ,EACIA,CAAA,CAAiBlD,CAAjB,CAAqBgD,CAArB,CACJ,IAAIhD,CAAJ,CAAQgD,CAAR,CAEI,IADA,IAAII,EAAQC,IAAAC,IAAA,EACZ,CAAOtD,CAAP,CAAWgD,CAAX,EAIQ,EAHJhD,CAGI,EAHI,CAGJ,CAFJyC,CAAA,CAAKhC,CAAL,CAAQsB,CAAR,CAAWC,CAAX,CAEI,CADJS,CAAA,CAAKM,CAAL,CAAWhB,CAAX,CAAcC,CAAd,CACI,CAzfKuB,GAyfL,CAAAF,IAAAC,IAAA,EAAA,CAAaF,CAAb,CAJR,CAAA,EAFJ,IASO,CACH,IAAKpD,CAAL,CAAS,CAAT,CAAgB,EAAhB,CAAYA,CAAZ,CAAoBA,CAAA,EAApB,CACI,IAAKwD,CAAL,CAAS,CAAT,CAAYA,CAAZ,CAAiBC,CAAjB,EAAyB,CAAzB,CAA6BD,CAAA,EAA7B,CACI3B,CAAA,CAAU6B,CAAV,CAAiBF,CAAjB,EAAsB,CAAtB,CAAyBzB,CAAzB,CAA4BC,CAA5B,CACJ2B,EAAAA,CAAM,EACV,KAAK3D,CAAL,CAAS,CAAT,CAAYA,CAAZ,CAAgByD,CAAhB,CAAsBzD,CAAA,EAAtB,CACI2D,CAAAjD,KAAA,EAAWgD,CAAA,CAAM1D,CAAN,CAAX,EAAuB,EAAvB,CAA6B,GAA7B,IAAuC,CAAvC,CAGA,CAFA2D,CAAAjD,KAAA,EAAWgD,CAAA,CAAM1D,CAAN,CAAX,EAAuB,EAAvB,CAA6B,GAA7B,IAAuC,CAAvC,CAEA,CADA2D,CAAAjD,KAAA,EAAWgD,CAAA,CAAM1D,CAAN,CAAX,EAAuB,CAAvB,CAA4B,GAA5B,IAAsC,CAAtC,CACA,CAAA2D,CAAAjD,KAAA,EAAUgD,CAAA,CAAM1D,CAAN,CAAV,CAAqB,GAArB,IAA+B,CAA/B,CACJ,IAAIiD,CAAJ,CAAc,CACVA,CAAA,CAAS,IAAT,CAAeU,CAAf,CACA,OAFU,CAIV,MAAOA,EAdR,CAgBHV,CAAJ,EACIW,CAAA,CAAST,CAAT,CA7BQ,CA1CyC,IACrDO,EAAQG,CAAAtE,MAAA,EAD6C,CAErDkE,EAAOC,CAAAxD,OAF8C,CAGrD4D,CAGJ,IAAa,CAAb,CAAId,CAAJ,EAA2B,EAA3B,CAAkBA,CAAlB,CAA+B,CAC3Bc,CAAA,CAAMpE,KAAA,CAAM,mCAAN,CAA0CsD,CAA1C,CACN,IAAIC,CAAJ,CAAc,CACVW,CAAA,CAASX,CAAAc,KAAA,CAAc,IAAd;AAAoBD,CAApB,CAAT,CACA,OAFU,CAIV,KAAMA,EAAN,CANuB,CAQ/B,GAzekBE,EAyelB,GAAIjB,CAAA7C,OAAJ,CAAqC,CACjC4D,CAAA,CAAKpE,KAAA,CAAM,uBAAN,CAA8BqD,CAAA7C,OAA9B,CA1eS8D,QA0eT,CACL,IAAIf,CAAJ,CAAc,CACVW,CAAA,CAASX,CAAAc,KAAA,CAAc,IAAd,CAAoBD,CAApB,CAAT,CACA,OAFU,CAIV,KAAMA,EAAN,CAN6B,CAQrCd,CAAA,CAAU,CAAV,EAAeA,CAAf,GAA2B,CAtB8B,KAwBrDjB,CAxBqD,CAwBlDC,CAxBkD,CAwB/ChC,EAAI,CAxB2C,CAwBxCwD,CAGbS,WAAJ,EACIlC,CACA,CADI,IAAIkC,UAAJ,CAAeC,CAAf,CACJ,CAAAlC,CAAA,CAAI,IAAIiC,UAAJ,CAAeE,CAAf,CAFR,GAIIpC,CACA,CADImC,CAAA3E,MAAA,EACJ,CAAAyC,CAAA,CAAImC,CAAA5E,MAAA,EALR,CAQAsD,EAAA,CAAQE,CAAR,CAActC,CAAd,CAAiBsB,CAAjB,CAAoBC,CAApB,CAwCA,IAAwB,WAAxB,GAAI,MAAOiB,EAAX,CACIE,CAAA,EADJ,KAMI,KAAA,CAAA,CAAA,CACI,GAA6B,WAA7B,GAAI,OAAOvB,CAAP,CAAauB,CAAA,EAAb,CAAJ,CACI,MAAOvB,EAAP,EAAc,EAnF+B,CAiG7DwC,QAASA,EAAK,CAACjD,CAAD,CAAI4B,CAAJ,CAAUE,CAAV,CAAoBC,CAApB,CAAsC,CA+DhDmB,QAASA,EAAM,CAACC,CAAD,CAAQ,CACnB,IAAI1C,EAAM,EACVA,EAAAlB,KAAA,CAAS,IAAT,CACa,IAAb,EAAI6D,CAAJ,EACI3C,CAAAlB,KAAA,CAAS6D,CAAT,CACJ3C,EAAAlB,KAAA,CAAS,GAAT,CACa,GAAb,CAAIsC,CAAJ,EACIpB,CAAAlB,KAAA,CAAS,GAAT,CACJkB,EAAAlB,KAAA,CAASsC,CAAAwB,SAAA,EAAT,CACA5C,EAAAlB,KAAA,CAAS,GAAT,CACAkB,EAAAlB,KAAA,CAASC,CAAA,CAAc8D,CAAd,CAAqBA,CAAAvE,OAArB,CAAT,CACA0B,EAAAlB,KAAA,CAASC,CAAA,CAAc2D,CAAd,CAAqC,CAArC;AAAqBT,CAAA3D,OAArB,CAAyC,CAAzC,CAAT,CACA,OAAO0B,EAAAX,KAAA,CAAS,EAAT,CAZY,CA7DvB,GAAiB,QAAjB,GAAI,MAAOE,EAAX,EAA6C,QAA7C,GAA6B,MAAO4B,EAApC,CAAuD,CACnDe,CAAA,CAAMpE,KAAA,CAAM,qCAAN,CACN,IAAIuD,CAAJ,CAAc,CACVW,CAAA,CAASX,CAAAc,KAAA,CAAc,IAAd,CAAoBD,CAApB,CAAT,CACA,OAFU,CAKV,KAAMA,EAAN,CAP+C,CAFP,IAa5CS,CAb4C,CAarC7B,CACX,IAAuB,GAAvB,GAAIK,CAAA2B,OAAA,CAAY,CAAZ,CAAJ,EAAiD,GAAjD,GAA8B3B,CAAA2B,OAAA,CAAY,CAAZ,CAA9B,CAAsD,CAClDZ,CAAA,CAAMpE,KAAA,CAAM,wBAAN,CAA+BqD,CAAA4B,UAAA,CAAe,CAAf,CAAiB,CAAjB,CAA/B,CACN,IAAI1B,CAAJ,CAAc,CACVW,CAAA,CAASX,CAAAc,KAAA,CAAc,IAAd,CAAoBD,CAApB,CAAT,CACA,OAFU,CAKV,KAAMA,EAAN,CAP8C,CAStD,GAAuB,GAAvB,GAAIf,CAAA2B,OAAA,CAAY,CAAZ,CAAJ,CACIH,CACA,CADQK,MAAAC,aAAA,CAAoB,CAApB,CACR,CAAAnC,CAAA,CAAS,CAFb,KAGK,CACD6B,CAAA,CAAQxB,CAAA2B,OAAA,CAAY,CAAZ,CACR,IAAe,GAAf,GAAKH,CAAL,EAAgC,GAAhC,GAAsBA,CAAtB,EAAiD,GAAjD,GAAuCA,CAAvC,EAA4E,GAA5E,GAAyDxB,CAAA2B,OAAA,CAAY,CAAZ,CAAzD,CAAiF,CAC7EZ,CAAA,CAAMpE,KAAA,CAAM,yBAAN,CAAgCqD,CAAA4B,UAAA,CAAe,CAAf,CAAiB,CAAjB,CAAhC,CACN,IAAI1B,CAAJ,CAAc,CACVW,CAAA,CAASX,CAAAc,KAAA,CAAc,IAAd,CAAoBD,CAApB,CAAT,CACA,OAFU,CAIV,KAAMA,EAAN;AANyE,CAQjFpB,CAAA,CAAS,CAVR,CAcL,GAA8B,GAA9B,CAAIK,CAAA2B,OAAA,CAAYhC,CAAZ,CAAqB,CAArB,CAAJ,CAAmC,CAC/BoB,CAAA,CAAMpE,KAAA,CAAM,qBAAN,CACN,IAAIuD,CAAJ,CAAc,CACVW,CAAA,CAASX,CAAAc,KAAA,CAAc,IAAd,CAAoBD,CAApB,CAAT,CACA,OAFU,CAIV,KAAMA,EAAN,CAN2B,CAxCa,IAgD5CgB,EAAwD,EAAxDA,CAAKC,QAAA,CAAShC,CAAA4B,UAAA,CAAejC,CAAf,CAAuBA,CAAvB,CAAgC,CAAhC,CAAT,CAA6C,EAA7C,CAhDuC,CAiD5CsC,EAAKD,QAAA,CAAShC,CAAA4B,UAAA,CAAejC,CAAf,CAAwB,CAAxB,CAA2BA,CAA3B,CAAoC,CAApC,CAAT,CAAiD,EAAjD,CAjDuC,CAkD5CM,EAAS8B,CAAT9B,CAAcgC,CACdC,EAAAA,CAAYlC,CAAA4B,UAAA,CAAejC,CAAf,CAAwB,CAAxB,CAA2BA,CAA3B,CAAoC,EAApC,CAGZwC,EAAAA,CAAY9E,CAAA,CAFhBe,CAEgB,EAFF,GAAT,EAAAoD,CAAA,CAAe,MAAf,CAAwB,EAEb,EAAhB,KACIE,EAAQvD,CAAA,CAAc+D,CAAd,CAnnBMjB,EAmnBN,CAwBZ,IAAuB,WAAvB,EAAI,MAAOf,EAAX,CACI,MAAOoB,EAAA,CAAOvB,CAAA,CAAOoC,CAAP,CAAkBT,CAAlB,CAAyBzB,CAAzB,CAAP,CAIPF,EAAA,CAAOoC,CAAP,CAAkBT,CAAlB,CAAyBzB,CAAzB,CAAiC,QAAQ,CAACc,CAAD,CAAMQ,CAAN,CAAa,CAC9CR,CAAJ,CACIb,CAAA,CAASa,CAAT,CAAc,IAAd,CADJ,CAGIb,CAAA,CAAS,IAAT,CAAeoB,CAAA,CAAOC,CAAP,CAAf,CAJ8C,CAAtD,CAKGpB,CALH,CApF4C,CA/rCpD,IAAIiC,EAAS,EAAb,CAOI1F,EAAiB,IA0BrB,IAAI,CACAV,CAAA,CAAO,CAAP,CADA,CAGF,MAAOE,CAAP,CAAU,EAGZQ,CAAA,CAAiB,IAUjB0F,EAAAC,kBAAA,CAA2BC,QAAQ,CAACtG,CAAD,CAAS,CACxCU,CAAA,CAAiBV,CADuB,CAY5CoG,EAAAG,YAAA,CAAqBC,QAAQ,CAACvC,CAAD,CAASwC,CAAT,CAAsB,CAC/CxC,CAAA,CAASA,CAAT,EA4kB8ByC,EA3kB9B,IAAsB,QAAtB,GAAI,MAAOzC,EAAX,CACI,KAAMtD,MAAA,CAAM,qBAAN;AAA6B,MAAOsD,EAApC,CAA4C,IAA5C,CAAkD,MAAOwC,EAAzD,CAAN,CACS,CAAb,CAAIxC,CAAJ,CACIA,CADJ,CACa,CADb,CAEkB,EAFlB,CAESA,CAFT,GAGIA,CAHJ,CAGa,EAHb,CAIA,KAAID,EAAO,EACXA,EAAArC,KAAA,CAAU,MAAV,CACa,GAAb,CAAIsC,CAAJ,EACID,CAAArC,KAAA,CAAU,GAAV,CACJqC,EAAArC,KAAA,CAAUsC,CAAAwB,SAAA,EAAV,CACAzB,EAAArC,KAAA,CAAU,GAAV,CACAqC,EAAArC,KAAA,CAAUC,CAAA,CAAc5B,CAAA,CAwjBNiF,EAxjBM,CAAd,CAwjBQA,EAxjBR,CAAV,CACA,OAAOjB,EAAA9B,KAAA,CAAU,EAAV,CAfwC,CA2BnDkE,EAAAO,QAAA,CAAiBC,QAAQ,CAAC3C,CAAD,CAASwC,CAAT,CAAsBvC,CAAtB,CAAgC,CAYrD2C,QAASA,EAAM,CAAC3C,CAAD,CAAW,CACtBW,CAAA,CAAS,QAAQ,EAAG,CAChB,GAAI,CACAX,CAAA,CAAS,IAAT,CAAekC,CAAAG,YAAA,CAAmBtC,CAAnB,CAAf,CADA,CAEF,MAAOc,CAAP,CAAY,CACVb,CAAA,CAASa,CAAT,CADU,CAHE,CAApB,CADsB,CAXC,UAA3B,GAAI,MAAO0B,EAAX,GACIvC,CACA,CADWuC,CACX,CAAAA,CAAA,CAAcK,IAAAA,EAFlB,CAGsB,WAAtB,GAAI,MAAO7C,EAAX,GACIC,CACA,CADWD,CACX,CAAAA,CAAA,CAAS6C,IAAAA,EAFb,CAGA,IAAsB,WAAtB,GAAI,MAAO7C,EAAX,CACIA,CAAA,CA0iB0ByC,EA3iB9B,KAEK,IAAsB,QAAtB,GAAI,MAAOzC,EAAX,CACD,KAAMtD,MAAA,CAAM,qBAAN,CAA6B,MAAOsD,EAApC,CAAN,CAYJ,GAAIC,CAAJ,CAAc,CACV,GAAwB,UAAxB,GAAI,MAAOA,EAAX,CACI,KAAMvD,MAAA,CAAM,oBAAN;AAA2B,MAAOuD,EAAlC,CAAN,CACJ2C,CAAA,CAAO3C,CAAP,CAHU,CAAd,IAKI,OAAO,KAAI6C,OAAJ,CAAY,QAAQ,CAACC,CAAD,CAAUC,CAAV,CAAkB,CACzCJ,CAAA,CAAO,QAAQ,CAAC9B,CAAD,CAAMlC,CAAN,CAAW,CAClBkC,CAAJ,CACIkC,CAAA,CAAOlC,CAAP,CADJ,CAIAiC,CAAA,CAAQnE,CAAR,CALsB,CAA1B,CADyC,CAAtC,CA3B0C,CA6CzDuD,EAAAc,SAAA,CAAkBC,QAAQ,CAAC/E,CAAD,CAAI4B,CAAJ,CAAU,CACZ,WAApB,GAAI,MAAOA,EAAX,GACIA,CADJ,CAogB8B0C,EApgB9B,CAEoB,SAApB,GAAI,MAAO1C,EAAX,GACIA,CADJ,CACWoC,CAAAG,YAAA,CAAmBvC,CAAnB,CADX,CAEA,IAAiB,QAAjB,GAAI,MAAO5B,EAAX,EAA6C,QAA7C,GAA6B,MAAO4B,EAApC,CACI,KAAMrD,MAAA,CAAM,qBAAN,CAA6B,MAAOyB,EAApC,CAAuC,IAAvC,CAA6C,MAAO4B,EAApD,CAAN,CACJ,MAAOqB,EAAA,CAAMjD,CAAN,CAAS4B,CAAT,CAPyB,CAqBpCoC,EAAAgB,KAAA,CAAcC,QAAQ,CAACjF,CAAD,CAAI4B,CAAJ,CAAUE,CAAV,CAAoBC,CAApB,CAAsC,CAExD0C,QAASA,EAAM,CAAC3C,CAAD,CAAW,CACL,QAAjB,GAAI,MAAO9B,EAAX,EAA6C,QAA7C,GAA6B,MAAO4B,EAApC,CACIoC,CAAAO,QAAA,CAAe3C,CAAf,CAAqB,QAAQ,CAACe,CAAD,CAAMf,CAAN,CAAY,CACrCqB,CAAA,CAAMjD,CAAN,CAAS4B,CAAT,CAAeE,CAAf,CAAyBC,CAAzB,CADqC,CAAzC,CADJ,CAIsB,QAAjB,GAAI,MAAO/B,EAAX,EAA6C,QAA7C,GAA6B,MAAO4B,EAApC,CACDqB,CAAA,CAAMjD,CAAN,CAAS4B,CAAT,CAAeE,CAAf,CAAyBC,CAAzB,CADC,CAGDU,CAAA,CAASX,CAAAc,KAAA,CAAc,IAAd,CAAoBrE,KAAA,CAAM,qBAAN;AAA6B,MAAOyB,EAApC,CAAuC,IAAvC,CAA6C,MAAO4B,EAApD,CAApB,CAAT,CARkB,CAW1B,GAAIE,CAAJ,CAAc,CACV,GAAwB,UAAxB,GAAI,MAAOA,EAAX,CACI,KAAMvD,MAAA,CAAM,oBAAN,CAA2B,MAAOuD,EAAlC,CAAN,CACJ2C,CAAA,CAAO3C,CAAP,CAHU,CAAd,IAKI,OAAO,KAAI6C,OAAJ,CAAY,QAAQ,CAACC,CAAD,CAAUC,CAAV,CAAkB,CACzCJ,CAAA,CAAO,QAAQ,CAAC9B,CAAD,CAAMlC,CAAN,CAAW,CAClBkC,CAAJ,CACIkC,CAAA,CAAOlC,CAAP,CADJ,CAIAiC,CAAA,CAAQnE,CAAR,CALsB,CAA1B,CADyC,CAAtC,CAlB6C,CA2D5DuD,EAAAkB,YAAA,CAAqBC,QAAQ,CAACnF,CAAD,CAAIgF,CAAJ,CAAU,CACnC,GAAiB,QAAjB,GAAI,MAAOhF,EAAX,EAA6C,QAA7C,GAA6B,MAAOgF,EAApC,CACI,KAAMzG,MAAA,CAAM,qBAAN,CAA6B,MAAOyB,EAApC,CAAuC,IAAvC,CAA6C,MAAOgF,EAApD,CAAN,CACJ,MAAoB,GAApB,GAAIA,CAAAjG,OAAJ,CACW,CAAA,CADX,CAEOP,CAAA,CAAkBwF,CAAAc,SAAA,CAAgB9E,CAAhB,CAAmBgF,CAAAI,OAAA,CAAY,CAAZ,CAAeJ,CAAAjG,OAAf,CAA2B,EAA3B,CAAnB,CAAlB,CAAsEiG,CAAtE,CAL4B,CAmBvChB,EAAAqB,QAAA,CAAiBC,QAAQ,CAACtF,CAAD,CAAIgF,CAAJ,CAAUlD,CAAV,CAAoBC,CAApB,CAAsC,CAE3D0C,QAASA,EAAM,CAAC3C,CAAD,CAAW,CACL,QAAjB,GAAI,MAAO9B,EAAX,EAA6C,QAA7C,GAA6B,MAAOgF,EAApC,CACIvC,CAAA,CAASX,CAAAc,KAAA,CAAc,IAAd,CAAoBrE,KAAA,CAAM,qBAAN,CAA6B,MAAOyB,EAApC;AAAuC,IAAvC,CAA6C,MAAOgF,EAApD,CAApB,CAAT,CADJ,CAIoB,EAApB,GAAIA,CAAAjG,OAAJ,CACI0D,CAAA,CAASX,CAAAc,KAAA,CAAc,IAAd,CAAoB,IAApB,CAA0B,CAAA,CAA1B,CAAT,CADJ,CAIAoB,CAAAgB,KAAA,CAAYhF,CAAZ,CAAegF,CAAAI,OAAA,CAAY,CAAZ,CAAe,EAAf,CAAf,CAAmC,QAAQ,CAACzC,CAAD,CAAM4C,CAAN,CAAY,CAC/C5C,CAAJ,CACIb,CAAA,CAASa,CAAT,CADJ,CAGIb,CAAA,CAAS,IAAT,CAAetD,CAAA,CAAkB+G,CAAlB,CAAwBP,CAAxB,CAAf,CAJ+C,CAAvD,CAKGjD,CALH,CATsB,CAiB1B,GAAID,CAAJ,CAAc,CACV,GAAwB,UAAxB,GAAI,MAAOA,EAAX,CACI,KAAMvD,MAAA,CAAM,oBAAN,CAA2B,MAAOuD,EAAlC,CAAN,CACJ2C,CAAA,CAAO3C,CAAP,CAHU,CAAd,IAKI,OAAO,KAAI6C,OAAJ,CAAY,QAAQ,CAACC,CAAD,CAAUC,CAAV,CAAkB,CACzCJ,CAAA,CAAO,QAAQ,CAAC9B,CAAD,CAAMlC,CAAN,CAAW,CAClBkC,CAAJ,CACIkC,CAAA,CAAOlC,CAAP,CADJ,CAIAiC,CAAA,CAAQnE,CAAR,CALsB,CAA1B,CADyC,CAAtC,CAxBgD,CA0C/DuD,EAAAwB,UAAA,CAAmBC,QAAQ,CAACT,CAAD,CAAO,CAC9B,GAAoB,QAApB,GAAI,MAAOA,EAAX,CACI,KAAMzG,MAAA,CAAM,qBAAN,CAA6B,MAAOyG,EAApC,CAAN,CACJ,MAAOpB,SAAA,CAASoB,CAAAU,MAAA,CAAW,GAAX,CAAA,CAAgB,CAAhB,CAAT,CAA6B,EAA7B,CAHuB,CAalC1B,EAAA2B,QAAA,CAAiBC,QAAQ,CAACZ,CAAD,CAAO,CAC5B,GAAoB,QAApB,GAAI,MAAOA,EAAX,CACI,KAAMzG,MAAA,CAAM,qBAAN,CAA6B,MAAOyG,EAApC,CAAN,CACJ,GAAoB,EAApB,GAAIA,CAAAjG,OAAJ,CACI,KAAMR,MAAA,CAAM,uBAAN;AAA8ByG,CAAAjG,OAA9B,CAA0C,QAA1C,CAAN,CACJ,MAAOiG,EAAAxB,UAAA,CAAe,CAAf,CAAkB,EAAlB,CALqB,CAchC,KAAIf,EAA8B,WAAnB,GAAA,MAAOoD,QAAP,EAAkCA,OAAlC,EAAyE,UAAzE,GAA6C,MAAOA,QAAApD,SAApD,CACgB,UAAxB,GAAA,MAAOqD,aAAP,CAAqCA,YAArC,CAAoDD,OAAApD,SAD5C,CAETsD,UAFN,CA8BIlG,EAAc,kEAAA,MAAA,CAAA,EAAA,CA9BlB,CAqCIQ,EAAe,CAAE,EAAF,CAAM,EAAN,CAAU,EAAV,CAAc,EAAd,CAAkB,EAAlB,CAAsB,EAAtB,CAA0B,EAA1B,CAA8B,EAA9B,CAAkC,EAAlC,CAAsC,EAAtC,CAA0C,EAA1C,CAA8C,EAA9C,CAAkD,EAAlD,CACd,EADc,CACV,EADU,CACN,EADM,CACF,EADE,CACE,EADF,CACM,EADN,CACU,EADV,CACc,EADd,CACkB,EADlB,CACsB,EADtB,CAC0B,EAD1B,CAC8B,EAD9B,CACkC,EADlC,CACsC,EADtC,CAC0C,EAD1C,CAC8C,EAD9C,CACkD,EADlD,CAEd,EAFc,CAEV,EAFU,CAEN,EAFM,CAEF,EAFE,CAEE,EAFF,CAEM,EAFN,CAEU,EAFV,CAEc,EAFd,CAEkB,EAFlB,CAEsB,EAFtB,CAE0B,EAF1B,CAE8B,EAF9B,CAEkC,EAFlC,CAEsC,EAFtC,CAE0C,EAF1C,CAE8C,EAF9C,CAEiD,CAFjD,CAGf,CAHe,CAGZ,EAHY,CAGR,EAHQ,CAGJ,EAHI,CAGA,EAHA,CAGI,EAHJ,CAGQ,EAHR,CAGY,EAHZ,CAGgB,EAHhB,CAGoB,EAHpB,CAGwB,EAHxB,CAG6B,EAH7B,CAGiC,EAHjC,CAGqC,EAHrC,CAGyC,EAHzC,CAG6C,EAH7C,CAGiD,EAHjD,CAId,EAJc,CAIX,CAJW,CAIR,CAJQ,CAIL,CAJK,CAIF,CAJE,CAIC,CAJD,CAII,CAJJ,CAIO,CAJP,CAIU,CAJV,CAIa,EAJb,CAIiB,EAJjB,CAIqB,EAJrB;AAIyB,EAJzB,CAI6B,EAJ7B,CAIiC,EAJjC,CAIqC,EAJrC,CAIyC,EAJzC,CAI6C,EAJ7C,CAIiD,EAJjD,CAKf,EALe,CAKX,EALW,CAKP,EALO,CAKH,EALG,CAKC,EALD,CAKK,EALL,CAKS,EALT,CAKa,EALb,CAKkB,EALlB,CAKsB,EALtB,CAK0B,EAL1B,CAK8B,EAL9B,CAKkC,EALlC,CAKsC,EALtC,CAKyC,EALzC,CAK6C,EAL7C,CAKiD,EALjD,CAMf,EANe,CAMX,EANW,CAMP,EANO,CAMH,EANG,CAMC,EAND,CAMK,EANL,CAMS,EANT,CAMa,EANb,CAMiB,EANjB,CAMqB,EANrB,CAMyB,EANzB,CAM6B,EAN7B,CAMiC,EANjC,CAMqC,EANrC,CAMyC,EANzC,CAM6C,EAN7C,CAMiD,EANjD,CAOf,EAPe,CAOX,EAPW,CAOP,EAPO,CAOH,EAPG,CAOC,EAPD,CAOK,EAPL,CAOU,EAPV,CAOc,EAPd,CAOkB,EAPlB,CAOsB,EAPtB,CAO0B,EAP1B,CArCnB,CAkDIC,EAAqBmD,MAAAC,aAlDzB,CA+IItE,EAAO,QAAQ,EAAG,CAQlB,IAAIA,EAAO,CAON,cAAgB,OAPV,CAeN,WAAa4G,QAAQ,CAACC,CAAD,CAAMC,CAAN,CAAW,CACjC,IAAIC,EAAK,IACU,SAAnB,GAAI,MAAOF,EAAX,GACIE,CACA,CADKF,CACL,CAAAA,CAAA,CAAMA,QAAQ,EAAG,CAAE,MAAO,KAAT,CAFrB,CAGA,KAAA,CAAc,IAAd,GAAOE,CAAP,EAAuC,IAAvC,IAAuBA,CAAvB,CAA4BF,CAAA,EAA5B,EAAA,CACa,GAAT,CAAIE,CAAJ,CACID,CAAA,CAAIC,CAAJ,CAAO,GAAP,CADJ,EAEc,IAAT,CAAIA,CAAJ,CACDD,CAAA,CAAMC,CAAN,EAAU,CAAV,CAAa,EAAb,CAAmB,GAAnB,CADC,EAGS,KAAT,CAAIA,CAAJ,CACDD,CAAA,CAAMC,CAAN,EAAU,EAAV,CAAc,EAAd,CAAoB,GAApB,CADC,EAKDD,CAAA,CAAMC,CAAN,EAAU,EAAV,CAAc,CAAd,CAAoB,GAApB,CACA,CAAAD,CAAA,CAAMC,CAAN,EAAU,EAAV,CAAc,EAAd,CAAoB,GAApB,CANC,CAED,CAAAD,CAAA,CAAMC,CAAN,EAAU,CAAV,CAAa,EAAb,CAAmB,GAAnB,CALC,CAED,CAAAD,CAAA,CAAKC,CAAL,CAAQ,EAAR,CAAc,GAAd,CAJJ,CAcA,CAAAA,CAAA,CAAK,IApBwB,CAf1B,CAgDN,WAAaC,QAAQ,CAACH,CAAD,CAAMC,CAAN,CAAW,CAQjC,IARiC,IAC7BnI,CAD6B;AAC1BuB,CAD0B,CACvB+G,CADuB,CACpBC,CADoB,CACjBC,EAAOA,QAAQ,CAACjH,CAAD,CAAI,CAC/BA,CAAA,CAAIA,CAAAlB,MAAA,CAAQ,CAAR,CAAWkB,CAAAkH,QAAA,CAAU,IAAV,CAAX,CACJ,KAAI7D,EAAMpE,KAAA,CAAMe,CAAA+D,SAAA,EAAN,CACVV,EAAA8D,KAAA,CAAW,gBACX9D,EAAA,MAAA,CAAerD,CACf,MAAMqD,EAAN,CAL+B,CAOnC,CAAuB,IAAvB,IAAQ5E,CAAR,CAAYkI,CAAA,EAAZ,EAAA,CACI,GAAiB,CAAjB,IAAKlI,CAAL,CAAO,GAAP,EACImI,CAAA,CAAInI,CAAJ,CADJ,KAEK,IAAiB,GAAjB,IAAKA,CAAL,CAAO,GAAP,EACgB,IACjB,IADEuB,CACF,CADM2G,CAAA,EACN,GAD0BM,CAAA,CAAK,CAACxI,CAAD,CAAIuB,CAAJ,CAAL,CAC1B,CAAA4G,CAAA,EAAMnI,CAAN,CAAQ,EAAR,GAAe,CAAf,CAAqBuB,CAArB,CAAuB,EAAvB,CAFC,KAGA,IAAiB,GAAjB,IAAKvB,CAAL,CAAO,GAAP,EACc,IACf,IADEuB,CACF,CADI2G,CAAA,EACJ,GADqC,IACrC,IADwBI,CACxB,CAD0BJ,CAAA,EAC1B,GAD8CM,CAAA,CAAK,CAACxI,CAAD,CAAIuB,CAAJ,CAAO+G,CAAP,CAAL,CAC9C,CAAAH,CAAA,EAAMnI,CAAN,CAAQ,EAAR,GAAe,EAAf,EAAuBuB,CAAvB,CAAyB,EAAzB,GAAgC,CAAhC,CAAsC+G,CAAtC,CAAwC,EAAxC,CAFC,KAGA,IAAiB,GAAjB,IAAKtI,CAAL,CAAO,GAAP,EACc,IACf,IADEuB,CACF,CADI2G,CAAA,EACJ,GADqC,IACrC,IADwBI,CACxB,CAD0BJ,CAAA,EAC1B,GAD2D,IAC3D,IAD8CK,CAC9C,CADgDL,CAAA,EAChD,GADoEM,CAAA,CAAK,CAACxI,CAAD,CAAIuB,CAAJ,CAAO+G,CAAP,CAAUC,CAAV,CAAL,CACpE,CAAAJ,CAAA,EAAMnI,CAAN,CAAQ,CAAR,GAAe,EAAf,EAAuBuB,CAAvB,CAAyB,EAAzB,GAAgC,EAAhC,EAAwC+G,CAAxC,CAA0C,EAA1C,GAAiD,CAAjD,CAAuDC,CAAvD,CAAyD,EAAzD,CAFC,KAGA,MAAMI,WAAA,CAAW,yBAAX,CAAqC3I,CAArC,CAAN,CApBwB,CAhD1B,CA+EN,YAAc4I,QAAQ,CAACV,CAAD;AAAMC,CAAN,CAAW,CAElC,IAFkC,IAC9BvG,CAD8B,CAC1BC,EAAK,IACb,CAC4C,IAD5C,IACSD,CADT,CACqB,IAAP,GAAAC,CAAA,CAAcA,CAAd,CAAmBqG,CAAA,EADjC,EAAA,CAGc,KAAV,EAAItG,CAAJ,EAA0B,KAA1B,EAAoBA,CAApB,EACyB,IADzB,IACSC,CADT,CACcqG,CAAA,EADd,GAEkB,KAFlB,EAEYrG,CAFZ,EAEkC,KAFlC,EAE4BA,CAF5B,EAGYsG,CAAA,CAAgB,IAAhB,EAAKvG,CAAL,CAAQ,KAAR,EAAsBC,CAAtB,CAAyB,KAAzB,CAAgC,KAAhC,CACA,CAAAA,CAAA,CAAK,IAJjB,EAQAsG,CAAA,CAAIvG,CAAJ,CAEO,KAAX,GAAIC,CAAJ,EAAiBsG,CAAA,CAAItG,CAAJ,CAfiB,CA/E3B,CAwGN,YAAcgH,QAAQ,CAACX,CAAD,CAAMC,CAAN,CAAW,CAClC,IAAIC,EAAK,IACU,SAAnB,GAAI,MAAOF,EAAX,GACIE,CAAU,CAALF,CAAK,CAAAA,CAAA,CAAMA,QAAQ,EAAG,CAAE,MAAO,KAAT,CAD/B,CAEA,KAAA,CAAc,IAAd,GAAOE,CAAP,EAAuC,IAAvC,IAAuBA,CAAvB,CAA4BF,CAAA,EAA5B,EAAA,CACc,KAAV,EAAIE,CAAJ,CACID,CAAA,CAAIC,CAAJ,CADJ,EAGIA,CAEA,EAFM,KAEN,CADAD,CAAA,EAAKC,CAAL,EAAS,EAAT,EAAa,KAAb,CACA,CAAAD,CAAA,CAAKC,CAAL,CAAQ,IAAR,CAAe,KAAf,CALJ,CAMA,CAAAA,CAAA,CAAK,IAXyB,CAxG3B,CA6HN,kBAAoBU,QAAQ,CAACZ,CAAD,CAAMC,CAAN,CAAW,CACxC9G,CAAA0H,YAAA,CAAiBb,CAAjB,CAAsB,QAAQ,CAACE,CAAD,CAAK,CAC/B/G,CAAA2H,WAAA,CAAgBZ,CAAhB,CAAoBD,CAApB,CAD+B,CAAnC,CADwC,CA7HjC,CA2IN,kBAAoBc,QAAQ,CAACf,CAAD,CAAMC,CAAN,CAAW,CACxC9G,CAAA6H,WAAA,CAAgBhB,CAAhB,CAAqB,QAAQ,CAACE,CAAD,CAAK,CAC9B/G,CAAA8H,YAAA,CAAiBf,CAAjB;AAAqBD,CAArB,CAD8B,CAAlC,CADwC,CA3IjC,CAsJN,mBAAqBiB,QAAQ,CAAChB,CAAD,CAAK,CACnC,MAAa,IAAN,CAACA,CAAD,CAAc,CAAd,CAAwB,IAAN,CAACA,CAAD,CAAe,CAAf,CAAyB,KAAN,CAACA,CAAD,CAAiB,CAAjB,CAAqB,CAD9B,CAtJ5B,CAgKN,cAAgBiB,QAAQ,CAACnB,CAAD,CAAM,CAE/B,IAF+B,IAC3BE,CAD2B,CACvBpF,EAAE,CACV,CAAwB,IAAxB,IAAQoF,CAAR,CAAaF,CAAA,EAAb,EAAA,CACIlF,CAAA,EAAK3B,CAAAiI,mBAAA,CAAwBlB,CAAxB,CACT,OAAOpF,EAJwB,CAhKxB,CA6KN,qBAAuBuG,QAAQ,CAACrB,CAAD,CAAM,CAAA,IAClCnF,EAAE,CADgC,CAC7BC,EAAE,CACX3B,EAAA0H,YAAA,CAAiBb,CAAjB,CAAsB,QAAQ,CAACE,CAAD,CAAK,CAC/B,EAAErF,CAAGC,EAAA,EAAK3B,CAAAiI,mBAAA,CAAwBlB,CAAxB,CADqB,CAAnC,CAGA,OAAO,CAACrF,CAAD,CAAGC,CAAH,CAL+B,CA7K/B,CAqLX,OAAO3B,EA7LW,CAAX,EAgMX8C,KAAAC,IAAA,CAAWD,IAAAC,IAAX,EAAuB,QAAQ,EAAG,CAAE,MAAO,CAAC,IAAID,IAAd,CAmClC,KAAIa,EAAS,CACT,SADS,CACG,UADH,CACe,SADf,CAC2B,QAD3B,CACuC,UADvC,CAET,SAFS,CAEG,SAFH,CAEe,UAFf,CAE2B,UAF3B,CAEuC,SAFvC,CAGT,UAHS,CAGG,SAHH,CAGe,UAHf,CAG2B,UAH3B,CAGuC,UAHvC;AAIT,UAJS,CAIG,UAJH,CAIe,UAJf,CAAb,CAYIC,EAAS,CACT,UADS,CACG,UADH,CACe,SADf,CAC2B,UAD3B,CACuC,UADvC,CAET,UAFS,CAEG,UAFH,CAEe,UAFf,CAE2B,SAF3B,CAEuC,UAFvC,CAGT,SAHS,CAGG,UAHH,CAGe,UAHf,CAG2B,UAH3B,CAGuC,UAHvC,CAIT,UAJS,CAIG,SAJH,CAIe,UAJf,CAI2B,UAJ3B,CAIuC,UAJvC,CAKT,UALS,CAKG,UALH,CAKe,UALf,CAK2B,SAL3B,CAKuC,UALvC,CAMT,SANS,CAMG,UANH,CAMe,UANf,CAM2B,UAN3B,CAMuC,UANvC,CAOT,UAPS,CAOG,UAPH,CAOe,UAPf,CAO2B,UAP3B,CAOuC,UAPvC,CAQT,UARS,CAQG,UARH,CAQe,UARf,CAQ2B,UAR3B,CAQuC,UARvC,CAST,UATS,CASG,SATH,CASe,UATf;AAS2B,SAT3B,CASuC,UATvC,CAUT,UAVS,CAUG,UAVH,CAUe,UAVf,CAU2B,SAV3B,CAUuC,UAVvC,CAWT,UAXS,CAWG,UAXH,CAWe,UAXf,CAW2B,UAX3B,CAWuC,UAXvC,CAYT,SAZS,CAYG,SAZH,CAYe,UAZf,CAY2B,UAZ3B,CAYuC,UAZvC,CAaT,UAbS,CAaG,UAbH,CAae,UAbf,CAa2B,UAb3B,CAauC,UAbvC,CAcT,UAdS,CAcG,UAdH,CAce,UAdf,CAc2B,SAd3B,CAcuC,UAdvC,CAeT,SAfS,CAeG,UAfH,CAee,SAff,CAe2B,UAf3B,CAeuC,UAfvC,CAgBT,UAhBS,CAgBG,SAhBH,CAgBe,UAhBf,CAgB2B,UAhB3B,CAgBuC,UAhBvC,CAiBT,UAjBS,CAiBG,UAjBH,CAiBe,UAjBf,CAiB2B,UAjB3B,CAiBuC,UAjBvC,CAkBT,SAlBS,CAkBG,UAlBH,CAkBe,UAlBf,CAkB2B,UAlB3B,CAkBuC,SAlBvC;AAmBT,UAnBS,CAmBG,UAnBH,CAmBe,UAnBf,CAmB2B,UAnB3B,CAmBuC,UAnBvC,CAoBT,SApBS,CAoBG,UApBH,CAoBe,UApBf,CAoB2B,UApB3B,CAoBuC,UApBvC,CAqBT,UArBS,CAqBG,SArBH,CAqBe,SArBf,CAqB2B,UArB3B,CAqBuC,SArBvC,CAsBT,UAtBS,CAsBG,UAtBH,CAsBe,UAtBf,CAsB2B,SAtB3B,CAsBuC,UAtBvC,CAuBT,SAvBS,CAuBG,UAvBH,CAuBe,UAvBf,CAuB2B,UAvB3B,CAuBuC,UAvBvC,CAwBT,QAxBS,CAwBG,UAxBH,CAwBe,UAxBf,CAwB2B,UAxB3B,CAwBuC,SAxBvC,CAyBT,UAzBS,CAyBG,UAzBH,CAyBe,SAzBf,CAyB2B,SAzB3B,CAyBuC,UAzBvC,CA0BT,UA1BS,CA0BG,UA1BH,CA0Be,UA1Bf,CA0B2B,UA1B3B,CA0BuC,UA1BvC,CA2BT,UA3BS,CA2BG,SA3BH,CA2Be,UA3Bf,CA2B2B,UA3B3B,CA2BuC,UA3BvC,CA4BT,UA5BS,CA4BG,UA5BH;AA4Be,SA5Bf,CA4B2B,UA5B3B,CA4BuC,UA5BvC,CA6BT,UA7BS,CA6BG,UA7BH,CA6Be,UA7Bf,CA6B2B,UA7B3B,CA6BuC,UA7BvC,CA8BT,UA9BS,CA8BG,SA9BH,CA8Be,UA9Bf,CA8B2B,SA9B3B,CA8BuC,UA9BvC,CA+BT,UA/BS,CA+BG,UA/BH,CA+Be,UA/Bf,CA+B2B,UA/B3B,CA+BuC,SA/BvC,CAgCT,UAhCS,CAgCG,UAhCH,CAgCe,SAhCf,CAgC2B,UAhC3B,CAgCuC,UAhCvC,CAiCT,UAjCS,CAiCG,UAjCH,CAiCe,UAjCf,CAiC2B,UAjC3B,CAiCuC,SAjCvC,CAkCT,UAlCS,CAkCG,UAlCH,CAkCe,SAlCf,CAkC2B,UAlC3B,CAkCuC,UAlCvC,CAmCT,UAnCS,CAmCG,UAnCH,CAmCe,UAnCf,CAmC2B,UAnC3B,CAmCuC,UAnCvC,CAoCT,UApCS,CAoCG,UApCH,CAoCe,SApCf,CAoC2B,UApC3B,CAoCuC,SApCvC,CAqCT,UArCS,CAqCG,UArCH,CAqCe,UArCf,CAqC2B,UArC3B;AAqCuC,UArCvC,CAsCT,UAtCS,CAsCG,UAtCH,CAsCe,UAtCf,CAsC2B,UAtC3B,CAsCuC,UAtCvC,CAuCT,UAvCS,CAuCG,UAvCH,CAuCe,UAvCf,CAuC2B,UAvC3B,CAuCuC,UAvCvC,CAwCT,UAxCS,CAwCG,SAxCH,CAwCe,UAxCf,CAwC2B,UAxC3B,CAwCuC,UAxCvC,CAyCT,UAzCS,CAyCG,UAzCH,CAyCe,SAzCf,CAyC2B,UAzC3B,CAyCuC,UAzCvC,CA0CT,UA1CS,CA0CG,UA1CH,CA0Ce,UA1Cf,CA0C2B,SA1C3B,CA0CuC,UA1CvC,CA2CT,UA3CS,CA2CG,SA3CH,CA2Ce,UA3Cf,CA2C2B,UA3C3B,CA2CuC,UA3CvC,CA4CT,UA5CS,CA4CG,UA5CH,CA4Ce,UA5Cf,CA4C2B,UA5C3B,CA4CuC,UA5CvC,CA6CT,OA7CS,CA6CG,SA7CH,CA6Ce,SA7Cf,CA6C2B,UA7C3B,CA6CuC,SA7CvC,CA8CT,UA9CS,CA8CG,UA9CH,CA8Ce,UA9Cf,CA8C2B,UA9C3B,CA8CuC,UA9CvC,CA+CT,SA/CS;AA+CG,QA/CH,CA+Ce,UA/Cf,CA+C2B,UA/C3B,CA+CuC,SA/CvC,CAgDT,UAhDS,CAgDG,UAhDH,CAgDe,UAhDf,CAgD2B,SAhD3B,CAgDuC,UAhDvC,CAiDT,UAjDS,CAiDG,UAjDH,CAiDe,SAjDf,CAiD2B,UAjD3B,CAiDuC,SAjDvC,CAkDT,UAlDS,CAkDG,UAlDH,CAkDe,SAlDf,CAkD2B,UAlD3B,CAkDuC,UAlDvC,CAmDT,UAnDS,CAmDG,UAnDH,CAmDe,UAnDf,CAmD2B,UAnD3B,CAmDuC,SAnDvC,CAoDT,UApDS,CAoDG,UApDH,CAoDe,UApDf,CAoD2B,UApD3B,CAoDuC,UApDvC,CAqDT,QArDS,CAqDG,UArDH,CAqDe,UArDf,CAqD2B,UArD3B,CAqDuC,UArDvC,CAsDT,UAtDS,CAsDG,UAtDH,CAsDe,UAtDf,CAsD2B,SAtD3B,CAsDuC,UAtDvC,CAuDT,UAvDS,CAuDG,UAvDH,CAuDe,UAvDf,CAuD2B,UAvD3B,CAuDuC,UAvDvC,CAwDT,UAxDS,CAwDG,UAxDH,CAwDe,UAxDf;AAwD2B,UAxD3B,CAwDuC,UAxDvC,CAyDT,UAzDS,CAyDG,UAzDH,CAyDe,UAzDf,CAyD2B,QAzD3B,CAyDuC,SAzDvC,CA0DT,UA1DS,CA0DG,UA1DH,CA0De,UA1Df,CA0D2B,UA1D3B,CA0DuC,UA1DvC,CA2DT,UA3DS,CA2DG,UA3DH,CA2De,UA3Df,CA2D2B,UA3D3B,CA2DuC,UA3DvC,CA4DT,UA5DS,CA4DG,UA5DH,CA4De,UA5Df,CA4D2B,UA5D3B,CA4DuC,QA5DvC,CA6DT,UA7DS,CA6DG,UA7DH,CA6De,SA7Df,CA6D2B,UA7D3B,CA6DuC,UA7DvC,CA8DT,UA9DS,CA8DG,UA9DH,CA8De,SA9Df,CA8D2B,SA9D3B,CA8DuC,SA9DvC,CA+DT,UA/DS,CA+DG,UA/DH,CA+De,UA/Df,CA+D2B,SA/D3B,CA+DuC,UA/DvC,CAgET,UAhES,CAgEG,UAhEH,CAgEe,UAhEf,CAgE2B,SAhE3B,CAgEuC,SAhEvC,CAiET,UAjES,CAiEG,UAjEH,CAiEe,UAjEf,CAiE2B,UAjE3B,CAiEuC,SAjEvC;AAkET,SAlES,CAkEG,UAlEH,CAkEe,UAlEf,CAkE2B,UAlE3B,CAkEuC,UAlEvC,CAmET,UAnES,CAmEG,UAnEH,CAmEe,UAnEf,CAmE2B,SAnE3B,CAmEuC,UAnEvC,CAoET,UApES,CAoEG,UApEH,CAoEe,UApEf,CAoE2B,UApE3B,CAoEuC,UApEvC,CAqET,UArES,CAqEG,UArEH,CAqEe,UArEf,CAqE2B,UArE3B,CAqEuC,UArEvC,CAsET,SAtES,CAsEG,UAtEH,CAsEe,SAtEf,CAsE2B,SAtE3B,CAsEuC,SAtEvC,CAuET,UAvES,CAuEG,SAvEH,CAuEe,UAvEf,CAuE2B,SAvE3B,CAuEuC,UAvEvC,CAwET,UAxES,CAwEG,QAxEH,CAwEe,UAxEf,CAwE2B,UAxE3B,CAwEuC,UAxEvC,CAyET,UAzES,CAyEG,UAzEH,CAyEe,UAzEf,CAyE2B,SAzE3B,CAyEuC,UAzEvC,CA0ET,UA1ES,CA0EG,UA1EH,CA0Ee,UA1Ef,CA0E2B,UA1E3B,CA0EuC,UA1EvC,CA2ET,SA3ES,CA2EG,UA3EH;AA2Ee,UA3Ef,CA2E2B,UA3E3B,CA2EuC,SA3EvC,CA4ET,UA5ES,CA4EG,UA5EH,CA4Ee,UA5Ef,CA4E2B,UA5E3B,CA4EuC,SA5EvC,CA6ET,UA7ES,CA6EG,SA7EH,CA6Ee,SA7Ef,CA6E2B,SA7E3B,CA6EuC,UA7EvC,CA8ET,UA9ES,CA8EG,UA9EH,CA8Ee,UA9Ef,CA8E2B,UA9E3B,CA8EuC,UA9EvC,CA+ET,UA/ES,CA+EG,QA/EH,CA+Ee,UA/Ef,CA+E2B,UA/E3B,CA+EuC,UA/EvC,CAgFT,UAhFS,CAgFG,UAhFH,CAgFe,UAhFf,CAgF2B,SAhF3B,CAgFuC,UAhFvC,CAiFT,SAjFS,CAiFG,SAjFH,CAiFe,UAjFf,CAiF2B,UAjF3B,CAiFuC,SAjFvC,CAkFT,UAlFS,CAkFG,QAlFH,CAkFe,UAlFf,CAkF2B,UAlF3B,CAkFuC,UAlFvC,CAmFT,UAnFS,CAmFG,UAnFH,CAmFe,UAnFf,CAmF2B,UAnF3B,CAmFuC,UAnFvC,CAoFT,UApFS,CAoFG,UApFH,CAoFe,SApFf,CAoF2B,UApF3B;AAoFuC,UApFvC,CAqFT,UArFS,CAqFG,UArFH,CAqFe,SArFf,CAqF2B,UArF3B,CAqFuC,UArFvC,CAsFT,UAtFS,CAsFG,UAtFH,CAsFe,UAtFf,CAsF2B,UAtF3B,CAsFuC,UAtFvC,CAuFT,SAvFS,CAuFG,SAvFH,CAuFe,SAvFf,CAuF2B,UAvF3B,CAuFuC,UAvFvC,CAwFT,UAxFS,CAwFG,UAxFH,CAwFe,SAxFf,CAwF2B,UAxF3B,CAwFuC,SAxFvC,CAyFT,UAzFS,CAyFG,UAzFH,CAyFe,UAzFf,CAyF2B,UAzF3B,CAyFuC,UAzFvC,CA0FT,SA1FS,CA0FG,UA1FH,CA0Fe,UA1Ff,CA0F2B,UA1F3B,CA0FuC,UA1FvC,CA2FT,UA3FS,CA2FG,SA3FH,CA2Fe,UA3Ff,CA2F2B,UA3F3B,CA2FuC,UA3FvC,CA4FT,UA5FS,CA4FG,UA5FH,CA4Fe,UA5Ff,CA4F2B,UA5F3B,CA4FuC,UA5FvC,CA6FT,UA7FS,CA6FG,UA7FH,CA6Fe,UA7Ff,CA6F2B,UA7F3B,CA6FuC,UA7FvC,CA8FT,UA9FS;AA8FG,UA9FH,CA8Fe,UA9Ff,CA8F2B,UA9F3B,CA8FuC,UA9FvC,CA+FT,UA/FS,CA+FG,UA/FH,CA+Fe,SA/Ff,CA+F2B,UA/F3B,CA+FuC,SA/FvC,CAgGT,SAhGS,CAgGG,UAhGH,CAgGe,SAhGf,CAgG2B,SAhG3B,CAgGuC,SAhGvC,CAiGT,SAjGS,CAiGG,UAjGH,CAiGe,UAjGf,CAiG2B,UAjG3B,CAiGuC,UAjGvC,CAkGT,UAlGS,CAkGG,UAlGH,CAkGe,UAlGf,CAkG2B,UAlG3B,CAkGuC,SAlGvC,CAmGT,UAnGS,CAmGG,UAnGH,CAmGe,UAnGf,CAmG2B,UAnG3B,CAmGuC,UAnGvC,CAoGT,UApGS,CAoGG,UApGH,CAoGe,UApGf,CAoG2B,UApG3B,CAoGuC,SApGvC,CAqGT,UArGS,CAqGG,SArGH,CAqGe,UArGf,CAqG2B,UArG3B,CAqGuC,UArGvC,CAsGT,UAtGS,CAsGG,UAtGH,CAsGe,UAtGf,CAsG2B,SAtG3B,CAsGuC,UAtGvC,CAuGT,UAvGS,CAuGG,UAvGH,CAuGe,UAvGf;AAuG2B,UAvG3B,CAuGuC,UAvGvC,CAwGT,UAxGS,CAwGG,UAxGH,CAwGe,UAxGf,CAwG2B,UAxG3B,CAwGuC,UAxGvC,CAyGT,UAzGS,CAyGG,SAzGH,CAyGe,UAzGf,CAyG2B,UAzG3B,CAyGuC,SAzGvC,CA0GT,UA1GS,CA0GG,SA1GH,CA0Ge,UA1Gf,CA0G2B,UA1G3B,CA0GuC,UA1GvC,CA2GT,UA3GS,CA2GG,UA3GH,CA2Ge,UA3Gf,CA2G2B,QA3G3B,CA2GuC,UA3GvC,CA4GT,SA5GS,CA4GG,UA5GH,CA4Ge,UA5Gf,CA4G2B,UA5G3B,CA4GuC,UA5GvC,CA6GT,SA7GS,CA6GG,UA7GH,CA6Ge,SA7Gf,CA6G2B,UA7G3B,CA6GuC,UA7GvC,CA8GT,UA9GS,CA8GG,UA9GH,CA8Ge,SA9Gf,CA8G2B,UA9G3B,CA8GuC,UA9GvC,CA+GT,UA/GS,CA+GG,UA/GH,CA+Ge,UA/Gf,CA+G2B,UA/G3B,CA+GuC,UA/GvC,CAgHT,UAhHS,CAgHG,SAhHH,CAgHe,UAhHf,CAgH2B,UAhH3B,CAgHuC,SAhHvC;AAiHT,SAjHS,CAiHG,UAjHH,CAiHe,SAjHf,CAiH2B,UAjH3B,CAiHuC,SAjHvC,CAkHT,UAlHS,CAkHG,UAlHH,CAkHe,UAlHf,CAkH2B,UAlH3B,CAkHuC,UAlHvC,CAmHT,UAnHS,CAmHG,UAnHH,CAmHe,UAnHf,CAmH2B,SAnH3B,CAmHuC,UAnHvC,CAoHT,UApHS,CAoHG,UApHH,CAoHe,UApHf,CAoH2B,UApH3B,CAoHuC,UApHvC,CAqHT,UArHS,CAqHG,UArHH,CAqHe,UArHf,CAqH2B,UArH3B,CAqHuC,UArHvC,CAsHT,QAtHS,CAsHG,UAtHH,CAsHe,QAtHf,CAsH2B,UAtH3B,CAsHuC,UAtHvC,CAuHT,UAvHS,CAuHG,UAvHH,CAuHe,SAvHf,CAuH2B,UAvH3B,CAuHuC,UAvHvC,CAwHT,UAxHS,CAwHG,SAxHH,CAwHe,UAxHf,CAwH2B,UAxH3B,CAwHuC,UAxHvC,CAyHT,SAzHS,CAyHG,UAzHH,CAyHe,UAzHf,CAyH2B,SAzH3B,CAyHuC,SAzHvC,CA0HT,QA1HS,CA0HG,UA1HH;AA0He,UA1Hf,CA0H2B,UA1H3B,CA0HuC,SA1HvC,CA2HT,SA3HS,CA2HG,UA3HH,CA2He,UA3Hf,CA2H2B,UA3H3B,CA2HuC,UA3HvC,CA4HT,SA5HS,CA4HG,UA5HH,CA4He,UA5Hf,CA4H2B,UA5H3B,CA4HuC,UA5HvC,CA6HT,UA7HS,CA6HG,UA7HH,CA6He,UA7Hf,CA6H2B,UA7H3B,CA6HuC,SA7HvC,CA8HT,UA9HS,CA8HG,SA9HH,CA8He,UA9Hf,CA8H2B,UA9H3B,CA8HuC,UA9HvC,CA+HT,UA/HS,CA+HG,UA/HH,CA+He,UA/Hf,CA+H2B,UA/H3B,CA+HuC,SA/HvC,CAgIT,UAhIS,CAgIG,UAhIH,CAgIe,UAhIf,CAgI2B,UAhI3B,CAgIuC,UAhIvC,CAiIT,UAjIS,CAiIG,UAjIH,CAiIe,UAjIf,CAiI2B,UAjI3B,CAiIuC,UAjIvC,CAkIT,UAlIS,CAkIG,UAlIH,CAkIe,UAlIf,CAkI2B,SAlI3B,CAkIuC,UAlIvC,CAmIT,UAnIS,CAmIG,UAnIH,CAmIe,UAnIf,CAmI2B,UAnI3B;AAmIuC,SAnIvC,CAoIT,UApIS,CAoIG,UApIH,CAoIe,UApIf,CAoI2B,SApI3B,CAoIuC,UApIvC,CAqIT,SArIS,CAqIG,SArIH,CAqIe,UArIf,CAqI2B,UArI3B,CAqIuC,UArIvC,CAsIT,SAtIS,CAsIG,UAtIH,CAsIe,UAtIf,CAsI2B,UAtI3B,CAsIuC,UAtIvC,CAuIT,UAvIS,CAuIG,UAvIH,CAuIe,UAvIf,CAuI2B,UAvI3B,CAuIuC,UAvIvC,CAwIT,UAxIS,CAwIG,UAxIH,CAwIe,UAxIf,CAwI2B,UAxI3B,CAwIuC,UAxIvC,CAyIT,UAzIS,CAyIG,UAzIH,CAyIe,UAzIf,CAyI2B,UAzI3B,CAyIuC,UAzIvC,CA0IT,UA1IS,CA0IG,UA1IH,CA0Ie,UA1If,CA0I2B,UA1I3B,CA0IuC,UA1IvC,CA2IT,UA3IS,CA2IG,UA3IH,CA2Ie,UA3If,CA2I2B,UA3I3B,CA2IuC,UA3IvC,CA4IT,UA5IS,CA4IG,UA5IH,CA4Ie,UA5If,CA4I2B,UA5I3B,CA4IuC,UA5IvC;AA6IT,UA7IS,CA6IG,SA7IH,CA6Ie,UA7If,CA6I2B,UA7I3B,CA6IuC,UA7IvC,CA8IT,UA9IS,CA8IG,SA9IH,CA8Ie,UA9If,CA8I2B,UA9I3B,CA8IuC,UA9IvC,CA+IT,UA/IS,CA+IG,UA/IH,CA+Ie,UA/If,CA+I2B,SA/I3B,CA+IuC,UA/IvC,CAgJT,SAhJS,CAgJG,SAhJH,CAgJe,SAhJf,CAgJ2B,UAhJ3B,CAgJuC,SAhJvC,CAiJT,UAjJS,CAiJG,UAjJH,CAiJe,UAjJf,CAiJ2B,UAjJ3B,CAiJuC,UAjJvC,CAkJT,UAlJS,CAkJG,UAlJH,CAkJe,SAlJf,CAkJ2B,UAlJ3B,CAkJuC,UAlJvC,CAmJT,UAnJS,CAmJG,UAnJH,CAmJe,UAnJf,CAmJ2B,UAnJ3B,CAmJuC,OAnJvC,CAoJT,SApJS,CAoJG,SApJH,CAoJe,SApJf,CAoJ2B,UApJ3B,CAoJuC,UApJvC,CAqJT,UArJS,CAqJG,UArJH,CAqJe,UArJf,CAqJ2B,UArJ3B,CAqJuC,UArJvC,CAsJT,UAtJS,CAsJG,SAtJH;AAsJe,UAtJf,CAsJ2B,UAtJ3B,CAsJuC,UAtJvC,CAuJT,SAvJS,CAuJG,UAvJH,CAuJe,UAvJf,CAuJ2B,SAvJ3B,CAuJuC,UAvJvC,CAwJT,UAxJS,CAwJG,SAxJH,CAwJe,UAxJf,CAwJ2B,UAxJ3B,CAwJuC,UAxJvC,CAyJT,UAzJS,CAyJG,UAzJH,CAyJe,SAzJf,CAyJ2B,UAzJ3B,CAyJuC,UAzJvC,CA0JT,UA1JS,CA0JG,UA1JH,CA0Je,UA1Jf,CA0J2B,SA1J3B,CA0JuC,UA1JvC,CA2JT,UA3JS,CA2JG,UA3JH,CA2Je,UA3Jf,CA2J2B,UA3J3B,CA2JuC,UA3JvC,CA4JT,UA5JS,CA4JG,UA5JH,CA4Je,UA5Jf,CA4J2B,UA5J3B,CA4JuC,UA5JvC,CA6JT,UA7JS,CA6JG,SA7JH,CA6Je,UA7Jf,CA6J2B,UA7J3B,CA6JuC,UA7JvC,CA8JT,UA9JS,CA8JG,UA9JH,CA8Je,UA9Jf,CA8J2B,UA9J3B,CA8JuC,UA9JvC,CA+JT,UA/JS,CA+JG,UA/JH,CA+Je,SA/Jf,CA+J2B,UA/J3B;AA+JuC,UA/JvC,CAgKT,UAhKS,CAgKG,UAhKH,CAgKe,UAhKf,CAgK2B,UAhK3B,CAgKuC,UAhKvC,CAiKT,UAjKS,CAiKG,UAjKH,CAiKe,UAjKf,CAiK2B,UAjK3B,CAiKuC,UAjKvC,CAkKT,UAlKS,CAkKG,UAlKH,CAkKe,UAlKf,CAkK2B,SAlK3B,CAkKuC,UAlKvC,CAmKT,UAnKS,CAmKG,UAnKH,CAmKe,UAnKf,CAmK2B,UAnK3B,CAmKuC,UAnKvC,CAoKT,UApKS,CAoKG,UApKH,CAoKe,UApKf,CAoK2B,UApK3B,CAoKuC,SApKvC,CAqKT,UArKS,CAqKG,UArKH,CAqKe,SArKf,CAqK2B,QArK3B,CAqKuC,UArKvC,CAsKT,QAtKS,CAsKG,UAtKH,CAsKe,UAtKf,CAsK2B,SAtK3B,CAsKuC,UAtKvC,CAuKT,UAvKS,CAuKG,UAvKH,CAuKe,UAvKf,CAuK2B,UAvK3B,CAuKuC,UAvKvC,CAwKT,UAxKS,CAwKG,UAxKH,CAwKe,SAxKf,CAwK2B,UAxK3B,CAwKuC,UAxKvC,CAyKT,UAzKS;AAyKG,UAzKH,CAyKe,UAzKf,CAyK2B,UAzK3B,CAyKuC,SAzKvC,CA0KT,UA1KS,CA0KG,QA1KH,CA0Ke,QA1Kf,CA0K2B,UA1K3B,CA0KuC,UA1KvC,CA2KT,UA3KS,CA2KG,UA3KH,CA2Ke,SA3Kf,CA2K2B,SA3K3B,CA2KuC,UA3KvC,CA4KT,SA5KS,CA4KG,UA5KH,CA4Ke,UA5Kf,CA4K2B,QA5K3B,CA4KuC,UA5KvC,CA6KT,SA7KS,CA6KG,UA7KH,CA6Ke,UA7Kf,CA6K2B,UA7K3B,CA6KuC,UA7KvC,CA8KT,SA9KS,CA8KG,SA9KH,CA8Ke,UA9Kf,CA8K2B,UA9K3B,CA8KuC,UA9KvC,CA+KT,UA/KS,CA+KG,UA/KH,CA+Ke,UA/Kf,CA+K2B,UA/K3B,CA+KuC,UA/KvC,CAgLT,UAhLS,CAgLG,UAhLH,CAgLe,UAhLf,CAgL2B,UAhL3B,CAgLuC,SAhLvC,CAiLT,UAjLS,CAiLG,UAjLH,CAiLe,UAjLf,CAiL2B,SAjL3B,CAiLuC,UAjLvC,CAkLT,SAlLS,CAkLG,UAlLH,CAkLe,UAlLf;AAkL2B,UAlL3B,CAkLuC,SAlLvC,CAmLT,UAnLS,CAmLG,UAnLH,CAmLe,UAnLf,CAmL2B,UAnL3B,CAmLuC,UAnLvC,CAoLT,UApLS,CAoLG,UApLH,CAoLe,UApLf,CAoL2B,UApL3B,CAoLuC,UApLvC,CAqLT,UArLS,CAqLG,UArLH,CAqLe,UArLf,CAqL2B,UArL3B,CAqLuC,UArLvC,CAsLT,UAtLS,CAsLG,SAtLH,CAsLe,QAtLf,CAsL2B,SAtL3B,CAsLuC,UAtLvC,CAuLT,SAvLS,CAuLG,UAvLH,CAuLe,UAvLf,CAuL2B,SAvL3B,CAuLuC,QAvLvC,CAwLT,SAxLS,CAwLG,UAxLH,CAwLe,UAxLf,CAwL2B,UAxL3B,CAwLuC,SAxLvC,CAyLT,UAzLS,CAyLG,UAzLH,CAyLe,SAzLf,CAyL2B,UAzL3B,CAyLuC,UAzLvC,CA0LT,UA1LS,CA0LG,UA1LH,CA0Le,UA1Lf,CA0L2B,SA1L3B,CA0LuC,UA1LvC,CA2LT,UA3LS,CA2LG,UA3LH,CA2Le,QA3Lf,CA2L2B,UA3L3B,CA2LuC,UA3LvC;AA4LT,UA5LS,CA4LG,UA5LH,CA4Le,UA5Lf,CA4L2B,UA5L3B,CA4LuC,SA5LvC,CA6LT,UA7LS,CA6LG,SA7LH,CA6Le,SA7Lf,CA6L2B,UA7L3B,CA6LuC,UA7LvC,CA8LT,UA9LS,CA8LG,UA9LH,CA8Le,SA9Lf,CA8L2B,UA9L3B,CA8LuC,UA9LvC,CA+LT,SA/LS,CA+LG,UA/LH,CA+Le,UA/Lf,CA+L2B,SA/L3B,CA+LuC,UA/LvC,CAgMT,SAhMS,CAgMG,UAhMH,CAgMe,UAhMf,CAgM2B,UAhM3B,CAgMuC,UAhMvC,CAiMT,SAjMS,CAiMG,UAjMH,CAiMe,UAjMf,CAiM2B,UAjM3B,CAiMuC,UAjMvC,CAkMT,UAlMS,CAkMG,UAlMH,CAkMe,SAlMf,CAkM2B,UAlM3B,CAkMuC,SAlMvC,CAmMT,UAnMS,CAmMG,UAnMH,CAmMe,SAnMf,CAmM2B,UAnM3B,CAmMuC,UAnMvC,CAoMT,UApMS,CAoMG,UApMH,CAoMe,UApMf,CAoM2B,UApM3B,CAoMuC,UApMvC,CAqMT,UArMS,CAqMG,UArMH;AAqMe,UArMf,CAqM2B,UArM3B,CAqMuC,UArMvC,CAsMT,UAtMS,CAsMG,UAtMH,CAsMe,UAtMf,CAsM2B,UAtM3B,CAsMuC,SAtMvC,CAuMT,UAvMS,CAuMG,UAvMH,CAuMe,UAvMf,CAuM2B,UAvM3B,CAuMuC,UAvMvC,CAwMT,SAxMS,CAwMG,UAxMH,CAwMe,UAxMf,CAwM2B,UAxM3B,CAwMuC,UAxMvC,CAyMT,UAzMS,CAyMG,SAzMH,CAyMe,SAzMf,CAyM2B,SAzM3B,CAyMuC,UAzMvC,CA0MT,UA1MS,CA0MG,UA1MH,CA0Me,SA1Mf,CA0M2B,UA1M3B,CA0MuC,UA1MvC,CA2MT,UA3MS,CA2MG,UA3MH,CA2Me,SA3Mf,CA2M2B,QA3M3B,CA2MuC,QA3MvC,CA4MT,UA5MS,CA4MG,UA5MH,CA4Me,UA5Mf,CA4M2B,UA5M3B,CA4MuC,UA5MvC,CA6MT,UA7MS,CA6MG,UA7MH,CA6Me,UA7Mf,CA6M2B,SA7M3B,CAZb,CAiOIN,EAAS,CACT,UADS,CACG,UADH,CACe,UADf,CAC2B,UAD3B,CACuC,UADvC;AAET,UAFS,CAoabsB,EAAAuD,aAAA,CAAsB/H,CAUtBwE,EAAAwD,aAAA,CAAsBzH,CAEtB,OAAOiE,EAvzCQ,CATlB;",
+"sources":["dist/bcrypt.js"],
+"names":["global","factory","define","require","module","random","len","e","a","self","Uint32Array","Array","prototype","slice","call","randomFallback","Error","safeStringCompare","known","unknown","right","wrong","i","k","length","charCodeAt","stringToBytes","str","out","utfx","encodeUTF16toUTF8","b","push","base64_encode","off","rs","c1","c2","BASE64_CODE","join","base64_decode","s","slen","olen","o","code","BASE64_INDEX","stringFromCharCode","c3","c4","res","_encipher","lr","P","S","n","l","r","_streamtoword","data","offp","word","key","_key","offset","plen","sw","_ekskey","_crypt","salt","rounds","callback","progressCallback","next","start","Date","now","MAX_EXECUTION_TIME","j","clen","cdata","ret","nextTick","C_ORIG","err","bind","BCRYPT_SALT_LEN","Int32Array","P_ORIG","S_ORIG","_hash","finish","bytes","minor","toString","saltb","charAt","substring","String","fromCharCode","r1","parseInt","r2","real_salt","passwordb","bcrypt","setRandomFallback","bcrypt.setRandomFallback","genSaltSync","bcrypt.genSaltSync","seed_length","GENSALT_DEFAULT_LOG2_ROUNDS","genSalt","bcrypt.genSalt","_async","undefined","Promise","resolve","reject","hashSync","bcrypt.hashSync","hash","bcrypt.hash","compareSync","bcrypt.compareSync","substr","compare","bcrypt.compare","comp","getRounds","bcrypt.getRounds","split","getSalt","bcrypt.getSalt","process","setImmediate","setTimeout","utfx.encodeUTF8","src","dst","cp","utfx.decodeUTF8","c","d","fail","indexOf","name","RangeError","utfx.UTF16toUTF8","utfx.UTF8toUTF16","utfx.encodeUTF16toUTF8","UTF16toUTF8","encodeUTF8","utfx.decodeUTF8toUTF16","decodeUTF8","UTF8toUTF16","utfx.calculateCodePoint","utfx.calculateUTF8","calculateCodePoint","utfx.calculateUTF16asUTF8","encodeBase64","decodeBase64"]
+}
diff --git a/node_modules/bcryptjs/externs/bcrypt.js b/node_modules/bcryptjs/externs/bcrypt.js
new file mode 100644
index 0000000..c458f9d
--- /dev/null
+++ b/node_modules/bcryptjs/externs/bcrypt.js
@@ -0,0 +1,91 @@
+/*
+ * Copyright 2012 The Closure Compiler Authors.
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+/**
+ * @fileoverview Definitions for bcrypt.js 2.
+ * @externs
+ * @author Daniel Wirtz
+ */
+
+/**
+ * @type {Object.}
+ */
+var bcrypt = {};
+
+/**
+ * @param {?function(number):!Array.} random
+ */
+bcrypt.setRandomFallback = function(random) {};
+
+/**
+ * @param {number=} rounds
+ * @param {number=} seed_length
+ * @returns {string}
+ */
+bcrypt.genSaltSync = function(rounds, seed_length) {};
+
+/**
+ * @param {(number|function(Error, ?string))=} rounds
+ * @param {(number|function(Error, ?string))=} seed_length
+ * @param {function(Error, string=)=} callback
+ */
+bcrypt.genSalt = function(rounds, seed_length, callback) {};
+
+/**
+ * @param {string} s
+ * @param {(number|string)=} salt
+ * @returns {?string}
+ */
+bcrypt.hashSync = function(s, salt) {};
+
+/**
+ * @param {string} s
+ * @param {number|string} salt
+ * @param {function(Error, string=)} callback
+ * @expose
+ */
+bcrypt.hash = function(s, salt, callback) {};
+
+/**
+ * @param {string} s
+ * @param {string} hash
+ * @returns {boolean}
+ * @throws {Error}
+ */
+bcrypt.compareSync = function(s, hash) {};
+
+/**
+ * @param {string} s
+ * @param {string} hash
+ * @param {function(Error, boolean)} callback
+ * @throws {Error}
+ */
+bcrypt.compare = function(s, hash, callback) {};
+
+/**
+ * @param {string} hash
+ * @returns {number}
+ * @throws {Error}
+ */
+bcrypt.getRounds = function(hash) {};
+
+/**
+ * @param {string} hash
+ * @returns {string}
+ * @throws {Error}
+ * @expose
+ */
+bcrypt.getSalt = function(hash) {};
diff --git a/node_modules/bcryptjs/externs/minimal-env.js b/node_modules/bcryptjs/externs/minimal-env.js
new file mode 100644
index 0000000..0db9d4c
--- /dev/null
+++ b/node_modules/bcryptjs/externs/minimal-env.js
@@ -0,0 +1,98 @@
+/**
+ * @fileoverview Minimal environment for bcrypt.js.
+ * @externs
+ */
+
+/**
+ * @param {string} moduleName
+ * returns {*}
+ */
+function require(moduleName) {}
+
+/**
+ * @constructor
+ * @private
+ */
+var Module = function() {};
+
+/**
+ * @type {*}
+ */
+Module.prototype.exports;
+
+/**
+ * @type {Module}
+ */
+var module;
+
+/**
+ * @type {string}
+ */
+var __dirname;
+
+/**
+ * @type {Object.}
+ */
+var process = {};
+
+/**
+ * @param {function()} func
+ */
+process.nextTick = function(func) {};
+
+/**
+ * @param {string} s
+ * @constructor
+ * @extends Array
+ */
+var Buffer = function(s) {};
+
+/**
+ BEGIN_NODE_INCLUDE
+ var crypto = require('crypto');
+ END_NODE_INCLUDE
+ */
+
+/**
+ * @type {Object.}
+ */
+var crypto = {};
+
+/**
+ * @param {number} n
+ * @returns {Array.}
+ */
+crypto.randomBytes = function(n) {};
+
+/**
+ * @type {Object.}
+ */
+window.crypto = {};
+
+/**
+ * @param {Uint8Array|Int8Array|Uint16Array|Int16Array|Uint32Array|Int32Array} array
+ */
+window.crypto.getRandomValues = function(array) {};
+
+/**
+ * @param {string} name
+ * @param {function(...[*]):*} constructor
+ */
+var define = function(name, constructor) {};
+
+/**
+ * @type {boolean}
+ */
+define.amd;
+
+/**
+ * @param {...*} var_args
+ * @returns {string}
+ */
+String.fromCodePoint = function(var_args) {};
+
+/**
+ * @param {number} offset
+ * @returns {number}
+ */
+String.prototype.codePointAt = function(offset) {};
diff --git a/node_modules/bcryptjs/index.js b/node_modules/bcryptjs/index.js
new file mode 100644
index 0000000..f11b4e7
--- /dev/null
+++ b/node_modules/bcryptjs/index.js
@@ -0,0 +1,29 @@
+/*
+ Copyright (c) 2012 Nevins Bartolomeo
+ Copyright (c) 2012 Shane Girish
+ Copyright (c) 2013 Daniel Wirtz
+
+ Redistribution and use in source and binary forms, with or without
+ modification, are permitted provided that the following conditions
+ are met:
+ 1. Redistributions of source code must retain the above copyright
+ notice, this list of conditions and the following disclaimer.
+ 2. Redistributions in binary form must reproduce the above copyright
+ notice, this list of conditions and the following disclaimer in the
+ documentation and/or other materials provided with the distribution.
+ 3. The name of the author may not be used to endorse or promote products
+ derived from this software without specific prior written permission.
+
+ THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR
+ IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES
+ OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED.
+ IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT,
+ INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT
+ NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE,
+ DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY
+ THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT
+ (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF
+ THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
+ */
+
+module.exports = require("./dist/bcrypt.js");
diff --git a/node_modules/bcryptjs/package.json b/node_modules/bcryptjs/package.json
new file mode 100644
index 0000000..97be5df
--- /dev/null
+++ b/node_modules/bcryptjs/package.json
@@ -0,0 +1,47 @@
+{
+ "name": "bcryptjs",
+ "description": "Optimized bcrypt in plain JavaScript with zero dependencies. Compatible to 'bcrypt'.",
+ "version": "2.4.3",
+ "author": "Daniel Wirtz ",
+ "contributors": [
+ "Shane Girish (https://github.com/shaneGirish)",
+ "Alex Murray <> (https://github.com/alexmurray)",
+ "Nicolas Pelletier <> (https://github.com/NicolasPelletier)",
+ "Josh Rogers <> (https://github.com/geekymole)",
+ "Noah Isaacson (https://github.com/nisaacson)"
+ ],
+ "repository": {
+ "type": "url",
+ "url": "https://github.com/dcodeIO/bcrypt.js.git"
+ },
+ "bugs": {
+ "url": "https://github.com/dcodeIO/bcrypt.js/issues"
+ },
+ "keywords": [
+ "bcrypt",
+ "password",
+ "auth",
+ "authentication",
+ "encryption",
+ "crypt",
+ "crypto"
+ ],
+ "main": "index.js",
+ "browser": "dist/bcrypt.js",
+ "dependencies": {},
+ "devDependencies": {
+ "testjs": "~1",
+ "closurecompiler": "~1",
+ "metascript": "~0.18",
+ "bcrypt": "latest",
+ "utfx": "~1"
+ },
+ "license": "MIT",
+ "scripts": {
+ "test": "node node_modules/testjs/bin/testjs",
+ "build": "node scripts/build.js",
+ "compile": "node node_modules/closurecompiler/bin/ccjs dist/bcrypt.js --compilation_level=SIMPLE_OPTIMIZATIONS --create_source_map=dist/bcrypt.min.map > dist/bcrypt.min.js",
+ "compress": "gzip -c -9 dist/bcrypt.min.js > dist/bcrypt.min.js.gz",
+ "make": "npm run build && npm run compile && npm run compress && npm test"
+ }
+}
diff --git a/node_modules/bcryptjs/scripts/build.js b/node_modules/bcryptjs/scripts/build.js
new file mode 100644
index 0000000..7b34ea4
--- /dev/null
+++ b/node_modules/bcryptjs/scripts/build.js
@@ -0,0 +1,37 @@
+var MetaScript = require("metascript"),
+ path = require("path"),
+ fs = require("fs");
+
+var rootDir = path.join(__dirname, ".."),
+ srcDir = path.join(rootDir, "src"),
+ distDir = path.join(rootDir, "dist"),
+ pkg = require(path.join(rootDir, "package.json")),
+ filename;
+
+var scope = {
+ VERSION: pkg.version,
+ ISAAC: false
+};
+
+// Make standard build
+console.log("Building bcrypt.js with scope", JSON.stringify(scope, null, 2));
+fs.writeFileSync(
+ path.join(distDir, "bcrypt.js"),
+ MetaScript.transform(fs.readFileSync(filename = path.join(srcDir, "wrap.js")), filename, scope, srcDir)
+);
+
+// Make isaac build - see: https://github.com/dcodeIO/bcrypt.js/issues/16
+/* scope.ISAAC = true;
+console.log("Building bcrypt-isaac.js with scope", JSON.stringify(scope, null, 2));
+fs.writeFileSync(
+ path.join(distDir, "bcrypt-isaac.js"),
+ MetaScript.transform(fs.readFileSync(filename = path.join(srcDir, "bcrypt.js")), filename, scope, srcDir)
+); */
+
+// Update bower.json
+scope = { VERSION: pkg.version };
+console.log("Updating bower.json with scope", JSON.stringify(scope, null, 2));
+fs.writeFileSync(
+ path.join(rootDir, "bower.json"),
+ MetaScript.transform(fs.readFileSync(filename = path.join(srcDir, "bower.json")), filename, scope, srcDir)
+);
diff --git a/node_modules/bcryptjs/src/bcrypt.js b/node_modules/bcryptjs/src/bcrypt.js
new file mode 100644
index 0000000..11dedc1
--- /dev/null
+++ b/node_modules/bcryptjs/src/bcrypt.js
@@ -0,0 +1,327 @@
+/**
+ * bcrypt namespace.
+ * @type {Object.}
+ */
+var bcrypt = {};
+
+/**
+ * The random implementation to use as a fallback.
+ * @type {?function(number):!Array.}
+ * @inner
+ */
+var randomFallback = null;
+
+/**
+ * Generates cryptographically secure random bytes.
+ * @function
+ * @param {number} len Bytes length
+ * @returns {!Array.} Random bytes
+ * @throws {Error} If no random implementation is available
+ * @inner
+ */
+function random(len) {
+ /* node */ if (typeof module !== 'undefined' && module && module['exports'])
+ try {
+ return require("crypto")['randomBytes'](len);
+ } catch (e) {}
+ /* WCA */ try {
+ var a; (self['crypto']||self['msCrypto'])['getRandomValues'](a = new Uint32Array(len));
+ return Array.prototype.slice.call(a);
+ } catch (e) {}
+ /* fallback */ if (!randomFallback)
+ throw Error("Neither WebCryptoAPI nor a crypto module is available. Use bcrypt.setRandomFallback to set an alternative");
+ return randomFallback(len);
+}
+
+// Test if any secure randomness source is available
+var randomAvailable = false;
+try {
+ random(1);
+ randomAvailable = true;
+} catch (e) {}
+
+// Default fallback, if any
+randomFallback = /*? if (ISAAC) { */function(len) {
+ for (var a=[], i=0; i} random Function taking the number of bytes to generate as its
+ * sole argument, returning the corresponding array of cryptographically secure random byte values.
+ * @see http://nodejs.org/api/crypto.html
+ * @see http://www.w3.org/TR/WebCryptoAPI/
+ */
+bcrypt.setRandomFallback = function(random) {
+ randomFallback = random;
+};
+
+/**
+ * Synchronously generates a salt.
+ * @param {number=} rounds Number of rounds to use, defaults to 10 if omitted
+ * @param {number=} seed_length Not supported.
+ * @returns {string} Resulting salt
+ * @throws {Error} If a random fallback is required but not set
+ * @expose
+ */
+bcrypt.genSaltSync = function(rounds, seed_length) {
+ rounds = rounds || GENSALT_DEFAULT_LOG2_ROUNDS;
+ if (typeof rounds !== 'number')
+ throw Error("Illegal arguments: "+(typeof rounds)+", "+(typeof seed_length));
+ if (rounds < 4)
+ rounds = 4;
+ else if (rounds > 31)
+ rounds = 31;
+ var salt = [];
+ salt.push("$2a$");
+ if (rounds < 10)
+ salt.push("0");
+ salt.push(rounds.toString());
+ salt.push('$');
+ salt.push(base64_encode(random(BCRYPT_SALT_LEN), BCRYPT_SALT_LEN)); // May throw
+ return salt.join('');
+};
+
+/**
+ * Asynchronously generates a salt.
+ * @param {(number|function(Error, string=))=} rounds Number of rounds to use, defaults to 10 if omitted
+ * @param {(number|function(Error, string=))=} seed_length Not supported.
+ * @param {function(Error, string=)=} callback Callback receiving the error, if any, and the resulting salt
+ * @returns {!Promise} If `callback` has been omitted
+ * @throws {Error} If `callback` is present but not a function
+ * @expose
+ */
+bcrypt.genSalt = function(rounds, seed_length, callback) {
+ if (typeof seed_length === 'function')
+ callback = seed_length,
+ seed_length = undefined; // Not supported.
+ if (typeof rounds === 'function')
+ callback = rounds,
+ rounds = undefined;
+ if (typeof rounds === 'undefined')
+ rounds = GENSALT_DEFAULT_LOG2_ROUNDS;
+ else if (typeof rounds !== 'number')
+ throw Error("illegal arguments: "+(typeof rounds));
+
+ function _async(callback) {
+ nextTick(function() { // Pretty thin, but salting is fast enough
+ try {
+ callback(null, bcrypt.genSaltSync(rounds));
+ } catch (err) {
+ callback(err);
+ }
+ });
+ }
+
+ if (callback) {
+ if (typeof callback !== 'function')
+ throw Error("Illegal callback: "+typeof(callback));
+ _async(callback);
+ } else
+ return new Promise(function(resolve, reject) {
+ _async(function(err, res) {
+ if (err) {
+ reject(err);
+ return;
+ }
+ resolve(res);
+ });
+ });
+};
+
+/**
+ * Synchronously generates a hash for the given string.
+ * @param {string} s String to hash
+ * @param {(number|string)=} salt Salt length to generate or salt to use, default to 10
+ * @returns {string} Resulting hash
+ * @expose
+ */
+bcrypt.hashSync = function(s, salt) {
+ if (typeof salt === 'undefined')
+ salt = GENSALT_DEFAULT_LOG2_ROUNDS;
+ if (typeof salt === 'number')
+ salt = bcrypt.genSaltSync(salt);
+ if (typeof s !== 'string' || typeof salt !== 'string')
+ throw Error("Illegal arguments: "+(typeof s)+', '+(typeof salt));
+ return _hash(s, salt);
+};
+
+/**
+ * Asynchronously generates a hash for the given string.
+ * @param {string} s String to hash
+ * @param {number|string} salt Salt length to generate or salt to use
+ * @param {function(Error, string=)=} callback Callback receiving the error, if any, and the resulting hash
+ * @param {function(number)=} progressCallback Callback successively called with the percentage of rounds completed
+ * (0.0 - 1.0), maximally once per `MAX_EXECUTION_TIME = 100` ms.
+ * @returns {!Promise} If `callback` has been omitted
+ * @throws {Error} If `callback` is present but not a function
+ * @expose
+ */
+bcrypt.hash = function(s, salt, callback, progressCallback) {
+
+ function _async(callback) {
+ if (typeof s === 'string' && typeof salt === 'number')
+ bcrypt.genSalt(salt, function(err, salt) {
+ _hash(s, salt, callback, progressCallback);
+ });
+ else if (typeof s === 'string' && typeof salt === 'string')
+ _hash(s, salt, callback, progressCallback);
+ else
+ nextTick(callback.bind(this, Error("Illegal arguments: "+(typeof s)+', '+(typeof salt))));
+ }
+
+ if (callback) {
+ if (typeof callback !== 'function')
+ throw Error("Illegal callback: "+typeof(callback));
+ _async(callback);
+ } else
+ return new Promise(function(resolve, reject) {
+ _async(function(err, res) {
+ if (err) {
+ reject(err);
+ return;
+ }
+ resolve(res);
+ });
+ });
+};
+
+/**
+ * Compares two strings of the same length in constant time.
+ * @param {string} known Must be of the correct length
+ * @param {string} unknown Must be the same length as `known`
+ * @returns {boolean}
+ * @inner
+ */
+function safeStringCompare(known, unknown) {
+ var right = 0,
+ wrong = 0;
+ for (var i=0, k=known.length; i} b Byte array
+ * @param {number} len Maximum input length
+ * @returns {string}
+ * @expose
+ */
+bcrypt.encodeBase64 = base64_encode;
+
+/**
+ * Decodes a base64 encoded string to up to len bytes of output, using the custom bcrypt alphabet.
+ * @function
+ * @param {string} s String to decode
+ * @param {number} len Maximum output length
+ * @returns {!Array.}
+ * @expose
+ */
+bcrypt.decodeBase64 = base64_decode;
diff --git a/node_modules/bcryptjs/src/bcrypt/impl.js b/node_modules/bcryptjs/src/bcrypt/impl.js
new file mode 100644
index 0000000..fb00aee
--- /dev/null
+++ b/node_modules/bcryptjs/src/bcrypt/impl.js
@@ -0,0 +1,669 @@
+/**
+ * @type {number}
+ * @const
+ * @inner
+ */
+var BCRYPT_SALT_LEN = 16;
+
+/**
+ * @type {number}
+ * @const
+ * @inner
+ */
+var GENSALT_DEFAULT_LOG2_ROUNDS = 10;
+
+/**
+ * @type {number}
+ * @const
+ * @inner
+ */
+var BLOWFISH_NUM_ROUNDS = 16;
+
+/**
+ * @type {number}
+ * @const
+ * @inner
+ */
+var MAX_EXECUTION_TIME = 100;
+
+/**
+ * @type {Array.}
+ * @const
+ * @inner
+ */
+var P_ORIG = [
+ 0x243f6a88, 0x85a308d3, 0x13198a2e, 0x03707344, 0xa4093822,
+ 0x299f31d0, 0x082efa98, 0xec4e6c89, 0x452821e6, 0x38d01377,
+ 0xbe5466cf, 0x34e90c6c, 0xc0ac29b7, 0xc97c50dd, 0x3f84d5b5,
+ 0xb5470917, 0x9216d5d9, 0x8979fb1b
+];
+
+/**
+ * @type {Array.}
+ * @const
+ * @inner
+ */
+var S_ORIG = [
+ 0xd1310ba6, 0x98dfb5ac, 0x2ffd72db, 0xd01adfb7, 0xb8e1afed,
+ 0x6a267e96, 0xba7c9045, 0xf12c7f99, 0x24a19947, 0xb3916cf7,
+ 0x0801f2e2, 0x858efc16, 0x636920d8, 0x71574e69, 0xa458fea3,
+ 0xf4933d7e, 0x0d95748f, 0x728eb658, 0x718bcd58, 0x82154aee,
+ 0x7b54a41d, 0xc25a59b5, 0x9c30d539, 0x2af26013, 0xc5d1b023,
+ 0x286085f0, 0xca417918, 0xb8db38ef, 0x8e79dcb0, 0x603a180e,
+ 0x6c9e0e8b, 0xb01e8a3e, 0xd71577c1, 0xbd314b27, 0x78af2fda,
+ 0x55605c60, 0xe65525f3, 0xaa55ab94, 0x57489862, 0x63e81440,
+ 0x55ca396a, 0x2aab10b6, 0xb4cc5c34, 0x1141e8ce, 0xa15486af,
+ 0x7c72e993, 0xb3ee1411, 0x636fbc2a, 0x2ba9c55d, 0x741831f6,
+ 0xce5c3e16, 0x9b87931e, 0xafd6ba33, 0x6c24cf5c, 0x7a325381,
+ 0x28958677, 0x3b8f4898, 0x6b4bb9af, 0xc4bfe81b, 0x66282193,
+ 0x61d809cc, 0xfb21a991, 0x487cac60, 0x5dec8032, 0xef845d5d,
+ 0xe98575b1, 0xdc262302, 0xeb651b88, 0x23893e81, 0xd396acc5,
+ 0x0f6d6ff3, 0x83f44239, 0x2e0b4482, 0xa4842004, 0x69c8f04a,
+ 0x9e1f9b5e, 0x21c66842, 0xf6e96c9a, 0x670c9c61, 0xabd388f0,
+ 0x6a51a0d2, 0xd8542f68, 0x960fa728, 0xab5133a3, 0x6eef0b6c,
+ 0x137a3be4, 0xba3bf050, 0x7efb2a98, 0xa1f1651d, 0x39af0176,
+ 0x66ca593e, 0x82430e88, 0x8cee8619, 0x456f9fb4, 0x7d84a5c3,
+ 0x3b8b5ebe, 0xe06f75d8, 0x85c12073, 0x401a449f, 0x56c16aa6,
+ 0x4ed3aa62, 0x363f7706, 0x1bfedf72, 0x429b023d, 0x37d0d724,
+ 0xd00a1248, 0xdb0fead3, 0x49f1c09b, 0x075372c9, 0x80991b7b,
+ 0x25d479d8, 0xf6e8def7, 0xe3fe501a, 0xb6794c3b, 0x976ce0bd,
+ 0x04c006ba, 0xc1a94fb6, 0x409f60c4, 0x5e5c9ec2, 0x196a2463,
+ 0x68fb6faf, 0x3e6c53b5, 0x1339b2eb, 0x3b52ec6f, 0x6dfc511f,
+ 0x9b30952c, 0xcc814544, 0xaf5ebd09, 0xbee3d004, 0xde334afd,
+ 0x660f2807, 0x192e4bb3, 0xc0cba857, 0x45c8740f, 0xd20b5f39,
+ 0xb9d3fbdb, 0x5579c0bd, 0x1a60320a, 0xd6a100c6, 0x402c7279,
+ 0x679f25fe, 0xfb1fa3cc, 0x8ea5e9f8, 0xdb3222f8, 0x3c7516df,
+ 0xfd616b15, 0x2f501ec8, 0xad0552ab, 0x323db5fa, 0xfd238760,
+ 0x53317b48, 0x3e00df82, 0x9e5c57bb, 0xca6f8ca0, 0x1a87562e,
+ 0xdf1769db, 0xd542a8f6, 0x287effc3, 0xac6732c6, 0x8c4f5573,
+ 0x695b27b0, 0xbbca58c8, 0xe1ffa35d, 0xb8f011a0, 0x10fa3d98,
+ 0xfd2183b8, 0x4afcb56c, 0x2dd1d35b, 0x9a53e479, 0xb6f84565,
+ 0xd28e49bc, 0x4bfb9790, 0xe1ddf2da, 0xa4cb7e33, 0x62fb1341,
+ 0xcee4c6e8, 0xef20cada, 0x36774c01, 0xd07e9efe, 0x2bf11fb4,
+ 0x95dbda4d, 0xae909198, 0xeaad8e71, 0x6b93d5a0, 0xd08ed1d0,
+ 0xafc725e0, 0x8e3c5b2f, 0x8e7594b7, 0x8ff6e2fb, 0xf2122b64,
+ 0x8888b812, 0x900df01c, 0x4fad5ea0, 0x688fc31c, 0xd1cff191,
+ 0xb3a8c1ad, 0x2f2f2218, 0xbe0e1777, 0xea752dfe, 0x8b021fa1,
+ 0xe5a0cc0f, 0xb56f74e8, 0x18acf3d6, 0xce89e299, 0xb4a84fe0,
+ 0xfd13e0b7, 0x7cc43b81, 0xd2ada8d9, 0x165fa266, 0x80957705,
+ 0x93cc7314, 0x211a1477, 0xe6ad2065, 0x77b5fa86, 0xc75442f5,
+ 0xfb9d35cf, 0xebcdaf0c, 0x7b3e89a0, 0xd6411bd3, 0xae1e7e49,
+ 0x00250e2d, 0x2071b35e, 0x226800bb, 0x57b8e0af, 0x2464369b,
+ 0xf009b91e, 0x5563911d, 0x59dfa6aa, 0x78c14389, 0xd95a537f,
+ 0x207d5ba2, 0x02e5b9c5, 0x83260376, 0x6295cfa9, 0x11c81968,
+ 0x4e734a41, 0xb3472dca, 0x7b14a94a, 0x1b510052, 0x9a532915,
+ 0xd60f573f, 0xbc9bc6e4, 0x2b60a476, 0x81e67400, 0x08ba6fb5,
+ 0x571be91f, 0xf296ec6b, 0x2a0dd915, 0xb6636521, 0xe7b9f9b6,
+ 0xff34052e, 0xc5855664, 0x53b02d5d, 0xa99f8fa1, 0x08ba4799,
+ 0x6e85076a, 0x4b7a70e9, 0xb5b32944, 0xdb75092e, 0xc4192623,
+ 0xad6ea6b0, 0x49a7df7d, 0x9cee60b8, 0x8fedb266, 0xecaa8c71,
+ 0x699a17ff, 0x5664526c, 0xc2b19ee1, 0x193602a5, 0x75094c29,
+ 0xa0591340, 0xe4183a3e, 0x3f54989a, 0x5b429d65, 0x6b8fe4d6,
+ 0x99f73fd6, 0xa1d29c07, 0xefe830f5, 0x4d2d38e6, 0xf0255dc1,
+ 0x4cdd2086, 0x8470eb26, 0x6382e9c6, 0x021ecc5e, 0x09686b3f,
+ 0x3ebaefc9, 0x3c971814, 0x6b6a70a1, 0x687f3584, 0x52a0e286,
+ 0xb79c5305, 0xaa500737, 0x3e07841c, 0x7fdeae5c, 0x8e7d44ec,
+ 0x5716f2b8, 0xb03ada37, 0xf0500c0d, 0xf01c1f04, 0x0200b3ff,
+ 0xae0cf51a, 0x3cb574b2, 0x25837a58, 0xdc0921bd, 0xd19113f9,
+ 0x7ca92ff6, 0x94324773, 0x22f54701, 0x3ae5e581, 0x37c2dadc,
+ 0xc8b57634, 0x9af3dda7, 0xa9446146, 0x0fd0030e, 0xecc8c73e,
+ 0xa4751e41, 0xe238cd99, 0x3bea0e2f, 0x3280bba1, 0x183eb331,
+ 0x4e548b38, 0x4f6db908, 0x6f420d03, 0xf60a04bf, 0x2cb81290,
+ 0x24977c79, 0x5679b072, 0xbcaf89af, 0xde9a771f, 0xd9930810,
+ 0xb38bae12, 0xdccf3f2e, 0x5512721f, 0x2e6b7124, 0x501adde6,
+ 0x9f84cd87, 0x7a584718, 0x7408da17, 0xbc9f9abc, 0xe94b7d8c,
+ 0xec7aec3a, 0xdb851dfa, 0x63094366, 0xc464c3d2, 0xef1c1847,
+ 0x3215d908, 0xdd433b37, 0x24c2ba16, 0x12a14d43, 0x2a65c451,
+ 0x50940002, 0x133ae4dd, 0x71dff89e, 0x10314e55, 0x81ac77d6,
+ 0x5f11199b, 0x043556f1, 0xd7a3c76b, 0x3c11183b, 0x5924a509,
+ 0xf28fe6ed, 0x97f1fbfa, 0x9ebabf2c, 0x1e153c6e, 0x86e34570,
+ 0xeae96fb1, 0x860e5e0a, 0x5a3e2ab3, 0x771fe71c, 0x4e3d06fa,
+ 0x2965dcb9, 0x99e71d0f, 0x803e89d6, 0x5266c825, 0x2e4cc978,
+ 0x9c10b36a, 0xc6150eba, 0x94e2ea78, 0xa5fc3c53, 0x1e0a2df4,
+ 0xf2f74ea7, 0x361d2b3d, 0x1939260f, 0x19c27960, 0x5223a708,
+ 0xf71312b6, 0xebadfe6e, 0xeac31f66, 0xe3bc4595, 0xa67bc883,
+ 0xb17f37d1, 0x018cff28, 0xc332ddef, 0xbe6c5aa5, 0x65582185,
+ 0x68ab9802, 0xeecea50f, 0xdb2f953b, 0x2aef7dad, 0x5b6e2f84,
+ 0x1521b628, 0x29076170, 0xecdd4775, 0x619f1510, 0x13cca830,
+ 0xeb61bd96, 0x0334fe1e, 0xaa0363cf, 0xb5735c90, 0x4c70a239,
+ 0xd59e9e0b, 0xcbaade14, 0xeecc86bc, 0x60622ca7, 0x9cab5cab,
+ 0xb2f3846e, 0x648b1eaf, 0x19bdf0ca, 0xa02369b9, 0x655abb50,
+ 0x40685a32, 0x3c2ab4b3, 0x319ee9d5, 0xc021b8f7, 0x9b540b19,
+ 0x875fa099, 0x95f7997e, 0x623d7da8, 0xf837889a, 0x97e32d77,
+ 0x11ed935f, 0x16681281, 0x0e358829, 0xc7e61fd6, 0x96dedfa1,
+ 0x7858ba99, 0x57f584a5, 0x1b227263, 0x9b83c3ff, 0x1ac24696,
+ 0xcdb30aeb, 0x532e3054, 0x8fd948e4, 0x6dbc3128, 0x58ebf2ef,
+ 0x34c6ffea, 0xfe28ed61, 0xee7c3c73, 0x5d4a14d9, 0xe864b7e3,
+ 0x42105d14, 0x203e13e0, 0x45eee2b6, 0xa3aaabea, 0xdb6c4f15,
+ 0xfacb4fd0, 0xc742f442, 0xef6abbb5, 0x654f3b1d, 0x41cd2105,
+ 0xd81e799e, 0x86854dc7, 0xe44b476a, 0x3d816250, 0xcf62a1f2,
+ 0x5b8d2646, 0xfc8883a0, 0xc1c7b6a3, 0x7f1524c3, 0x69cb7492,
+ 0x47848a0b, 0x5692b285, 0x095bbf00, 0xad19489d, 0x1462b174,
+ 0x23820e00, 0x58428d2a, 0x0c55f5ea, 0x1dadf43e, 0x233f7061,
+ 0x3372f092, 0x8d937e41, 0xd65fecf1, 0x6c223bdb, 0x7cde3759,
+ 0xcbee7460, 0x4085f2a7, 0xce77326e, 0xa6078084, 0x19f8509e,
+ 0xe8efd855, 0x61d99735, 0xa969a7aa, 0xc50c06c2, 0x5a04abfc,
+ 0x800bcadc, 0x9e447a2e, 0xc3453484, 0xfdd56705, 0x0e1e9ec9,
+ 0xdb73dbd3, 0x105588cd, 0x675fda79, 0xe3674340, 0xc5c43465,
+ 0x713e38d8, 0x3d28f89e, 0xf16dff20, 0x153e21e7, 0x8fb03d4a,
+ 0xe6e39f2b, 0xdb83adf7, 0xe93d5a68, 0x948140f7, 0xf64c261c,
+ 0x94692934, 0x411520f7, 0x7602d4f7, 0xbcf46b2e, 0xd4a20068,
+ 0xd4082471, 0x3320f46a, 0x43b7d4b7, 0x500061af, 0x1e39f62e,
+ 0x97244546, 0x14214f74, 0xbf8b8840, 0x4d95fc1d, 0x96b591af,
+ 0x70f4ddd3, 0x66a02f45, 0xbfbc09ec, 0x03bd9785, 0x7fac6dd0,
+ 0x31cb8504, 0x96eb27b3, 0x55fd3941, 0xda2547e6, 0xabca0a9a,
+ 0x28507825, 0x530429f4, 0x0a2c86da, 0xe9b66dfb, 0x68dc1462,
+ 0xd7486900, 0x680ec0a4, 0x27a18dee, 0x4f3ffea2, 0xe887ad8c,
+ 0xb58ce006, 0x7af4d6b6, 0xaace1e7c, 0xd3375fec, 0xce78a399,
+ 0x406b2a42, 0x20fe9e35, 0xd9f385b9, 0xee39d7ab, 0x3b124e8b,
+ 0x1dc9faf7, 0x4b6d1856, 0x26a36631, 0xeae397b2, 0x3a6efa74,
+ 0xdd5b4332, 0x6841e7f7, 0xca7820fb, 0xfb0af54e, 0xd8feb397,
+ 0x454056ac, 0xba489527, 0x55533a3a, 0x20838d87, 0xfe6ba9b7,
+ 0xd096954b, 0x55a867bc, 0xa1159a58, 0xcca92963, 0x99e1db33,
+ 0xa62a4a56, 0x3f3125f9, 0x5ef47e1c, 0x9029317c, 0xfdf8e802,
+ 0x04272f70, 0x80bb155c, 0x05282ce3, 0x95c11548, 0xe4c66d22,
+ 0x48c1133f, 0xc70f86dc, 0x07f9c9ee, 0x41041f0f, 0x404779a4,
+ 0x5d886e17, 0x325f51eb, 0xd59bc0d1, 0xf2bcc18f, 0x41113564,
+ 0x257b7834, 0x602a9c60, 0xdff8e8a3, 0x1f636c1b, 0x0e12b4c2,
+ 0x02e1329e, 0xaf664fd1, 0xcad18115, 0x6b2395e0, 0x333e92e1,
+ 0x3b240b62, 0xeebeb922, 0x85b2a20e, 0xe6ba0d99, 0xde720c8c,
+ 0x2da2f728, 0xd0127845, 0x95b794fd, 0x647d0862, 0xe7ccf5f0,
+ 0x5449a36f, 0x877d48fa, 0xc39dfd27, 0xf33e8d1e, 0x0a476341,
+ 0x992eff74, 0x3a6f6eab, 0xf4f8fd37, 0xa812dc60, 0xa1ebddf8,
+ 0x991be14c, 0xdb6e6b0d, 0xc67b5510, 0x6d672c37, 0x2765d43b,
+ 0xdcd0e804, 0xf1290dc7, 0xcc00ffa3, 0xb5390f92, 0x690fed0b,
+ 0x667b9ffb, 0xcedb7d9c, 0xa091cf0b, 0xd9155ea3, 0xbb132f88,
+ 0x515bad24, 0x7b9479bf, 0x763bd6eb, 0x37392eb3, 0xcc115979,
+ 0x8026e297, 0xf42e312d, 0x6842ada7, 0xc66a2b3b, 0x12754ccc,
+ 0x782ef11c, 0x6a124237, 0xb79251e7, 0x06a1bbe6, 0x4bfb6350,
+ 0x1a6b1018, 0x11caedfa, 0x3d25bdd8, 0xe2e1c3c9, 0x44421659,
+ 0x0a121386, 0xd90cec6e, 0xd5abea2a, 0x64af674e, 0xda86a85f,
+ 0xbebfe988, 0x64e4c3fe, 0x9dbc8057, 0xf0f7c086, 0x60787bf8,
+ 0x6003604d, 0xd1fd8346, 0xf6381fb0, 0x7745ae04, 0xd736fccc,
+ 0x83426b33, 0xf01eab71, 0xb0804187, 0x3c005e5f, 0x77a057be,
+ 0xbde8ae24, 0x55464299, 0xbf582e61, 0x4e58f48f, 0xf2ddfda2,
+ 0xf474ef38, 0x8789bdc2, 0x5366f9c3, 0xc8b38e74, 0xb475f255,
+ 0x46fcd9b9, 0x7aeb2661, 0x8b1ddf84, 0x846a0e79, 0x915f95e2,
+ 0x466e598e, 0x20b45770, 0x8cd55591, 0xc902de4c, 0xb90bace1,
+ 0xbb8205d0, 0x11a86248, 0x7574a99e, 0xb77f19b6, 0xe0a9dc09,
+ 0x662d09a1, 0xc4324633, 0xe85a1f02, 0x09f0be8c, 0x4a99a025,
+ 0x1d6efe10, 0x1ab93d1d, 0x0ba5a4df, 0xa186f20f, 0x2868f169,
+ 0xdcb7da83, 0x573906fe, 0xa1e2ce9b, 0x4fcd7f52, 0x50115e01,
+ 0xa70683fa, 0xa002b5c4, 0x0de6d027, 0x9af88c27, 0x773f8641,
+ 0xc3604c06, 0x61a806b5, 0xf0177a28, 0xc0f586e0, 0x006058aa,
+ 0x30dc7d62, 0x11e69ed7, 0x2338ea63, 0x53c2dd94, 0xc2c21634,
+ 0xbbcbee56, 0x90bcb6de, 0xebfc7da1, 0xce591d76, 0x6f05e409,
+ 0x4b7c0188, 0x39720a3d, 0x7c927c24, 0x86e3725f, 0x724d9db9,
+ 0x1ac15bb4, 0xd39eb8fc, 0xed545578, 0x08fca5b5, 0xd83d7cd3,
+ 0x4dad0fc4, 0x1e50ef5e, 0xb161e6f8, 0xa28514d9, 0x6c51133c,
+ 0x6fd5c7e7, 0x56e14ec4, 0x362abfce, 0xddc6c837, 0xd79a3234,
+ 0x92638212, 0x670efa8e, 0x406000e0, 0x3a39ce37, 0xd3faf5cf,
+ 0xabc27737, 0x5ac52d1b, 0x5cb0679e, 0x4fa33742, 0xd3822740,
+ 0x99bc9bbe, 0xd5118e9d, 0xbf0f7315, 0xd62d1c7e, 0xc700c47b,
+ 0xb78c1b6b, 0x21a19045, 0xb26eb1be, 0x6a366eb4, 0x5748ab2f,
+ 0xbc946e79, 0xc6a376d2, 0x6549c2c8, 0x530ff8ee, 0x468dde7d,
+ 0xd5730a1d, 0x4cd04dc6, 0x2939bbdb, 0xa9ba4650, 0xac9526e8,
+ 0xbe5ee304, 0xa1fad5f0, 0x6a2d519a, 0x63ef8ce2, 0x9a86ee22,
+ 0xc089c2b8, 0x43242ef6, 0xa51e03aa, 0x9cf2d0a4, 0x83c061ba,
+ 0x9be96a4d, 0x8fe51550, 0xba645bd6, 0x2826a2f9, 0xa73a3ae1,
+ 0x4ba99586, 0xef5562e9, 0xc72fefd3, 0xf752f7da, 0x3f046f69,
+ 0x77fa0a59, 0x80e4a915, 0x87b08601, 0x9b09e6ad, 0x3b3ee593,
+ 0xe990fd5a, 0x9e34d797, 0x2cf0b7d9, 0x022b8b51, 0x96d5ac3a,
+ 0x017da67d, 0xd1cf3ed6, 0x7c7d2d28, 0x1f9f25cf, 0xadf2b89b,
+ 0x5ad6b472, 0x5a88f54c, 0xe029ac71, 0xe019a5e6, 0x47b0acfd,
+ 0xed93fa9b, 0xe8d3c48d, 0x283b57cc, 0xf8d56629, 0x79132e28,
+ 0x785f0191, 0xed756055, 0xf7960e44, 0xe3d35e8c, 0x15056dd4,
+ 0x88f46dba, 0x03a16125, 0x0564f0bd, 0xc3eb9e15, 0x3c9057a2,
+ 0x97271aec, 0xa93a072a, 0x1b3f6d9b, 0x1e6321f5, 0xf59c66fb,
+ 0x26dcf319, 0x7533d928, 0xb155fdf5, 0x03563482, 0x8aba3cbb,
+ 0x28517711, 0xc20ad9f8, 0xabcc5167, 0xccad925f, 0x4de81751,
+ 0x3830dc8e, 0x379d5862, 0x9320f991, 0xea7a90c2, 0xfb3e7bce,
+ 0x5121ce64, 0x774fbe32, 0xa8b6e37e, 0xc3293d46, 0x48de5369,
+ 0x6413e680, 0xa2ae0810, 0xdd6db224, 0x69852dfd, 0x09072166,
+ 0xb39a460a, 0x6445c0dd, 0x586cdecf, 0x1c20c8ae, 0x5bbef7dd,
+ 0x1b588d40, 0xccd2017f, 0x6bb4e3bb, 0xdda26a7e, 0x3a59ff45,
+ 0x3e350a44, 0xbcb4cdd5, 0x72eacea8, 0xfa6484bb, 0x8d6612ae,
+ 0xbf3c6f47, 0xd29be463, 0x542f5d9e, 0xaec2771b, 0xf64e6370,
+ 0x740e0d8d, 0xe75b1357, 0xf8721671, 0xaf537d5d, 0x4040cb08,
+ 0x4eb4e2cc, 0x34d2466a, 0x0115af84, 0xe1b00428, 0x95983a1d,
+ 0x06b89fb4, 0xce6ea048, 0x6f3f3b82, 0x3520ab82, 0x011a1d4b,
+ 0x277227f8, 0x611560b1, 0xe7933fdc, 0xbb3a792b, 0x344525bd,
+ 0xa08839e1, 0x51ce794b, 0x2f32c9b7, 0xa01fbac9, 0xe01cc87e,
+ 0xbcc7d1f6, 0xcf0111c3, 0xa1e8aac7, 0x1a908749, 0xd44fbd9a,
+ 0xd0dadecb, 0xd50ada38, 0x0339c32a, 0xc6913667, 0x8df9317c,
+ 0xe0b12b4f, 0xf79e59b7, 0x43f5bb3a, 0xf2d519ff, 0x27d9459c,
+ 0xbf97222c, 0x15e6fc2a, 0x0f91fc71, 0x9b941525, 0xfae59361,
+ 0xceb69ceb, 0xc2a86459, 0x12baa8d1, 0xb6c1075e, 0xe3056a0c,
+ 0x10d25065, 0xcb03a442, 0xe0ec6e0e, 0x1698db3b, 0x4c98a0be,
+ 0x3278e964, 0x9f1f9532, 0xe0d392df, 0xd3a0342b, 0x8971f21e,
+ 0x1b0a7441, 0x4ba3348c, 0xc5be7120, 0xc37632d8, 0xdf359f8d,
+ 0x9b992f2e, 0xe60b6f47, 0x0fe3f11d, 0xe54cda54, 0x1edad891,
+ 0xce6279cf, 0xcd3e7e6f, 0x1618b166, 0xfd2c1d05, 0x848fd2c5,
+ 0xf6fb2299, 0xf523f357, 0xa6327623, 0x93a83531, 0x56cccd02,
+ 0xacf08162, 0x5a75ebb5, 0x6e163697, 0x88d273cc, 0xde966292,
+ 0x81b949d0, 0x4c50901b, 0x71c65614, 0xe6c6c7bd, 0x327a140a,
+ 0x45e1d006, 0xc3f27b9a, 0xc9aa53fd, 0x62a80f00, 0xbb25bfe2,
+ 0x35bdd2f6, 0x71126905, 0xb2040222, 0xb6cbcf7c, 0xcd769c2b,
+ 0x53113ec0, 0x1640e3d3, 0x38abbd60, 0x2547adf0, 0xba38209c,
+ 0xf746ce76, 0x77afa1c5, 0x20756060, 0x85cbfe4e, 0x8ae88dd8,
+ 0x7aaaf9b0, 0x4cf9aa7e, 0x1948c25c, 0x02fb8a8c, 0x01c36ae4,
+ 0xd6ebe1f9, 0x90d4f869, 0xa65cdea0, 0x3f09252d, 0xc208e69f,
+ 0xb74e6132, 0xce77e25b, 0x578fdfe3, 0x3ac372e6
+];
+
+/**
+ * @type {Array.}
+ * @const
+ * @inner
+ */
+var C_ORIG = [
+ 0x4f727068, 0x65616e42, 0x65686f6c, 0x64657253, 0x63727944,
+ 0x6f756274
+];
+
+/**
+ * @param {Array.} lr
+ * @param {number} off
+ * @param {Array.} P
+ * @param {Array.} S
+ * @returns {Array.}
+ * @inner
+ */
+function _encipher(lr, off, P, S) { // This is our bottleneck: 1714/1905 ticks / 90% - see profile.txt
+ var n,
+ l = lr[off],
+ r = lr[off + 1];
+
+ l ^= P[0];
+
+ /*
+ for (var i=0, k=BLOWFISH_NUM_ROUNDS-2; i<=k;)
+ // Feistel substitution on left word
+ n = S[l >>> 24],
+ n += S[0x100 | ((l >> 16) & 0xff)],
+ n ^= S[0x200 | ((l >> 8) & 0xff)],
+ n += S[0x300 | (l & 0xff)],
+ r ^= n ^ P[++i],
+ // Feistel substitution on right word
+ n = S[r >>> 24],
+ n += S[0x100 | ((r >> 16) & 0xff)],
+ n ^= S[0x200 | ((r >> 8) & 0xff)],
+ n += S[0x300 | (r & 0xff)],
+ l ^= n ^ P[++i];
+ */
+
+ //The following is an unrolled version of the above loop.
+ //Iteration 0
+ n = S[l >>> 24];
+ n += S[0x100 | ((l >> 16) & 0xff)];
+ n ^= S[0x200 | ((l >> 8) & 0xff)];
+ n += S[0x300 | (l & 0xff)];
+ r ^= n ^ P[1];
+ n = S[r >>> 24];
+ n += S[0x100 | ((r >> 16) & 0xff)];
+ n ^= S[0x200 | ((r >> 8) & 0xff)];
+ n += S[0x300 | (r & 0xff)];
+ l ^= n ^ P[2];
+ //Iteration 1
+ n = S[l >>> 24];
+ n += S[0x100 | ((l >> 16) & 0xff)];
+ n ^= S[0x200 | ((l >> 8) & 0xff)];
+ n += S[0x300 | (l & 0xff)];
+ r ^= n ^ P[3];
+ n = S[r >>> 24];
+ n += S[0x100 | ((r >> 16) & 0xff)];
+ n ^= S[0x200 | ((r >> 8) & 0xff)];
+ n += S[0x300 | (r & 0xff)];
+ l ^= n ^ P[4];
+ //Iteration 2
+ n = S[l >>> 24];
+ n += S[0x100 | ((l >> 16) & 0xff)];
+ n ^= S[0x200 | ((l >> 8) & 0xff)];
+ n += S[0x300 | (l & 0xff)];
+ r ^= n ^ P[5];
+ n = S[r >>> 24];
+ n += S[0x100 | ((r >> 16) & 0xff)];
+ n ^= S[0x200 | ((r >> 8) & 0xff)];
+ n += S[0x300 | (r & 0xff)];
+ l ^= n ^ P[6];
+ //Iteration 3
+ n = S[l >>> 24];
+ n += S[0x100 | ((l >> 16) & 0xff)];
+ n ^= S[0x200 | ((l >> 8) & 0xff)];
+ n += S[0x300 | (l & 0xff)];
+ r ^= n ^ P[7];
+ n = S[r >>> 24];
+ n += S[0x100 | ((r >> 16) & 0xff)];
+ n ^= S[0x200 | ((r >> 8) & 0xff)];
+ n += S[0x300 | (r & 0xff)];
+ l ^= n ^ P[8];
+ //Iteration 4
+ n = S[l >>> 24];
+ n += S[0x100 | ((l >> 16) & 0xff)];
+ n ^= S[0x200 | ((l >> 8) & 0xff)];
+ n += S[0x300 | (l & 0xff)];
+ r ^= n ^ P[9];
+ n = S[r >>> 24];
+ n += S[0x100 | ((r >> 16) & 0xff)];
+ n ^= S[0x200 | ((r >> 8) & 0xff)];
+ n += S[0x300 | (r & 0xff)];
+ l ^= n ^ P[10];
+ //Iteration 5
+ n = S[l >>> 24];
+ n += S[0x100 | ((l >> 16) & 0xff)];
+ n ^= S[0x200 | ((l >> 8) & 0xff)];
+ n += S[0x300 | (l & 0xff)];
+ r ^= n ^ P[11];
+ n = S[r >>> 24];
+ n += S[0x100 | ((r >> 16) & 0xff)];
+ n ^= S[0x200 | ((r >> 8) & 0xff)];
+ n += S[0x300 | (r & 0xff)];
+ l ^= n ^ P[12];
+ //Iteration 6
+ n = S[l >>> 24];
+ n += S[0x100 | ((l >> 16) & 0xff)];
+ n ^= S[0x200 | ((l >> 8) & 0xff)];
+ n += S[0x300 | (l & 0xff)];
+ r ^= n ^ P[13];
+ n = S[r >>> 24];
+ n += S[0x100 | ((r >> 16) & 0xff)];
+ n ^= S[0x200 | ((r >> 8) & 0xff)];
+ n += S[0x300 | (r & 0xff)];
+ l ^= n ^ P[14];
+ //Iteration 7
+ n = S[l >>> 24];
+ n += S[0x100 | ((l >> 16) & 0xff)];
+ n ^= S[0x200 | ((l >> 8) & 0xff)];
+ n += S[0x300 | (l & 0xff)];
+ r ^= n ^ P[15];
+ n = S[r >>> 24];
+ n += S[0x100 | ((r >> 16) & 0xff)];
+ n ^= S[0x200 | ((r >> 8) & 0xff)];
+ n += S[0x300 | (r & 0xff)];
+ l ^= n ^ P[16];
+
+ lr[off] = r ^ P[BLOWFISH_NUM_ROUNDS + 1];
+ lr[off + 1] = l;
+ return lr;
+}
+
+/**
+ * @param {Array.} data
+ * @param {number} offp
+ * @returns {{key: number, offp: number}}
+ * @inner
+ */
+function _streamtoword(data, offp) {
+ for (var i = 0, word = 0; i < 4; ++i)
+ word = (word << 8) | (data[offp] & 0xff),
+ offp = (offp + 1) % data.length;
+ return { key: word, offp: offp };
+}
+
+/**
+ * @param {Array.} key
+ * @param {Array.} P
+ * @param {Array.} S
+ * @inner
+ */
+function _key(key, P, S) {
+ var offset = 0,
+ lr = [0, 0],
+ plen = P.length,
+ slen = S.length,
+ sw;
+ for (var i = 0; i < plen; i++)
+ sw = _streamtoword(key, offset),
+ offset = sw.offp,
+ P[i] = P[i] ^ sw.key;
+ for (i = 0; i < plen; i += 2)
+ lr = _encipher(lr, 0, P, S),
+ P[i] = lr[0],
+ P[i + 1] = lr[1];
+ for (i = 0; i < slen; i += 2)
+ lr = _encipher(lr, 0, P, S),
+ S[i] = lr[0],
+ S[i + 1] = lr[1];
+}
+
+/**
+ * Expensive key schedule Blowfish.
+ * @param {Array.} data
+ * @param {Array.} key
+ * @param {Array.} P
+ * @param {Array.} S
+ * @inner
+ */
+function _ekskey(data, key, P, S) {
+ var offp = 0,
+ lr = [0, 0],
+ plen = P.length,
+ slen = S.length,
+ sw;
+ for (var i = 0; i < plen; i++)
+ sw = _streamtoword(key, offp),
+ offp = sw.offp,
+ P[i] = P[i] ^ sw.key;
+ offp = 0;
+ for (i = 0; i < plen; i += 2)
+ sw = _streamtoword(data, offp),
+ offp = sw.offp,
+ lr[0] ^= sw.key,
+ sw = _streamtoword(data, offp),
+ offp = sw.offp,
+ lr[1] ^= sw.key,
+ lr = _encipher(lr, 0, P, S),
+ P[i] = lr[0],
+ P[i + 1] = lr[1];
+ for (i = 0; i < slen; i += 2)
+ sw = _streamtoword(data, offp),
+ offp = sw.offp,
+ lr[0] ^= sw.key,
+ sw = _streamtoword(data, offp),
+ offp = sw.offp,
+ lr[1] ^= sw.key,
+ lr = _encipher(lr, 0, P, S),
+ S[i] = lr[0],
+ S[i + 1] = lr[1];
+}
+
+/**
+ * Internaly crypts a string.
+ * @param {Array.} b Bytes to crypt
+ * @param {Array.} salt Salt bytes to use
+ * @param {number} rounds Number of rounds
+ * @param {function(Error, Array.=)=} callback Callback receiving the error, if any, and the resulting bytes. If
+ * omitted, the operation will be performed synchronously.
+ * @param {function(number)=} progressCallback Callback called with the current progress
+ * @returns {!Array.|undefined} Resulting bytes if callback has been omitted, otherwise `undefined`
+ * @inner
+ */
+function _crypt(b, salt, rounds, callback, progressCallback) {
+ var cdata = C_ORIG.slice(),
+ clen = cdata.length,
+ err;
+
+ // Validate
+ if (rounds < 4 || rounds > 31) {
+ err = Error("Illegal number of rounds (4-31): "+rounds);
+ if (callback) {
+ nextTick(callback.bind(this, err));
+ return;
+ } else
+ throw err;
+ }
+ if (salt.length !== BCRYPT_SALT_LEN) {
+ err =Error("Illegal salt length: "+salt.length+" != "+BCRYPT_SALT_LEN);
+ if (callback) {
+ nextTick(callback.bind(this, err));
+ return;
+ } else
+ throw err;
+ }
+ rounds = (1 << rounds) >>> 0;
+
+ var P, S, i = 0, j;
+
+ //Use typed arrays when available - huge speedup!
+ if (Int32Array) {
+ P = new Int32Array(P_ORIG);
+ S = new Int32Array(S_ORIG);
+ } else {
+ P = P_ORIG.slice();
+ S = S_ORIG.slice();
+ }
+
+ _ekskey(salt, b, P, S);
+
+ /**
+ * Calcualtes the next round.
+ * @returns {Array.|undefined} Resulting array if callback has been omitted, otherwise `undefined`
+ * @inner
+ */
+ function next() {
+ if (progressCallback)
+ progressCallback(i / rounds);
+ if (i < rounds) {
+ var start = Date.now();
+ for (; i < rounds;) {
+ i = i + 1;
+ _key(b, P, S);
+ _key(salt, P, S);
+ if (Date.now() - start > MAX_EXECUTION_TIME)
+ break;
+ }
+ } else {
+ for (i = 0; i < 64; i++)
+ for (j = 0; j < (clen >> 1); j++)
+ _encipher(cdata, j << 1, P, S);
+ var ret = [];
+ for (i = 0; i < clen; i++)
+ ret.push(((cdata[i] >> 24) & 0xff) >>> 0),
+ ret.push(((cdata[i] >> 16) & 0xff) >>> 0),
+ ret.push(((cdata[i] >> 8) & 0xff) >>> 0),
+ ret.push((cdata[i] & 0xff) >>> 0);
+ if (callback) {
+ callback(null, ret);
+ return;
+ } else
+ return ret;
+ }
+ if (callback)
+ nextTick(next);
+ }
+
+ // Async
+ if (typeof callback !== 'undefined') {
+ next();
+
+ // Sync
+ } else {
+ var res;
+ while (true)
+ if (typeof(res = next()) !== 'undefined')
+ return res || [];
+ }
+}
+
+/**
+ * Internally hashes a string.
+ * @param {string} s String to hash
+ * @param {?string} salt Salt to use, actually never null
+ * @param {function(Error, string=)=} callback Callback receiving the error, if any, and the resulting hash. If omitted,
+ * hashing is perormed synchronously.
+ * @param {function(number)=} progressCallback Callback called with the current progress
+ * @returns {string|undefined} Resulting hash if callback has been omitted, otherwise `undefined`
+ * @inner
+ */
+function _hash(s, salt, callback, progressCallback) {
+ var err;
+ if (typeof s !== 'string' || typeof salt !== 'string') {
+ err = Error("Invalid string / salt: Not a string");
+ if (callback) {
+ nextTick(callback.bind(this, err));
+ return;
+ }
+ else
+ throw err;
+ }
+
+ // Validate the salt
+ var minor, offset;
+ if (salt.charAt(0) !== '$' || salt.charAt(1) !== '2') {
+ err = Error("Invalid salt version: "+salt.substring(0,2));
+ if (callback) {
+ nextTick(callback.bind(this, err));
+ return;
+ }
+ else
+ throw err;
+ }
+ if (salt.charAt(2) === '$')
+ minor = String.fromCharCode(0),
+ offset = 3;
+ else {
+ minor = salt.charAt(2);
+ if ((minor !== 'a' && minor !== 'b' && minor !== 'y') || salt.charAt(3) !== '$') {
+ err = Error("Invalid salt revision: "+salt.substring(2,4));
+ if (callback) {
+ nextTick(callback.bind(this, err));
+ return;
+ } else
+ throw err;
+ }
+ offset = 4;
+ }
+
+ // Extract number of rounds
+ if (salt.charAt(offset + 2) > '$') {
+ err = Error("Missing salt rounds");
+ if (callback) {
+ nextTick(callback.bind(this, err));
+ return;
+ } else
+ throw err;
+ }
+ var r1 = parseInt(salt.substring(offset, offset + 1), 10) * 10,
+ r2 = parseInt(salt.substring(offset + 1, offset + 2), 10),
+ rounds = r1 + r2,
+ real_salt = salt.substring(offset + 3, offset + 25);
+ s += minor >= 'a' ? "\x00" : "";
+
+ var passwordb = stringToBytes(s),
+ saltb = base64_decode(real_salt, BCRYPT_SALT_LEN);
+
+ /**
+ * Finishes hashing.
+ * @param {Array.} bytes Byte array
+ * @returns {string}
+ * @inner
+ */
+ function finish(bytes) {
+ var res = [];
+ res.push("$2");
+ if (minor >= 'a')
+ res.push(minor);
+ res.push("$");
+ if (rounds < 10)
+ res.push("0");
+ res.push(rounds.toString());
+ res.push("$");
+ res.push(base64_encode(saltb, saltb.length));
+ res.push(base64_encode(bytes, C_ORIG.length * 4 - 1));
+ return res.join('');
+ }
+
+ // Sync
+ if (typeof callback == 'undefined')
+ return finish(_crypt(passwordb, saltb, rounds));
+
+ // Async
+ else {
+ _crypt(passwordb, saltb, rounds, function(err, bytes) {
+ if (err)
+ callback(err, null);
+ else
+ callback(null, finish(bytes));
+ }, progressCallback);
+ }
+}
diff --git a/node_modules/bcryptjs/src/bcrypt/prng/README.md b/node_modules/bcryptjs/src/bcrypt/prng/README.md
new file mode 100644
index 0000000..4735aa6
--- /dev/null
+++ b/node_modules/bcryptjs/src/bcrypt/prng/README.md
@@ -0,0 +1,5 @@
+Because of [reasonable security doubts](https://github.com/dcodeIO/bcrypt.js/issues/16), these files, which used to be
+a part of bcrypt-isaac.js, are no longer used but are kept here for reference only.
+
+What is required instead is a proper way to collect entropy sources (using an intermediate stream cipher) which is then
+used to seed the CSPRNG. Pick one and use `bcrypt.setRandomFallback` instead.
diff --git a/node_modules/bcryptjs/src/bcrypt/prng/accum.js b/node_modules/bcryptjs/src/bcrypt/prng/accum.js
new file mode 100644
index 0000000..8ea7773
--- /dev/null
+++ b/node_modules/bcryptjs/src/bcrypt/prng/accum.js
@@ -0,0 +1,133 @@
+/* basic entropy accumulator */
+var accum = (function() {
+
+ var pool, // randomness pool
+ time, // start timestamp
+ last; // last step timestamp
+
+ /* initialize with default pool */
+ function init() {
+ pool = [];
+ time = new Date().getTime();
+ last = time;
+ // use Math.random
+ pool.push((Math.random() * 0xffffffff)|0);
+ // use current time
+ pool.push(time|0);
+ }
+
+ /* perform one step */
+ function step() {
+ if (!to)
+ return;
+ if (pool.length >= 255) { // stop at 255 values (1 more is added on fetch)
+ stop();
+ return;
+ }
+ var now = new Date().getTime();
+ // use actual time difference
+ pool.push(now-last);
+ // always compute, occasionally use Math.random
+ var rnd = (Math.random() * 0xffffffff)|0;
+ if (now % 2)
+ pool[pool.length-1] += rnd;
+ last = now;
+ to = setTimeout(step, 100+Math.random()*512); // use hypothetical time difference
+ }
+
+ var to = null;
+
+ /* starts accumulating */
+ function start() {
+ if (to) return;
+ to = setTimeout(step, 100+Math.random()*512);
+ if (console.log)
+ console.log("bcrypt-isaac: collecting entropy...");
+ // install collectors
+ if (typeof window !== 'undefined' && window && window.addEventListener)
+ window.addEventListener("load", loadCollector, false),
+ window.addEventListener("mousemove", mouseCollector, false),
+ window.addEventListener("touchmove", touchCollector, false);
+ else if (typeof document !== 'undefined' && document && document.attachEvent)
+ document.attachEvent("onload", loadCollector),
+ document.attachEvent("onmousemove", mouseCollector);
+ }
+
+ /* stops accumulating */
+ function stop() {
+ if (!to) return;
+ clearTimeout(to); to = null;
+ // uninstall collectors
+ if (typeof window !== 'undefined' && window && window.removeEventListener)
+ window.removeEventListener("load", loadCollector, false),
+ window.removeEventListener("mousemove", mouseCollector, false),
+ window.removeEventListener("touchmove", touchCollector, false);
+ else if (typeof document !== 'undefined' && document && document.detachEvent)
+ document.detachEvent("onload", loadCollector),
+ document.detachEvent("onmousemove", mouseCollector);
+ }
+
+ /* fetches the randomness pool */
+ function fetch() {
+ // add overall time difference
+ pool.push((new Date().getTime()-time)|0);
+ var res = pool;
+ init();
+ if (console.log)
+ console.log("bcrypt-isaac: using "+res.length+"/256 samples of entropy");
+ // console.log(res);
+ return res;
+ }
+
+ /* adds the current time to the top of the pool */
+ function addTime() {
+ pool[pool.length-1] += new Date().getTime() - time;
+ }
+
+ /* page load collector */
+ function loadCollector() {
+ if (!to || pool.length >= 255)
+ return;
+ pool.push(0);
+ addTime();
+ }
+
+ /* mouse events collector */
+ function mouseCollector(ev) {
+ if (!to || pool.length >= 255)
+ return;
+ try {
+ var x = ev.x || ev.clientX || ev.offsetX || 0,
+ y = ev.y || ev.clientY || ev.offsetY || 0;
+ if (x != 0 || y != 0)
+ pool[pool.length-1] += ((x-mouseCollector.last[0]) ^ (y-mouseCollector.last[1])),
+ addTime(),
+ mouseCollector.last = [x,y];
+ } catch (e) {}
+ }
+ mouseCollector.last = [0,0];
+
+ /* touch events collector */
+ function touchCollector(ev) {
+ if (!to || pool.length >= 255)
+ return;
+ try {
+ var touch = ev.touches[0] || ev.changedTouches[0];
+ var x = touch.pageX || touch.clientX || 0,
+ y = touch.pageY || touch.clientY || 0;
+ if (x != 0 || y != 0)
+ pool[pool.length-1] += (x-touchCollector.last[0]) ^ (y-touchCollector.last[1]),
+ addTime(),
+ touchCollector.last = [x,y];
+ } catch (e) {}
+ }
+ touchCollector.last = [0,0];
+
+ init();
+ return {
+ "start": start,
+ "stop": stop,
+ "fetch": fetch
+ }
+
+})();
diff --git a/node_modules/bcryptjs/src/bcrypt/prng/isaac.js b/node_modules/bcryptjs/src/bcrypt/prng/isaac.js
new file mode 100644
index 0000000..e33b0e5
--- /dev/null
+++ b/node_modules/bcryptjs/src/bcrypt/prng/isaac.js
@@ -0,0 +1,140 @@
+/*
+ isaac.js Copyright (c) 2012 Yves-Marie K. Rinquin
+
+ Permission is hereby granted, free of charge, to any person obtaining
+ a copy of this software and associated documentation files (the
+ "Software"), to deal in the Software without restriction, including
+ without limitation the rights to use, copy, modify, merge, publish,
+ distribute, sublicense, and/or sell copies of the Software, and to
+ permit persons to whom the Software is furnished to do so, subject to
+ the following conditions:
+
+ The above copyright notice and this permission notice shall be
+ included in all copies or substantial portions of the Software.
+
+ THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND,
+ EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+ MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND
+ NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE
+ LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION
+ OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION
+ WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
+ */
+
+/* isaac module pattern */
+var isaac = (function(){
+
+ /* internal states */
+ var m = Array(256), // internal memory
+ acc = 0, // accumulator
+ brs = 0, // last result
+ cnt = 0, // counter
+ r = Array(256), // result array
+ gnt = 0, // generation counter
+ isd = false; // initially seeded
+
+
+ /* 32-bit integer safe adder */
+ function add(x, y) {
+ var lsb = (x & 0xffff) + (y & 0xffff),
+ msb = (x >>> 16) + (y >>> 16) + (lsb >>> 16);
+ return (msb << 16) | (lsb & 0xffff);
+ }
+
+ /* initialisation */
+ function reset() {
+ acc = brs = cnt = 0;
+ for (var i = 0; i < 256; ++i)
+ m[i] = r[i] = 0;
+ gnt = 0;
+ }
+
+ /* seeding function */
+ function seed(s) {
+ var a, b, c, d, e, f, g, h, i;
+
+ /* seeding the seeds of love */
+ a = b = c = d = e = f = g = h = 0x9e3779b9; /* the golden ratio */
+
+ if (s && typeof(s) === 'number')
+ s = [s];
+
+ if (s instanceof Array) {
+ reset();
+ for (i = 0; i < s.length; ++i)
+ r[i & 0xff] += typeof(s[i]) === 'number' ? s[i] : 0;
+ }
+
+ /* private: seed mixer */
+ function seed_mix() {
+ a ^= b << 11; d = add(d, a); b = add(b, c);
+ b ^= c >>> 2; e = add(e, b); c = add(c, d);
+ c ^= d << 8; f = add(f, c); d = add(d, e);
+ d ^= e >>> 16; g = add(g, d); e = add(e, f);
+ e ^= f << 10; h = add(h, e); f = add(f, g);
+ f ^= g >>> 4; a = add(a, f); g = add(g, h);
+ g ^= h << 8; b = add(b, g); h = add(h, a);
+ h ^= a >>> 9; c = add(c, h); a = add(a, b);
+ }
+
+ for (i = 0; i < 4; i++) /* scramble it */
+ seed_mix();
+
+ for (i = 0; i < 256; i += 8) {
+ if (s) /* use all the information in the seed */
+ a = add(a, r[i + 0]), b = add(b, r[i + 1]),
+ c = add(c, r[i + 2]), d = add(d, r[i + 3]),
+ e = add(e, r[i + 4]), f = add(f, r[i + 5]),
+ g = add(g, r[i + 6]), h = add(h, r[i + 7]);
+ seed_mix();
+ /* fill in m[] with messy stuff */
+ m[i + 0] = a; m[i + 1] = b; m[i + 2] = c; m[i + 3] = d;
+ m[i + 4] = e; m[i + 5] = f; m[i + 6] = g; m[i + 7] = h;
+ }
+ if (s)
+ /* do a second pass to make all of the seed affect all of m[] */
+ for (i = 0; i < 256; i += 8)
+ a = add(a, m[i + 0]), b = add(b, m[i + 1]),
+ c = add(c, m[i + 2]), d = add(d, m[i + 3]),
+ e = add(e, m[i + 4]), f = add(f, m[i + 5]),
+ g = add(g, m[i + 6]), h = add(h, m[i + 7]),
+ seed_mix(),
+ /* fill in m[] with messy stuff (again) */
+ m[i + 0] = a, m[i + 1] = b, m[i + 2] = c, m[i + 3] = d,
+ m[i + 4] = e, m[i + 5] = f, m[i + 6] = g, m[i + 7] = h;
+ prng(); /* fill in the first set of results */
+ gnt = 256; /* prepare to use the first set of results */;
+ }
+
+ /* isaac generator, n = number of run */
+ function prng(n) {
+ var i, x, y;
+ n = n && typeof(n) === 'number' ? Math.abs(Math.floor(n)) : 1;
+ while (n--) {
+ cnt = add(cnt, 1);
+ brs = add(brs, cnt);
+ for(i = 0; i < 256; i++) {
+ switch(i & 3) {
+ case 0: acc ^= acc << 13; break;
+ case 1: acc ^= acc >>> 6; break;
+ case 2: acc ^= acc << 2; break;
+ case 3: acc ^= acc >>> 16; break;
+ }
+ acc = add(m[(i + 128) & 0xff], acc); x = m[i];
+ m[i] = y = add(m[(x >>> 2) & 0xff], add(acc, brs));
+ r[i] = brs = add(m[(y >>> 10) & 0xff], x);
+ }
+ }
+ }
+
+ /* return a random number between */
+ return function() {
+ if (!isd) // seed from accumulator
+ isd = true,
+ accum.stop(),
+ seed(accum.fetch());
+ if (!gnt--)
+ prng(), gnt = 255;
+ return r[gnt];
+ };
+})();
diff --git a/node_modules/bcryptjs/src/bcrypt/util.js b/node_modules/bcryptjs/src/bcrypt/util.js
new file mode 100644
index 0000000..a149f71
--- /dev/null
+++ b/node_modules/bcryptjs/src/bcrypt/util.js
@@ -0,0 +1,33 @@
+/**
+ * Continues with the callback on the next tick.
+ * @function
+ * @param {function(...[*])} callback Callback to execute
+ * @inner
+ */
+var nextTick = typeof process !== 'undefined' && process && typeof process.nextTick === 'function'
+ ? (typeof setImmediate === 'function' ? setImmediate : process.nextTick)
+ : setTimeout;
+
+/**
+ * Converts a JavaScript string to UTF8 bytes.
+ * @param {string} str String
+ * @returns {!Array.} UTF8 bytes
+ * @inner
+ */
+function stringToBytes(str) {
+ var out = [],
+ i = 0;
+ utfx.encodeUTF16toUTF8(function() {
+ if (i >= str.length) return null;
+ return str.charCodeAt(i++);
+ }, function(b) {
+ out.push(b);
+ });
+ return out;
+}
+
+//? include("util/base64.js");
+
+//? include("../../node_modules/utfx/dist/utfx-embeddable.js");
+
+Date.now = Date.now || function() { return +new Date; };
diff --git a/node_modules/bcryptjs/src/bcrypt/util/base64.js b/node_modules/bcryptjs/src/bcrypt/util/base64.js
new file mode 100644
index 0000000..deda4af
--- /dev/null
+++ b/node_modules/bcryptjs/src/bcrypt/util/base64.js
@@ -0,0 +1,115 @@
+// A base64 implementation for the bcrypt algorithm. This is partly non-standard.
+
+/**
+ * bcrypt's own non-standard base64 dictionary.
+ * @type {!Array.}
+ * @const
+ * @inner
+ **/
+var BASE64_CODE = "./ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789".split('');
+
+/**
+ * @type {!Array.}
+ * @const
+ * @inner
+ **/
+var BASE64_INDEX = [-1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1,
+ -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1,
+ -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, -1, 0,
+ 1, 54, 55, 56, 57, 58, 59, 60, 61, 62, 63, -1, -1, -1, -1, -1, -1,
+ -1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19,
+ 20, 21, 22, 23, 24, 25, 26, 27, -1, -1, -1, -1, -1, -1, 28, 29, 30,
+ 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, 41, 42, 43, 44, 45, 46, 47,
+ 48, 49, 50, 51, 52, 53, -1, -1, -1, -1, -1];
+
+/**
+ * @type {!function(...number):string}
+ * @inner
+ */
+var stringFromCharCode = String.fromCharCode;
+
+/**
+ * Encodes a byte array to base64 with up to len bytes of input.
+ * @param {!Array.} b Byte array
+ * @param {number} len Maximum input length
+ * @returns {string}
+ * @inner
+ */
+function base64_encode(b, len) {
+ var off = 0,
+ rs = [],
+ c1, c2;
+ if (len <= 0 || len > b.length)
+ throw Error("Illegal len: "+len);
+ while (off < len) {
+ c1 = b[off++] & 0xff;
+ rs.push(BASE64_CODE[(c1 >> 2) & 0x3f]);
+ c1 = (c1 & 0x03) << 4;
+ if (off >= len) {
+ rs.push(BASE64_CODE[c1 & 0x3f]);
+ break;
+ }
+ c2 = b[off++] & 0xff;
+ c1 |= (c2 >> 4) & 0x0f;
+ rs.push(BASE64_CODE[c1 & 0x3f]);
+ c1 = (c2 & 0x0f) << 2;
+ if (off >= len) {
+ rs.push(BASE64_CODE[c1 & 0x3f]);
+ break;
+ }
+ c2 = b[off++] & 0xff;
+ c1 |= (c2 >> 6) & 0x03;
+ rs.push(BASE64_CODE[c1 & 0x3f]);
+ rs.push(BASE64_CODE[c2 & 0x3f]);
+ }
+ return rs.join('');
+}
+
+/**
+ * Decodes a base64 encoded string to up to len bytes of output.
+ * @param {string} s String to decode
+ * @param {number} len Maximum output length
+ * @returns {!Array.}
+ * @inner
+ */
+function base64_decode(s, len) {
+ var off = 0,
+ slen = s.length,
+ olen = 0,
+ rs = [],
+ c1, c2, c3, c4, o, code;
+ if (len <= 0)
+ throw Error("Illegal len: "+len);
+ while (off < slen - 1 && olen < len) {
+ code = s.charCodeAt(off++);
+ c1 = code < BASE64_INDEX.length ? BASE64_INDEX[code] : -1;
+ code = s.charCodeAt(off++);
+ c2 = code < BASE64_INDEX.length ? BASE64_INDEX[code] : -1;
+ if (c1 == -1 || c2 == -1)
+ break;
+ o = (c1 << 2) >>> 0;
+ o |= (c2 & 0x30) >> 4;
+ rs.push(stringFromCharCode(o));
+ if (++olen >= len || off >= slen)
+ break;
+ code = s.charCodeAt(off++);
+ c3 = code < BASE64_INDEX.length ? BASE64_INDEX[code] : -1;
+ if (c3 == -1)
+ break;
+ o = ((c2 & 0x0f) << 4) >>> 0;
+ o |= (c3 & 0x3c) >> 2;
+ rs.push(stringFromCharCode(o));
+ if (++olen >= len || off >= slen)
+ break;
+ code = s.charCodeAt(off++);
+ c4 = code < BASE64_INDEX.length ? BASE64_INDEX[code] : -1;
+ o = ((c3 & 0x03) << 6) >>> 0;
+ o |= c4;
+ rs.push(stringFromCharCode(o));
+ ++olen;
+ }
+ var res = [];
+ for (off = 0; off
+ Copyright (c) 2012 Shane Girish
+ Copyright (c) 2014 Daniel Wirtz
+
+ Redistribution and use in source and binary forms, with or without
+ modification, are permitted provided that the following conditions
+ are met:
+ 1. Redistributions of source code must retain the above copyright
+ notice, this list of conditions and the following disclaimer.
+ 2. Redistributions in binary form must reproduce the above copyright
+ notice, this list of conditions and the following disclaimer in the
+ documentation and/or other materials provided with the distribution.
+ 3. The name of the author may not be used to endorse or promote products
+ derived from this software without specific prior written permission.
+
+ THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR
+ IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES
+ OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED.
+ IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT,
+ INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT
+ NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE,
+ DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY
+ THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT
+ (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF
+ THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
+ */
+
+/**
+ * @license bcrypt.js (c) 2013 Daniel Wirtz
+ * Released under the Apache License, Version 2.0
+ * see: https://github.com/dcodeIO/bcrypt.js for details
+ */
+(function(global, factory) {
+
+ /* AMD */ if (typeof define === 'function' && define["amd"])
+ define([], factory);
+ /* CommonJS */ else if (typeof require === 'function' && typeof module === "object" && module && module["exports"])
+ module["exports"] = factory();
+ /* Global */ else
+ (global["dcodeIO"] = global["dcodeIO"] || {})["bcrypt"] = factory();
+
+}(this, function() {
+ "use strict";
+
+ //? include("bcrypt.js");
+
+ return bcrypt;
+}));
diff --git a/node_modules/bcryptjs/tests/quickbrown.txt b/node_modules/bcryptjs/tests/quickbrown.txt
new file mode 100644
index 0000000..81e850f
--- /dev/null
+++ b/node_modules/bcryptjs/tests/quickbrown.txt
@@ -0,0 +1,150 @@
+Sentences that contain all letters commonly used in a language
+--------------------------------------------------------------
+
+Markus Kuhn ';
+ };
+
+ /*
+
+ var zeros = [];
+ var groupSizes = [];
+ var groupBases = [];
+
+ var s = '';
+ var i = -1;
+ while (++i < BN.wordSize) {
+ zeros[i] = s;
+ s += '0';
+ }
+ groupSizes[0] = 0;
+ groupSizes[1] = 0;
+ groupBases[0] = 0;
+ groupBases[1] = 0;
+ var base = 2 - 1;
+ while (++base < 36 + 1) {
+ var groupSize = 0;
+ var groupBase = 1;
+ while (groupBase < (1 << BN.wordSize) / base) {
+ groupBase *= base;
+ groupSize += 1;
+ }
+ groupSizes[base] = groupSize;
+ groupBases[base] = groupBase;
+ }
+
+ */
+
+ var zeros = [
+ '',
+ '0',
+ '00',
+ '000',
+ '0000',
+ '00000',
+ '000000',
+ '0000000',
+ '00000000',
+ '000000000',
+ '0000000000',
+ '00000000000',
+ '000000000000',
+ '0000000000000',
+ '00000000000000',
+ '000000000000000',
+ '0000000000000000',
+ '00000000000000000',
+ '000000000000000000',
+ '0000000000000000000',
+ '00000000000000000000',
+ '000000000000000000000',
+ '0000000000000000000000',
+ '00000000000000000000000',
+ '000000000000000000000000',
+ '0000000000000000000000000'
+ ];
+
+ var groupSizes = [
+ 0, 0,
+ 25, 16, 12, 11, 10, 9, 8,
+ 8, 7, 7, 7, 7, 6, 6,
+ 6, 6, 6, 6, 6, 5, 5,
+ 5, 5, 5, 5, 5, 5, 5,
+ 5, 5, 5, 5, 5, 5, 5
+ ];
+
+ var groupBases = [
+ 0, 0,
+ 33554432, 43046721, 16777216, 48828125, 60466176, 40353607, 16777216,
+ 43046721, 10000000, 19487171, 35831808, 62748517, 7529536, 11390625,
+ 16777216, 24137569, 34012224, 47045881, 64000000, 4084101, 5153632,
+ 6436343, 7962624, 9765625, 11881376, 14348907, 17210368, 20511149,
+ 24300000, 28629151, 33554432, 39135393, 45435424, 52521875, 60466176
+ ];
+
+ BN.prototype.toString = function toString (base, padding) {
+ base = base || 10;
+ padding = padding | 0 || 1;
+
+ var out;
+ if (base === 16 || base === 'hex') {
+ out = '';
+ var off = 0;
+ var carry = 0;
+ for (var i = 0; i < this.length; i++) {
+ var w = this.words[i];
+ var word = (((w << off) | carry) & 0xffffff).toString(16);
+ carry = (w >>> (24 - off)) & 0xffffff;
+ off += 2;
+ if (off >= 26) {
+ off -= 26;
+ i--;
+ }
+ if (carry !== 0 || i !== this.length - 1) {
+ out = zeros[6 - word.length] + word + out;
+ } else {
+ out = word + out;
+ }
+ }
+ if (carry !== 0) {
+ out = carry.toString(16) + out;
+ }
+ while (out.length % padding !== 0) {
+ out = '0' + out;
+ }
+ if (this.negative !== 0) {
+ out = '-' + out;
+ }
+ return out;
+ }
+
+ if (base === (base | 0) && base >= 2 && base <= 36) {
+ // var groupSize = Math.floor(BN.wordSize * Math.LN2 / Math.log(base));
+ var groupSize = groupSizes[base];
+ // var groupBase = Math.pow(base, groupSize);
+ var groupBase = groupBases[base];
+ out = '';
+ var c = this.clone();
+ c.negative = 0;
+ while (!c.isZero()) {
+ var r = c.modn(groupBase).toString(base);
+ c = c.idivn(groupBase);
+
+ if (!c.isZero()) {
+ out = zeros[groupSize - r.length] + r + out;
+ } else {
+ out = r + out;
+ }
+ }
+ if (this.isZero()) {
+ out = '0' + out;
+ }
+ while (out.length % padding !== 0) {
+ out = '0' + out;
+ }
+ if (this.negative !== 0) {
+ out = '-' + out;
+ }
+ return out;
+ }
+
+ assert(false, 'Base should be between 2 and 36');
+ };
+
+ BN.prototype.toNumber = function toNumber () {
+ var ret = this.words[0];
+ if (this.length === 2) {
+ ret += this.words[1] * 0x4000000;
+ } else if (this.length === 3 && this.words[2] === 0x01) {
+ // NOTE: at this stage it is known that the top bit is set
+ ret += 0x10000000000000 + (this.words[1] * 0x4000000);
+ } else if (this.length > 2) {
+ assert(false, 'Number can only safely store up to 53 bits');
+ }
+ return (this.negative !== 0) ? -ret : ret;
+ };
+
+ BN.prototype.toJSON = function toJSON () {
+ return this.toString(16);
+ };
+
+ BN.prototype.toBuffer = function toBuffer (endian, length) {
+ assert(typeof Buffer !== 'undefined');
+ return this.toArrayLike(Buffer, endian, length);
+ };
+
+ BN.prototype.toArray = function toArray (endian, length) {
+ return this.toArrayLike(Array, endian, length);
+ };
+
+ BN.prototype.toArrayLike = function toArrayLike (ArrayType, endian, length) {
+ var byteLength = this.byteLength();
+ var reqLength = length || Math.max(1, byteLength);
+ assert(byteLength <= reqLength, 'byte array longer than desired length');
+ assert(reqLength > 0, 'Requested array length <= 0');
+
+ this.strip();
+ var littleEndian = endian === 'le';
+ var res = new ArrayType(reqLength);
+
+ var b, i;
+ var q = this.clone();
+ if (!littleEndian) {
+ // Assume big-endian
+ for (i = 0; i < reqLength - byteLength; i++) {
+ res[i] = 0;
+ }
+
+ for (i = 0; !q.isZero(); i++) {
+ b = q.andln(0xff);
+ q.iushrn(8);
+
+ res[reqLength - i - 1] = b;
+ }
+ } else {
+ for (i = 0; !q.isZero(); i++) {
+ b = q.andln(0xff);
+ q.iushrn(8);
+
+ res[i] = b;
+ }
+
+ for (; i < reqLength; i++) {
+ res[i] = 0;
+ }
+ }
+
+ return res;
+ };
+
+ if (Math.clz32) {
+ BN.prototype._countBits = function _countBits (w) {
+ return 32 - Math.clz32(w);
+ };
+ } else {
+ BN.prototype._countBits = function _countBits (w) {
+ var t = w;
+ var r = 0;
+ if (t >= 0x1000) {
+ r += 13;
+ t >>>= 13;
+ }
+ if (t >= 0x40) {
+ r += 7;
+ t >>>= 7;
+ }
+ if (t >= 0x8) {
+ r += 4;
+ t >>>= 4;
+ }
+ if (t >= 0x02) {
+ r += 2;
+ t >>>= 2;
+ }
+ return r + t;
+ };
+ }
+
+ BN.prototype._zeroBits = function _zeroBits (w) {
+ // Short-cut
+ if (w === 0) return 26;
+
+ var t = w;
+ var r = 0;
+ if ((t & 0x1fff) === 0) {
+ r += 13;
+ t >>>= 13;
+ }
+ if ((t & 0x7f) === 0) {
+ r += 7;
+ t >>>= 7;
+ }
+ if ((t & 0xf) === 0) {
+ r += 4;
+ t >>>= 4;
+ }
+ if ((t & 0x3) === 0) {
+ r += 2;
+ t >>>= 2;
+ }
+ if ((t & 0x1) === 0) {
+ r++;
+ }
+ return r;
+ };
+
+ // Return number of used bits in a BN
+ BN.prototype.bitLength = function bitLength () {
+ var w = this.words[this.length - 1];
+ var hi = this._countBits(w);
+ return (this.length - 1) * 26 + hi;
+ };
+
+ function toBitArray (num) {
+ var w = new Array(num.bitLength());
+
+ for (var bit = 0; bit < w.length; bit++) {
+ var off = (bit / 26) | 0;
+ var wbit = bit % 26;
+
+ w[bit] = (num.words[off] & (1 << wbit)) >>> wbit;
+ }
+
+ return w;
+ }
+
+ // Number of trailing zero bits
+ BN.prototype.zeroBits = function zeroBits () {
+ if (this.isZero()) return 0;
+
+ var r = 0;
+ for (var i = 0; i < this.length; i++) {
+ var b = this._zeroBits(this.words[i]);
+ r += b;
+ if (b !== 26) break;
+ }
+ return r;
+ };
+
+ BN.prototype.byteLength = function byteLength () {
+ return Math.ceil(this.bitLength() / 8);
+ };
+
+ BN.prototype.toTwos = function toTwos (width) {
+ if (this.negative !== 0) {
+ return this.abs().inotn(width).iaddn(1);
+ }
+ return this.clone();
+ };
+
+ BN.prototype.fromTwos = function fromTwos (width) {
+ if (this.testn(width - 1)) {
+ return this.notn(width).iaddn(1).ineg();
+ }
+ return this.clone();
+ };
+
+ BN.prototype.isNeg = function isNeg () {
+ return this.negative !== 0;
+ };
+
+ // Return negative clone of `this`
+ BN.prototype.neg = function neg () {
+ return this.clone().ineg();
+ };
+
+ BN.prototype.ineg = function ineg () {
+ if (!this.isZero()) {
+ this.negative ^= 1;
+ }
+
+ return this;
+ };
+
+ // Or `num` with `this` in-place
+ BN.prototype.iuor = function iuor (num) {
+ while (this.length < num.length) {
+ this.words[this.length++] = 0;
+ }
+
+ for (var i = 0; i < num.length; i++) {
+ this.words[i] = this.words[i] | num.words[i];
+ }
+
+ return this.strip();
+ };
+
+ BN.prototype.ior = function ior (num) {
+ assert((this.negative | num.negative) === 0);
+ return this.iuor(num);
+ };
+
+ // Or `num` with `this`
+ BN.prototype.or = function or (num) {
+ if (this.length > num.length) return this.clone().ior(num);
+ return num.clone().ior(this);
+ };
+
+ BN.prototype.uor = function uor (num) {
+ if (this.length > num.length) return this.clone().iuor(num);
+ return num.clone().iuor(this);
+ };
+
+ // And `num` with `this` in-place
+ BN.prototype.iuand = function iuand (num) {
+ // b = min-length(num, this)
+ var b;
+ if (this.length > num.length) {
+ b = num;
+ } else {
+ b = this;
+ }
+
+ for (var i = 0; i < b.length; i++) {
+ this.words[i] = this.words[i] & num.words[i];
+ }
+
+ this.length = b.length;
+
+ return this.strip();
+ };
+
+ BN.prototype.iand = function iand (num) {
+ assert((this.negative | num.negative) === 0);
+ return this.iuand(num);
+ };
+
+ // And `num` with `this`
+ BN.prototype.and = function and (num) {
+ if (this.length > num.length) return this.clone().iand(num);
+ return num.clone().iand(this);
+ };
+
+ BN.prototype.uand = function uand (num) {
+ if (this.length > num.length) return this.clone().iuand(num);
+ return num.clone().iuand(this);
+ };
+
+ // Xor `num` with `this` in-place
+ BN.prototype.iuxor = function iuxor (num) {
+ // a.length > b.length
+ var a;
+ var b;
+ if (this.length > num.length) {
+ a = this;
+ b = num;
+ } else {
+ a = num;
+ b = this;
+ }
+
+ for (var i = 0; i < b.length; i++) {
+ this.words[i] = a.words[i] ^ b.words[i];
+ }
+
+ if (this !== a) {
+ for (; i < a.length; i++) {
+ this.words[i] = a.words[i];
+ }
+ }
+
+ this.length = a.length;
+
+ return this.strip();
+ };
+
+ BN.prototype.ixor = function ixor (num) {
+ assert((this.negative | num.negative) === 0);
+ return this.iuxor(num);
+ };
+
+ // Xor `num` with `this`
+ BN.prototype.xor = function xor (num) {
+ if (this.length > num.length) return this.clone().ixor(num);
+ return num.clone().ixor(this);
+ };
+
+ BN.prototype.uxor = function uxor (num) {
+ if (this.length > num.length) return this.clone().iuxor(num);
+ return num.clone().iuxor(this);
+ };
+
+ // Not ``this`` with ``width`` bitwidth
+ BN.prototype.inotn = function inotn (width) {
+ assert(typeof width === 'number' && width >= 0);
+
+ var bytesNeeded = Math.ceil(width / 26) | 0;
+ var bitsLeft = width % 26;
+
+ // Extend the buffer with leading zeroes
+ this._expand(bytesNeeded);
+
+ if (bitsLeft > 0) {
+ bytesNeeded--;
+ }
+
+ // Handle complete words
+ for (var i = 0; i < bytesNeeded; i++) {
+ this.words[i] = ~this.words[i] & 0x3ffffff;
+ }
+
+ // Handle the residue
+ if (bitsLeft > 0) {
+ this.words[i] = ~this.words[i] & (0x3ffffff >> (26 - bitsLeft));
+ }
+
+ // And remove leading zeroes
+ return this.strip();
+ };
+
+ BN.prototype.notn = function notn (width) {
+ return this.clone().inotn(width);
+ };
+
+ // Set `bit` of `this`
+ BN.prototype.setn = function setn (bit, val) {
+ assert(typeof bit === 'number' && bit >= 0);
+
+ var off = (bit / 26) | 0;
+ var wbit = bit % 26;
+
+ this._expand(off + 1);
+
+ if (val) {
+ this.words[off] = this.words[off] | (1 << wbit);
+ } else {
+ this.words[off] = this.words[off] & ~(1 << wbit);
+ }
+
+ return this.strip();
+ };
+
+ // Add `num` to `this` in-place
+ BN.prototype.iadd = function iadd (num) {
+ var r;
+
+ // negative + positive
+ if (this.negative !== 0 && num.negative === 0) {
+ this.negative = 0;
+ r = this.isub(num);
+ this.negative ^= 1;
+ return this._normSign();
+
+ // positive + negative
+ } else if (this.negative === 0 && num.negative !== 0) {
+ num.negative = 0;
+ r = this.isub(num);
+ num.negative = 1;
+ return r._normSign();
+ }
+
+ // a.length > b.length
+ var a, b;
+ if (this.length > num.length) {
+ a = this;
+ b = num;
+ } else {
+ a = num;
+ b = this;
+ }
+
+ var carry = 0;
+ for (var i = 0; i < b.length; i++) {
+ r = (a.words[i] | 0) + (b.words[i] | 0) + carry;
+ this.words[i] = r & 0x3ffffff;
+ carry = r >>> 26;
+ }
+ for (; carry !== 0 && i < a.length; i++) {
+ r = (a.words[i] | 0) + carry;
+ this.words[i] = r & 0x3ffffff;
+ carry = r >>> 26;
+ }
+
+ this.length = a.length;
+ if (carry !== 0) {
+ this.words[this.length] = carry;
+ this.length++;
+ // Copy the rest of the words
+ } else if (a !== this) {
+ for (; i < a.length; i++) {
+ this.words[i] = a.words[i];
+ }
+ }
+
+ return this;
+ };
+
+ // Add `num` to `this`
+ BN.prototype.add = function add (num) {
+ var res;
+ if (num.negative !== 0 && this.negative === 0) {
+ num.negative = 0;
+ res = this.sub(num);
+ num.negative ^= 1;
+ return res;
+ } else if (num.negative === 0 && this.negative !== 0) {
+ this.negative = 0;
+ res = num.sub(this);
+ this.negative = 1;
+ return res;
+ }
+
+ if (this.length > num.length) return this.clone().iadd(num);
+
+ return num.clone().iadd(this);
+ };
+
+ // Subtract `num` from `this` in-place
+ BN.prototype.isub = function isub (num) {
+ // this - (-num) = this + num
+ if (num.negative !== 0) {
+ num.negative = 0;
+ var r = this.iadd(num);
+ num.negative = 1;
+ return r._normSign();
+
+ // -this - num = -(this + num)
+ } else if (this.negative !== 0) {
+ this.negative = 0;
+ this.iadd(num);
+ this.negative = 1;
+ return this._normSign();
+ }
+
+ // At this point both numbers are positive
+ var cmp = this.cmp(num);
+
+ // Optimization - zeroify
+ if (cmp === 0) {
+ this.negative = 0;
+ this.length = 1;
+ this.words[0] = 0;
+ return this;
+ }
+
+ // a > b
+ var a, b;
+ if (cmp > 0) {
+ a = this;
+ b = num;
+ } else {
+ a = num;
+ b = this;
+ }
+
+ var carry = 0;
+ for (var i = 0; i < b.length; i++) {
+ r = (a.words[i] | 0) - (b.words[i] | 0) + carry;
+ carry = r >> 26;
+ this.words[i] = r & 0x3ffffff;
+ }
+ for (; carry !== 0 && i < a.length; i++) {
+ r = (a.words[i] | 0) + carry;
+ carry = r >> 26;
+ this.words[i] = r & 0x3ffffff;
+ }
+
+ // Copy rest of the words
+ if (carry === 0 && i < a.length && a !== this) {
+ for (; i < a.length; i++) {
+ this.words[i] = a.words[i];
+ }
+ }
+
+ this.length = Math.max(this.length, i);
+
+ if (a !== this) {
+ this.negative = 1;
+ }
+
+ return this.strip();
+ };
+
+ // Subtract `num` from `this`
+ BN.prototype.sub = function sub (num) {
+ return this.clone().isub(num);
+ };
+
+ function smallMulTo (self, num, out) {
+ out.negative = num.negative ^ self.negative;
+ var len = (self.length + num.length) | 0;
+ out.length = len;
+ len = (len - 1) | 0;
+
+ // Peel one iteration (compiler can't do it, because of code complexity)
+ var a = self.words[0] | 0;
+ var b = num.words[0] | 0;
+ var r = a * b;
+
+ var lo = r & 0x3ffffff;
+ var carry = (r / 0x4000000) | 0;
+ out.words[0] = lo;
+
+ for (var k = 1; k < len; k++) {
+ // Sum all words with the same `i + j = k` and accumulate `ncarry`,
+ // note that ncarry could be >= 0x3ffffff
+ var ncarry = carry >>> 26;
+ var rword = carry & 0x3ffffff;
+ var maxJ = Math.min(k, num.length - 1);
+ for (var j = Math.max(0, k - self.length + 1); j <= maxJ; j++) {
+ var i = (k - j) | 0;
+ a = self.words[i] | 0;
+ b = num.words[j] | 0;
+ r = a * b + rword;
+ ncarry += (r / 0x4000000) | 0;
+ rword = r & 0x3ffffff;
+ }
+ out.words[k] = rword | 0;
+ carry = ncarry | 0;
+ }
+ if (carry !== 0) {
+ out.words[k] = carry | 0;
+ } else {
+ out.length--;
+ }
+
+ return out.strip();
+ }
+
+ // TODO(indutny): it may be reasonable to omit it for users who don't need
+ // to work with 256-bit numbers, otherwise it gives 20% improvement for 256-bit
+ // multiplication (like elliptic secp256k1).
+ var comb10MulTo = function comb10MulTo (self, num, out) {
+ var a = self.words;
+ var b = num.words;
+ var o = out.words;
+ var c = 0;
+ var lo;
+ var mid;
+ var hi;
+ var a0 = a[0] | 0;
+ var al0 = a0 & 0x1fff;
+ var ah0 = a0 >>> 13;
+ var a1 = a[1] | 0;
+ var al1 = a1 & 0x1fff;
+ var ah1 = a1 >>> 13;
+ var a2 = a[2] | 0;
+ var al2 = a2 & 0x1fff;
+ var ah2 = a2 >>> 13;
+ var a3 = a[3] | 0;
+ var al3 = a3 & 0x1fff;
+ var ah3 = a3 >>> 13;
+ var a4 = a[4] | 0;
+ var al4 = a4 & 0x1fff;
+ var ah4 = a4 >>> 13;
+ var a5 = a[5] | 0;
+ var al5 = a5 & 0x1fff;
+ var ah5 = a5 >>> 13;
+ var a6 = a[6] | 0;
+ var al6 = a6 & 0x1fff;
+ var ah6 = a6 >>> 13;
+ var a7 = a[7] | 0;
+ var al7 = a7 & 0x1fff;
+ var ah7 = a7 >>> 13;
+ var a8 = a[8] | 0;
+ var al8 = a8 & 0x1fff;
+ var ah8 = a8 >>> 13;
+ var a9 = a[9] | 0;
+ var al9 = a9 & 0x1fff;
+ var ah9 = a9 >>> 13;
+ var b0 = b[0] | 0;
+ var bl0 = b0 & 0x1fff;
+ var bh0 = b0 >>> 13;
+ var b1 = b[1] | 0;
+ var bl1 = b1 & 0x1fff;
+ var bh1 = b1 >>> 13;
+ var b2 = b[2] | 0;
+ var bl2 = b2 & 0x1fff;
+ var bh2 = b2 >>> 13;
+ var b3 = b[3] | 0;
+ var bl3 = b3 & 0x1fff;
+ var bh3 = b3 >>> 13;
+ var b4 = b[4] | 0;
+ var bl4 = b4 & 0x1fff;
+ var bh4 = b4 >>> 13;
+ var b5 = b[5] | 0;
+ var bl5 = b5 & 0x1fff;
+ var bh5 = b5 >>> 13;
+ var b6 = b[6] | 0;
+ var bl6 = b6 & 0x1fff;
+ var bh6 = b6 >>> 13;
+ var b7 = b[7] | 0;
+ var bl7 = b7 & 0x1fff;
+ var bh7 = b7 >>> 13;
+ var b8 = b[8] | 0;
+ var bl8 = b8 & 0x1fff;
+ var bh8 = b8 >>> 13;
+ var b9 = b[9] | 0;
+ var bl9 = b9 & 0x1fff;
+ var bh9 = b9 >>> 13;
+
+ out.negative = self.negative ^ num.negative;
+ out.length = 19;
+ /* k = 0 */
+ lo = Math.imul(al0, bl0);
+ mid = Math.imul(al0, bh0);
+ mid = (mid + Math.imul(ah0, bl0)) | 0;
+ hi = Math.imul(ah0, bh0);
+ var w0 = (((c + lo) | 0) + ((mid & 0x1fff) << 13)) | 0;
+ c = (((hi + (mid >>> 13)) | 0) + (w0 >>> 26)) | 0;
+ w0 &= 0x3ffffff;
+ /* k = 1 */
+ lo = Math.imul(al1, bl0);
+ mid = Math.imul(al1, bh0);
+ mid = (mid + Math.imul(ah1, bl0)) | 0;
+ hi = Math.imul(ah1, bh0);
+ lo = (lo + Math.imul(al0, bl1)) | 0;
+ mid = (mid + Math.imul(al0, bh1)) | 0;
+ mid = (mid + Math.imul(ah0, bl1)) | 0;
+ hi = (hi + Math.imul(ah0, bh1)) | 0;
+ var w1 = (((c + lo) | 0) + ((mid & 0x1fff) << 13)) | 0;
+ c = (((hi + (mid >>> 13)) | 0) + (w1 >>> 26)) | 0;
+ w1 &= 0x3ffffff;
+ /* k = 2 */
+ lo = Math.imul(al2, bl0);
+ mid = Math.imul(al2, bh0);
+ mid = (mid + Math.imul(ah2, bl0)) | 0;
+ hi = Math.imul(ah2, bh0);
+ lo = (lo + Math.imul(al1, bl1)) | 0;
+ mid = (mid + Math.imul(al1, bh1)) | 0;
+ mid = (mid + Math.imul(ah1, bl1)) | 0;
+ hi = (hi + Math.imul(ah1, bh1)) | 0;
+ lo = (lo + Math.imul(al0, bl2)) | 0;
+ mid = (mid + Math.imul(al0, bh2)) | 0;
+ mid = (mid + Math.imul(ah0, bl2)) | 0;
+ hi = (hi + Math.imul(ah0, bh2)) | 0;
+ var w2 = (((c + lo) | 0) + ((mid & 0x1fff) << 13)) | 0;
+ c = (((hi + (mid >>> 13)) | 0) + (w2 >>> 26)) | 0;
+ w2 &= 0x3ffffff;
+ /* k = 3 */
+ lo = Math.imul(al3, bl0);
+ mid = Math.imul(al3, bh0);
+ mid = (mid + Math.imul(ah3, bl0)) | 0;
+ hi = Math.imul(ah3, bh0);
+ lo = (lo + Math.imul(al2, bl1)) | 0;
+ mid = (mid + Math.imul(al2, bh1)) | 0;
+ mid = (mid + Math.imul(ah2, bl1)) | 0;
+ hi = (hi + Math.imul(ah2, bh1)) | 0;
+ lo = (lo + Math.imul(al1, bl2)) | 0;
+ mid = (mid + Math.imul(al1, bh2)) | 0;
+ mid = (mid + Math.imul(ah1, bl2)) | 0;
+ hi = (hi + Math.imul(ah1, bh2)) | 0;
+ lo = (lo + Math.imul(al0, bl3)) | 0;
+ mid = (mid + Math.imul(al0, bh3)) | 0;
+ mid = (mid + Math.imul(ah0, bl3)) | 0;
+ hi = (hi + Math.imul(ah0, bh3)) | 0;
+ var w3 = (((c + lo) | 0) + ((mid & 0x1fff) << 13)) | 0;
+ c = (((hi + (mid >>> 13)) | 0) + (w3 >>> 26)) | 0;
+ w3 &= 0x3ffffff;
+ /* k = 4 */
+ lo = Math.imul(al4, bl0);
+ mid = Math.imul(al4, bh0);
+ mid = (mid + Math.imul(ah4, bl0)) | 0;
+ hi = Math.imul(ah4, bh0);
+ lo = (lo + Math.imul(al3, bl1)) | 0;
+ mid = (mid + Math.imul(al3, bh1)) | 0;
+ mid = (mid + Math.imul(ah3, bl1)) | 0;
+ hi = (hi + Math.imul(ah3, bh1)) | 0;
+ lo = (lo + Math.imul(al2, bl2)) | 0;
+ mid = (mid + Math.imul(al2, bh2)) | 0;
+ mid = (mid + Math.imul(ah2, bl2)) | 0;
+ hi = (hi + Math.imul(ah2, bh2)) | 0;
+ lo = (lo + Math.imul(al1, bl3)) | 0;
+ mid = (mid + Math.imul(al1, bh3)) | 0;
+ mid = (mid + Math.imul(ah1, bl3)) | 0;
+ hi = (hi + Math.imul(ah1, bh3)) | 0;
+ lo = (lo + Math.imul(al0, bl4)) | 0;
+ mid = (mid + Math.imul(al0, bh4)) | 0;
+ mid = (mid + Math.imul(ah0, bl4)) | 0;
+ hi = (hi + Math.imul(ah0, bh4)) | 0;
+ var w4 = (((c + lo) | 0) + ((mid & 0x1fff) << 13)) | 0;
+ c = (((hi + (mid >>> 13)) | 0) + (w4 >>> 26)) | 0;
+ w4 &= 0x3ffffff;
+ /* k = 5 */
+ lo = Math.imul(al5, bl0);
+ mid = Math.imul(al5, bh0);
+ mid = (mid + Math.imul(ah5, bl0)) | 0;
+ hi = Math.imul(ah5, bh0);
+ lo = (lo + Math.imul(al4, bl1)) | 0;
+ mid = (mid + Math.imul(al4, bh1)) | 0;
+ mid = (mid + Math.imul(ah4, bl1)) | 0;
+ hi = (hi + Math.imul(ah4, bh1)) | 0;
+ lo = (lo + Math.imul(al3, bl2)) | 0;
+ mid = (mid + Math.imul(al3, bh2)) | 0;
+ mid = (mid + Math.imul(ah3, bl2)) | 0;
+ hi = (hi + Math.imul(ah3, bh2)) | 0;
+ lo = (lo + Math.imul(al2, bl3)) | 0;
+ mid = (mid + Math.imul(al2, bh3)) | 0;
+ mid = (mid + Math.imul(ah2, bl3)) | 0;
+ hi = (hi + Math.imul(ah2, bh3)) | 0;
+ lo = (lo + Math.imul(al1, bl4)) | 0;
+ mid = (mid + Math.imul(al1, bh4)) | 0;
+ mid = (mid + Math.imul(ah1, bl4)) | 0;
+ hi = (hi + Math.imul(ah1, bh4)) | 0;
+ lo = (lo + Math.imul(al0, bl5)) | 0;
+ mid = (mid + Math.imul(al0, bh5)) | 0;
+ mid = (mid + Math.imul(ah0, bl5)) | 0;
+ hi = (hi + Math.imul(ah0, bh5)) | 0;
+ var w5 = (((c + lo) | 0) + ((mid & 0x1fff) << 13)) | 0;
+ c = (((hi + (mid >>> 13)) | 0) + (w5 >>> 26)) | 0;
+ w5 &= 0x3ffffff;
+ /* k = 6 */
+ lo = Math.imul(al6, bl0);
+ mid = Math.imul(al6, bh0);
+ mid = (mid + Math.imul(ah6, bl0)) | 0;
+ hi = Math.imul(ah6, bh0);
+ lo = (lo + Math.imul(al5, bl1)) | 0;
+ mid = (mid + Math.imul(al5, bh1)) | 0;
+ mid = (mid + Math.imul(ah5, bl1)) | 0;
+ hi = (hi + Math.imul(ah5, bh1)) | 0;
+ lo = (lo + Math.imul(al4, bl2)) | 0;
+ mid = (mid + Math.imul(al4, bh2)) | 0;
+ mid = (mid + Math.imul(ah4, bl2)) | 0;
+ hi = (hi + Math.imul(ah4, bh2)) | 0;
+ lo = (lo + Math.imul(al3, bl3)) | 0;
+ mid = (mid + Math.imul(al3, bh3)) | 0;
+ mid = (mid + Math.imul(ah3, bl3)) | 0;
+ hi = (hi + Math.imul(ah3, bh3)) | 0;
+ lo = (lo + Math.imul(al2, bl4)) | 0;
+ mid = (mid + Math.imul(al2, bh4)) | 0;
+ mid = (mid + Math.imul(ah2, bl4)) | 0;
+ hi = (hi + Math.imul(ah2, bh4)) | 0;
+ lo = (lo + Math.imul(al1, bl5)) | 0;
+ mid = (mid + Math.imul(al1, bh5)) | 0;
+ mid = (mid + Math.imul(ah1, bl5)) | 0;
+ hi = (hi + Math.imul(ah1, bh5)) | 0;
+ lo = (lo + Math.imul(al0, bl6)) | 0;
+ mid = (mid + Math.imul(al0, bh6)) | 0;
+ mid = (mid + Math.imul(ah0, bl6)) | 0;
+ hi = (hi + Math.imul(ah0, bh6)) | 0;
+ var w6 = (((c + lo) | 0) + ((mid & 0x1fff) << 13)) | 0;
+ c = (((hi + (mid >>> 13)) | 0) + (w6 >>> 26)) | 0;
+ w6 &= 0x3ffffff;
+ /* k = 7 */
+ lo = Math.imul(al7, bl0);
+ mid = Math.imul(al7, bh0);
+ mid = (mid + Math.imul(ah7, bl0)) | 0;
+ hi = Math.imul(ah7, bh0);
+ lo = (lo + Math.imul(al6, bl1)) | 0;
+ mid = (mid + Math.imul(al6, bh1)) | 0;
+ mid = (mid + Math.imul(ah6, bl1)) | 0;
+ hi = (hi + Math.imul(ah6, bh1)) | 0;
+ lo = (lo + Math.imul(al5, bl2)) | 0;
+ mid = (mid + Math.imul(al5, bh2)) | 0;
+ mid = (mid + Math.imul(ah5, bl2)) | 0;
+ hi = (hi + Math.imul(ah5, bh2)) | 0;
+ lo = (lo + Math.imul(al4, bl3)) | 0;
+ mid = (mid + Math.imul(al4, bh3)) | 0;
+ mid = (mid + Math.imul(ah4, bl3)) | 0;
+ hi = (hi + Math.imul(ah4, bh3)) | 0;
+ lo = (lo + Math.imul(al3, bl4)) | 0;
+ mid = (mid + Math.imul(al3, bh4)) | 0;
+ mid = (mid + Math.imul(ah3, bl4)) | 0;
+ hi = (hi + Math.imul(ah3, bh4)) | 0;
+ lo = (lo + Math.imul(al2, bl5)) | 0;
+ mid = (mid + Math.imul(al2, bh5)) | 0;
+ mid = (mid + Math.imul(ah2, bl5)) | 0;
+ hi = (hi + Math.imul(ah2, bh5)) | 0;
+ lo = (lo + Math.imul(al1, bl6)) | 0;
+ mid = (mid + Math.imul(al1, bh6)) | 0;
+ mid = (mid + Math.imul(ah1, bl6)) | 0;
+ hi = (hi + Math.imul(ah1, bh6)) | 0;
+ lo = (lo + Math.imul(al0, bl7)) | 0;
+ mid = (mid + Math.imul(al0, bh7)) | 0;
+ mid = (mid + Math.imul(ah0, bl7)) | 0;
+ hi = (hi + Math.imul(ah0, bh7)) | 0;
+ var w7 = (((c + lo) | 0) + ((mid & 0x1fff) << 13)) | 0;
+ c = (((hi + (mid >>> 13)) | 0) + (w7 >>> 26)) | 0;
+ w7 &= 0x3ffffff;
+ /* k = 8 */
+ lo = Math.imul(al8, bl0);
+ mid = Math.imul(al8, bh0);
+ mid = (mid + Math.imul(ah8, bl0)) | 0;
+ hi = Math.imul(ah8, bh0);
+ lo = (lo + Math.imul(al7, bl1)) | 0;
+ mid = (mid + Math.imul(al7, bh1)) | 0;
+ mid = (mid + Math.imul(ah7, bl1)) | 0;
+ hi = (hi + Math.imul(ah7, bh1)) | 0;
+ lo = (lo + Math.imul(al6, bl2)) | 0;
+ mid = (mid + Math.imul(al6, bh2)) | 0;
+ mid = (mid + Math.imul(ah6, bl2)) | 0;
+ hi = (hi + Math.imul(ah6, bh2)) | 0;
+ lo = (lo + Math.imul(al5, bl3)) | 0;
+ mid = (mid + Math.imul(al5, bh3)) | 0;
+ mid = (mid + Math.imul(ah5, bl3)) | 0;
+ hi = (hi + Math.imul(ah5, bh3)) | 0;
+ lo = (lo + Math.imul(al4, bl4)) | 0;
+ mid = (mid + Math.imul(al4, bh4)) | 0;
+ mid = (mid + Math.imul(ah4, bl4)) | 0;
+ hi = (hi + Math.imul(ah4, bh4)) | 0;
+ lo = (lo + Math.imul(al3, bl5)) | 0;
+ mid = (mid + Math.imul(al3, bh5)) | 0;
+ mid = (mid + Math.imul(ah3, bl5)) | 0;
+ hi = (hi + Math.imul(ah3, bh5)) | 0;
+ lo = (lo + Math.imul(al2, bl6)) | 0;
+ mid = (mid + Math.imul(al2, bh6)) | 0;
+ mid = (mid + Math.imul(ah2, bl6)) | 0;
+ hi = (hi + Math.imul(ah2, bh6)) | 0;
+ lo = (lo + Math.imul(al1, bl7)) | 0;
+ mid = (mid + Math.imul(al1, bh7)) | 0;
+ mid = (mid + Math.imul(ah1, bl7)) | 0;
+ hi = (hi + Math.imul(ah1, bh7)) | 0;
+ lo = (lo + Math.imul(al0, bl8)) | 0;
+ mid = (mid + Math.imul(al0, bh8)) | 0;
+ mid = (mid + Math.imul(ah0, bl8)) | 0;
+ hi = (hi + Math.imul(ah0, bh8)) | 0;
+ var w8 = (((c + lo) | 0) + ((mid & 0x1fff) << 13)) | 0;
+ c = (((hi + (mid >>> 13)) | 0) + (w8 >>> 26)) | 0;
+ w8 &= 0x3ffffff;
+ /* k = 9 */
+ lo = Math.imul(al9, bl0);
+ mid = Math.imul(al9, bh0);
+ mid = (mid + Math.imul(ah9, bl0)) | 0;
+ hi = Math.imul(ah9, bh0);
+ lo = (lo + Math.imul(al8, bl1)) | 0;
+ mid = (mid + Math.imul(al8, bh1)) | 0;
+ mid = (mid + Math.imul(ah8, bl1)) | 0;
+ hi = (hi + Math.imul(ah8, bh1)) | 0;
+ lo = (lo + Math.imul(al7, bl2)) | 0;
+ mid = (mid + Math.imul(al7, bh2)) | 0;
+ mid = (mid + Math.imul(ah7, bl2)) | 0;
+ hi = (hi + Math.imul(ah7, bh2)) | 0;
+ lo = (lo + Math.imul(al6, bl3)) | 0;
+ mid = (mid + Math.imul(al6, bh3)) | 0;
+ mid = (mid + Math.imul(ah6, bl3)) | 0;
+ hi = (hi + Math.imul(ah6, bh3)) | 0;
+ lo = (lo + Math.imul(al5, bl4)) | 0;
+ mid = (mid + Math.imul(al5, bh4)) | 0;
+ mid = (mid + Math.imul(ah5, bl4)) | 0;
+ hi = (hi + Math.imul(ah5, bh4)) | 0;
+ lo = (lo + Math.imul(al4, bl5)) | 0;
+ mid = (mid + Math.imul(al4, bh5)) | 0;
+ mid = (mid + Math.imul(ah4, bl5)) | 0;
+ hi = (hi + Math.imul(ah4, bh5)) | 0;
+ lo = (lo + Math.imul(al3, bl6)) | 0;
+ mid = (mid + Math.imul(al3, bh6)) | 0;
+ mid = (mid + Math.imul(ah3, bl6)) | 0;
+ hi = (hi + Math.imul(ah3, bh6)) | 0;
+ lo = (lo + Math.imul(al2, bl7)) | 0;
+ mid = (mid + Math.imul(al2, bh7)) | 0;
+ mid = (mid + Math.imul(ah2, bl7)) | 0;
+ hi = (hi + Math.imul(ah2, bh7)) | 0;
+ lo = (lo + Math.imul(al1, bl8)) | 0;
+ mid = (mid + Math.imul(al1, bh8)) | 0;
+ mid = (mid + Math.imul(ah1, bl8)) | 0;
+ hi = (hi + Math.imul(ah1, bh8)) | 0;
+ lo = (lo + Math.imul(al0, bl9)) | 0;
+ mid = (mid + Math.imul(al0, bh9)) | 0;
+ mid = (mid + Math.imul(ah0, bl9)) | 0;
+ hi = (hi + Math.imul(ah0, bh9)) | 0;
+ var w9 = (((c + lo) | 0) + ((mid & 0x1fff) << 13)) | 0;
+ c = (((hi + (mid >>> 13)) | 0) + (w9 >>> 26)) | 0;
+ w9 &= 0x3ffffff;
+ /* k = 10 */
+ lo = Math.imul(al9, bl1);
+ mid = Math.imul(al9, bh1);
+ mid = (mid + Math.imul(ah9, bl1)) | 0;
+ hi = Math.imul(ah9, bh1);
+ lo = (lo + Math.imul(al8, bl2)) | 0;
+ mid = (mid + Math.imul(al8, bh2)) | 0;
+ mid = (mid + Math.imul(ah8, bl2)) | 0;
+ hi = (hi + Math.imul(ah8, bh2)) | 0;
+ lo = (lo + Math.imul(al7, bl3)) | 0;
+ mid = (mid + Math.imul(al7, bh3)) | 0;
+ mid = (mid + Math.imul(ah7, bl3)) | 0;
+ hi = (hi + Math.imul(ah7, bh3)) | 0;
+ lo = (lo + Math.imul(al6, bl4)) | 0;
+ mid = (mid + Math.imul(al6, bh4)) | 0;
+ mid = (mid + Math.imul(ah6, bl4)) | 0;
+ hi = (hi + Math.imul(ah6, bh4)) | 0;
+ lo = (lo + Math.imul(al5, bl5)) | 0;
+ mid = (mid + Math.imul(al5, bh5)) | 0;
+ mid = (mid + Math.imul(ah5, bl5)) | 0;
+ hi = (hi + Math.imul(ah5, bh5)) | 0;
+ lo = (lo + Math.imul(al4, bl6)) | 0;
+ mid = (mid + Math.imul(al4, bh6)) | 0;
+ mid = (mid + Math.imul(ah4, bl6)) | 0;
+ hi = (hi + Math.imul(ah4, bh6)) | 0;
+ lo = (lo + Math.imul(al3, bl7)) | 0;
+ mid = (mid + Math.imul(al3, bh7)) | 0;
+ mid = (mid + Math.imul(ah3, bl7)) | 0;
+ hi = (hi + Math.imul(ah3, bh7)) | 0;
+ lo = (lo + Math.imul(al2, bl8)) | 0;
+ mid = (mid + Math.imul(al2, bh8)) | 0;
+ mid = (mid + Math.imul(ah2, bl8)) | 0;
+ hi = (hi + Math.imul(ah2, bh8)) | 0;
+ lo = (lo + Math.imul(al1, bl9)) | 0;
+ mid = (mid + Math.imul(al1, bh9)) | 0;
+ mid = (mid + Math.imul(ah1, bl9)) | 0;
+ hi = (hi + Math.imul(ah1, bh9)) | 0;
+ var w10 = (((c + lo) | 0) + ((mid & 0x1fff) << 13)) | 0;
+ c = (((hi + (mid >>> 13)) | 0) + (w10 >>> 26)) | 0;
+ w10 &= 0x3ffffff;
+ /* k = 11 */
+ lo = Math.imul(al9, bl2);
+ mid = Math.imul(al9, bh2);
+ mid = (mid + Math.imul(ah9, bl2)) | 0;
+ hi = Math.imul(ah9, bh2);
+ lo = (lo + Math.imul(al8, bl3)) | 0;
+ mid = (mid + Math.imul(al8, bh3)) | 0;
+ mid = (mid + Math.imul(ah8, bl3)) | 0;
+ hi = (hi + Math.imul(ah8, bh3)) | 0;
+ lo = (lo + Math.imul(al7, bl4)) | 0;
+ mid = (mid + Math.imul(al7, bh4)) | 0;
+ mid = (mid + Math.imul(ah7, bl4)) | 0;
+ hi = (hi + Math.imul(ah7, bh4)) | 0;
+ lo = (lo + Math.imul(al6, bl5)) | 0;
+ mid = (mid + Math.imul(al6, bh5)) | 0;
+ mid = (mid + Math.imul(ah6, bl5)) | 0;
+ hi = (hi + Math.imul(ah6, bh5)) | 0;
+ lo = (lo + Math.imul(al5, bl6)) | 0;
+ mid = (mid + Math.imul(al5, bh6)) | 0;
+ mid = (mid + Math.imul(ah5, bl6)) | 0;
+ hi = (hi + Math.imul(ah5, bh6)) | 0;
+ lo = (lo + Math.imul(al4, bl7)) | 0;
+ mid = (mid + Math.imul(al4, bh7)) | 0;
+ mid = (mid + Math.imul(ah4, bl7)) | 0;
+ hi = (hi + Math.imul(ah4, bh7)) | 0;
+ lo = (lo + Math.imul(al3, bl8)) | 0;
+ mid = (mid + Math.imul(al3, bh8)) | 0;
+ mid = (mid + Math.imul(ah3, bl8)) | 0;
+ hi = (hi + Math.imul(ah3, bh8)) | 0;
+ lo = (lo + Math.imul(al2, bl9)) | 0;
+ mid = (mid + Math.imul(al2, bh9)) | 0;
+ mid = (mid + Math.imul(ah2, bl9)) | 0;
+ hi = (hi + Math.imul(ah2, bh9)) | 0;
+ var w11 = (((c + lo) | 0) + ((mid & 0x1fff) << 13)) | 0;
+ c = (((hi + (mid >>> 13)) | 0) + (w11 >>> 26)) | 0;
+ w11 &= 0x3ffffff;
+ /* k = 12 */
+ lo = Math.imul(al9, bl3);
+ mid = Math.imul(al9, bh3);
+ mid = (mid + Math.imul(ah9, bl3)) | 0;
+ hi = Math.imul(ah9, bh3);
+ lo = (lo + Math.imul(al8, bl4)) | 0;
+ mid = (mid + Math.imul(al8, bh4)) | 0;
+ mid = (mid + Math.imul(ah8, bl4)) | 0;
+ hi = (hi + Math.imul(ah8, bh4)) | 0;
+ lo = (lo + Math.imul(al7, bl5)) | 0;
+ mid = (mid + Math.imul(al7, bh5)) | 0;
+ mid = (mid + Math.imul(ah7, bl5)) | 0;
+ hi = (hi + Math.imul(ah7, bh5)) | 0;
+ lo = (lo + Math.imul(al6, bl6)) | 0;
+ mid = (mid + Math.imul(al6, bh6)) | 0;
+ mid = (mid + Math.imul(ah6, bl6)) | 0;
+ hi = (hi + Math.imul(ah6, bh6)) | 0;
+ lo = (lo + Math.imul(al5, bl7)) | 0;
+ mid = (mid + Math.imul(al5, bh7)) | 0;
+ mid = (mid + Math.imul(ah5, bl7)) | 0;
+ hi = (hi + Math.imul(ah5, bh7)) | 0;
+ lo = (lo + Math.imul(al4, bl8)) | 0;
+ mid = (mid + Math.imul(al4, bh8)) | 0;
+ mid = (mid + Math.imul(ah4, bl8)) | 0;
+ hi = (hi + Math.imul(ah4, bh8)) | 0;
+ lo = (lo + Math.imul(al3, bl9)) | 0;
+ mid = (mid + Math.imul(al3, bh9)) | 0;
+ mid = (mid + Math.imul(ah3, bl9)) | 0;
+ hi = (hi + Math.imul(ah3, bh9)) | 0;
+ var w12 = (((c + lo) | 0) + ((mid & 0x1fff) << 13)) | 0;
+ c = (((hi + (mid >>> 13)) | 0) + (w12 >>> 26)) | 0;
+ w12 &= 0x3ffffff;
+ /* k = 13 */
+ lo = Math.imul(al9, bl4);
+ mid = Math.imul(al9, bh4);
+ mid = (mid + Math.imul(ah9, bl4)) | 0;
+ hi = Math.imul(ah9, bh4);
+ lo = (lo + Math.imul(al8, bl5)) | 0;
+ mid = (mid + Math.imul(al8, bh5)) | 0;
+ mid = (mid + Math.imul(ah8, bl5)) | 0;
+ hi = (hi + Math.imul(ah8, bh5)) | 0;
+ lo = (lo + Math.imul(al7, bl6)) | 0;
+ mid = (mid + Math.imul(al7, bh6)) | 0;
+ mid = (mid + Math.imul(ah7, bl6)) | 0;
+ hi = (hi + Math.imul(ah7, bh6)) | 0;
+ lo = (lo + Math.imul(al6, bl7)) | 0;
+ mid = (mid + Math.imul(al6, bh7)) | 0;
+ mid = (mid + Math.imul(ah6, bl7)) | 0;
+ hi = (hi + Math.imul(ah6, bh7)) | 0;
+ lo = (lo + Math.imul(al5, bl8)) | 0;
+ mid = (mid + Math.imul(al5, bh8)) | 0;
+ mid = (mid + Math.imul(ah5, bl8)) | 0;
+ hi = (hi + Math.imul(ah5, bh8)) | 0;
+ lo = (lo + Math.imul(al4, bl9)) | 0;
+ mid = (mid + Math.imul(al4, bh9)) | 0;
+ mid = (mid + Math.imul(ah4, bl9)) | 0;
+ hi = (hi + Math.imul(ah4, bh9)) | 0;
+ var w13 = (((c + lo) | 0) + ((mid & 0x1fff) << 13)) | 0;
+ c = (((hi + (mid >>> 13)) | 0) + (w13 >>> 26)) | 0;
+ w13 &= 0x3ffffff;
+ /* k = 14 */
+ lo = Math.imul(al9, bl5);
+ mid = Math.imul(al9, bh5);
+ mid = (mid + Math.imul(ah9, bl5)) | 0;
+ hi = Math.imul(ah9, bh5);
+ lo = (lo + Math.imul(al8, bl6)) | 0;
+ mid = (mid + Math.imul(al8, bh6)) | 0;
+ mid = (mid + Math.imul(ah8, bl6)) | 0;
+ hi = (hi + Math.imul(ah8, bh6)) | 0;
+ lo = (lo + Math.imul(al7, bl7)) | 0;
+ mid = (mid + Math.imul(al7, bh7)) | 0;
+ mid = (mid + Math.imul(ah7, bl7)) | 0;
+ hi = (hi + Math.imul(ah7, bh7)) | 0;
+ lo = (lo + Math.imul(al6, bl8)) | 0;
+ mid = (mid + Math.imul(al6, bh8)) | 0;
+ mid = (mid + Math.imul(ah6, bl8)) | 0;
+ hi = (hi + Math.imul(ah6, bh8)) | 0;
+ lo = (lo + Math.imul(al5, bl9)) | 0;
+ mid = (mid + Math.imul(al5, bh9)) | 0;
+ mid = (mid + Math.imul(ah5, bl9)) | 0;
+ hi = (hi + Math.imul(ah5, bh9)) | 0;
+ var w14 = (((c + lo) | 0) + ((mid & 0x1fff) << 13)) | 0;
+ c = (((hi + (mid >>> 13)) | 0) + (w14 >>> 26)) | 0;
+ w14 &= 0x3ffffff;
+ /* k = 15 */
+ lo = Math.imul(al9, bl6);
+ mid = Math.imul(al9, bh6);
+ mid = (mid + Math.imul(ah9, bl6)) | 0;
+ hi = Math.imul(ah9, bh6);
+ lo = (lo + Math.imul(al8, bl7)) | 0;
+ mid = (mid + Math.imul(al8, bh7)) | 0;
+ mid = (mid + Math.imul(ah8, bl7)) | 0;
+ hi = (hi + Math.imul(ah8, bh7)) | 0;
+ lo = (lo + Math.imul(al7, bl8)) | 0;
+ mid = (mid + Math.imul(al7, bh8)) | 0;
+ mid = (mid + Math.imul(ah7, bl8)) | 0;
+ hi = (hi + Math.imul(ah7, bh8)) | 0;
+ lo = (lo + Math.imul(al6, bl9)) | 0;
+ mid = (mid + Math.imul(al6, bh9)) | 0;
+ mid = (mid + Math.imul(ah6, bl9)) | 0;
+ hi = (hi + Math.imul(ah6, bh9)) | 0;
+ var w15 = (((c + lo) | 0) + ((mid & 0x1fff) << 13)) | 0;
+ c = (((hi + (mid >>> 13)) | 0) + (w15 >>> 26)) | 0;
+ w15 &= 0x3ffffff;
+ /* k = 16 */
+ lo = Math.imul(al9, bl7);
+ mid = Math.imul(al9, bh7);
+ mid = (mid + Math.imul(ah9, bl7)) | 0;
+ hi = Math.imul(ah9, bh7);
+ lo = (lo + Math.imul(al8, bl8)) | 0;
+ mid = (mid + Math.imul(al8, bh8)) | 0;
+ mid = (mid + Math.imul(ah8, bl8)) | 0;
+ hi = (hi + Math.imul(ah8, bh8)) | 0;
+ lo = (lo + Math.imul(al7, bl9)) | 0;
+ mid = (mid + Math.imul(al7, bh9)) | 0;
+ mid = (mid + Math.imul(ah7, bl9)) | 0;
+ hi = (hi + Math.imul(ah7, bh9)) | 0;
+ var w16 = (((c + lo) | 0) + ((mid & 0x1fff) << 13)) | 0;
+ c = (((hi + (mid >>> 13)) | 0) + (w16 >>> 26)) | 0;
+ w16 &= 0x3ffffff;
+ /* k = 17 */
+ lo = Math.imul(al9, bl8);
+ mid = Math.imul(al9, bh8);
+ mid = (mid + Math.imul(ah9, bl8)) | 0;
+ hi = Math.imul(ah9, bh8);
+ lo = (lo + Math.imul(al8, bl9)) | 0;
+ mid = (mid + Math.imul(al8, bh9)) | 0;
+ mid = (mid + Math.imul(ah8, bl9)) | 0;
+ hi = (hi + Math.imul(ah8, bh9)) | 0;
+ var w17 = (((c + lo) | 0) + ((mid & 0x1fff) << 13)) | 0;
+ c = (((hi + (mid >>> 13)) | 0) + (w17 >>> 26)) | 0;
+ w17 &= 0x3ffffff;
+ /* k = 18 */
+ lo = Math.imul(al9, bl9);
+ mid = Math.imul(al9, bh9);
+ mid = (mid + Math.imul(ah9, bl9)) | 0;
+ hi = Math.imul(ah9, bh9);
+ var w18 = (((c + lo) | 0) + ((mid & 0x1fff) << 13)) | 0;
+ c = (((hi + (mid >>> 13)) | 0) + (w18 >>> 26)) | 0;
+ w18 &= 0x3ffffff;
+ o[0] = w0;
+ o[1] = w1;
+ o[2] = w2;
+ o[3] = w3;
+ o[4] = w4;
+ o[5] = w5;
+ o[6] = w6;
+ o[7] = w7;
+ o[8] = w8;
+ o[9] = w9;
+ o[10] = w10;
+ o[11] = w11;
+ o[12] = w12;
+ o[13] = w13;
+ o[14] = w14;
+ o[15] = w15;
+ o[16] = w16;
+ o[17] = w17;
+ o[18] = w18;
+ if (c !== 0) {
+ o[19] = c;
+ out.length++;
+ }
+ return out;
+ };
+
+ // Polyfill comb
+ if (!Math.imul) {
+ comb10MulTo = smallMulTo;
+ }
+
+ function bigMulTo (self, num, out) {
+ out.negative = num.negative ^ self.negative;
+ out.length = self.length + num.length;
+
+ var carry = 0;
+ var hncarry = 0;
+ for (var k = 0; k < out.length - 1; k++) {
+ // Sum all words with the same `i + j = k` and accumulate `ncarry`,
+ // note that ncarry could be >= 0x3ffffff
+ var ncarry = hncarry;
+ hncarry = 0;
+ var rword = carry & 0x3ffffff;
+ var maxJ = Math.min(k, num.length - 1);
+ for (var j = Math.max(0, k - self.length + 1); j <= maxJ; j++) {
+ var i = k - j;
+ var a = self.words[i] | 0;
+ var b = num.words[j] | 0;
+ var r = a * b;
+
+ var lo = r & 0x3ffffff;
+ ncarry = (ncarry + ((r / 0x4000000) | 0)) | 0;
+ lo = (lo + rword) | 0;
+ rword = lo & 0x3ffffff;
+ ncarry = (ncarry + (lo >>> 26)) | 0;
+
+ hncarry += ncarry >>> 26;
+ ncarry &= 0x3ffffff;
+ }
+ out.words[k] = rword;
+ carry = ncarry;
+ ncarry = hncarry;
+ }
+ if (carry !== 0) {
+ out.words[k] = carry;
+ } else {
+ out.length--;
+ }
+
+ return out.strip();
+ }
+
+ function jumboMulTo (self, num, out) {
+ var fftm = new FFTM();
+ return fftm.mulp(self, num, out);
+ }
+
+ BN.prototype.mulTo = function mulTo (num, out) {
+ var res;
+ var len = this.length + num.length;
+ if (this.length === 10 && num.length === 10) {
+ res = comb10MulTo(this, num, out);
+ } else if (len < 63) {
+ res = smallMulTo(this, num, out);
+ } else if (len < 1024) {
+ res = bigMulTo(this, num, out);
+ } else {
+ res = jumboMulTo(this, num, out);
+ }
+
+ return res;
+ };
+
+ // Cooley-Tukey algorithm for FFT
+ // slightly revisited to rely on looping instead of recursion
+
+ function FFTM (x, y) {
+ this.x = x;
+ this.y = y;
+ }
+
+ FFTM.prototype.makeRBT = function makeRBT (N) {
+ var t = new Array(N);
+ var l = BN.prototype._countBits(N) - 1;
+ for (var i = 0; i < N; i++) {
+ t[i] = this.revBin(i, l, N);
+ }
+
+ return t;
+ };
+
+ // Returns binary-reversed representation of `x`
+ FFTM.prototype.revBin = function revBin (x, l, N) {
+ if (x === 0 || x === N - 1) return x;
+
+ var rb = 0;
+ for (var i = 0; i < l; i++) {
+ rb |= (x & 1) << (l - i - 1);
+ x >>= 1;
+ }
+
+ return rb;
+ };
+
+ // Performs "tweedling" phase, therefore 'emulating'
+ // behaviour of the recursive algorithm
+ FFTM.prototype.permute = function permute (rbt, rws, iws, rtws, itws, N) {
+ for (var i = 0; i < N; i++) {
+ rtws[i] = rws[rbt[i]];
+ itws[i] = iws[rbt[i]];
+ }
+ };
+
+ FFTM.prototype.transform = function transform (rws, iws, rtws, itws, N, rbt) {
+ this.permute(rbt, rws, iws, rtws, itws, N);
+
+ for (var s = 1; s < N; s <<= 1) {
+ var l = s << 1;
+
+ var rtwdf = Math.cos(2 * Math.PI / l);
+ var itwdf = Math.sin(2 * Math.PI / l);
+
+ for (var p = 0; p < N; p += l) {
+ var rtwdf_ = rtwdf;
+ var itwdf_ = itwdf;
+
+ for (var j = 0; j < s; j++) {
+ var re = rtws[p + j];
+ var ie = itws[p + j];
+
+ var ro = rtws[p + j + s];
+ var io = itws[p + j + s];
+
+ var rx = rtwdf_ * ro - itwdf_ * io;
+
+ io = rtwdf_ * io + itwdf_ * ro;
+ ro = rx;
+
+ rtws[p + j] = re + ro;
+ itws[p + j] = ie + io;
+
+ rtws[p + j + s] = re - ro;
+ itws[p + j + s] = ie - io;
+
+ /* jshint maxdepth : false */
+ if (j !== l) {
+ rx = rtwdf * rtwdf_ - itwdf * itwdf_;
+
+ itwdf_ = rtwdf * itwdf_ + itwdf * rtwdf_;
+ rtwdf_ = rx;
+ }
+ }
+ }
+ }
+ };
+
+ FFTM.prototype.guessLen13b = function guessLen13b (n, m) {
+ var N = Math.max(m, n) | 1;
+ var odd = N & 1;
+ var i = 0;
+ for (N = N / 2 | 0; N; N = N >>> 1) {
+ i++;
+ }
+
+ return 1 << i + 1 + odd;
+ };
+
+ FFTM.prototype.conjugate = function conjugate (rws, iws, N) {
+ if (N <= 1) return;
+
+ for (var i = 0; i < N / 2; i++) {
+ var t = rws[i];
+
+ rws[i] = rws[N - i - 1];
+ rws[N - i - 1] = t;
+
+ t = iws[i];
+
+ iws[i] = -iws[N - i - 1];
+ iws[N - i - 1] = -t;
+ }
+ };
+
+ FFTM.prototype.normalize13b = function normalize13b (ws, N) {
+ var carry = 0;
+ for (var i = 0; i < N / 2; i++) {
+ var w = Math.round(ws[2 * i + 1] / N) * 0x2000 +
+ Math.round(ws[2 * i] / N) +
+ carry;
+
+ ws[i] = w & 0x3ffffff;
+
+ if (w < 0x4000000) {
+ carry = 0;
+ } else {
+ carry = w / 0x4000000 | 0;
+ }
+ }
+
+ return ws;
+ };
+
+ FFTM.prototype.convert13b = function convert13b (ws, len, rws, N) {
+ var carry = 0;
+ for (var i = 0; i < len; i++) {
+ carry = carry + (ws[i] | 0);
+
+ rws[2 * i] = carry & 0x1fff; carry = carry >>> 13;
+ rws[2 * i + 1] = carry & 0x1fff; carry = carry >>> 13;
+ }
+
+ // Pad with zeroes
+ for (i = 2 * len; i < N; ++i) {
+ rws[i] = 0;
+ }
+
+ assert(carry === 0);
+ assert((carry & ~0x1fff) === 0);
+ };
+
+ FFTM.prototype.stub = function stub (N) {
+ var ph = new Array(N);
+ for (var i = 0; i < N; i++) {
+ ph[i] = 0;
+ }
+
+ return ph;
+ };
+
+ FFTM.prototype.mulp = function mulp (x, y, out) {
+ var N = 2 * this.guessLen13b(x.length, y.length);
+
+ var rbt = this.makeRBT(N);
+
+ var _ = this.stub(N);
+
+ var rws = new Array(N);
+ var rwst = new Array(N);
+ var iwst = new Array(N);
+
+ var nrws = new Array(N);
+ var nrwst = new Array(N);
+ var niwst = new Array(N);
+
+ var rmws = out.words;
+ rmws.length = N;
+
+ this.convert13b(x.words, x.length, rws, N);
+ this.convert13b(y.words, y.length, nrws, N);
+
+ this.transform(rws, _, rwst, iwst, N, rbt);
+ this.transform(nrws, _, nrwst, niwst, N, rbt);
+
+ for (var i = 0; i < N; i++) {
+ var rx = rwst[i] * nrwst[i] - iwst[i] * niwst[i];
+ iwst[i] = rwst[i] * niwst[i] + iwst[i] * nrwst[i];
+ rwst[i] = rx;
+ }
+
+ this.conjugate(rwst, iwst, N);
+ this.transform(rwst, iwst, rmws, _, N, rbt);
+ this.conjugate(rmws, _, N);
+ this.normalize13b(rmws, N);
+
+ out.negative = x.negative ^ y.negative;
+ out.length = x.length + y.length;
+ return out.strip();
+ };
+
+ // Multiply `this` by `num`
+ BN.prototype.mul = function mul (num) {
+ var out = new BN(null);
+ out.words = new Array(this.length + num.length);
+ return this.mulTo(num, out);
+ };
+
+ // Multiply employing FFT
+ BN.prototype.mulf = function mulf (num) {
+ var out = new BN(null);
+ out.words = new Array(this.length + num.length);
+ return jumboMulTo(this, num, out);
+ };
+
+ // In-place Multiplication
+ BN.prototype.imul = function imul (num) {
+ return this.clone().mulTo(num, this);
+ };
+
+ BN.prototype.imuln = function imuln (num) {
+ assert(typeof num === 'number');
+ assert(num < 0x4000000);
+
+ // Carry
+ var carry = 0;
+ for (var i = 0; i < this.length; i++) {
+ var w = (this.words[i] | 0) * num;
+ var lo = (w & 0x3ffffff) + (carry & 0x3ffffff);
+ carry >>= 26;
+ carry += (w / 0x4000000) | 0;
+ // NOTE: lo is 27bit maximum
+ carry += lo >>> 26;
+ this.words[i] = lo & 0x3ffffff;
+ }
+
+ if (carry !== 0) {
+ this.words[i] = carry;
+ this.length++;
+ }
+
+ return this;
+ };
+
+ BN.prototype.muln = function muln (num) {
+ return this.clone().imuln(num);
+ };
+
+ // `this` * `this`
+ BN.prototype.sqr = function sqr () {
+ return this.mul(this);
+ };
+
+ // `this` * `this` in-place
+ BN.prototype.isqr = function isqr () {
+ return this.imul(this.clone());
+ };
+
+ // Math.pow(`this`, `num`)
+ BN.prototype.pow = function pow (num) {
+ var w = toBitArray(num);
+ if (w.length === 0) return new BN(1);
+
+ // Skip leading zeroes
+ var res = this;
+ for (var i = 0; i < w.length; i++, res = res.sqr()) {
+ if (w[i] !== 0) break;
+ }
+
+ if (++i < w.length) {
+ for (var q = res.sqr(); i < w.length; i++, q = q.sqr()) {
+ if (w[i] === 0) continue;
+
+ res = res.mul(q);
+ }
+ }
+
+ return res;
+ };
+
+ // Shift-left in-place
+ BN.prototype.iushln = function iushln (bits) {
+ assert(typeof bits === 'number' && bits >= 0);
+ var r = bits % 26;
+ var s = (bits - r) / 26;
+ var carryMask = (0x3ffffff >>> (26 - r)) << (26 - r);
+ var i;
+
+ if (r !== 0) {
+ var carry = 0;
+
+ for (i = 0; i < this.length; i++) {
+ var newCarry = this.words[i] & carryMask;
+ var c = ((this.words[i] | 0) - newCarry) << r;
+ this.words[i] = c | carry;
+ carry = newCarry >>> (26 - r);
+ }
+
+ if (carry) {
+ this.words[i] = carry;
+ this.length++;
+ }
+ }
+
+ if (s !== 0) {
+ for (i = this.length - 1; i >= 0; i--) {
+ this.words[i + s] = this.words[i];
+ }
+
+ for (i = 0; i < s; i++) {
+ this.words[i] = 0;
+ }
+
+ this.length += s;
+ }
+
+ return this.strip();
+ };
+
+ BN.prototype.ishln = function ishln (bits) {
+ // TODO(indutny): implement me
+ assert(this.negative === 0);
+ return this.iushln(bits);
+ };
+
+ // Shift-right in-place
+ // NOTE: `hint` is a lowest bit before trailing zeroes
+ // NOTE: if `extended` is present - it will be filled with destroyed bits
+ BN.prototype.iushrn = function iushrn (bits, hint, extended) {
+ assert(typeof bits === 'number' && bits >= 0);
+ var h;
+ if (hint) {
+ h = (hint - (hint % 26)) / 26;
+ } else {
+ h = 0;
+ }
+
+ var r = bits % 26;
+ var s = Math.min((bits - r) / 26, this.length);
+ var mask = 0x3ffffff ^ ((0x3ffffff >>> r) << r);
+ var maskedWords = extended;
+
+ h -= s;
+ h = Math.max(0, h);
+
+ // Extended mode, copy masked part
+ if (maskedWords) {
+ for (var i = 0; i < s; i++) {
+ maskedWords.words[i] = this.words[i];
+ }
+ maskedWords.length = s;
+ }
+
+ if (s === 0) {
+ // No-op, we should not move anything at all
+ } else if (this.length > s) {
+ this.length -= s;
+ for (i = 0; i < this.length; i++) {
+ this.words[i] = this.words[i + s];
+ }
+ } else {
+ this.words[0] = 0;
+ this.length = 1;
+ }
+
+ var carry = 0;
+ for (i = this.length - 1; i >= 0 && (carry !== 0 || i >= h); i--) {
+ var word = this.words[i] | 0;
+ this.words[i] = (carry << (26 - r)) | (word >>> r);
+ carry = word & mask;
+ }
+
+ // Push carried bits as a mask
+ if (maskedWords && carry !== 0) {
+ maskedWords.words[maskedWords.length++] = carry;
+ }
+
+ if (this.length === 0) {
+ this.words[0] = 0;
+ this.length = 1;
+ }
+
+ return this.strip();
+ };
+
+ BN.prototype.ishrn = function ishrn (bits, hint, extended) {
+ // TODO(indutny): implement me
+ assert(this.negative === 0);
+ return this.iushrn(bits, hint, extended);
+ };
+
+ // Shift-left
+ BN.prototype.shln = function shln (bits) {
+ return this.clone().ishln(bits);
+ };
+
+ BN.prototype.ushln = function ushln (bits) {
+ return this.clone().iushln(bits);
+ };
+
+ // Shift-right
+ BN.prototype.shrn = function shrn (bits) {
+ return this.clone().ishrn(bits);
+ };
+
+ BN.prototype.ushrn = function ushrn (bits) {
+ return this.clone().iushrn(bits);
+ };
+
+ // Test if n bit is set
+ BN.prototype.testn = function testn (bit) {
+ assert(typeof bit === 'number' && bit >= 0);
+ var r = bit % 26;
+ var s = (bit - r) / 26;
+ var q = 1 << r;
+
+ // Fast case: bit is much higher than all existing words
+ if (this.length <= s) return false;
+
+ // Check bit and return
+ var w = this.words[s];
+
+ return !!(w & q);
+ };
+
+ // Return only lowers bits of number (in-place)
+ BN.prototype.imaskn = function imaskn (bits) {
+ assert(typeof bits === 'number' && bits >= 0);
+ var r = bits % 26;
+ var s = (bits - r) / 26;
+
+ assert(this.negative === 0, 'imaskn works only with positive numbers');
+
+ if (this.length <= s) {
+ return this;
+ }
+
+ if (r !== 0) {
+ s++;
+ }
+ this.length = Math.min(s, this.length);
+
+ if (r !== 0) {
+ var mask = 0x3ffffff ^ ((0x3ffffff >>> r) << r);
+ this.words[this.length - 1] &= mask;
+ }
+
+ return this.strip();
+ };
+
+ // Return only lowers bits of number
+ BN.prototype.maskn = function maskn (bits) {
+ return this.clone().imaskn(bits);
+ };
+
+ // Add plain number `num` to `this`
+ BN.prototype.iaddn = function iaddn (num) {
+ assert(typeof num === 'number');
+ assert(num < 0x4000000);
+ if (num < 0) return this.isubn(-num);
+
+ // Possible sign change
+ if (this.negative !== 0) {
+ if (this.length === 1 && (this.words[0] | 0) < num) {
+ this.words[0] = num - (this.words[0] | 0);
+ this.negative = 0;
+ return this;
+ }
+
+ this.negative = 0;
+ this.isubn(num);
+ this.negative = 1;
+ return this;
+ }
+
+ // Add without checks
+ return this._iaddn(num);
+ };
+
+ BN.prototype._iaddn = function _iaddn (num) {
+ this.words[0] += num;
+
+ // Carry
+ for (var i = 0; i < this.length && this.words[i] >= 0x4000000; i++) {
+ this.words[i] -= 0x4000000;
+ if (i === this.length - 1) {
+ this.words[i + 1] = 1;
+ } else {
+ this.words[i + 1]++;
+ }
+ }
+ this.length = Math.max(this.length, i + 1);
+
+ return this;
+ };
+
+ // Subtract plain number `num` from `this`
+ BN.prototype.isubn = function isubn (num) {
+ assert(typeof num === 'number');
+ assert(num < 0x4000000);
+ if (num < 0) return this.iaddn(-num);
+
+ if (this.negative !== 0) {
+ this.negative = 0;
+ this.iaddn(num);
+ this.negative = 1;
+ return this;
+ }
+
+ this.words[0] -= num;
+
+ if (this.length === 1 && this.words[0] < 0) {
+ this.words[0] = -this.words[0];
+ this.negative = 1;
+ } else {
+ // Carry
+ for (var i = 0; i < this.length && this.words[i] < 0; i++) {
+ this.words[i] += 0x4000000;
+ this.words[i + 1] -= 1;
+ }
+ }
+
+ return this.strip();
+ };
+
+ BN.prototype.addn = function addn (num) {
+ return this.clone().iaddn(num);
+ };
+
+ BN.prototype.subn = function subn (num) {
+ return this.clone().isubn(num);
+ };
+
+ BN.prototype.iabs = function iabs () {
+ this.negative = 0;
+
+ return this;
+ };
+
+ BN.prototype.abs = function abs () {
+ return this.clone().iabs();
+ };
+
+ BN.prototype._ishlnsubmul = function _ishlnsubmul (num, mul, shift) {
+ var len = num.length + shift;
+ var i;
+
+ this._expand(len);
+
+ var w;
+ var carry = 0;
+ for (i = 0; i < num.length; i++) {
+ w = (this.words[i + shift] | 0) + carry;
+ var right = (num.words[i] | 0) * mul;
+ w -= right & 0x3ffffff;
+ carry = (w >> 26) - ((right / 0x4000000) | 0);
+ this.words[i + shift] = w & 0x3ffffff;
+ }
+ for (; i < this.length - shift; i++) {
+ w = (this.words[i + shift] | 0) + carry;
+ carry = w >> 26;
+ this.words[i + shift] = w & 0x3ffffff;
+ }
+
+ if (carry === 0) return this.strip();
+
+ // Subtraction overflow
+ assert(carry === -1);
+ carry = 0;
+ for (i = 0; i < this.length; i++) {
+ w = -(this.words[i] | 0) + carry;
+ carry = w >> 26;
+ this.words[i] = w & 0x3ffffff;
+ }
+ this.negative = 1;
+
+ return this.strip();
+ };
+
+ BN.prototype._wordDiv = function _wordDiv (num, mode) {
+ var shift = this.length - num.length;
+
+ var a = this.clone();
+ var b = num;
+
+ // Normalize
+ var bhi = b.words[b.length - 1] | 0;
+ var bhiBits = this._countBits(bhi);
+ shift = 26 - bhiBits;
+ if (shift !== 0) {
+ b = b.ushln(shift);
+ a.iushln(shift);
+ bhi = b.words[b.length - 1] | 0;
+ }
+
+ // Initialize quotient
+ var m = a.length - b.length;
+ var q;
+
+ if (mode !== 'mod') {
+ q = new BN(null);
+ q.length = m + 1;
+ q.words = new Array(q.length);
+ for (var i = 0; i < q.length; i++) {
+ q.words[i] = 0;
+ }
+ }
+
+ var diff = a.clone()._ishlnsubmul(b, 1, m);
+ if (diff.negative === 0) {
+ a = diff;
+ if (q) {
+ q.words[m] = 1;
+ }
+ }
+
+ for (var j = m - 1; j >= 0; j--) {
+ var qj = (a.words[b.length + j] | 0) * 0x4000000 +
+ (a.words[b.length + j - 1] | 0);
+
+ // NOTE: (qj / bhi) is (0x3ffffff * 0x4000000 + 0x3ffffff) / 0x2000000 max
+ // (0x7ffffff)
+ qj = Math.min((qj / bhi) | 0, 0x3ffffff);
+
+ a._ishlnsubmul(b, qj, j);
+ while (a.negative !== 0) {
+ qj--;
+ a.negative = 0;
+ a._ishlnsubmul(b, 1, j);
+ if (!a.isZero()) {
+ a.negative ^= 1;
+ }
+ }
+ if (q) {
+ q.words[j] = qj;
+ }
+ }
+ if (q) {
+ q.strip();
+ }
+ a.strip();
+
+ // Denormalize
+ if (mode !== 'div' && shift !== 0) {
+ a.iushrn(shift);
+ }
+
+ return {
+ div: q || null,
+ mod: a
+ };
+ };
+
+ // NOTE: 1) `mode` can be set to `mod` to request mod only,
+ // to `div` to request div only, or be absent to
+ // request both div & mod
+ // 2) `positive` is true if unsigned mod is requested
+ BN.prototype.divmod = function divmod (num, mode, positive) {
+ assert(!num.isZero());
+
+ if (this.isZero()) {
+ return {
+ div: new BN(0),
+ mod: new BN(0)
+ };
+ }
+
+ var div, mod, res;
+ if (this.negative !== 0 && num.negative === 0) {
+ res = this.neg().divmod(num, mode);
+
+ if (mode !== 'mod') {
+ div = res.div.neg();
+ }
+
+ if (mode !== 'div') {
+ mod = res.mod.neg();
+ if (positive && mod.negative !== 0) {
+ mod.iadd(num);
+ }
+ }
+
+ return {
+ div: div,
+ mod: mod
+ };
+ }
+
+ if (this.negative === 0 && num.negative !== 0) {
+ res = this.divmod(num.neg(), mode);
+
+ if (mode !== 'mod') {
+ div = res.div.neg();
+ }
+
+ return {
+ div: div,
+ mod: res.mod
+ };
+ }
+
+ if ((this.negative & num.negative) !== 0) {
+ res = this.neg().divmod(num.neg(), mode);
+
+ if (mode !== 'div') {
+ mod = res.mod.neg();
+ if (positive && mod.negative !== 0) {
+ mod.isub(num);
+ }
+ }
+
+ return {
+ div: res.div,
+ mod: mod
+ };
+ }
+
+ // Both numbers are positive at this point
+
+ // Strip both numbers to approximate shift value
+ if (num.length > this.length || this.cmp(num) < 0) {
+ return {
+ div: new BN(0),
+ mod: this
+ };
+ }
+
+ // Very short reduction
+ if (num.length === 1) {
+ if (mode === 'div') {
+ return {
+ div: this.divn(num.words[0]),
+ mod: null
+ };
+ }
+
+ if (mode === 'mod') {
+ return {
+ div: null,
+ mod: new BN(this.modn(num.words[0]))
+ };
+ }
+
+ return {
+ div: this.divn(num.words[0]),
+ mod: new BN(this.modn(num.words[0]))
+ };
+ }
+
+ return this._wordDiv(num, mode);
+ };
+
+ // Find `this` / `num`
+ BN.prototype.div = function div (num) {
+ return this.divmod(num, 'div', false).div;
+ };
+
+ // Find `this` % `num`
+ BN.prototype.mod = function mod (num) {
+ return this.divmod(num, 'mod', false).mod;
+ };
+
+ BN.prototype.umod = function umod (num) {
+ return this.divmod(num, 'mod', true).mod;
+ };
+
+ // Find Round(`this` / `num`)
+ BN.prototype.divRound = function divRound (num) {
+ var dm = this.divmod(num);
+
+ // Fast case - exact division
+ if (dm.mod.isZero()) return dm.div;
+
+ var mod = dm.div.negative !== 0 ? dm.mod.isub(num) : dm.mod;
+
+ var half = num.ushrn(1);
+ var r2 = num.andln(1);
+ var cmp = mod.cmp(half);
+
+ // Round down
+ if (cmp < 0 || r2 === 1 && cmp === 0) return dm.div;
+
+ // Round up
+ return dm.div.negative !== 0 ? dm.div.isubn(1) : dm.div.iaddn(1);
+ };
+
+ BN.prototype.modn = function modn (num) {
+ assert(num <= 0x3ffffff);
+ var p = (1 << 26) % num;
+
+ var acc = 0;
+ for (var i = this.length - 1; i >= 0; i--) {
+ acc = (p * acc + (this.words[i] | 0)) % num;
+ }
+
+ return acc;
+ };
+
+ // In-place division by number
+ BN.prototype.idivn = function idivn (num) {
+ assert(num <= 0x3ffffff);
+
+ var carry = 0;
+ for (var i = this.length - 1; i >= 0; i--) {
+ var w = (this.words[i] | 0) + carry * 0x4000000;
+ this.words[i] = (w / num) | 0;
+ carry = w % num;
+ }
+
+ return this.strip();
+ };
+
+ BN.prototype.divn = function divn (num) {
+ return this.clone().idivn(num);
+ };
+
+ BN.prototype.egcd = function egcd (p) {
+ assert(p.negative === 0);
+ assert(!p.isZero());
+
+ var x = this;
+ var y = p.clone();
+
+ if (x.negative !== 0) {
+ x = x.umod(p);
+ } else {
+ x = x.clone();
+ }
+
+ // A * x + B * y = x
+ var A = new BN(1);
+ var B = new BN(0);
+
+ // C * x + D * y = y
+ var C = new BN(0);
+ var D = new BN(1);
+
+ var g = 0;
+
+ while (x.isEven() && y.isEven()) {
+ x.iushrn(1);
+ y.iushrn(1);
+ ++g;
+ }
+
+ var yp = y.clone();
+ var xp = x.clone();
+
+ while (!x.isZero()) {
+ for (var i = 0, im = 1; (x.words[0] & im) === 0 && i < 26; ++i, im <<= 1);
+ if (i > 0) {
+ x.iushrn(i);
+ while (i-- > 0) {
+ if (A.isOdd() || B.isOdd()) {
+ A.iadd(yp);
+ B.isub(xp);
+ }
+
+ A.iushrn(1);
+ B.iushrn(1);
+ }
+ }
+
+ for (var j = 0, jm = 1; (y.words[0] & jm) === 0 && j < 26; ++j, jm <<= 1);
+ if (j > 0) {
+ y.iushrn(j);
+ while (j-- > 0) {
+ if (C.isOdd() || D.isOdd()) {
+ C.iadd(yp);
+ D.isub(xp);
+ }
+
+ C.iushrn(1);
+ D.iushrn(1);
+ }
+ }
+
+ if (x.cmp(y) >= 0) {
+ x.isub(y);
+ A.isub(C);
+ B.isub(D);
+ } else {
+ y.isub(x);
+ C.isub(A);
+ D.isub(B);
+ }
+ }
+
+ return {
+ a: C,
+ b: D,
+ gcd: y.iushln(g)
+ };
+ };
+
+ // This is reduced incarnation of the binary EEA
+ // above, designated to invert members of the
+ // _prime_ fields F(p) at a maximal speed
+ BN.prototype._invmp = function _invmp (p) {
+ assert(p.negative === 0);
+ assert(!p.isZero());
+
+ var a = this;
+ var b = p.clone();
+
+ if (a.negative !== 0) {
+ a = a.umod(p);
+ } else {
+ a = a.clone();
+ }
+
+ var x1 = new BN(1);
+ var x2 = new BN(0);
+
+ var delta = b.clone();
+
+ while (a.cmpn(1) > 0 && b.cmpn(1) > 0) {
+ for (var i = 0, im = 1; (a.words[0] & im) === 0 && i < 26; ++i, im <<= 1);
+ if (i > 0) {
+ a.iushrn(i);
+ while (i-- > 0) {
+ if (x1.isOdd()) {
+ x1.iadd(delta);
+ }
+
+ x1.iushrn(1);
+ }
+ }
+
+ for (var j = 0, jm = 1; (b.words[0] & jm) === 0 && j < 26; ++j, jm <<= 1);
+ if (j > 0) {
+ b.iushrn(j);
+ while (j-- > 0) {
+ if (x2.isOdd()) {
+ x2.iadd(delta);
+ }
+
+ x2.iushrn(1);
+ }
+ }
+
+ if (a.cmp(b) >= 0) {
+ a.isub(b);
+ x1.isub(x2);
+ } else {
+ b.isub(a);
+ x2.isub(x1);
+ }
+ }
+
+ var res;
+ if (a.cmpn(1) === 0) {
+ res = x1;
+ } else {
+ res = x2;
+ }
+
+ if (res.cmpn(0) < 0) {
+ res.iadd(p);
+ }
+
+ return res;
+ };
+
+ BN.prototype.gcd = function gcd (num) {
+ if (this.isZero()) return num.abs();
+ if (num.isZero()) return this.abs();
+
+ var a = this.clone();
+ var b = num.clone();
+ a.negative = 0;
+ b.negative = 0;
+
+ // Remove common factor of two
+ for (var shift = 0; a.isEven() && b.isEven(); shift++) {
+ a.iushrn(1);
+ b.iushrn(1);
+ }
+
+ do {
+ while (a.isEven()) {
+ a.iushrn(1);
+ }
+ while (b.isEven()) {
+ b.iushrn(1);
+ }
+
+ var r = a.cmp(b);
+ if (r < 0) {
+ // Swap `a` and `b` to make `a` always bigger than `b`
+ var t = a;
+ a = b;
+ b = t;
+ } else if (r === 0 || b.cmpn(1) === 0) {
+ break;
+ }
+
+ a.isub(b);
+ } while (true);
+
+ return b.iushln(shift);
+ };
+
+ // Invert number in the field F(num)
+ BN.prototype.invm = function invm (num) {
+ return this.egcd(num).a.umod(num);
+ };
+
+ BN.prototype.isEven = function isEven () {
+ return (this.words[0] & 1) === 0;
+ };
+
+ BN.prototype.isOdd = function isOdd () {
+ return (this.words[0] & 1) === 1;
+ };
+
+ // And first word and num
+ BN.prototype.andln = function andln (num) {
+ return this.words[0] & num;
+ };
+
+ // Increment at the bit position in-line
+ BN.prototype.bincn = function bincn (bit) {
+ assert(typeof bit === 'number');
+ var r = bit % 26;
+ var s = (bit - r) / 26;
+ var q = 1 << r;
+
+ // Fast case: bit is much higher than all existing words
+ if (this.length <= s) {
+ this._expand(s + 1);
+ this.words[s] |= q;
+ return this;
+ }
+
+ // Add bit and propagate, if needed
+ var carry = q;
+ for (var i = s; carry !== 0 && i < this.length; i++) {
+ var w = this.words[i] | 0;
+ w += carry;
+ carry = w >>> 26;
+ w &= 0x3ffffff;
+ this.words[i] = w;
+ }
+ if (carry !== 0) {
+ this.words[i] = carry;
+ this.length++;
+ }
+ return this;
+ };
+
+ BN.prototype.isZero = function isZero () {
+ return this.length === 1 && this.words[0] === 0;
+ };
+
+ BN.prototype.cmpn = function cmpn (num) {
+ var negative = num < 0;
+
+ if (this.negative !== 0 && !negative) return -1;
+ if (this.negative === 0 && negative) return 1;
+
+ this.strip();
+
+ var res;
+ if (this.length > 1) {
+ res = 1;
+ } else {
+ if (negative) {
+ num = -num;
+ }
+
+ assert(num <= 0x3ffffff, 'Number is too big');
+
+ var w = this.words[0] | 0;
+ res = w === num ? 0 : w < num ? -1 : 1;
+ }
+ if (this.negative !== 0) return -res | 0;
+ return res;
+ };
+
+ // Compare two numbers and return:
+ // 1 - if `this` > `num`
+ // 0 - if `this` == `num`
+ // -1 - if `this` < `num`
+ BN.prototype.cmp = function cmp (num) {
+ if (this.negative !== 0 && num.negative === 0) return -1;
+ if (this.negative === 0 && num.negative !== 0) return 1;
+
+ var res = this.ucmp(num);
+ if (this.negative !== 0) return -res | 0;
+ return res;
+ };
+
+ // Unsigned comparison
+ BN.prototype.ucmp = function ucmp (num) {
+ // At this point both numbers have the same sign
+ if (this.length > num.length) return 1;
+ if (this.length < num.length) return -1;
+
+ var res = 0;
+ for (var i = this.length - 1; i >= 0; i--) {
+ var a = this.words[i] | 0;
+ var b = num.words[i] | 0;
+
+ if (a === b) continue;
+ if (a < b) {
+ res = -1;
+ } else if (a > b) {
+ res = 1;
+ }
+ break;
+ }
+ return res;
+ };
+
+ BN.prototype.gtn = function gtn (num) {
+ return this.cmpn(num) === 1;
+ };
+
+ BN.prototype.gt = function gt (num) {
+ return this.cmp(num) === 1;
+ };
+
+ BN.prototype.gten = function gten (num) {
+ return this.cmpn(num) >= 0;
+ };
+
+ BN.prototype.gte = function gte (num) {
+ return this.cmp(num) >= 0;
+ };
+
+ BN.prototype.ltn = function ltn (num) {
+ return this.cmpn(num) === -1;
+ };
+
+ BN.prototype.lt = function lt (num) {
+ return this.cmp(num) === -1;
+ };
+
+ BN.prototype.lten = function lten (num) {
+ return this.cmpn(num) <= 0;
+ };
+
+ BN.prototype.lte = function lte (num) {
+ return this.cmp(num) <= 0;
+ };
+
+ BN.prototype.eqn = function eqn (num) {
+ return this.cmpn(num) === 0;
+ };
+
+ BN.prototype.eq = function eq (num) {
+ return this.cmp(num) === 0;
+ };
+
+ //
+ // A reduce context, could be using montgomery or something better, depending
+ // on the `m` itself.
+ //
+ BN.red = function red (num) {
+ return new Red(num);
+ };
+
+ BN.prototype.toRed = function toRed (ctx) {
+ assert(!this.red, 'Already a number in reduction context');
+ assert(this.negative === 0, 'red works only with positives');
+ return ctx.convertTo(this)._forceRed(ctx);
+ };
+
+ BN.prototype.fromRed = function fromRed () {
+ assert(this.red, 'fromRed works only with numbers in reduction context');
+ return this.red.convertFrom(this);
+ };
+
+ BN.prototype._forceRed = function _forceRed (ctx) {
+ this.red = ctx;
+ return this;
+ };
+
+ BN.prototype.forceRed = function forceRed (ctx) {
+ assert(!this.red, 'Already a number in reduction context');
+ return this._forceRed(ctx);
+ };
+
+ BN.prototype.redAdd = function redAdd (num) {
+ assert(this.red, 'redAdd works only with red numbers');
+ return this.red.add(this, num);
+ };
+
+ BN.prototype.redIAdd = function redIAdd (num) {
+ assert(this.red, 'redIAdd works only with red numbers');
+ return this.red.iadd(this, num);
+ };
+
+ BN.prototype.redSub = function redSub (num) {
+ assert(this.red, 'redSub works only with red numbers');
+ return this.red.sub(this, num);
+ };
+
+ BN.prototype.redISub = function redISub (num) {
+ assert(this.red, 'redISub works only with red numbers');
+ return this.red.isub(this, num);
+ };
+
+ BN.prototype.redShl = function redShl (num) {
+ assert(this.red, 'redShl works only with red numbers');
+ return this.red.shl(this, num);
+ };
+
+ BN.prototype.redMul = function redMul (num) {
+ assert(this.red, 'redMul works only with red numbers');
+ this.red._verify2(this, num);
+ return this.red.mul(this, num);
+ };
+
+ BN.prototype.redIMul = function redIMul (num) {
+ assert(this.red, 'redMul works only with red numbers');
+ this.red._verify2(this, num);
+ return this.red.imul(this, num);
+ };
+
+ BN.prototype.redSqr = function redSqr () {
+ assert(this.red, 'redSqr works only with red numbers');
+ this.red._verify1(this);
+ return this.red.sqr(this);
+ };
+
+ BN.prototype.redISqr = function redISqr () {
+ assert(this.red, 'redISqr works only with red numbers');
+ this.red._verify1(this);
+ return this.red.isqr(this);
+ };
+
+ // Square root over p
+ BN.prototype.redSqrt = function redSqrt () {
+ assert(this.red, 'redSqrt works only with red numbers');
+ this.red._verify1(this);
+ return this.red.sqrt(this);
+ };
+
+ BN.prototype.redInvm = function redInvm () {
+ assert(this.red, 'redInvm works only with red numbers');
+ this.red._verify1(this);
+ return this.red.invm(this);
+ };
+
+ // Return negative clone of `this` % `red modulo`
+ BN.prototype.redNeg = function redNeg () {
+ assert(this.red, 'redNeg works only with red numbers');
+ this.red._verify1(this);
+ return this.red.neg(this);
+ };
+
+ BN.prototype.redPow = function redPow (num) {
+ assert(this.red && !num.red, 'redPow(normalNum)');
+ this.red._verify1(this);
+ return this.red.pow(this, num);
+ };
+
+ // Prime numbers with efficient reduction
+ var primes = {
+ k256: null,
+ p224: null,
+ p192: null,
+ p25519: null
+ };
+
+ // Pseudo-Mersenne prime
+ function MPrime (name, p) {
+ // P = 2 ^ N - K
+ this.name = name;
+ this.p = new BN(p, 16);
+ this.n = this.p.bitLength();
+ this.k = new BN(1).iushln(this.n).isub(this.p);
+
+ this.tmp = this._tmp();
+ }
+
+ MPrime.prototype._tmp = function _tmp () {
+ var tmp = new BN(null);
+ tmp.words = new Array(Math.ceil(this.n / 13));
+ return tmp;
+ };
+
+ MPrime.prototype.ireduce = function ireduce (num) {
+ // Assumes that `num` is less than `P^2`
+ // num = HI * (2 ^ N - K) + HI * K + LO = HI * K + LO (mod P)
+ var r = num;
+ var rlen;
+
+ do {
+ this.split(r, this.tmp);
+ r = this.imulK(r);
+ r = r.iadd(this.tmp);
+ rlen = r.bitLength();
+ } while (rlen > this.n);
+
+ var cmp = rlen < this.n ? -1 : r.ucmp(this.p);
+ if (cmp === 0) {
+ r.words[0] = 0;
+ r.length = 1;
+ } else if (cmp > 0) {
+ r.isub(this.p);
+ } else {
+ if (r.strip !== undefined) {
+ // r is BN v4 instance
+ r.strip();
+ } else {
+ // r is BN v5 instance
+ r._strip();
+ }
+ }
+
+ return r;
+ };
+
+ MPrime.prototype.split = function split (input, out) {
+ input.iushrn(this.n, 0, out);
+ };
+
+ MPrime.prototype.imulK = function imulK (num) {
+ return num.imul(this.k);
+ };
+
+ function K256 () {
+ MPrime.call(
+ this,
+ 'k256',
+ 'ffffffff ffffffff ffffffff ffffffff ffffffff ffffffff fffffffe fffffc2f');
+ }
+ inherits(K256, MPrime);
+
+ K256.prototype.split = function split (input, output) {
+ // 256 = 9 * 26 + 22
+ var mask = 0x3fffff;
+
+ var outLen = Math.min(input.length, 9);
+ for (var i = 0; i < outLen; i++) {
+ output.words[i] = input.words[i];
+ }
+ output.length = outLen;
+
+ if (input.length <= 9) {
+ input.words[0] = 0;
+ input.length = 1;
+ return;
+ }
+
+ // Shift by 9 limbs
+ var prev = input.words[9];
+ output.words[output.length++] = prev & mask;
+
+ for (i = 10; i < input.length; i++) {
+ var next = input.words[i] | 0;
+ input.words[i - 10] = ((next & mask) << 4) | (prev >>> 22);
+ prev = next;
+ }
+ prev >>>= 22;
+ input.words[i - 10] = prev;
+ if (prev === 0 && input.length > 10) {
+ input.length -= 10;
+ } else {
+ input.length -= 9;
+ }
+ };
+
+ K256.prototype.imulK = function imulK (num) {
+ // K = 0x1000003d1 = [ 0x40, 0x3d1 ]
+ num.words[num.length] = 0;
+ num.words[num.length + 1] = 0;
+ num.length += 2;
+
+ // bounded at: 0x40 * 0x3ffffff + 0x3d0 = 0x100000390
+ var lo = 0;
+ for (var i = 0; i < num.length; i++) {
+ var w = num.words[i] | 0;
+ lo += w * 0x3d1;
+ num.words[i] = lo & 0x3ffffff;
+ lo = w * 0x40 + ((lo / 0x4000000) | 0);
+ }
+
+ // Fast length reduction
+ if (num.words[num.length - 1] === 0) {
+ num.length--;
+ if (num.words[num.length - 1] === 0) {
+ num.length--;
+ }
+ }
+ return num;
+ };
+
+ function P224 () {
+ MPrime.call(
+ this,
+ 'p224',
+ 'ffffffff ffffffff ffffffff ffffffff 00000000 00000000 00000001');
+ }
+ inherits(P224, MPrime);
+
+ function P192 () {
+ MPrime.call(
+ this,
+ 'p192',
+ 'ffffffff ffffffff ffffffff fffffffe ffffffff ffffffff');
+ }
+ inherits(P192, MPrime);
+
+ function P25519 () {
+ // 2 ^ 255 - 19
+ MPrime.call(
+ this,
+ '25519',
+ '7fffffffffffffff ffffffffffffffff ffffffffffffffff ffffffffffffffed');
+ }
+ inherits(P25519, MPrime);
+
+ P25519.prototype.imulK = function imulK (num) {
+ // K = 0x13
+ var carry = 0;
+ for (var i = 0; i < num.length; i++) {
+ var hi = (num.words[i] | 0) * 0x13 + carry;
+ var lo = hi & 0x3ffffff;
+ hi >>>= 26;
+
+ num.words[i] = lo;
+ carry = hi;
+ }
+ if (carry !== 0) {
+ num.words[num.length++] = carry;
+ }
+ return num;
+ };
+
+ // Exported mostly for testing purposes, use plain name instead
+ BN._prime = function prime (name) {
+ // Cached version of prime
+ if (primes[name]) return primes[name];
+
+ var prime;
+ if (name === 'k256') {
+ prime = new K256();
+ } else if (name === 'p224') {
+ prime = new P224();
+ } else if (name === 'p192') {
+ prime = new P192();
+ } else if (name === 'p25519') {
+ prime = new P25519();
+ } else {
+ throw new Error('Unknown prime ' + name);
+ }
+ primes[name] = prime;
+
+ return prime;
+ };
+
+ //
+ // Base reduction engine
+ //
+ function Red (m) {
+ if (typeof m === 'string') {
+ var prime = BN._prime(m);
+ this.m = prime.p;
+ this.prime = prime;
+ } else {
+ assert(m.gtn(1), 'modulus must be greater than 1');
+ this.m = m;
+ this.prime = null;
+ }
+ }
+
+ Red.prototype._verify1 = function _verify1 (a) {
+ assert(a.negative === 0, 'red works only with positives');
+ assert(a.red, 'red works only with red numbers');
+ };
+
+ Red.prototype._verify2 = function _verify2 (a, b) {
+ assert((a.negative | b.negative) === 0, 'red works only with positives');
+ assert(a.red && a.red === b.red,
+ 'red works only with red numbers');
+ };
+
+ Red.prototype.imod = function imod (a) {
+ if (this.prime) return this.prime.ireduce(a)._forceRed(this);
+ return a.umod(this.m)._forceRed(this);
+ };
+
+ Red.prototype.neg = function neg (a) {
+ if (a.isZero()) {
+ return a.clone();
+ }
+
+ return this.m.sub(a)._forceRed(this);
+ };
+
+ Red.prototype.add = function add (a, b) {
+ this._verify2(a, b);
+
+ var res = a.add(b);
+ if (res.cmp(this.m) >= 0) {
+ res.isub(this.m);
+ }
+ return res._forceRed(this);
+ };
+
+ Red.prototype.iadd = function iadd (a, b) {
+ this._verify2(a, b);
+
+ var res = a.iadd(b);
+ if (res.cmp(this.m) >= 0) {
+ res.isub(this.m);
+ }
+ return res;
+ };
+
+ Red.prototype.sub = function sub (a, b) {
+ this._verify2(a, b);
+
+ var res = a.sub(b);
+ if (res.cmpn(0) < 0) {
+ res.iadd(this.m);
+ }
+ return res._forceRed(this);
+ };
+
+ Red.prototype.isub = function isub (a, b) {
+ this._verify2(a, b);
+
+ var res = a.isub(b);
+ if (res.cmpn(0) < 0) {
+ res.iadd(this.m);
+ }
+ return res;
+ };
+
+ Red.prototype.shl = function shl (a, num) {
+ this._verify1(a);
+ return this.imod(a.ushln(num));
+ };
+
+ Red.prototype.imul = function imul (a, b) {
+ this._verify2(a, b);
+ return this.imod(a.imul(b));
+ };
+
+ Red.prototype.mul = function mul (a, b) {
+ this._verify2(a, b);
+ return this.imod(a.mul(b));
+ };
+
+ Red.prototype.isqr = function isqr (a) {
+ return this.imul(a, a.clone());
+ };
+
+ Red.prototype.sqr = function sqr (a) {
+ return this.mul(a, a);
+ };
+
+ Red.prototype.sqrt = function sqrt (a) {
+ if (a.isZero()) return a.clone();
+
+ var mod3 = this.m.andln(3);
+ assert(mod3 % 2 === 1);
+
+ // Fast case
+ if (mod3 === 3) {
+ var pow = this.m.add(new BN(1)).iushrn(2);
+ return this.pow(a, pow);
+ }
+
+ // Tonelli-Shanks algorithm (Totally unoptimized and slow)
+ //
+ // Find Q and S, that Q * 2 ^ S = (P - 1)
+ var q = this.m.subn(1);
+ var s = 0;
+ while (!q.isZero() && q.andln(1) === 0) {
+ s++;
+ q.iushrn(1);
+ }
+ assert(!q.isZero());
+
+ var one = new BN(1).toRed(this);
+ var nOne = one.redNeg();
+
+ // Find quadratic non-residue
+ // NOTE: Max is such because of generalized Riemann hypothesis.
+ var lpow = this.m.subn(1).iushrn(1);
+ var z = this.m.bitLength();
+ z = new BN(2 * z * z).toRed(this);
+
+ while (this.pow(z, lpow).cmp(nOne) !== 0) {
+ z.redIAdd(nOne);
+ }
+
+ var c = this.pow(z, q);
+ var r = this.pow(a, q.addn(1).iushrn(1));
+ var t = this.pow(a, q);
+ var m = s;
+ while (t.cmp(one) !== 0) {
+ var tmp = t;
+ for (var i = 0; tmp.cmp(one) !== 0; i++) {
+ tmp = tmp.redSqr();
+ }
+ assert(i < m);
+ var b = this.pow(c, new BN(1).iushln(m - i - 1));
+
+ r = r.redMul(b);
+ c = b.redSqr();
+ t = t.redMul(c);
+ m = i;
+ }
+
+ return r;
+ };
+
+ Red.prototype.invm = function invm (a) {
+ var inv = a._invmp(this.m);
+ if (inv.negative !== 0) {
+ inv.negative = 0;
+ return this.imod(inv).redNeg();
+ } else {
+ return this.imod(inv);
+ }
+ };
+
+ Red.prototype.pow = function pow (a, num) {
+ if (num.isZero()) return new BN(1).toRed(this);
+ if (num.cmpn(1) === 0) return a.clone();
+
+ var windowSize = 4;
+ var wnd = new Array(1 << windowSize);
+ wnd[0] = new BN(1).toRed(this);
+ wnd[1] = a;
+ for (var i = 2; i < wnd.length; i++) {
+ wnd[i] = this.mul(wnd[i - 1], a);
+ }
+
+ var res = wnd[0];
+ var current = 0;
+ var currentLen = 0;
+ var start = num.bitLength() % 26;
+ if (start === 0) {
+ start = 26;
+ }
+
+ for (i = num.length - 1; i >= 0; i--) {
+ var word = num.words[i];
+ for (var j = start - 1; j >= 0; j--) {
+ var bit = (word >> j) & 1;
+ if (res !== wnd[0]) {
+ res = this.sqr(res);
+ }
+
+ if (bit === 0 && current === 0) {
+ currentLen = 0;
+ continue;
+ }
+
+ current <<= 1;
+ current |= bit;
+ currentLen++;
+ if (currentLen !== windowSize && (i !== 0 || j !== 0)) continue;
+
+ res = this.mul(res, wnd[current]);
+ currentLen = 0;
+ current = 0;
+ }
+ start = 26;
+ }
+
+ return res;
+ };
+
+ Red.prototype.convertTo = function convertTo (num) {
+ var r = num.umod(this.m);
+
+ return r === num ? r.clone() : r;
+ };
+
+ Red.prototype.convertFrom = function convertFrom (num) {
+ var res = num.clone();
+ res.red = null;
+ return res;
+ };
+
+ //
+ // Montgomery method engine
+ //
+
+ BN.mont = function mont (num) {
+ return new Mont(num);
+ };
+
+ function Mont (m) {
+ Red.call(this, m);
+
+ this.shift = this.m.bitLength();
+ if (this.shift % 26 !== 0) {
+ this.shift += 26 - (this.shift % 26);
+ }
+
+ this.r = new BN(1).iushln(this.shift);
+ this.r2 = this.imod(this.r.sqr());
+ this.rinv = this.r._invmp(this.m);
+
+ this.minv = this.rinv.mul(this.r).isubn(1).div(this.m);
+ this.minv = this.minv.umod(this.r);
+ this.minv = this.r.sub(this.minv);
+ }
+ inherits(Mont, Red);
+
+ Mont.prototype.convertTo = function convertTo (num) {
+ return this.imod(num.ushln(this.shift));
+ };
+
+ Mont.prototype.convertFrom = function convertFrom (num) {
+ var r = this.imod(num.mul(this.rinv));
+ r.red = null;
+ return r;
+ };
+
+ Mont.prototype.imul = function imul (a, b) {
+ if (a.isZero() || b.isZero()) {
+ a.words[0] = 0;
+ a.length = 1;
+ return a;
+ }
+
+ var t = a.imul(b);
+ var c = t.maskn(this.shift).mul(this.minv).imaskn(this.shift).mul(this.m);
+ var u = t.isub(c).iushrn(this.shift);
+ var res = u;
+
+ if (u.cmp(this.m) >= 0) {
+ res = u.isub(this.m);
+ } else if (u.cmpn(0) < 0) {
+ res = u.iadd(this.m);
+ }
+
+ return res._forceRed(this);
+ };
+
+ Mont.prototype.mul = function mul (a, b) {
+ if (a.isZero() || b.isZero()) return new BN(0)._forceRed(this);
+
+ var t = a.mul(b);
+ var c = t.maskn(this.shift).mul(this.minv).imaskn(this.shift).mul(this.m);
+ var u = t.isub(c).iushrn(this.shift);
+ var res = u;
+ if (u.cmp(this.m) >= 0) {
+ res = u.isub(this.m);
+ } else if (u.cmpn(0) < 0) {
+ res = u.iadd(this.m);
+ }
+
+ return res._forceRed(this);
+ };
+
+ Mont.prototype.invm = function invm (a) {
+ // (AR)^-1 * R^2 = (A^-1 * R^-1) * R^2 = A^-1 * R
+ var res = this.imod(a._invmp(this.m).mul(this.r2));
+ return res._forceRed(this);
+ };
+})(typeof module === 'undefined' || module, this);
diff --git a/node_modules/bn.js/package.json b/node_modules/bn.js/package.json
new file mode 100644
index 0000000..a3c4ebc
--- /dev/null
+++ b/node_modules/bn.js/package.json
@@ -0,0 +1,36 @@
+{
+ "name": "bn.js",
+ "version": "4.12.1",
+ "description": "Big number implementation in pure javascript",
+ "main": "lib/bn.js",
+ "scripts": {
+ "lint": "semistandard",
+ "unit": "mocha --reporter=spec test/*-test.js",
+ "test": "npm run lint && npm run unit"
+ },
+ "repository": {
+ "type": "git",
+ "url": "git@github.com:indutny/bn.js"
+ },
+ "keywords": [
+ "BN",
+ "BigNum",
+ "Big number",
+ "Modulo",
+ "Montgomery"
+ ],
+ "author": "Fedor Indutny ",
+ "license": "MIT",
+ "bugs": {
+ "url": "https://github.com/indutny/bn.js/issues"
+ },
+ "homepage": "https://github.com/indutny/bn.js",
+ "browser": {
+ "buffer": false
+ },
+ "devDependencies": {
+ "istanbul": "^0.3.5",
+ "mocha": "^2.1.0",
+ "semistandard": "^7.0.4"
+ }
+}
diff --git a/node_modules/bn.js/util/genCombMulTo.js b/node_modules/bn.js/util/genCombMulTo.js
new file mode 100644
index 0000000..8b456c7
--- /dev/null
+++ b/node_modules/bn.js/util/genCombMulTo.js
@@ -0,0 +1,65 @@
+'use strict';
+
+// NOTE: This could be potentionally used to generate loop-less multiplications
+function genCombMulTo (alen, blen) {
+ var len = alen + blen - 1;
+ var src = [
+ 'var a = self.words;',
+ 'var b = num.words;',
+ 'var o = out.words;',
+ 'var c = 0;',
+ 'var lo;',
+ 'var mid;',
+ 'var hi;'
+ ];
+ for (var i = 0; i < alen; i++) {
+ src.push('var a' + i + ' = a[' + i + '] | 0;');
+ src.push('var al' + i + ' = a' + i + ' & 0x1fff;');
+ src.push('var ah' + i + ' = a' + i + ' >>> 13;');
+ }
+ for (i = 0; i < blen; i++) {
+ src.push('var b' + i + ' = b[' + i + '] | 0;');
+ src.push('var bl' + i + ' = b' + i + ' & 0x1fff;');
+ src.push('var bh' + i + ' = b' + i + ' >>> 13;');
+ }
+ src.push('');
+ src.push('out.negative = self.negative ^ num.negative;');
+ src.push('out.length = ' + len + ';');
+
+ for (var k = 0; k < len; k++) {
+ var minJ = Math.max(0, k - alen + 1);
+ var maxJ = Math.min(k, blen - 1);
+
+ src.push('\/* k = ' + k + ' *\/');
+ src.push('var w' + k + ' = c;');
+ src.push('c = 0;');
+ for (var j = minJ; j <= maxJ; j++) {
+ i = k - j;
+
+ src.push('lo = Math.imul(al' + i + ', bl' + j + ');');
+ src.push('mid = Math.imul(al' + i + ', bh' + j + ');');
+ src.push('mid = (mid + Math.imul(ah' + i + ', bl' + j + ')) | 0;');
+ src.push('hi = Math.imul(ah' + i + ', bh' + j + ');');
+
+ src.push('w' + k + ' = (w' + k + ' + lo) | 0;');
+ src.push('w' + k + ' = (w' + k + ' + ((mid & 0x1fff) << 13)) | 0;');
+ src.push('c = (c + hi) | 0;');
+ src.push('c = (c + (mid >>> 13)) | 0;');
+ src.push('c = (c + (w' + k + ' >>> 26)) | 0;');
+ src.push('w' + k + ' &= 0x3ffffff;');
+ }
+ }
+ // Store in separate step for better memory access
+ for (k = 0; k < len; k++) {
+ src.push('o[' + k + '] = w' + k + ';');
+ }
+ src.push('if (c !== 0) {',
+ ' o[' + k + '] = c;',
+ ' out.length++;',
+ '}',
+ 'return out;');
+
+ return src.join('\n');
+}
+
+console.log(genCombMulTo(10, 10));
diff --git a/node_modules/bn.js/util/genCombMulTo10.js b/node_modules/bn.js/util/genCombMulTo10.js
new file mode 100644
index 0000000..cf2e6e8
--- /dev/null
+++ b/node_modules/bn.js/util/genCombMulTo10.js
@@ -0,0 +1,65 @@
+'use strict';
+
+function genCombMulTo (alen, blen) {
+ var len = alen + blen - 1;
+ var src = [
+ 'var a = self.words;',
+ 'var b = num.words;',
+ 'var o = out.words;',
+ 'var c = 0;',
+ 'var lo;',
+ 'var mid;',
+ 'var hi;'
+ ];
+ for (var i = 0; i < alen; i++) {
+ src.push('var a' + i + ' = a[' + i + '] | 0;');
+ src.push('var al' + i + ' = a' + i + ' & 0x1fff;');
+ src.push('var ah' + i + ' = a' + i + ' >>> 13;');
+ }
+ for (i = 0; i < blen; i++) {
+ src.push('var b' + i + ' = b[' + i + '] | 0;');
+ src.push('var bl' + i + ' = b' + i + ' & 0x1fff;');
+ src.push('var bh' + i + ' = b' + i + ' >>> 13;');
+ }
+ src.push('');
+ src.push('out.negative = self.negative ^ num.negative;');
+ src.push('out.length = ' + len + ';');
+
+ for (var k = 0; k < len; k++) {
+ var minJ = Math.max(0, k - alen + 1);
+ var maxJ = Math.min(k, blen - 1);
+
+ src.push('\/* k = ' + k + ' *\/');
+ src.push('lo = Math.imul(al' + (k - minJ) + ', bl' + minJ + ');');
+ src.push('mid = Math.imul(al' + (k - minJ) + ', bh' + minJ + ');');
+ src.push(
+ 'mid = (mid + Math.imul(ah' + (k - minJ) + ', bl' + minJ + ')) | 0;');
+ src.push('hi = Math.imul(ah' + (k - minJ) + ', bh' + minJ + ');');
+
+ for (var j = minJ + 1; j <= maxJ; j++) {
+ i = k - j;
+
+ src.push('lo = (lo + Math.imul(al' + i + ', bl' + j + ')) | 0;');
+ src.push('mid = (mid + Math.imul(al' + i + ', bh' + j + ')) | 0;');
+ src.push('mid = (mid + Math.imul(ah' + i + ', bl' + j + ')) | 0;');
+ src.push('hi = (hi + Math.imul(ah' + i + ', bh' + j + ')) | 0;');
+ }
+
+ src.push('var w' + k + ' = (((c + lo) | 0) + ((mid & 0x1fff) << 13)) | 0;');
+ src.push('c = (((hi + (mid >>> 13)) | 0) + (w' + k + ' >>> 26)) | 0;');
+ src.push('w' + k + ' &= 0x3ffffff;');
+ }
+ // Store in separate step for better memory access
+ for (k = 0; k < len; k++) {
+ src.push('o[' + k + '] = w' + k + ';');
+ }
+ src.push('if (c !== 0) {',
+ ' o[' + k + '] = c;',
+ ' out.length++;',
+ '}',
+ 'return out;');
+
+ return src.join('\n');
+}
+
+console.log(genCombMulTo(10, 10));
diff --git a/node_modules/body-parser/HISTORY.md b/node_modules/body-parser/HISTORY.md
new file mode 100644
index 0000000..81d23e0
--- /dev/null
+++ b/node_modules/body-parser/HISTORY.md
@@ -0,0 +1,672 @@
+1.20.3 / 2024-09-10
+===================
+
+ * deps: qs@6.13.0
+ * add `depth` option to customize the depth level in the parser
+ * IMPORTANT: The default `depth` level for parsing URL-encoded data is now `32` (previously was `Infinity`)
+
+1.20.2 / 2023-02-21
+===================
+
+ * Fix strict json error message on Node.js 19+
+ * deps: content-type@~1.0.5
+ - perf: skip value escaping when unnecessary
+ * deps: raw-body@2.5.2
+
+1.20.1 / 2022-10-06
+===================
+
+ * deps: qs@6.11.0
+ * perf: remove unnecessary object clone
+
+1.20.0 / 2022-04-02
+===================
+
+ * Fix error message for json parse whitespace in `strict`
+ * Fix internal error when inflated body exceeds limit
+ * Prevent loss of async hooks context
+ * Prevent hanging when request already read
+ * deps: depd@2.0.0
+ - Replace internal `eval` usage with `Function` constructor
+ - Use instance methods on `process` to check for listeners
+ * deps: http-errors@2.0.0
+ - deps: depd@2.0.0
+ - deps: statuses@2.0.1
+ * deps: on-finished@2.4.1
+ * deps: qs@6.10.3
+ * deps: raw-body@2.5.1
+ - deps: http-errors@2.0.0
+
+1.19.2 / 2022-02-15
+===================
+
+ * deps: bytes@3.1.2
+ * deps: qs@6.9.7
+ * Fix handling of `__proto__` keys
+ * deps: raw-body@2.4.3
+ - deps: bytes@3.1.2
+
+1.19.1 / 2021-12-10
+===================
+
+ * deps: bytes@3.1.1
+ * deps: http-errors@1.8.1
+ - deps: inherits@2.0.4
+ - deps: toidentifier@1.0.1
+ - deps: setprototypeof@1.2.0
+ * deps: qs@6.9.6
+ * deps: raw-body@2.4.2
+ - deps: bytes@3.1.1
+ - deps: http-errors@1.8.1
+ * deps: safe-buffer@5.2.1
+ * deps: type-is@~1.6.18
+
+1.19.0 / 2019-04-25
+===================
+
+ * deps: bytes@3.1.0
+ - Add petabyte (`pb`) support
+ * deps: http-errors@1.7.2
+ - Set constructor name when possible
+ - deps: setprototypeof@1.1.1
+ - deps: statuses@'>= 1.5.0 < 2'
+ * deps: iconv-lite@0.4.24
+ - Added encoding MIK
+ * deps: qs@6.7.0
+ - Fix parsing array brackets after index
+ * deps: raw-body@2.4.0
+ - deps: bytes@3.1.0
+ - deps: http-errors@1.7.2
+ - deps: iconv-lite@0.4.24
+ * deps: type-is@~1.6.17
+ - deps: mime-types@~2.1.24
+ - perf: prevent internal `throw` on invalid type
+
+1.18.3 / 2018-05-14
+===================
+
+ * Fix stack trace for strict json parse error
+ * deps: depd@~1.1.2
+ - perf: remove argument reassignment
+ * deps: http-errors@~1.6.3
+ - deps: depd@~1.1.2
+ - deps: setprototypeof@1.1.0
+ - deps: statuses@'>= 1.3.1 < 2'
+ * deps: iconv-lite@0.4.23
+ - Fix loading encoding with year appended
+ - Fix deprecation warnings on Node.js 10+
+ * deps: qs@6.5.2
+ * deps: raw-body@2.3.3
+ - deps: http-errors@1.6.3
+ - deps: iconv-lite@0.4.23
+ * deps: type-is@~1.6.16
+ - deps: mime-types@~2.1.18
+
+1.18.2 / 2017-09-22
+===================
+
+ * deps: debug@2.6.9
+ * perf: remove argument reassignment
+
+1.18.1 / 2017-09-12
+===================
+
+ * deps: content-type@~1.0.4
+ - perf: remove argument reassignment
+ - perf: skip parameter parsing when no parameters
+ * deps: iconv-lite@0.4.19
+ - Fix ISO-8859-1 regression
+ - Update Windows-1255
+ * deps: qs@6.5.1
+ - Fix parsing & compacting very deep objects
+ * deps: raw-body@2.3.2
+ - deps: iconv-lite@0.4.19
+
+1.18.0 / 2017-09-08
+===================
+
+ * Fix JSON strict violation error to match native parse error
+ * Include the `body` property on verify errors
+ * Include the `type` property on all generated errors
+ * Use `http-errors` to set status code on errors
+ * deps: bytes@3.0.0
+ * deps: debug@2.6.8
+ * deps: depd@~1.1.1
+ - Remove unnecessary `Buffer` loading
+ * deps: http-errors@~1.6.2
+ - deps: depd@1.1.1
+ * deps: iconv-lite@0.4.18
+ - Add support for React Native
+ - Add a warning if not loaded as utf-8
+ - Fix CESU-8 decoding in Node.js 8
+ - Improve speed of ISO-8859-1 encoding
+ * deps: qs@6.5.0
+ * deps: raw-body@2.3.1
+ - Use `http-errors` for standard emitted errors
+ - deps: bytes@3.0.0
+ - deps: iconv-lite@0.4.18
+ - perf: skip buffer decoding on overage chunk
+ * perf: prevent internal `throw` when missing charset
+
+1.17.2 / 2017-05-17
+===================
+
+ * deps: debug@2.6.7
+ - Fix `DEBUG_MAX_ARRAY_LENGTH`
+ - deps: ms@2.0.0
+ * deps: type-is@~1.6.15
+ - deps: mime-types@~2.1.15
+
+1.17.1 / 2017-03-06
+===================
+
+ * deps: qs@6.4.0
+ - Fix regression parsing keys starting with `[`
+
+1.17.0 / 2017-03-01
+===================
+
+ * deps: http-errors@~1.6.1
+ - Make `message` property enumerable for `HttpError`s
+ - deps: setprototypeof@1.0.3
+ * deps: qs@6.3.1
+ - Fix compacting nested arrays
+
+1.16.1 / 2017-02-10
+===================
+
+ * deps: debug@2.6.1
+ - Fix deprecation messages in WebStorm and other editors
+ - Undeprecate `DEBUG_FD` set to `1` or `2`
+
+1.16.0 / 2017-01-17
+===================
+
+ * deps: debug@2.6.0
+ - Allow colors in workers
+ - Deprecated `DEBUG_FD` environment variable
+ - Fix error when running under React Native
+ - Use same color for same namespace
+ - deps: ms@0.7.2
+ * deps: http-errors@~1.5.1
+ - deps: inherits@2.0.3
+ - deps: setprototypeof@1.0.2
+ - deps: statuses@'>= 1.3.1 < 2'
+ * deps: iconv-lite@0.4.15
+ - Added encoding MS-31J
+ - Added encoding MS-932
+ - Added encoding MS-936
+ - Added encoding MS-949
+ - Added encoding MS-950
+ - Fix GBK/GB18030 handling of Euro character
+ * deps: qs@6.2.1
+ - Fix array parsing from skipping empty values
+ * deps: raw-body@~2.2.0
+ - deps: iconv-lite@0.4.15
+ * deps: type-is@~1.6.14
+ - deps: mime-types@~2.1.13
+
+1.15.2 / 2016-06-19
+===================
+
+ * deps: bytes@2.4.0
+ * deps: content-type@~1.0.2
+ - perf: enable strict mode
+ * deps: http-errors@~1.5.0
+ - Use `setprototypeof` module to replace `__proto__` setting
+ - deps: statuses@'>= 1.3.0 < 2'
+ - perf: enable strict mode
+ * deps: qs@6.2.0
+ * deps: raw-body@~2.1.7
+ - deps: bytes@2.4.0
+ - perf: remove double-cleanup on happy path
+ * deps: type-is@~1.6.13
+ - deps: mime-types@~2.1.11
+
+1.15.1 / 2016-05-05
+===================
+
+ * deps: bytes@2.3.0
+ - Drop partial bytes on all parsed units
+ - Fix parsing byte string that looks like hex
+ * deps: raw-body@~2.1.6
+ - deps: bytes@2.3.0
+ * deps: type-is@~1.6.12
+ - deps: mime-types@~2.1.10
+
+1.15.0 / 2016-02-10
+===================
+
+ * deps: http-errors@~1.4.0
+ - Add `HttpError` export, for `err instanceof createError.HttpError`
+ - deps: inherits@2.0.1
+ - deps: statuses@'>= 1.2.1 < 2'
+ * deps: qs@6.1.0
+ * deps: type-is@~1.6.11
+ - deps: mime-types@~2.1.9
+
+1.14.2 / 2015-12-16
+===================
+
+ * deps: bytes@2.2.0
+ * deps: iconv-lite@0.4.13
+ * deps: qs@5.2.0
+ * deps: raw-body@~2.1.5
+ - deps: bytes@2.2.0
+ - deps: iconv-lite@0.4.13
+ * deps: type-is@~1.6.10
+ - deps: mime-types@~2.1.8
+
+1.14.1 / 2015-09-27
+===================
+
+ * Fix issue where invalid charset results in 400 when `verify` used
+ * deps: iconv-lite@0.4.12
+ - Fix CESU-8 decoding in Node.js 4.x
+ * deps: raw-body@~2.1.4
+ - Fix masking critical errors from `iconv-lite`
+ - deps: iconv-lite@0.4.12
+ * deps: type-is@~1.6.9
+ - deps: mime-types@~2.1.7
+
+1.14.0 / 2015-09-16
+===================
+
+ * Fix JSON strict parse error to match syntax errors
+ * Provide static `require` analysis in `urlencoded` parser
+ * deps: depd@~1.1.0
+ - Support web browser loading
+ * deps: qs@5.1.0
+ * deps: raw-body@~2.1.3
+ - Fix sync callback when attaching data listener causes sync read
+ * deps: type-is@~1.6.8
+ - Fix type error when given invalid type to match against
+ - deps: mime-types@~2.1.6
+
+1.13.3 / 2015-07-31
+===================
+
+ * deps: type-is@~1.6.6
+ - deps: mime-types@~2.1.4
+
+1.13.2 / 2015-07-05
+===================
+
+ * deps: iconv-lite@0.4.11
+ * deps: qs@4.0.0
+ - Fix dropping parameters like `hasOwnProperty`
+ - Fix user-visible incompatibilities from 3.1.0
+ - Fix various parsing edge cases
+ * deps: raw-body@~2.1.2
+ - Fix error stack traces to skip `makeError`
+ - deps: iconv-lite@0.4.11
+ * deps: type-is@~1.6.4
+ - deps: mime-types@~2.1.2
+ - perf: enable strict mode
+ - perf: remove argument reassignment
+
+1.13.1 / 2015-06-16
+===================
+
+ * deps: qs@2.4.2
+ - Downgraded from 3.1.0 because of user-visible incompatibilities
+
+1.13.0 / 2015-06-14
+===================
+
+ * Add `statusCode` property on `Error`s, in addition to `status`
+ * Change `type` default to `application/json` for JSON parser
+ * Change `type` default to `application/x-www-form-urlencoded` for urlencoded parser
+ * Provide static `require` analysis
+ * Use the `http-errors` module to generate errors
+ * deps: bytes@2.1.0
+ - Slight optimizations
+ * deps: iconv-lite@0.4.10
+ - The encoding UTF-16 without BOM now defaults to UTF-16LE when detection fails
+ - Leading BOM is now removed when decoding
+ * deps: on-finished@~2.3.0
+ - Add defined behavior for HTTP `CONNECT` requests
+ - Add defined behavior for HTTP `Upgrade` requests
+ - deps: ee-first@1.1.1
+ * deps: qs@3.1.0
+ - Fix dropping parameters like `hasOwnProperty`
+ - Fix various parsing edge cases
+ - Parsed object now has `null` prototype
+ * deps: raw-body@~2.1.1
+ - Use `unpipe` module for unpiping requests
+ - deps: iconv-lite@0.4.10
+ * deps: type-is@~1.6.3
+ - deps: mime-types@~2.1.1
+ - perf: reduce try block size
+ - perf: remove bitwise operations
+ * perf: enable strict mode
+ * perf: remove argument reassignment
+ * perf: remove delete call
+
+1.12.4 / 2015-05-10
+===================
+
+ * deps: debug@~2.2.0
+ * deps: qs@2.4.2
+ - Fix allowing parameters like `constructor`
+ * deps: on-finished@~2.2.1
+ * deps: raw-body@~2.0.1
+ - Fix a false-positive when unpiping in Node.js 0.8
+ - deps: bytes@2.0.1
+ * deps: type-is@~1.6.2
+ - deps: mime-types@~2.0.11
+
+1.12.3 / 2015-04-15
+===================
+
+ * Slight efficiency improvement when not debugging
+ * deps: depd@~1.0.1
+ * deps: iconv-lite@0.4.8
+ - Add encoding alias UNICODE-1-1-UTF-7
+ * deps: raw-body@1.3.4
+ - Fix hanging callback if request aborts during read
+ - deps: iconv-lite@0.4.8
+
+1.12.2 / 2015-03-16
+===================
+
+ * deps: qs@2.4.1
+ - Fix error when parameter `hasOwnProperty` is present
+
+1.12.1 / 2015-03-15
+===================
+
+ * deps: debug@~2.1.3
+ - Fix high intensity foreground color for bold
+ - deps: ms@0.7.0
+ * deps: type-is@~1.6.1
+ - deps: mime-types@~2.0.10
+
+1.12.0 / 2015-02-13
+===================
+
+ * add `debug` messages
+ * accept a function for the `type` option
+ * use `content-type` to parse `Content-Type` headers
+ * deps: iconv-lite@0.4.7
+ - Gracefully support enumerables on `Object.prototype`
+ * deps: raw-body@1.3.3
+ - deps: iconv-lite@0.4.7
+ * deps: type-is@~1.6.0
+ - fix argument reassignment
+ - fix false-positives in `hasBody` `Transfer-Encoding` check
+ - support wildcard for both type and subtype (`*/*`)
+ - deps: mime-types@~2.0.9
+
+1.11.0 / 2015-01-30
+===================
+
+ * make internal `extended: true` depth limit infinity
+ * deps: type-is@~1.5.6
+ - deps: mime-types@~2.0.8
+
+1.10.2 / 2015-01-20
+===================
+
+ * deps: iconv-lite@0.4.6
+ - Fix rare aliases of single-byte encodings
+ * deps: raw-body@1.3.2
+ - deps: iconv-lite@0.4.6
+
+1.10.1 / 2015-01-01
+===================
+
+ * deps: on-finished@~2.2.0
+ * deps: type-is@~1.5.5
+ - deps: mime-types@~2.0.7
+
+1.10.0 / 2014-12-02
+===================
+
+ * make internal `extended: true` array limit dynamic
+
+1.9.3 / 2014-11-21
+==================
+
+ * deps: iconv-lite@0.4.5
+ - Fix Windows-31J and X-SJIS encoding support
+ * deps: qs@2.3.3
+ - Fix `arrayLimit` behavior
+ * deps: raw-body@1.3.1
+ - deps: iconv-lite@0.4.5
+ * deps: type-is@~1.5.3
+ - deps: mime-types@~2.0.3
+
+1.9.2 / 2014-10-27
+==================
+
+ * deps: qs@2.3.2
+ - Fix parsing of mixed objects and values
+
+1.9.1 / 2014-10-22
+==================
+
+ * deps: on-finished@~2.1.1
+ - Fix handling of pipelined requests
+ * deps: qs@2.3.0
+ - Fix parsing of mixed implicit and explicit arrays
+ * deps: type-is@~1.5.2
+ - deps: mime-types@~2.0.2
+
+1.9.0 / 2014-09-24
+==================
+
+ * include the charset in "unsupported charset" error message
+ * include the encoding in "unsupported content encoding" error message
+ * deps: depd@~1.0.0
+
+1.8.4 / 2014-09-23
+==================
+
+ * fix content encoding to be case-insensitive
+
+1.8.3 / 2014-09-19
+==================
+
+ * deps: qs@2.2.4
+ - Fix issue with object keys starting with numbers truncated
+
+1.8.2 / 2014-09-15
+==================
+
+ * deps: depd@0.4.5
+
+1.8.1 / 2014-09-07
+==================
+
+ * deps: media-typer@0.3.0
+ * deps: type-is@~1.5.1
+
+1.8.0 / 2014-09-05
+==================
+
+ * make empty-body-handling consistent between chunked requests
+ - empty `json` produces `{}`
+ - empty `raw` produces `new Buffer(0)`
+ - empty `text` produces `''`
+ - empty `urlencoded` produces `{}`
+ * deps: qs@2.2.3
+ - Fix issue where first empty value in array is discarded
+ * deps: type-is@~1.5.0
+ - fix `hasbody` to be true for `content-length: 0`
+
+1.7.0 / 2014-09-01
+==================
+
+ * add `parameterLimit` option to `urlencoded` parser
+ * change `urlencoded` extended array limit to 100
+ * respond with 413 when over `parameterLimit` in `urlencoded`
+
+1.6.7 / 2014-08-29
+==================
+
+ * deps: qs@2.2.2
+ - Remove unnecessary cloning
+
+1.6.6 / 2014-08-27
+==================
+
+ * deps: qs@2.2.0
+ - Array parsing fix
+ - Performance improvements
+
+1.6.5 / 2014-08-16
+==================
+
+ * deps: on-finished@2.1.0
+
+1.6.4 / 2014-08-14
+==================
+
+ * deps: qs@1.2.2
+
+1.6.3 / 2014-08-10
+==================
+
+ * deps: qs@1.2.1
+
+1.6.2 / 2014-08-07
+==================
+
+ * deps: qs@1.2.0
+ - Fix parsing array of objects
+
+1.6.1 / 2014-08-06
+==================
+
+ * deps: qs@1.1.0
+ - Accept urlencoded square brackets
+ - Accept empty values in implicit array notation
+
+1.6.0 / 2014-08-05
+==================
+
+ * deps: qs@1.0.2
+ - Complete rewrite
+ - Limits array length to 20
+ - Limits object depth to 5
+ - Limits parameters to 1,000
+
+1.5.2 / 2014-07-27
+==================
+
+ * deps: depd@0.4.4
+ - Work-around v8 generating empty stack traces
+
+1.5.1 / 2014-07-26
+==================
+
+ * deps: depd@0.4.3
+ - Fix exception when global `Error.stackTraceLimit` is too low
+
+1.5.0 / 2014-07-20
+==================
+
+ * deps: depd@0.4.2
+ - Add `TRACE_DEPRECATION` environment variable
+ - Remove non-standard grey color from color output
+ - Support `--no-deprecation` argument
+ - Support `--trace-deprecation` argument
+ * deps: iconv-lite@0.4.4
+ - Added encoding UTF-7
+ * deps: raw-body@1.3.0
+ - deps: iconv-lite@0.4.4
+ - Added encoding UTF-7
+ - Fix `Cannot switch to old mode now` error on Node.js 0.10+
+ * deps: type-is@~1.3.2
+
+1.4.3 / 2014-06-19
+==================
+
+ * deps: type-is@1.3.1
+ - fix global variable leak
+
+1.4.2 / 2014-06-19
+==================
+
+ * deps: type-is@1.3.0
+ - improve type parsing
+
+1.4.1 / 2014-06-19
+==================
+
+ * fix urlencoded extended deprecation message
+
+1.4.0 / 2014-06-19
+==================
+
+ * add `text` parser
+ * add `raw` parser
+ * check accepted charset in content-type (accepts utf-8)
+ * check accepted encoding in content-encoding (accepts identity)
+ * deprecate `bodyParser()` middleware; use `.json()` and `.urlencoded()` as needed
+ * deprecate `urlencoded()` without provided `extended` option
+ * lazy-load urlencoded parsers
+ * parsers split into files for reduced mem usage
+ * support gzip and deflate bodies
+ - set `inflate: false` to turn off
+ * deps: raw-body@1.2.2
+ - Support all encodings from `iconv-lite`
+
+1.3.1 / 2014-06-11
+==================
+
+ * deps: type-is@1.2.1
+ - Switch dependency from mime to mime-types@1.0.0
+
+1.3.0 / 2014-05-31
+==================
+
+ * add `extended` option to urlencoded parser
+
+1.2.2 / 2014-05-27
+==================
+
+ * deps: raw-body@1.1.6
+ - assert stream encoding on node.js 0.8
+ - assert stream encoding on node.js < 0.10.6
+ - deps: bytes@1
+
+1.2.1 / 2014-05-26
+==================
+
+ * invoke `next(err)` after request fully read
+ - prevents hung responses and socket hang ups
+
+1.2.0 / 2014-05-11
+==================
+
+ * add `verify` option
+ * deps: type-is@1.2.0
+ - support suffix matching
+
+1.1.2 / 2014-05-11
+==================
+
+ * improve json parser speed
+
+1.1.1 / 2014-05-11
+==================
+
+ * fix repeated limit parsing with every request
+
+1.1.0 / 2014-05-10
+==================
+
+ * add `type` option
+ * deps: pin for safety and consistency
+
+1.0.2 / 2014-04-14
+==================
+
+ * use `type-is` module
+
+1.0.1 / 2014-03-20
+==================
+
+ * lower default limits to 100kb
diff --git a/node_modules/body-parser/LICENSE b/node_modules/body-parser/LICENSE
new file mode 100644
index 0000000..386b7b6
--- /dev/null
+++ b/node_modules/body-parser/LICENSE
@@ -0,0 +1,23 @@
+(The MIT License)
+
+Copyright (c) 2014 Jonathan Ong
+Copyright (c) 2014-2015 Douglas Christopher Wilson
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/node_modules/body-parser/README.md b/node_modules/body-parser/README.md
new file mode 100644
index 0000000..f6661b7
--- /dev/null
+++ b/node_modules/body-parser/README.md
@@ -0,0 +1,476 @@
+# body-parser
+
+[![NPM Version][npm-version-image]][npm-url]
+[![NPM Downloads][npm-downloads-image]][npm-url]
+[![Build Status][ci-image]][ci-url]
+[![Test Coverage][coveralls-image]][coveralls-url]
+[![OpenSSF Scorecard Badge][ossf-scorecard-badge]][ossf-scorecard-visualizer]
+
+Node.js body parsing middleware.
+
+Parse incoming request bodies in a middleware before your handlers, available
+under the `req.body` property.
+
+**Note** As `req.body`'s shape is based on user-controlled input, all
+properties and values in this object are untrusted and should be validated
+before trusting. For example, `req.body.foo.toString()` may fail in multiple
+ways, for example the `foo` property may not be there or may not be a string,
+and `toString` may not be a function and instead a string or other user input.
+
+[Learn about the anatomy of an HTTP transaction in Node.js](https://nodejs.org/en/docs/guides/anatomy-of-an-http-transaction/).
+
+_This does not handle multipart bodies_, due to their complex and typically
+large nature. For multipart bodies, you may be interested in the following
+modules:
+
+ * [busboy](https://www.npmjs.org/package/busboy#readme) and
+ [connect-busboy](https://www.npmjs.org/package/connect-busboy#readme)
+ * [multiparty](https://www.npmjs.org/package/multiparty#readme) and
+ [connect-multiparty](https://www.npmjs.org/package/connect-multiparty#readme)
+ * [formidable](https://www.npmjs.org/package/formidable#readme)
+ * [multer](https://www.npmjs.org/package/multer#readme)
+
+This module provides the following parsers:
+
+ * [JSON body parser](#bodyparserjsonoptions)
+ * [Raw body parser](#bodyparserrawoptions)
+ * [Text body parser](#bodyparsertextoptions)
+ * [URL-encoded form body parser](#bodyparserurlencodedoptions)
+
+Other body parsers you might be interested in:
+
+- [body](https://www.npmjs.org/package/body#readme)
+- [co-body](https://www.npmjs.org/package/co-body#readme)
+
+## Installation
+
+```sh
+$ npm install body-parser
+```
+
+## API
+
+```js
+var bodyParser = require('body-parser')
+```
+
+The `bodyParser` object exposes various factories to create middlewares. All
+middlewares will populate the `req.body` property with the parsed body when
+the `Content-Type` request header matches the `type` option, or an empty
+object (`{}`) if there was no body to parse, the `Content-Type` was not matched,
+or an error occurred.
+
+The various errors returned by this module are described in the
+[errors section](#errors).
+
+### bodyParser.json([options])
+
+Returns middleware that only parses `json` and only looks at requests where
+the `Content-Type` header matches the `type` option. This parser accepts any
+Unicode encoding of the body and supports automatic inflation of `gzip` and
+`deflate` encodings.
+
+A new `body` object containing the parsed data is populated on the `request`
+object after the middleware (i.e. `req.body`).
+
+#### Options
+
+The `json` function takes an optional `options` object that may contain any of
+the following keys:
+
+##### inflate
+
+When set to `true`, then deflated (compressed) bodies will be inflated; when
+`false`, deflated bodies are rejected. Defaults to `true`.
+
+##### limit
+
+Controls the maximum request body size. If this is a number, then the value
+specifies the number of bytes; if it is a string, the value is passed to the
+[bytes](https://www.npmjs.com/package/bytes) library for parsing. Defaults
+to `'100kb'`.
+
+##### reviver
+
+The `reviver` option is passed directly to `JSON.parse` as the second
+argument. You can find more information on this argument
+[in the MDN documentation about JSON.parse](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/JSON/parse#Example.3A_Using_the_reviver_parameter).
+
+##### strict
+
+When set to `true`, will only accept arrays and objects; when `false` will
+accept anything `JSON.parse` accepts. Defaults to `true`.
+
+##### type
+
+The `type` option is used to determine what media type the middleware will
+parse. This option can be a string, array of strings, or a function. If not a
+function, `type` option is passed directly to the
+[type-is](https://www.npmjs.org/package/type-is#readme) library and this can
+be an extension name (like `json`), a mime type (like `application/json`), or
+a mime type with a wildcard (like `*/*` or `*/json`). If a function, the `type`
+option is called as `fn(req)` and the request is parsed if it returns a truthy
+value. Defaults to `application/json`.
+
+##### verify
+
+The `verify` option, if supplied, is called as `verify(req, res, buf, encoding)`,
+where `buf` is a `Buffer` of the raw request body and `encoding` is the
+encoding of the request. The parsing can be aborted by throwing an error.
+
+### bodyParser.raw([options])
+
+Returns middleware that parses all bodies as a `Buffer` and only looks at
+requests where the `Content-Type` header matches the `type` option. This
+parser supports automatic inflation of `gzip` and `deflate` encodings.
+
+A new `body` object containing the parsed data is populated on the `request`
+object after the middleware (i.e. `req.body`). This will be a `Buffer` object
+of the body.
+
+#### Options
+
+The `raw` function takes an optional `options` object that may contain any of
+the following keys:
+
+##### inflate
+
+When set to `true`, then deflated (compressed) bodies will be inflated; when
+`false`, deflated bodies are rejected. Defaults to `true`.
+
+##### limit
+
+Controls the maximum request body size. If this is a number, then the value
+specifies the number of bytes; if it is a string, the value is passed to the
+[bytes](https://www.npmjs.com/package/bytes) library for parsing. Defaults
+to `'100kb'`.
+
+##### type
+
+The `type` option is used to determine what media type the middleware will
+parse. This option can be a string, array of strings, or a function.
+If not a function, `type` option is passed directly to the
+[type-is](https://www.npmjs.org/package/type-is#readme) library and this
+can be an extension name (like `bin`), a mime type (like
+`application/octet-stream`), or a mime type with a wildcard (like `*/*` or
+`application/*`). If a function, the `type` option is called as `fn(req)`
+and the request is parsed if it returns a truthy value. Defaults to
+`application/octet-stream`.
+
+##### verify
+
+The `verify` option, if supplied, is called as `verify(req, res, buf, encoding)`,
+where `buf` is a `Buffer` of the raw request body and `encoding` is the
+encoding of the request. The parsing can be aborted by throwing an error.
+
+### bodyParser.text([options])
+
+Returns middleware that parses all bodies as a string and only looks at
+requests where the `Content-Type` header matches the `type` option. This
+parser supports automatic inflation of `gzip` and `deflate` encodings.
+
+A new `body` string containing the parsed data is populated on the `request`
+object after the middleware (i.e. `req.body`). This will be a string of the
+body.
+
+#### Options
+
+The `text` function takes an optional `options` object that may contain any of
+the following keys:
+
+##### defaultCharset
+
+Specify the default character set for the text content if the charset is not
+specified in the `Content-Type` header of the request. Defaults to `utf-8`.
+
+##### inflate
+
+When set to `true`, then deflated (compressed) bodies will be inflated; when
+`false`, deflated bodies are rejected. Defaults to `true`.
+
+##### limit
+
+Controls the maximum request body size. If this is a number, then the value
+specifies the number of bytes; if it is a string, the value is passed to the
+[bytes](https://www.npmjs.com/package/bytes) library for parsing. Defaults
+to `'100kb'`.
+
+##### type
+
+The `type` option is used to determine what media type the middleware will
+parse. This option can be a string, array of strings, or a function. If not
+a function, `type` option is passed directly to the
+[type-is](https://www.npmjs.org/package/type-is#readme) library and this can
+be an extension name (like `txt`), a mime type (like `text/plain`), or a mime
+type with a wildcard (like `*/*` or `text/*`). If a function, the `type`
+option is called as `fn(req)` and the request is parsed if it returns a
+truthy value. Defaults to `text/plain`.
+
+##### verify
+
+The `verify` option, if supplied, is called as `verify(req, res, buf, encoding)`,
+where `buf` is a `Buffer` of the raw request body and `encoding` is the
+encoding of the request. The parsing can be aborted by throwing an error.
+
+### bodyParser.urlencoded([options])
+
+Returns middleware that only parses `urlencoded` bodies and only looks at
+requests where the `Content-Type` header matches the `type` option. This
+parser accepts only UTF-8 encoding of the body and supports automatic
+inflation of `gzip` and `deflate` encodings.
+
+A new `body` object containing the parsed data is populated on the `request`
+object after the middleware (i.e. `req.body`). This object will contain
+key-value pairs, where the value can be a string or array (when `extended` is
+`false`), or any type (when `extended` is `true`).
+
+#### Options
+
+The `urlencoded` function takes an optional `options` object that may contain
+any of the following keys:
+
+##### extended
+
+The `extended` option allows to choose between parsing the URL-encoded data
+with the `querystring` library (when `false`) or the `qs` library (when
+`true`). The "extended" syntax allows for rich objects and arrays to be
+encoded into the URL-encoded format, allowing for a JSON-like experience
+with URL-encoded. For more information, please
+[see the qs library](https://www.npmjs.org/package/qs#readme).
+
+Defaults to `true`, but using the default has been deprecated. Please
+research into the difference between `qs` and `querystring` and choose the
+appropriate setting.
+
+##### inflate
+
+When set to `true`, then deflated (compressed) bodies will be inflated; when
+`false`, deflated bodies are rejected. Defaults to `true`.
+
+##### limit
+
+Controls the maximum request body size. If this is a number, then the value
+specifies the number of bytes; if it is a string, the value is passed to the
+[bytes](https://www.npmjs.com/package/bytes) library for parsing. Defaults
+to `'100kb'`.
+
+##### parameterLimit
+
+The `parameterLimit` option controls the maximum number of parameters that
+are allowed in the URL-encoded data. If a request contains more parameters
+than this value, a 413 will be returned to the client. Defaults to `1000`.
+
+##### type
+
+The `type` option is used to determine what media type the middleware will
+parse. This option can be a string, array of strings, or a function. If not
+a function, `type` option is passed directly to the
+[type-is](https://www.npmjs.org/package/type-is#readme) library and this can
+be an extension name (like `urlencoded`), a mime type (like
+`application/x-www-form-urlencoded`), or a mime type with a wildcard (like
+`*/x-www-form-urlencoded`). If a function, the `type` option is called as
+`fn(req)` and the request is parsed if it returns a truthy value. Defaults
+to `application/x-www-form-urlencoded`.
+
+##### verify
+
+The `verify` option, if supplied, is called as `verify(req, res, buf, encoding)`,
+where `buf` is a `Buffer` of the raw request body and `encoding` is the
+encoding of the request. The parsing can be aborted by throwing an error.
+
+#### depth
+
+The `depth` option is used to configure the maximum depth of the `qs` library when `extended` is `true`. This allows you to limit the amount of keys that are parsed and can be useful to prevent certain types of abuse. Defaults to `32`. It is recommended to keep this value as low as possible.
+
+## Errors
+
+The middlewares provided by this module create errors using the
+[`http-errors` module](https://www.npmjs.com/package/http-errors). The errors
+will typically have a `status`/`statusCode` property that contains the suggested
+HTTP response code, an `expose` property to determine if the `message` property
+should be displayed to the client, a `type` property to determine the type of
+error without matching against the `message`, and a `body` property containing
+the read body, if available.
+
+The following are the common errors created, though any error can come through
+for various reasons.
+
+### content encoding unsupported
+
+This error will occur when the request had a `Content-Encoding` header that
+contained an encoding but the "inflation" option was set to `false`. The
+`status` property is set to `415`, the `type` property is set to
+`'encoding.unsupported'`, and the `charset` property will be set to the
+encoding that is unsupported.
+
+### entity parse failed
+
+This error will occur when the request contained an entity that could not be
+parsed by the middleware. The `status` property is set to `400`, the `type`
+property is set to `'entity.parse.failed'`, and the `body` property is set to
+the entity value that failed parsing.
+
+### entity verify failed
+
+This error will occur when the request contained an entity that could not be
+failed verification by the defined `verify` option. The `status` property is
+set to `403`, the `type` property is set to `'entity.verify.failed'`, and the
+`body` property is set to the entity value that failed verification.
+
+### request aborted
+
+This error will occur when the request is aborted by the client before reading
+the body has finished. The `received` property will be set to the number of
+bytes received before the request was aborted and the `expected` property is
+set to the number of expected bytes. The `status` property is set to `400`
+and `type` property is set to `'request.aborted'`.
+
+### request entity too large
+
+This error will occur when the request body's size is larger than the "limit"
+option. The `limit` property will be set to the byte limit and the `length`
+property will be set to the request body's length. The `status` property is
+set to `413` and the `type` property is set to `'entity.too.large'`.
+
+### request size did not match content length
+
+This error will occur when the request's length did not match the length from
+the `Content-Length` header. This typically occurs when the request is malformed,
+typically when the `Content-Length` header was calculated based on characters
+instead of bytes. The `status` property is set to `400` and the `type` property
+is set to `'request.size.invalid'`.
+
+### stream encoding should not be set
+
+This error will occur when something called the `req.setEncoding` method prior
+to this middleware. This module operates directly on bytes only and you cannot
+call `req.setEncoding` when using this module. The `status` property is set to
+`500` and the `type` property is set to `'stream.encoding.set'`.
+
+### stream is not readable
+
+This error will occur when the request is no longer readable when this middleware
+attempts to read it. This typically means something other than a middleware from
+this module read the request body already and the middleware was also configured to
+read the same request. The `status` property is set to `500` and the `type`
+property is set to `'stream.not.readable'`.
+
+### too many parameters
+
+This error will occur when the content of the request exceeds the configured
+`parameterLimit` for the `urlencoded` parser. The `status` property is set to
+`413` and the `type` property is set to `'parameters.too.many'`.
+
+### unsupported charset "BOGUS"
+
+This error will occur when the request had a charset parameter in the
+`Content-Type` header, but the `iconv-lite` module does not support it OR the
+parser does not support it. The charset is contained in the message as well
+as in the `charset` property. The `status` property is set to `415`, the
+`type` property is set to `'charset.unsupported'`, and the `charset` property
+is set to the charset that is unsupported.
+
+### unsupported content encoding "bogus"
+
+This error will occur when the request had a `Content-Encoding` header that
+contained an unsupported encoding. The encoding is contained in the message
+as well as in the `encoding` property. The `status` property is set to `415`,
+the `type` property is set to `'encoding.unsupported'`, and the `encoding`
+property is set to the encoding that is unsupported.
+
+### The input exceeded the depth
+
+This error occurs when using `bodyParser.urlencoded` with the `extended` property set to `true` and the input exceeds the configured `depth` option. The `status` property is set to `400`. It is recommended to review the `depth` option and evaluate if it requires a higher value. When the `depth` option is set to `32` (default value), the error will not be thrown.
+
+## Examples
+
+### Express/Connect top-level generic
+
+This example demonstrates adding a generic JSON and URL-encoded parser as a
+top-level middleware, which will parse the bodies of all incoming requests.
+This is the simplest setup.
+
+```js
+var express = require('express')
+var bodyParser = require('body-parser')
+
+var app = express()
+
+// parse application/x-www-form-urlencoded
+app.use(bodyParser.urlencoded({ extended: false }))
+
+// parse application/json
+app.use(bodyParser.json())
+
+app.use(function (req, res) {
+ res.setHeader('Content-Type', 'text/plain')
+ res.write('you posted:\n')
+ res.end(JSON.stringify(req.body, null, 2))
+})
+```
+
+### Express route-specific
+
+This example demonstrates adding body parsers specifically to the routes that
+need them. In general, this is the most recommended way to use body-parser with
+Express.
+
+```js
+var express = require('express')
+var bodyParser = require('body-parser')
+
+var app = express()
+
+// create application/json parser
+var jsonParser = bodyParser.json()
+
+// create application/x-www-form-urlencoded parser
+var urlencodedParser = bodyParser.urlencoded({ extended: false })
+
+// POST /login gets urlencoded bodies
+app.post('/login', urlencodedParser, function (req, res) {
+ res.send('welcome, ' + req.body.username)
+})
+
+// POST /api/users gets JSON bodies
+app.post('/api/users', jsonParser, function (req, res) {
+ // create user in req.body
+})
+```
+
+### Change accepted type for parsers
+
+All the parsers accept a `type` option which allows you to change the
+`Content-Type` that the middleware will parse.
+
+```js
+var express = require('express')
+var bodyParser = require('body-parser')
+
+var app = express()
+
+// parse various different custom JSON types as JSON
+app.use(bodyParser.json({ type: 'application/*+json' }))
+
+// parse some custom thing into a Buffer
+app.use(bodyParser.raw({ type: 'application/vnd.custom-type' }))
+
+// parse an HTML body into a string
+app.use(bodyParser.text({ type: 'text/html' }))
+```
+
+## License
+
+[MIT](LICENSE)
+
+[ci-image]: https://badgen.net/github/checks/expressjs/body-parser/master?label=ci
+[ci-url]: https://github.com/expressjs/body-parser/actions/workflows/ci.yml
+[coveralls-image]: https://badgen.net/coveralls/c/github/expressjs/body-parser/master
+[coveralls-url]: https://coveralls.io/r/expressjs/body-parser?branch=master
+[node-version-image]: https://badgen.net/npm/node/body-parser
+[node-version-url]: https://nodejs.org/en/download
+[npm-downloads-image]: https://badgen.net/npm/dm/body-parser
+[npm-url]: https://npmjs.org/package/body-parser
+[npm-version-image]: https://badgen.net/npm/v/body-parser
+[ossf-scorecard-badge]: https://api.scorecard.dev/projects/github.com/expressjs/body-parser/badge
+[ossf-scorecard-visualizer]: https://ossf.github.io/scorecard-visualizer/#/projects/github.com/expressjs/body-parser
\ No newline at end of file
diff --git a/node_modules/body-parser/SECURITY.md b/node_modules/body-parser/SECURITY.md
new file mode 100644
index 0000000..9694d42
--- /dev/null
+++ b/node_modules/body-parser/SECURITY.md
@@ -0,0 +1,25 @@
+# Security Policies and Procedures
+
+## Reporting a Bug
+
+The Express team and community take all security bugs seriously. Thank you
+for improving the security of Express. We appreciate your efforts and
+responsible disclosure and will make every effort to acknowledge your
+contributions.
+
+Report security bugs by emailing the current owner(s) of `body-parser`. This
+information can be found in the npm registry using the command
+`npm owner ls body-parser`.
+If unsure or unable to get the information from the above, open an issue
+in the [project issue tracker](https://github.com/expressjs/body-parser/issues)
+asking for the current contact information.
+
+To ensure the timely response to your report, please ensure that the entirety
+of the report is contained within the email body and not solely behind a web
+link or an attachment.
+
+At least one owner will acknowledge your email within 48 hours, and will send a
+more detailed response within 48 hours indicating the next steps in handling
+your report. After the initial reply to your report, the owners will
+endeavor to keep you informed of the progress towards a fix and full
+announcement, and may ask for additional information or guidance.
diff --git a/node_modules/body-parser/index.js b/node_modules/body-parser/index.js
new file mode 100644
index 0000000..bb24d73
--- /dev/null
+++ b/node_modules/body-parser/index.js
@@ -0,0 +1,156 @@
+/*!
+ * body-parser
+ * Copyright(c) 2014-2015 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+'use strict'
+
+/**
+ * Module dependencies.
+ * @private
+ */
+
+var deprecate = require('depd')('body-parser')
+
+/**
+ * Cache of loaded parsers.
+ * @private
+ */
+
+var parsers = Object.create(null)
+
+/**
+ * @typedef Parsers
+ * @type {function}
+ * @property {function} json
+ * @property {function} raw
+ * @property {function} text
+ * @property {function} urlencoded
+ */
+
+/**
+ * Module exports.
+ * @type {Parsers}
+ */
+
+exports = module.exports = deprecate.function(bodyParser,
+ 'bodyParser: use individual json/urlencoded middlewares')
+
+/**
+ * JSON parser.
+ * @public
+ */
+
+Object.defineProperty(exports, 'json', {
+ configurable: true,
+ enumerable: true,
+ get: createParserGetter('json')
+})
+
+/**
+ * Raw parser.
+ * @public
+ */
+
+Object.defineProperty(exports, 'raw', {
+ configurable: true,
+ enumerable: true,
+ get: createParserGetter('raw')
+})
+
+/**
+ * Text parser.
+ * @public
+ */
+
+Object.defineProperty(exports, 'text', {
+ configurable: true,
+ enumerable: true,
+ get: createParserGetter('text')
+})
+
+/**
+ * URL-encoded parser.
+ * @public
+ */
+
+Object.defineProperty(exports, 'urlencoded', {
+ configurable: true,
+ enumerable: true,
+ get: createParserGetter('urlencoded')
+})
+
+/**
+ * Create a middleware to parse json and urlencoded bodies.
+ *
+ * @param {object} [options]
+ * @return {function}
+ * @deprecated
+ * @public
+ */
+
+function bodyParser (options) {
+ // use default type for parsers
+ var opts = Object.create(options || null, {
+ type: {
+ configurable: true,
+ enumerable: true,
+ value: undefined,
+ writable: true
+ }
+ })
+
+ var _urlencoded = exports.urlencoded(opts)
+ var _json = exports.json(opts)
+
+ return function bodyParser (req, res, next) {
+ _json(req, res, function (err) {
+ if (err) return next(err)
+ _urlencoded(req, res, next)
+ })
+ }
+}
+
+/**
+ * Create a getter for loading a parser.
+ * @private
+ */
+
+function createParserGetter (name) {
+ return function get () {
+ return loadParser(name)
+ }
+}
+
+/**
+ * Load a parser module.
+ * @private
+ */
+
+function loadParser (parserName) {
+ var parser = parsers[parserName]
+
+ if (parser !== undefined) {
+ return parser
+ }
+
+ // this uses a switch for static require analysis
+ switch (parserName) {
+ case 'json':
+ parser = require('./lib/types/json')
+ break
+ case 'raw':
+ parser = require('./lib/types/raw')
+ break
+ case 'text':
+ parser = require('./lib/types/text')
+ break
+ case 'urlencoded':
+ parser = require('./lib/types/urlencoded')
+ break
+ }
+
+ // store to prevent invoking require()
+ return (parsers[parserName] = parser)
+}
diff --git a/node_modules/body-parser/lib/read.js b/node_modules/body-parser/lib/read.js
new file mode 100644
index 0000000..fce6283
--- /dev/null
+++ b/node_modules/body-parser/lib/read.js
@@ -0,0 +1,205 @@
+/*!
+ * body-parser
+ * Copyright(c) 2014-2015 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+'use strict'
+
+/**
+ * Module dependencies.
+ * @private
+ */
+
+var createError = require('http-errors')
+var destroy = require('destroy')
+var getBody = require('raw-body')
+var iconv = require('iconv-lite')
+var onFinished = require('on-finished')
+var unpipe = require('unpipe')
+var zlib = require('zlib')
+
+/**
+ * Module exports.
+ */
+
+module.exports = read
+
+/**
+ * Read a request into a buffer and parse.
+ *
+ * @param {object} req
+ * @param {object} res
+ * @param {function} next
+ * @param {function} parse
+ * @param {function} debug
+ * @param {object} options
+ * @private
+ */
+
+function read (req, res, next, parse, debug, options) {
+ var length
+ var opts = options
+ var stream
+
+ // flag as parsed
+ req._body = true
+
+ // read options
+ var encoding = opts.encoding !== null
+ ? opts.encoding
+ : null
+ var verify = opts.verify
+
+ try {
+ // get the content stream
+ stream = contentstream(req, debug, opts.inflate)
+ length = stream.length
+ stream.length = undefined
+ } catch (err) {
+ return next(err)
+ }
+
+ // set raw-body options
+ opts.length = length
+ opts.encoding = verify
+ ? null
+ : encoding
+
+ // assert charset is supported
+ if (opts.encoding === null && encoding !== null && !iconv.encodingExists(encoding)) {
+ return next(createError(415, 'unsupported charset "' + encoding.toUpperCase() + '"', {
+ charset: encoding.toLowerCase(),
+ type: 'charset.unsupported'
+ }))
+ }
+
+ // read body
+ debug('read body')
+ getBody(stream, opts, function (error, body) {
+ if (error) {
+ var _error
+
+ if (error.type === 'encoding.unsupported') {
+ // echo back charset
+ _error = createError(415, 'unsupported charset "' + encoding.toUpperCase() + '"', {
+ charset: encoding.toLowerCase(),
+ type: 'charset.unsupported'
+ })
+ } else {
+ // set status code on error
+ _error = createError(400, error)
+ }
+
+ // unpipe from stream and destroy
+ if (stream !== req) {
+ unpipe(req)
+ destroy(stream, true)
+ }
+
+ // read off entire request
+ dump(req, function onfinished () {
+ next(createError(400, _error))
+ })
+ return
+ }
+
+ // verify
+ if (verify) {
+ try {
+ debug('verify body')
+ verify(req, res, body, encoding)
+ } catch (err) {
+ next(createError(403, err, {
+ body: body,
+ type: err.type || 'entity.verify.failed'
+ }))
+ return
+ }
+ }
+
+ // parse
+ var str = body
+ try {
+ debug('parse body')
+ str = typeof body !== 'string' && encoding !== null
+ ? iconv.decode(body, encoding)
+ : body
+ req.body = parse(str)
+ } catch (err) {
+ next(createError(400, err, {
+ body: str,
+ type: err.type || 'entity.parse.failed'
+ }))
+ return
+ }
+
+ next()
+ })
+}
+
+/**
+ * Get the content stream of the request.
+ *
+ * @param {object} req
+ * @param {function} debug
+ * @param {boolean} [inflate=true]
+ * @return {object}
+ * @api private
+ */
+
+function contentstream (req, debug, inflate) {
+ var encoding = (req.headers['content-encoding'] || 'identity').toLowerCase()
+ var length = req.headers['content-length']
+ var stream
+
+ debug('content-encoding "%s"', encoding)
+
+ if (inflate === false && encoding !== 'identity') {
+ throw createError(415, 'content encoding unsupported', {
+ encoding: encoding,
+ type: 'encoding.unsupported'
+ })
+ }
+
+ switch (encoding) {
+ case 'deflate':
+ stream = zlib.createInflate()
+ debug('inflate body')
+ req.pipe(stream)
+ break
+ case 'gzip':
+ stream = zlib.createGunzip()
+ debug('gunzip body')
+ req.pipe(stream)
+ break
+ case 'identity':
+ stream = req
+ stream.length = length
+ break
+ default:
+ throw createError(415, 'unsupported content encoding "' + encoding + '"', {
+ encoding: encoding,
+ type: 'encoding.unsupported'
+ })
+ }
+
+ return stream
+}
+
+/**
+ * Dump the contents of a request.
+ *
+ * @param {object} req
+ * @param {function} callback
+ * @api private
+ */
+
+function dump (req, callback) {
+ if (onFinished.isFinished(req)) {
+ callback(null)
+ } else {
+ onFinished(req, callback)
+ req.resume()
+ }
+}
diff --git a/node_modules/body-parser/lib/types/json.js b/node_modules/body-parser/lib/types/json.js
new file mode 100644
index 0000000..59f3f7e
--- /dev/null
+++ b/node_modules/body-parser/lib/types/json.js
@@ -0,0 +1,247 @@
+/*!
+ * body-parser
+ * Copyright(c) 2014 Jonathan Ong
+ * Copyright(c) 2014-2015 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+'use strict'
+
+/**
+ * Module dependencies.
+ * @private
+ */
+
+var bytes = require('bytes')
+var contentType = require('content-type')
+var createError = require('http-errors')
+var debug = require('debug')('body-parser:json')
+var read = require('../read')
+var typeis = require('type-is')
+
+/**
+ * Module exports.
+ */
+
+module.exports = json
+
+/**
+ * RegExp to match the first non-space in a string.
+ *
+ * Allowed whitespace is defined in RFC 7159:
+ *
+ * ws = *(
+ * %x20 / ; Space
+ * %x09 / ; Horizontal tab
+ * %x0A / ; Line feed or New line
+ * %x0D ) ; Carriage return
+ */
+
+var FIRST_CHAR_REGEXP = /^[\x20\x09\x0a\x0d]*([^\x20\x09\x0a\x0d])/ // eslint-disable-line no-control-regex
+
+var JSON_SYNTAX_CHAR = '#'
+var JSON_SYNTAX_REGEXP = /#+/g
+
+/**
+ * Create a middleware to parse JSON bodies.
+ *
+ * @param {object} [options]
+ * @return {function}
+ * @public
+ */
+
+function json (options) {
+ var opts = options || {}
+
+ var limit = typeof opts.limit !== 'number'
+ ? bytes.parse(opts.limit || '100kb')
+ : opts.limit
+ var inflate = opts.inflate !== false
+ var reviver = opts.reviver
+ var strict = opts.strict !== false
+ var type = opts.type || 'application/json'
+ var verify = opts.verify || false
+
+ if (verify !== false && typeof verify !== 'function') {
+ throw new TypeError('option verify must be function')
+ }
+
+ // create the appropriate type checking function
+ var shouldParse = typeof type !== 'function'
+ ? typeChecker(type)
+ : type
+
+ function parse (body) {
+ if (body.length === 0) {
+ // special-case empty json body, as it's a common client-side mistake
+ // TODO: maybe make this configurable or part of "strict" option
+ return {}
+ }
+
+ if (strict) {
+ var first = firstchar(body)
+
+ if (first !== '{' && first !== '[') {
+ debug('strict violation')
+ throw createStrictSyntaxError(body, first)
+ }
+ }
+
+ try {
+ debug('parse json')
+ return JSON.parse(body, reviver)
+ } catch (e) {
+ throw normalizeJsonSyntaxError(e, {
+ message: e.message,
+ stack: e.stack
+ })
+ }
+ }
+
+ return function jsonParser (req, res, next) {
+ if (req._body) {
+ debug('body already parsed')
+ next()
+ return
+ }
+
+ req.body = req.body || {}
+
+ // skip requests without bodies
+ if (!typeis.hasBody(req)) {
+ debug('skip empty body')
+ next()
+ return
+ }
+
+ debug('content-type %j', req.headers['content-type'])
+
+ // determine if request should be parsed
+ if (!shouldParse(req)) {
+ debug('skip parsing')
+ next()
+ return
+ }
+
+ // assert charset per RFC 7159 sec 8.1
+ var charset = getCharset(req) || 'utf-8'
+ if (charset.slice(0, 4) !== 'utf-') {
+ debug('invalid charset')
+ next(createError(415, 'unsupported charset "' + charset.toUpperCase() + '"', {
+ charset: charset,
+ type: 'charset.unsupported'
+ }))
+ return
+ }
+
+ // read
+ read(req, res, next, parse, debug, {
+ encoding: charset,
+ inflate: inflate,
+ limit: limit,
+ verify: verify
+ })
+ }
+}
+
+/**
+ * Create strict violation syntax error matching native error.
+ *
+ * @param {string} str
+ * @param {string} char
+ * @return {Error}
+ * @private
+ */
+
+function createStrictSyntaxError (str, char) {
+ var index = str.indexOf(char)
+ var partial = ''
+
+ if (index !== -1) {
+ partial = str.substring(0, index) + JSON_SYNTAX_CHAR
+
+ for (var i = index + 1; i < str.length; i++) {
+ partial += JSON_SYNTAX_CHAR
+ }
+ }
+
+ try {
+ JSON.parse(partial); /* istanbul ignore next */ throw new SyntaxError('strict violation')
+ } catch (e) {
+ return normalizeJsonSyntaxError(e, {
+ message: e.message.replace(JSON_SYNTAX_REGEXP, function (placeholder) {
+ return str.substring(index, index + placeholder.length)
+ }),
+ stack: e.stack
+ })
+ }
+}
+
+/**
+ * Get the first non-whitespace character in a string.
+ *
+ * @param {string} str
+ * @return {function}
+ * @private
+ */
+
+function firstchar (str) {
+ var match = FIRST_CHAR_REGEXP.exec(str)
+
+ return match
+ ? match[1]
+ : undefined
+}
+
+/**
+ * Get the charset of a request.
+ *
+ * @param {object} req
+ * @api private
+ */
+
+function getCharset (req) {
+ try {
+ return (contentType.parse(req).parameters.charset || '').toLowerCase()
+ } catch (e) {
+ return undefined
+ }
+}
+
+/**
+ * Normalize a SyntaxError for JSON.parse.
+ *
+ * @param {SyntaxError} error
+ * @param {object} obj
+ * @return {SyntaxError}
+ */
+
+function normalizeJsonSyntaxError (error, obj) {
+ var keys = Object.getOwnPropertyNames(error)
+
+ for (var i = 0; i < keys.length; i++) {
+ var key = keys[i]
+ if (key !== 'stack' && key !== 'message') {
+ delete error[key]
+ }
+ }
+
+ // replace stack before message for Node.js 0.10 and below
+ error.stack = obj.stack.replace(error.message, obj.message)
+ error.message = obj.message
+
+ return error
+}
+
+/**
+ * Get the simple type checker.
+ *
+ * @param {string} type
+ * @return {function}
+ */
+
+function typeChecker (type) {
+ return function checkType (req) {
+ return Boolean(typeis(req, type))
+ }
+}
diff --git a/node_modules/body-parser/lib/types/raw.js b/node_modules/body-parser/lib/types/raw.js
new file mode 100644
index 0000000..f5d1b67
--- /dev/null
+++ b/node_modules/body-parser/lib/types/raw.js
@@ -0,0 +1,101 @@
+/*!
+ * body-parser
+ * Copyright(c) 2014-2015 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+'use strict'
+
+/**
+ * Module dependencies.
+ */
+
+var bytes = require('bytes')
+var debug = require('debug')('body-parser:raw')
+var read = require('../read')
+var typeis = require('type-is')
+
+/**
+ * Module exports.
+ */
+
+module.exports = raw
+
+/**
+ * Create a middleware to parse raw bodies.
+ *
+ * @param {object} [options]
+ * @return {function}
+ * @api public
+ */
+
+function raw (options) {
+ var opts = options || {}
+
+ var inflate = opts.inflate !== false
+ var limit = typeof opts.limit !== 'number'
+ ? bytes.parse(opts.limit || '100kb')
+ : opts.limit
+ var type = opts.type || 'application/octet-stream'
+ var verify = opts.verify || false
+
+ if (verify !== false && typeof verify !== 'function') {
+ throw new TypeError('option verify must be function')
+ }
+
+ // create the appropriate type checking function
+ var shouldParse = typeof type !== 'function'
+ ? typeChecker(type)
+ : type
+
+ function parse (buf) {
+ return buf
+ }
+
+ return function rawParser (req, res, next) {
+ if (req._body) {
+ debug('body already parsed')
+ next()
+ return
+ }
+
+ req.body = req.body || {}
+
+ // skip requests without bodies
+ if (!typeis.hasBody(req)) {
+ debug('skip empty body')
+ next()
+ return
+ }
+
+ debug('content-type %j', req.headers['content-type'])
+
+ // determine if request should be parsed
+ if (!shouldParse(req)) {
+ debug('skip parsing')
+ next()
+ return
+ }
+
+ // read
+ read(req, res, next, parse, debug, {
+ encoding: null,
+ inflate: inflate,
+ limit: limit,
+ verify: verify
+ })
+ }
+}
+
+/**
+ * Get the simple type checker.
+ *
+ * @param {string} type
+ * @return {function}
+ */
+
+function typeChecker (type) {
+ return function checkType (req) {
+ return Boolean(typeis(req, type))
+ }
+}
diff --git a/node_modules/body-parser/lib/types/text.js b/node_modules/body-parser/lib/types/text.js
new file mode 100644
index 0000000..083a009
--- /dev/null
+++ b/node_modules/body-parser/lib/types/text.js
@@ -0,0 +1,121 @@
+/*!
+ * body-parser
+ * Copyright(c) 2014-2015 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+'use strict'
+
+/**
+ * Module dependencies.
+ */
+
+var bytes = require('bytes')
+var contentType = require('content-type')
+var debug = require('debug')('body-parser:text')
+var read = require('../read')
+var typeis = require('type-is')
+
+/**
+ * Module exports.
+ */
+
+module.exports = text
+
+/**
+ * Create a middleware to parse text bodies.
+ *
+ * @param {object} [options]
+ * @return {function}
+ * @api public
+ */
+
+function text (options) {
+ var opts = options || {}
+
+ var defaultCharset = opts.defaultCharset || 'utf-8'
+ var inflate = opts.inflate !== false
+ var limit = typeof opts.limit !== 'number'
+ ? bytes.parse(opts.limit || '100kb')
+ : opts.limit
+ var type = opts.type || 'text/plain'
+ var verify = opts.verify || false
+
+ if (verify !== false && typeof verify !== 'function') {
+ throw new TypeError('option verify must be function')
+ }
+
+ // create the appropriate type checking function
+ var shouldParse = typeof type !== 'function'
+ ? typeChecker(type)
+ : type
+
+ function parse (buf) {
+ return buf
+ }
+
+ return function textParser (req, res, next) {
+ if (req._body) {
+ debug('body already parsed')
+ next()
+ return
+ }
+
+ req.body = req.body || {}
+
+ // skip requests without bodies
+ if (!typeis.hasBody(req)) {
+ debug('skip empty body')
+ next()
+ return
+ }
+
+ debug('content-type %j', req.headers['content-type'])
+
+ // determine if request should be parsed
+ if (!shouldParse(req)) {
+ debug('skip parsing')
+ next()
+ return
+ }
+
+ // get charset
+ var charset = getCharset(req) || defaultCharset
+
+ // read
+ read(req, res, next, parse, debug, {
+ encoding: charset,
+ inflate: inflate,
+ limit: limit,
+ verify: verify
+ })
+ }
+}
+
+/**
+ * Get the charset of a request.
+ *
+ * @param {object} req
+ * @api private
+ */
+
+function getCharset (req) {
+ try {
+ return (contentType.parse(req).parameters.charset || '').toLowerCase()
+ } catch (e) {
+ return undefined
+ }
+}
+
+/**
+ * Get the simple type checker.
+ *
+ * @param {string} type
+ * @return {function}
+ */
+
+function typeChecker (type) {
+ return function checkType (req) {
+ return Boolean(typeis(req, type))
+ }
+}
diff --git a/node_modules/body-parser/lib/types/urlencoded.js b/node_modules/body-parser/lib/types/urlencoded.js
new file mode 100644
index 0000000..2bd4485
--- /dev/null
+++ b/node_modules/body-parser/lib/types/urlencoded.js
@@ -0,0 +1,307 @@
+/*!
+ * body-parser
+ * Copyright(c) 2014 Jonathan Ong
+ * Copyright(c) 2014-2015 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+'use strict'
+
+/**
+ * Module dependencies.
+ * @private
+ */
+
+var bytes = require('bytes')
+var contentType = require('content-type')
+var createError = require('http-errors')
+var debug = require('debug')('body-parser:urlencoded')
+var deprecate = require('depd')('body-parser')
+var read = require('../read')
+var typeis = require('type-is')
+
+/**
+ * Module exports.
+ */
+
+module.exports = urlencoded
+
+/**
+ * Cache of parser modules.
+ */
+
+var parsers = Object.create(null)
+
+/**
+ * Create a middleware to parse urlencoded bodies.
+ *
+ * @param {object} [options]
+ * @return {function}
+ * @public
+ */
+
+function urlencoded (options) {
+ var opts = options || {}
+
+ // notice because option default will flip in next major
+ if (opts.extended === undefined) {
+ deprecate('undefined extended: provide extended option')
+ }
+
+ var extended = opts.extended !== false
+ var inflate = opts.inflate !== false
+ var limit = typeof opts.limit !== 'number'
+ ? bytes.parse(opts.limit || '100kb')
+ : opts.limit
+ var type = opts.type || 'application/x-www-form-urlencoded'
+ var verify = opts.verify || false
+ var depth = typeof opts.depth !== 'number'
+ ? Number(opts.depth || 32)
+ : opts.depth
+
+ if (verify !== false && typeof verify !== 'function') {
+ throw new TypeError('option verify must be function')
+ }
+
+ // create the appropriate query parser
+ var queryparse = extended
+ ? extendedparser(opts)
+ : simpleparser(opts)
+
+ // create the appropriate type checking function
+ var shouldParse = typeof type !== 'function'
+ ? typeChecker(type)
+ : type
+
+ function parse (body) {
+ return body.length
+ ? queryparse(body)
+ : {}
+ }
+
+ return function urlencodedParser (req, res, next) {
+ if (req._body) {
+ debug('body already parsed')
+ next()
+ return
+ }
+
+ req.body = req.body || {}
+
+ // skip requests without bodies
+ if (!typeis.hasBody(req)) {
+ debug('skip empty body')
+ next()
+ return
+ }
+
+ debug('content-type %j', req.headers['content-type'])
+
+ // determine if request should be parsed
+ if (!shouldParse(req)) {
+ debug('skip parsing')
+ next()
+ return
+ }
+
+ // assert charset
+ var charset = getCharset(req) || 'utf-8'
+ if (charset !== 'utf-8') {
+ debug('invalid charset')
+ next(createError(415, 'unsupported charset "' + charset.toUpperCase() + '"', {
+ charset: charset,
+ type: 'charset.unsupported'
+ }))
+ return
+ }
+
+ // read
+ read(req, res, next, parse, debug, {
+ debug: debug,
+ encoding: charset,
+ inflate: inflate,
+ limit: limit,
+ verify: verify,
+ depth: depth
+ })
+ }
+}
+
+/**
+ * Get the extended query parser.
+ *
+ * @param {object} options
+ */
+
+function extendedparser (options) {
+ var parameterLimit = options.parameterLimit !== undefined
+ ? options.parameterLimit
+ : 1000
+
+ var depth = typeof options.depth !== 'number'
+ ? Number(options.depth || 32)
+ : options.depth
+ var parse = parser('qs')
+
+ if (isNaN(parameterLimit) || parameterLimit < 1) {
+ throw new TypeError('option parameterLimit must be a positive number')
+ }
+
+ if (isNaN(depth) || depth < 0) {
+ throw new TypeError('option depth must be a zero or a positive number')
+ }
+
+ if (isFinite(parameterLimit)) {
+ parameterLimit = parameterLimit | 0
+ }
+
+ return function queryparse (body) {
+ var paramCount = parameterCount(body, parameterLimit)
+
+ if (paramCount === undefined) {
+ debug('too many parameters')
+ throw createError(413, 'too many parameters', {
+ type: 'parameters.too.many'
+ })
+ }
+
+ var arrayLimit = Math.max(100, paramCount)
+
+ debug('parse extended urlencoding')
+ try {
+ return parse(body, {
+ allowPrototypes: true,
+ arrayLimit: arrayLimit,
+ depth: depth,
+ strictDepth: true,
+ parameterLimit: parameterLimit
+ })
+ } catch (err) {
+ if (err instanceof RangeError) {
+ throw createError(400, 'The input exceeded the depth', {
+ type: 'querystring.parse.rangeError'
+ })
+ } else {
+ throw err
+ }
+ }
+ }
+}
+
+/**
+ * Get the charset of a request.
+ *
+ * @param {object} req
+ * @api private
+ */
+
+function getCharset (req) {
+ try {
+ return (contentType.parse(req).parameters.charset || '').toLowerCase()
+ } catch (e) {
+ return undefined
+ }
+}
+
+/**
+ * Count the number of parameters, stopping once limit reached
+ *
+ * @param {string} body
+ * @param {number} limit
+ * @api private
+ */
+
+function parameterCount (body, limit) {
+ var count = 0
+ var index = 0
+
+ while ((index = body.indexOf('&', index)) !== -1) {
+ count++
+ index++
+
+ if (count === limit) {
+ return undefined
+ }
+ }
+
+ return count
+}
+
+/**
+ * Get parser for module name dynamically.
+ *
+ * @param {string} name
+ * @return {function}
+ * @api private
+ */
+
+function parser (name) {
+ var mod = parsers[name]
+
+ if (mod !== undefined) {
+ return mod.parse
+ }
+
+ // this uses a switch for static require analysis
+ switch (name) {
+ case 'qs':
+ mod = require('qs')
+ break
+ case 'querystring':
+ mod = require('querystring')
+ break
+ }
+
+ // store to prevent invoking require()
+ parsers[name] = mod
+
+ return mod.parse
+}
+
+/**
+ * Get the simple query parser.
+ *
+ * @param {object} options
+ */
+
+function simpleparser (options) {
+ var parameterLimit = options.parameterLimit !== undefined
+ ? options.parameterLimit
+ : 1000
+ var parse = parser('querystring')
+
+ if (isNaN(parameterLimit) || parameterLimit < 1) {
+ throw new TypeError('option parameterLimit must be a positive number')
+ }
+
+ if (isFinite(parameterLimit)) {
+ parameterLimit = parameterLimit | 0
+ }
+
+ return function queryparse (body) {
+ var paramCount = parameterCount(body, parameterLimit)
+
+ if (paramCount === undefined) {
+ debug('too many parameters')
+ throw createError(413, 'too many parameters', {
+ type: 'parameters.too.many'
+ })
+ }
+
+ debug('parse urlencoding')
+ return parse(body, undefined, undefined, { maxKeys: parameterLimit })
+ }
+}
+
+/**
+ * Get the simple type checker.
+ *
+ * @param {string} type
+ * @return {function}
+ */
+
+function typeChecker (type) {
+ return function checkType (req) {
+ return Boolean(typeis(req, type))
+ }
+}
diff --git a/node_modules/body-parser/package.json b/node_modules/body-parser/package.json
new file mode 100644
index 0000000..3c9926f
--- /dev/null
+++ b/node_modules/body-parser/package.json
@@ -0,0 +1,56 @@
+{
+ "name": "body-parser",
+ "description": "Node.js body parsing middleware",
+ "version": "1.20.3",
+ "contributors": [
+ "Douglas Christopher Wilson ",
+ "Jonathan Ong (http://jongleberry.com)"
+ ],
+ "license": "MIT",
+ "repository": "expressjs/body-parser",
+ "dependencies": {
+ "bytes": "3.1.2",
+ "content-type": "~1.0.5",
+ "debug": "2.6.9",
+ "depd": "2.0.0",
+ "destroy": "1.2.0",
+ "http-errors": "2.0.0",
+ "iconv-lite": "0.4.24",
+ "on-finished": "2.4.1",
+ "qs": "6.13.0",
+ "raw-body": "2.5.2",
+ "type-is": "~1.6.18",
+ "unpipe": "1.0.0"
+ },
+ "devDependencies": {
+ "eslint": "8.34.0",
+ "eslint-config-standard": "14.1.1",
+ "eslint-plugin-import": "2.27.5",
+ "eslint-plugin-markdown": "3.0.0",
+ "eslint-plugin-node": "11.1.0",
+ "eslint-plugin-promise": "6.1.1",
+ "eslint-plugin-standard": "4.1.0",
+ "methods": "1.1.2",
+ "mocha": "10.2.0",
+ "nyc": "15.1.0",
+ "safe-buffer": "5.2.1",
+ "supertest": "6.3.3"
+ },
+ "files": [
+ "lib/",
+ "LICENSE",
+ "HISTORY.md",
+ "SECURITY.md",
+ "index.js"
+ ],
+ "engines": {
+ "node": ">= 0.8",
+ "npm": "1.2.8000 || >= 1.4.16"
+ },
+ "scripts": {
+ "lint": "eslint .",
+ "test": "mocha --require test/support/env --reporter spec --check-leaks --bail test/",
+ "test-ci": "nyc --reporter=lcov --reporter=text npm test",
+ "test-cov": "nyc --reporter=html --reporter=text npm test"
+ }
+}
diff --git a/node_modules/buffer-equal-constant-time/.npmignore b/node_modules/buffer-equal-constant-time/.npmignore
new file mode 100644
index 0000000..34e4f5c
--- /dev/null
+++ b/node_modules/buffer-equal-constant-time/.npmignore
@@ -0,0 +1,2 @@
+.*.sw[mnop]
+node_modules/
diff --git a/node_modules/buffer-equal-constant-time/.travis.yml b/node_modules/buffer-equal-constant-time/.travis.yml
new file mode 100644
index 0000000..78e1c01
--- /dev/null
+++ b/node_modules/buffer-equal-constant-time/.travis.yml
@@ -0,0 +1,4 @@
+language: node_js
+node_js:
+- "0.11"
+- "0.10"
diff --git a/node_modules/buffer-equal-constant-time/LICENSE.txt b/node_modules/buffer-equal-constant-time/LICENSE.txt
new file mode 100644
index 0000000..9a064f3
--- /dev/null
+++ b/node_modules/buffer-equal-constant-time/LICENSE.txt
@@ -0,0 +1,12 @@
+Copyright (c) 2013, GoInstant Inc., a salesforce.com company
+All rights reserved.
+
+Redistribution and use in source and binary forms, with or without modification, are permitted provided that the following conditions are met:
+
+* Redistributions of source code must retain the above copyright notice, this list of conditions and the following disclaimer.
+
+* Redistributions in binary form must reproduce the above copyright notice, this list of conditions and the following disclaimer in the documentation and/or other materials provided with the distribution.
+
+* Neither the name of salesforce.com, nor GoInstant, nor the names of its contributors may be used to endorse or promote products derived from this software without specific prior written permission.
+
+THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
diff --git a/node_modules/buffer-equal-constant-time/README.md b/node_modules/buffer-equal-constant-time/README.md
new file mode 100644
index 0000000..4f227f5
--- /dev/null
+++ b/node_modules/buffer-equal-constant-time/README.md
@@ -0,0 +1,50 @@
+# buffer-equal-constant-time
+
+Constant-time `Buffer` comparison for node.js. Should work with browserify too.
+
+[](https://travis-ci.org/goinstant/buffer-equal-constant-time)
+
+```sh
+ npm install buffer-equal-constant-time
+```
+
+# Usage
+
+```js
+ var bufferEq = require('buffer-equal-constant-time');
+
+ var a = new Buffer('asdf');
+ var b = new Buffer('asdf');
+ if (bufferEq(a,b)) {
+ // the same!
+ } else {
+ // different in at least one byte!
+ }
+```
+
+If you'd like to install an `.equal()` method onto the node.js `Buffer` and
+`SlowBuffer` prototypes:
+
+```js
+ require('buffer-equal-constant-time').install();
+
+ var a = new Buffer('asdf');
+ var b = new Buffer('asdf');
+ if (a.equal(b)) {
+ // the same!
+ } else {
+ // different in at least one byte!
+ }
+```
+
+To get rid of the installed `.equal()` method, call `.restore()`:
+
+```js
+ require('buffer-equal-constant-time').restore();
+```
+
+# Legal
+
+© 2013 GoInstant Inc., a salesforce.com company
+
+Licensed under the BSD 3-clause license.
diff --git a/node_modules/buffer-equal-constant-time/index.js b/node_modules/buffer-equal-constant-time/index.js
new file mode 100644
index 0000000..5462c1f
--- /dev/null
+++ b/node_modules/buffer-equal-constant-time/index.js
@@ -0,0 +1,41 @@
+/*jshint node:true */
+'use strict';
+var Buffer = require('buffer').Buffer; // browserify
+var SlowBuffer = require('buffer').SlowBuffer;
+
+module.exports = bufferEq;
+
+function bufferEq(a, b) {
+
+ // shortcutting on type is necessary for correctness
+ if (!Buffer.isBuffer(a) || !Buffer.isBuffer(b)) {
+ return false;
+ }
+
+ // buffer sizes should be well-known information, so despite this
+ // shortcutting, it doesn't leak any information about the *contents* of the
+ // buffers.
+ if (a.length !== b.length) {
+ return false;
+ }
+
+ var c = 0;
+ for (var i = 0; i < a.length; i++) {
+ /*jshint bitwise:false */
+ c |= a[i] ^ b[i]; // XOR
+ }
+ return c === 0;
+}
+
+bufferEq.install = function() {
+ Buffer.prototype.equal = SlowBuffer.prototype.equal = function equal(that) {
+ return bufferEq(this, that);
+ };
+};
+
+var origBufEqual = Buffer.prototype.equal;
+var origSlowBufEqual = SlowBuffer.prototype.equal;
+bufferEq.restore = function() {
+ Buffer.prototype.equal = origBufEqual;
+ SlowBuffer.prototype.equal = origSlowBufEqual;
+};
diff --git a/node_modules/buffer-equal-constant-time/package.json b/node_modules/buffer-equal-constant-time/package.json
new file mode 100644
index 0000000..17c7de2
--- /dev/null
+++ b/node_modules/buffer-equal-constant-time/package.json
@@ -0,0 +1,21 @@
+{
+ "name": "buffer-equal-constant-time",
+ "version": "1.0.1",
+ "description": "Constant-time comparison of Buffers",
+ "main": "index.js",
+ "scripts": {
+ "test": "mocha test.js"
+ },
+ "repository": "git@github.com:goinstant/buffer-equal-constant-time.git",
+ "keywords": [
+ "buffer",
+ "equal",
+ "constant-time",
+ "crypto"
+ ],
+ "author": "GoInstant Inc., a salesforce.com company",
+ "license": "BSD-3-Clause",
+ "devDependencies": {
+ "mocha": "~1.15.1"
+ }
+}
diff --git a/node_modules/buffer-equal-constant-time/test.js b/node_modules/buffer-equal-constant-time/test.js
new file mode 100644
index 0000000..0bc972d
--- /dev/null
+++ b/node_modules/buffer-equal-constant-time/test.js
@@ -0,0 +1,42 @@
+/*jshint node:true */
+'use strict';
+
+var bufferEq = require('./index');
+var assert = require('assert');
+
+describe('buffer-equal-constant-time', function() {
+ var a = new Buffer('asdfasdf123456');
+ var b = new Buffer('asdfasdf123456');
+ var c = new Buffer('asdfasdf');
+
+ describe('bufferEq', function() {
+ it('says a == b', function() {
+ assert.strictEqual(bufferEq(a, b), true);
+ });
+
+ it('says a != c', function() {
+ assert.strictEqual(bufferEq(a, c), false);
+ });
+ });
+
+ describe('install/restore', function() {
+ before(function() {
+ bufferEq.install();
+ });
+ after(function() {
+ bufferEq.restore();
+ });
+
+ it('installed an .equal method', function() {
+ var SlowBuffer = require('buffer').SlowBuffer;
+ assert.ok(Buffer.prototype.equal);
+ assert.ok(SlowBuffer.prototype.equal);
+ });
+
+ it('infected existing Buffers', function() {
+ assert.strictEqual(a.equal(b), true);
+ assert.strictEqual(a.equal(c), false);
+ });
+ });
+
+});
diff --git a/node_modules/bytes/History.md b/node_modules/bytes/History.md
new file mode 100644
index 0000000..d60ce0e
--- /dev/null
+++ b/node_modules/bytes/History.md
@@ -0,0 +1,97 @@
+3.1.2 / 2022-01-27
+==================
+
+ * Fix return value for un-parsable strings
+
+3.1.1 / 2021-11-15
+==================
+
+ * Fix "thousandsSeparator" incorrecting formatting fractional part
+
+3.1.0 / 2019-01-22
+==================
+
+ * Add petabyte (`pb`) support
+
+3.0.0 / 2017-08-31
+==================
+
+ * Change "kB" to "KB" in format output
+ * Remove support for Node.js 0.6
+ * Remove support for ComponentJS
+
+2.5.0 / 2017-03-24
+==================
+
+ * Add option "unit"
+
+2.4.0 / 2016-06-01
+==================
+
+ * Add option "unitSeparator"
+
+2.3.0 / 2016-02-15
+==================
+
+ * Drop partial bytes on all parsed units
+ * Fix non-finite numbers to `.format` to return `null`
+ * Fix parsing byte string that looks like hex
+ * perf: hoist regular expressions
+
+2.2.0 / 2015-11-13
+==================
+
+ * add option "decimalPlaces"
+ * add option "fixedDecimals"
+
+2.1.0 / 2015-05-21
+==================
+
+ * add `.format` export
+ * add `.parse` export
+
+2.0.2 / 2015-05-20
+==================
+
+ * remove map recreation
+ * remove unnecessary object construction
+
+2.0.1 / 2015-05-07
+==================
+
+ * fix browserify require
+ * remove node.extend dependency
+
+2.0.0 / 2015-04-12
+==================
+
+ * add option "case"
+ * add option "thousandsSeparator"
+ * return "null" on invalid parse input
+ * support proper round-trip: bytes(bytes(num)) === num
+ * units no longer case sensitive when parsing
+
+1.0.0 / 2014-05-05
+==================
+
+ * add negative support. fixes #6
+
+0.3.0 / 2014-03-19
+==================
+
+ * added terabyte support
+
+0.2.1 / 2013-04-01
+==================
+
+ * add .component
+
+0.2.0 / 2012-10-28
+==================
+
+ * bytes(200).should.eql('200b')
+
+0.1.0 / 2012-07-04
+==================
+
+ * add bytes to string conversion [yields]
diff --git a/node_modules/bytes/LICENSE b/node_modules/bytes/LICENSE
new file mode 100644
index 0000000..63e95a9
--- /dev/null
+++ b/node_modules/bytes/LICENSE
@@ -0,0 +1,23 @@
+(The MIT License)
+
+Copyright (c) 2012-2014 TJ Holowaychuk
+Copyright (c) 2015 Jed Watson
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/node_modules/bytes/Readme.md b/node_modules/bytes/Readme.md
new file mode 100644
index 0000000..5790e23
--- /dev/null
+++ b/node_modules/bytes/Readme.md
@@ -0,0 +1,152 @@
+# Bytes utility
+
+[![NPM Version][npm-image]][npm-url]
+[![NPM Downloads][downloads-image]][downloads-url]
+[![Build Status][ci-image]][ci-url]
+[![Test Coverage][coveralls-image]][coveralls-url]
+
+Utility to parse a string bytes (ex: `1TB`) to bytes (`1099511627776`) and vice-versa.
+
+## Installation
+
+This is a [Node.js](https://nodejs.org/en/) module available through the
+[npm registry](https://www.npmjs.com/). Installation is done using the
+[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally):
+
+```bash
+$ npm install bytes
+```
+
+## Usage
+
+```js
+var bytes = require('bytes');
+```
+
+#### bytes(number｜string value, [options]): number｜string｜null
+
+Default export function. Delegates to either `bytes.format` or `bytes.parse` based on the type of `value`.
+
+**Arguments**
+
+| Name | Type | Description |
+|---------|----------|--------------------|
+| value | `number`｜`string` | Number value to format or string value to parse |
+| options | `Object` | Conversion options for `format` |
+
+**Returns**
+
+| Name | Type | Description |
+|---------|------------------|-------------------------------------------------|
+| results | `string`｜`number`｜`null` | Return null upon error. Numeric value in bytes, or string value otherwise. |
+
+**Example**
+
+```js
+bytes(1024);
+// output: '1KB'
+
+bytes('1KB');
+// output: 1024
+```
+
+#### bytes.format(number value, [options]): string｜null
+
+Format the given value in bytes into a string. If the value is negative, it is kept as such. If it is a float, it is
+ rounded.
+
+**Arguments**
+
+| Name | Type | Description |
+|---------|----------|--------------------|
+| value | `number` | Value in bytes |
+| options | `Object` | Conversion options |
+
+**Options**
+
+| Property | Type | Description |
+|-------------------|--------|-----------------------------------------------------------------------------------------|
+| decimalPlaces | `number`｜`null` | Maximum number of decimal places to include in output. Default value to `2`. |
+| fixedDecimals | `boolean`｜`null` | Whether to always display the maximum number of decimal places. Default value to `false` |
+| thousandsSeparator | `string`｜`null` | Example of values: `' '`, `','` and `'.'`... Default value to `''`. |
+| unit | `string`｜`null` | The unit in which the result will be returned (B/KB/MB/GB/TB). Default value to `''` (which means auto detect). |
+| unitSeparator | `string`｜`null` | Separator to use between number and unit. Default value to `''`. |
+
+**Returns**
+
+| Name | Type | Description |
+|---------|------------------|-------------------------------------------------|
+| results | `string`｜`null` | Return null upon error. String value otherwise. |
+
+**Example**
+
+```js
+bytes.format(1024);
+// output: '1KB'
+
+bytes.format(1000);
+// output: '1000B'
+
+bytes.format(1000, {thousandsSeparator: ' '});
+// output: '1 000B'
+
+bytes.format(1024 * 1.7, {decimalPlaces: 0});
+// output: '2KB'
+
+bytes.format(1024, {unitSeparator: ' '});
+// output: '1 KB'
+```
+
+#### bytes.parse(string｜number value): number｜null
+
+Parse the string value into an integer in bytes. If no unit is given, or `value`
+is a number, it is assumed the value is in bytes.
+
+Supported units and abbreviations are as follows and are case-insensitive:
+
+ * `b` for bytes
+ * `kb` for kilobytes
+ * `mb` for megabytes
+ * `gb` for gigabytes
+ * `tb` for terabytes
+ * `pb` for petabytes
+
+The units are in powers of two, not ten. This means 1kb = 1024b according to this parser.
+
+**Arguments**
+
+| Name | Type | Description |
+|---------------|--------|--------------------|
+| value | `string`｜`number` | String to parse, or number in bytes. |
+
+**Returns**
+
+| Name | Type | Description |
+|---------|-------------|-------------------------|
+| results | `number`｜`null` | Return null upon error. Value in bytes otherwise. |
+
+**Example**
+
+```js
+bytes.parse('1KB');
+// output: 1024
+
+bytes.parse('1024');
+// output: 1024
+
+bytes.parse(1024);
+// output: 1024
+```
+
+## License
+
+[MIT](LICENSE)
+
+[ci-image]: https://badgen.net/github/checks/visionmedia/bytes.js/master?label=ci
+[ci-url]: https://github.com/visionmedia/bytes.js/actions?query=workflow%3Aci
+[coveralls-image]: https://badgen.net/coveralls/c/github/visionmedia/bytes.js/master
+[coveralls-url]: https://coveralls.io/r/visionmedia/bytes.js?branch=master
+[downloads-image]: https://badgen.net/npm/dm/bytes
+[downloads-url]: https://npmjs.org/package/bytes
+[npm-image]: https://badgen.net/npm/v/bytes
+[npm-url]: https://npmjs.org/package/bytes
diff --git a/node_modules/bytes/index.js b/node_modules/bytes/index.js
new file mode 100644
index 0000000..6f2d0f8
--- /dev/null
+++ b/node_modules/bytes/index.js
@@ -0,0 +1,170 @@
+/*!
+ * bytes
+ * Copyright(c) 2012-2014 TJ Holowaychuk
+ * Copyright(c) 2015 Jed Watson
+ * MIT Licensed
+ */
+
+'use strict';
+
+/**
+ * Module exports.
+ * @public
+ */
+
+module.exports = bytes;
+module.exports.format = format;
+module.exports.parse = parse;
+
+/**
+ * Module variables.
+ * @private
+ */
+
+var formatThousandsRegExp = /\B(?=(\d{3})+(?!\d))/g;
+
+var formatDecimalsRegExp = /(?:\.0*|(\.[^0]+)0+)$/;
+
+var map = {
+ b: 1,
+ kb: 1 << 10,
+ mb: 1 << 20,
+ gb: 1 << 30,
+ tb: Math.pow(1024, 4),
+ pb: Math.pow(1024, 5),
+};
+
+var parseRegExp = /^((-|\+)?(\d+(?:\.\d+)?)) *(kb|mb|gb|tb|pb)$/i;
+
+/**
+ * Convert the given value in bytes into a string or parse to string to an integer in bytes.
+ *
+ * @param {string|number} value
+ * @param {{
+ * case: [string],
+ * decimalPlaces: [number]
+ * fixedDecimals: [boolean]
+ * thousandsSeparator: [string]
+ * unitSeparator: [string]
+ * }} [options] bytes options.
+ *
+ * @returns {string|number|null}
+ */
+
+function bytes(value, options) {
+ if (typeof value === 'string') {
+ return parse(value);
+ }
+
+ if (typeof value === 'number') {
+ return format(value, options);
+ }
+
+ return null;
+}
+
+/**
+ * Format the given value in bytes into a string.
+ *
+ * If the value is negative, it is kept as such. If it is a float,
+ * it is rounded.
+ *
+ * @param {number} value
+ * @param {object} [options]
+ * @param {number} [options.decimalPlaces=2]
+ * @param {number} [options.fixedDecimals=false]
+ * @param {string} [options.thousandsSeparator=]
+ * @param {string} [options.unit=]
+ * @param {string} [options.unitSeparator=]
+ *
+ * @returns {string|null}
+ * @public
+ */
+
+function format(value, options) {
+ if (!Number.isFinite(value)) {
+ return null;
+ }
+
+ var mag = Math.abs(value);
+ var thousandsSeparator = (options && options.thousandsSeparator) || '';
+ var unitSeparator = (options && options.unitSeparator) || '';
+ var decimalPlaces = (options && options.decimalPlaces !== undefined) ? options.decimalPlaces : 2;
+ var fixedDecimals = Boolean(options && options.fixedDecimals);
+ var unit = (options && options.unit) || '';
+
+ if (!unit || !map[unit.toLowerCase()]) {
+ if (mag >= map.pb) {
+ unit = 'PB';
+ } else if (mag >= map.tb) {
+ unit = 'TB';
+ } else if (mag >= map.gb) {
+ unit = 'GB';
+ } else if (mag >= map.mb) {
+ unit = 'MB';
+ } else if (mag >= map.kb) {
+ unit = 'KB';
+ } else {
+ unit = 'B';
+ }
+ }
+
+ var val = value / map[unit.toLowerCase()];
+ var str = val.toFixed(decimalPlaces);
+
+ if (!fixedDecimals) {
+ str = str.replace(formatDecimalsRegExp, '$1');
+ }
+
+ if (thousandsSeparator) {
+ str = str.split('.').map(function (s, i) {
+ return i === 0
+ ? s.replace(formatThousandsRegExp, thousandsSeparator)
+ : s
+ }).join('.');
+ }
+
+ return str + unitSeparator + unit;
+}
+
+/**
+ * Parse the string value into an integer in bytes.
+ *
+ * If no unit is given, it is assumed the value is in bytes.
+ *
+ * @param {number|string} val
+ *
+ * @returns {number|null}
+ * @public
+ */
+
+function parse(val) {
+ if (typeof val === 'number' && !isNaN(val)) {
+ return val;
+ }
+
+ if (typeof val !== 'string') {
+ return null;
+ }
+
+ // Test if the string passed is valid
+ var results = parseRegExp.exec(val);
+ var floatValue;
+ var unit = 'b';
+
+ if (!results) {
+ // Nothing could be extracted from the given string
+ floatValue = parseInt(val, 10);
+ unit = 'b'
+ } else {
+ // Retrieve the value and the unit
+ floatValue = parseFloat(results[1]);
+ unit = results[4].toLowerCase();
+ }
+
+ if (isNaN(floatValue)) {
+ return null;
+ }
+
+ return Math.floor(map[unit] * floatValue);
+}
diff --git a/node_modules/bytes/package.json b/node_modules/bytes/package.json
new file mode 100644
index 0000000..f2b6a8b
--- /dev/null
+++ b/node_modules/bytes/package.json
@@ -0,0 +1,42 @@
+{
+ "name": "bytes",
+ "description": "Utility to parse a string bytes to bytes and vice-versa",
+ "version": "3.1.2",
+ "author": "TJ Holowaychuk (http://tjholowaychuk.com)",
+ "contributors": [
+ "Jed Watson ",
+ "Théo FIDRY "
+ ],
+ "license": "MIT",
+ "keywords": [
+ "byte",
+ "bytes",
+ "utility",
+ "parse",
+ "parser",
+ "convert",
+ "converter"
+ ],
+ "repository": "visionmedia/bytes.js",
+ "devDependencies": {
+ "eslint": "7.32.0",
+ "eslint-plugin-markdown": "2.2.1",
+ "mocha": "9.2.0",
+ "nyc": "15.1.0"
+ },
+ "files": [
+ "History.md",
+ "LICENSE",
+ "Readme.md",
+ "index.js"
+ ],
+ "engines": {
+ "node": ">= 0.8"
+ },
+ "scripts": {
+ "lint": "eslint .",
+ "test": "mocha --check-leaks --reporter spec",
+ "test-ci": "nyc --reporter=lcov --reporter=text npm test",
+ "test-cov": "nyc --reporter=html --reporter=text npm test"
+ }
+}
diff --git a/node_modules/call-bind/.eslintignore b/node_modules/call-bind/.eslintignore
new file mode 100644
index 0000000..404abb2
--- /dev/null
+++ b/node_modules/call-bind/.eslintignore
@@ -0,0 +1 @@
+coverage/
diff --git a/node_modules/call-bind/.eslintrc b/node_modules/call-bind/.eslintrc
new file mode 100644
index 0000000..dfa9a6c
--- /dev/null
+++ b/node_modules/call-bind/.eslintrc
@@ -0,0 +1,16 @@
+{
+ "root": true,
+
+ "extends": "@ljharb",
+
+ "rules": {
+ "func-name-matching": 0,
+ "id-length": 0,
+ "new-cap": [2, {
+ "capIsNewExceptions": [
+ "GetIntrinsic",
+ ],
+ }],
+ "no-magic-numbers": 0,
+ },
+}
diff --git a/node_modules/call-bind/.github/FUNDING.yml b/node_modules/call-bind/.github/FUNDING.yml
new file mode 100644
index 0000000..c70c2ec
--- /dev/null
+++ b/node_modules/call-bind/.github/FUNDING.yml
@@ -0,0 +1,12 @@
+# These are supported funding model platforms
+
+github: [ljharb]
+patreon: # Replace with a single Patreon username
+open_collective: # Replace with a single Open Collective username
+ko_fi: # Replace with a single Ko-fi username
+tidelift: npm/call-bind
+community_bridge: # Replace with a single Community Bridge project-name e.g., cloud-foundry
+liberapay: # Replace with a single Liberapay username
+issuehunt: # Replace with a single IssueHunt username
+otechie: # Replace with a single Otechie username
+custom: # Replace with up to 4 custom sponsorship URLs e.g., ['link1', 'link2']
diff --git a/node_modules/call-bind/.nycrc b/node_modules/call-bind/.nycrc
new file mode 100644
index 0000000..bdd626c
--- /dev/null
+++ b/node_modules/call-bind/.nycrc
@@ -0,0 +1,9 @@
+{
+ "all": true,
+ "check-coverage": false,
+ "reporter": ["text-summary", "text", "html", "json"],
+ "exclude": [
+ "coverage",
+ "test"
+ ]
+}
diff --git a/node_modules/call-bind/CHANGELOG.md b/node_modules/call-bind/CHANGELOG.md
new file mode 100644
index 0000000..c653f70
--- /dev/null
+++ b/node_modules/call-bind/CHANGELOG.md
@@ -0,0 +1,93 @@
+# Changelog
+
+All notable changes to this project will be documented in this file.
+
+The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.0.0/)
+and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0.html).
+
+## [v1.0.7](https://github.com/ljharb/call-bind/compare/v1.0.6...v1.0.7) - 2024-02-12
+
+### Commits
+
+- [Refactor] use `es-define-property` [`09b76a0`](https://github.com/ljharb/call-bind/commit/09b76a01634440461d44a80c9924ec4b500f3b03)
+- [Deps] update `get-intrinsic`, `set-function-length` [`ad5136d`](https://github.com/ljharb/call-bind/commit/ad5136ddda2a45c590959829ad3dce0c9f4e3590)
+
+## [v1.0.6](https://github.com/ljharb/call-bind/compare/v1.0.5...v1.0.6) - 2024-02-05
+
+### Commits
+
+- [Dev Deps] update `aud`, `npmignore`, `tape` [`d564d5c`](https://github.com/ljharb/call-bind/commit/d564d5ce3e06a19df4d499c77f8d1a9da44e77aa)
+- [Deps] update `get-intrinsic`, `set-function-length` [`cfc2bdc`](https://github.com/ljharb/call-bind/commit/cfc2bdca7b633df0e0e689e6b637f668f1c6792e)
+- [Refactor] use `es-errors`, so things that only need those do not need `get-intrinsic` [`64cd289`](https://github.com/ljharb/call-bind/commit/64cd289ae5862c250a4ca80aa8d461047c166af5)
+- [meta] add missing `engines.node` [`32a4038`](https://github.com/ljharb/call-bind/commit/32a4038857b62179f7f9b7b3df2c5260036be582)
+
+## [v1.0.5](https://github.com/ljharb/call-bind/compare/v1.0.4...v1.0.5) - 2023-10-19
+
+### Commits
+
+- [Fix] throw an error on non-functions as early as possible [`f262408`](https://github.com/ljharb/call-bind/commit/f262408f822c840fbc268080f3ad7c429611066d)
+- [Deps] update `set-function-length` [`3fff271`](https://github.com/ljharb/call-bind/commit/3fff27145a1e3a76a5b74f1d7c3c43d0fa3b9871)
+
+## [v1.0.4](https://github.com/ljharb/call-bind/compare/v1.0.3...v1.0.4) - 2023-10-19
+
+## [v1.0.3](https://github.com/ljharb/call-bind/compare/v1.0.2...v1.0.3) - 2023-10-19
+
+### Commits
+
+- [actions] reuse common workflows [`a994df6`](https://github.com/ljharb/call-bind/commit/a994df69f401f4bf735a4ccd77029b85d1549453)
+- [meta] use `npmignore` to autogenerate an npmignore file [`eef3ef2`](https://github.com/ljharb/call-bind/commit/eef3ef21e1f002790837fedb8af2679c761fbdf5)
+- [readme] flesh out content [`1845ccf`](https://github.com/ljharb/call-bind/commit/1845ccfd9976a607884cfc7157c93192cc16cf22)
+- [actions] use `node/install` instead of `node/run`; use `codecov` action [`5b47d53`](https://github.com/ljharb/call-bind/commit/5b47d53d2fd74af5ea0a44f1d51e503cd42f7a90)
+- [Refactor] use `set-function-length` [`a0e165c`](https://github.com/ljharb/call-bind/commit/a0e165c5dc61db781cbc919b586b1c2b8da0b150)
+- [Dev Deps] update `@ljharb/eslint-config`, `aud`, `tape` [`9c50103`](https://github.com/ljharb/call-bind/commit/9c50103f44137279a817317cf6cc421a658f85b4)
+- [meta] simplify "exports" [`019c6d0`](https://github.com/ljharb/call-bind/commit/019c6d06b0e1246ceed8e579f57e44441cbbf6d9)
+- [Dev Deps] update `eslint`, `@ljharb/eslint-config`, `aud`, `auto-changelog`, `safe-publish-latest`, `tape` [`23bd718`](https://github.com/ljharb/call-bind/commit/23bd718a288d3b03042062b4ef5153b3cea83f11)
+- [actions] update codecov uploader [`62552d7`](https://github.com/ljharb/call-bind/commit/62552d79cc79e05825e99aaba134ae5b37f33da5)
+- [Dev Deps] update `eslint`, `@ljharb/eslint-config`, `aud`, `auto-changelog`, `tape` [`ec81665`](https://github.com/ljharb/call-bind/commit/ec81665b300f87eabff597afdc8b8092adfa7afd)
+- [Dev Deps] update `eslint`, `@ljharb/eslint-config`, `safe-publish-latest`, `tape` [`35d67fc`](https://github.com/ljharb/call-bind/commit/35d67fcea883e686650f736f61da5ddca2592de8)
+- [Dev Deps] update `eslint`, `@ljharb/eslint-config`, `aud`, `tape` [`0266d8d`](https://github.com/ljharb/call-bind/commit/0266d8d2a45086a922db366d0c2932fa463662ff)
+- [Dev Deps] update `@ljharb/eslint-config`, `aud`, `tape` [`43a5b28`](https://github.com/ljharb/call-bind/commit/43a5b28a444e710e1bbf92adb8afb5cf7523a223)
+- [Deps] update `define-data-property`, `function-bind`, `get-intrinsic` [`780eb36`](https://github.com/ljharb/call-bind/commit/780eb36552514f8cc99c70821ce698697c2726a5)
+- [Dev Deps] update `aud`, `tape` [`90d50ad`](https://github.com/ljharb/call-bind/commit/90d50ad03b061e0268b3380b0065fcaec183dc05)
+- [meta] use `prepublishOnly` script for npm 7+ [`44c5433`](https://github.com/ljharb/call-bind/commit/44c5433b7980e02b4870007046407cf6fc543329)
+- [Deps] update `get-intrinsic` [`86bfbfc`](https://github.com/ljharb/call-bind/commit/86bfbfcf34afdc6eabc93ce3d408548d0e27d958)
+- [Deps] update `get-intrinsic` [`5c53354`](https://github.com/ljharb/call-bind/commit/5c5335489be0294c18cd7a8bb6e08226ee019ff5)
+- [actions] update checkout action [`4c393a8`](https://github.com/ljharb/call-bind/commit/4c393a8173b3c8e5b30d5b3297b3b94d48bf87f3)
+- [Deps] update `get-intrinsic` [`4e70bde`](https://github.com/ljharb/call-bind/commit/4e70bdec0626acb11616d66250fc14565e716e91)
+- [Deps] update `get-intrinsic` [`55ae803`](https://github.com/ljharb/call-bind/commit/55ae803a920bd93c369cd798c20de31f91e9fc60)
+
+## [v1.0.2](https://github.com/ljharb/call-bind/compare/v1.0.1...v1.0.2) - 2021-01-11
+
+### Commits
+
+- [Fix] properly include the receiver in the bound length [`dbae7bc`](https://github.com/ljharb/call-bind/commit/dbae7bc676c079a0d33c0a43e9ef92cb7b01345d)
+
+## [v1.0.1](https://github.com/ljharb/call-bind/compare/v1.0.0...v1.0.1) - 2021-01-08
+
+### Commits
+
+- [Tests] migrate tests to Github Actions [`b6db284`](https://github.com/ljharb/call-bind/commit/b6db284c36f8ccd195b88a6764fe84b7223a0da1)
+- [meta] do not publish github action workflow files [`ec7fe46`](https://github.com/ljharb/call-bind/commit/ec7fe46e60cfa4764ee943d2755f5e5a366e578e)
+- [Fix] preserve original function’s length when possible [`adbceaa`](https://github.com/ljharb/call-bind/commit/adbceaa3cac4b41ea78bb19d7ccdbaaf7e0bdadb)
+- [Tests] gather coverage data on every job [`d69e23c`](https://github.com/ljharb/call-bind/commit/d69e23cc65f101ba1d4c19bb07fa8eb0ec624be8)
+- [Dev Deps] update `eslint`, `@ljharb/eslint-config`, `aud`, `tape` [`2fd3586`](https://github.com/ljharb/call-bind/commit/2fd3586c5d47b335364c14293114c6b625ae1f71)
+- [Deps] update `get-intrinsic` [`f23e931`](https://github.com/ljharb/call-bind/commit/f23e9318cc271c2add8bb38cfded85ee7baf8eee)
+- [Deps] update `get-intrinsic` [`72d9f44`](https://github.com/ljharb/call-bind/commit/72d9f44e184465ba8dd3fb48260bbcff234985f2)
+- [meta] fix FUNDING.yml [`e723573`](https://github.com/ljharb/call-bind/commit/e723573438c5a68dcec31fb5d96ea6b7e4a93be8)
+- [eslint] ignore coverage output [`15e76d2`](https://github.com/ljharb/call-bind/commit/15e76d28a5f43e504696401e5b31ebb78ee1b532)
+- [meta] add Automatic Rebase and Require Allow Edits workflows [`8fa4dab`](https://github.com/ljharb/call-bind/commit/8fa4dabb23ba3dd7bb92c9571c1241c08b56e4b6)
+
+## v1.0.0 - 2020-10-30
+
+### Commits
+
+- Initial commit [`306cf98`](https://github.com/ljharb/call-bind/commit/306cf98c7ec9e7ef66b653ec152277ac1381eb50)
+- Tests [`e10d0bb`](https://github.com/ljharb/call-bind/commit/e10d0bbdadc7a10ecedc9a1c035112d3e368b8df)
+- Implementation [`43852ed`](https://github.com/ljharb/call-bind/commit/43852eda0f187327b7fad2423ca972149a52bd65)
+- npm init [`408f860`](https://github.com/ljharb/call-bind/commit/408f860b773a2f610805fd3613d0d71bac1b6249)
+- [meta] add Automatic Rebase and Require Allow Edits workflows [`fb349b2`](https://github.com/ljharb/call-bind/commit/fb349b2e48defbec8b5ec8a8395cc8f69f220b13)
+- [meta] add `auto-changelog` [`c4001fc`](https://github.com/ljharb/call-bind/commit/c4001fc43031799ef908211c98d3b0fb2b60fde4)
+- [meta] add "funding"; create `FUNDING.yml` [`d4d6d29`](https://github.com/ljharb/call-bind/commit/d4d6d2974a14bc2e98830468eda7fe6d6a776717)
+- [Tests] add `npm run lint` [`dedfb98`](https://github.com/ljharb/call-bind/commit/dedfb98bd0ecefb08ddb9a94061bd10cde4332af)
+- Only apps should have lockfiles [`54ac776`](https://github.com/ljharb/call-bind/commit/54ac77653db45a7361dc153d2f478e743f110650)
+- [meta] add `safe-publish-latest` [`9ea8e43`](https://github.com/ljharb/call-bind/commit/9ea8e435b950ce9b705559cd651039f9bf40140f)
diff --git a/node_modules/call-bind/LICENSE b/node_modules/call-bind/LICENSE
new file mode 100644
index 0000000..48f05d0
--- /dev/null
+++ b/node_modules/call-bind/LICENSE
@@ -0,0 +1,21 @@
+MIT License
+
+Copyright (c) 2020 Jordan Harband
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
+SOFTWARE.
diff --git a/node_modules/call-bind/README.md b/node_modules/call-bind/README.md
new file mode 100644
index 0000000..48e9047
--- /dev/null
+++ b/node_modules/call-bind/README.md
@@ -0,0 +1,64 @@
+# call-bind [![Version Badge][npm-version-svg]][package-url]
+
+[![github actions][actions-image]][actions-url]
+[![coverage][codecov-image]][codecov-url]
+[![dependency status][deps-svg]][deps-url]
+[![dev dependency status][dev-deps-svg]][dev-deps-url]
+[![License][license-image]][license-url]
+[![Downloads][downloads-image]][downloads-url]
+
+[![npm badge][npm-badge-png]][package-url]
+
+Robustly `.call.bind()` a function.
+
+## Getting started
+
+```sh
+npm install --save call-bind
+```
+
+## Usage/Examples
+
+```js
+const assert = require('assert');
+const callBind = require('call-bind');
+const callBound = require('call-bind/callBound');
+
+function f(a, b) {
+ assert.equal(this, 1);
+ assert.equal(a, 2);
+ assert.equal(b, 3);
+ assert.equal(arguments.length, 2);
+}
+
+const fBound = callBind(f);
+
+const slice = callBound('Array.prototype.slice');
+
+delete Function.prototype.call;
+delete Function.prototype.bind;
+
+fBound(1, 2, 3);
+
+assert.deepEqual(slice([1, 2, 3, 4], 1, -1), [2, 3]);
+```
+
+## Tests
+
+Clone the repo, `npm install`, and run `npm test`
+
+[package-url]: https://npmjs.org/package/call-bind
+[npm-version-svg]: https://versionbadg.es/ljharb/call-bind.svg
+[deps-svg]: https://david-dm.org/ljharb/call-bind.svg
+[deps-url]: https://david-dm.org/ljharb/call-bind
+[dev-deps-svg]: https://david-dm.org/ljharb/call-bind/dev-status.svg
+[dev-deps-url]: https://david-dm.org/ljharb/call-bind#info=devDependencies
+[npm-badge-png]: https://nodei.co/npm/call-bind.png?downloads=true&stars=true
+[license-image]: https://img.shields.io/npm/l/call-bind.svg
+[license-url]: LICENSE
+[downloads-image]: https://img.shields.io/npm/dm/call-bind.svg
+[downloads-url]: https://npm-stat.com/charts.html?package=call-bind
+[codecov-image]: https://codecov.io/gh/ljharb/call-bind/branch/main/graphs/badge.svg
+[codecov-url]: https://app.codecov.io/gh/ljharb/call-bind/
+[actions-image]: https://img.shields.io/endpoint?url=https://github-actions-badge-u3jn4tfpocch.runkit.sh/ljharb/call-bind
+[actions-url]: https://github.com/ljharb/call-bind/actions
diff --git a/node_modules/call-bind/callBound.js b/node_modules/call-bind/callBound.js
new file mode 100644
index 0000000..8374adf
--- /dev/null
+++ b/node_modules/call-bind/callBound.js
@@ -0,0 +1,15 @@
+'use strict';
+
+var GetIntrinsic = require('get-intrinsic');
+
+var callBind = require('./');
+
+var $indexOf = callBind(GetIntrinsic('String.prototype.indexOf'));
+
+module.exports = function callBoundIntrinsic(name, allowMissing) {
+ var intrinsic = GetIntrinsic(name, !!allowMissing);
+ if (typeof intrinsic === 'function' && $indexOf(name, '.prototype.') > -1) {
+ return callBind(intrinsic);
+ }
+ return intrinsic;
+};
diff --git a/node_modules/call-bind/index.js b/node_modules/call-bind/index.js
new file mode 100644
index 0000000..01c5b3d
--- /dev/null
+++ b/node_modules/call-bind/index.js
@@ -0,0 +1,35 @@
+'use strict';
+
+var bind = require('function-bind');
+var GetIntrinsic = require('get-intrinsic');
+var setFunctionLength = require('set-function-length');
+
+var $TypeError = require('es-errors/type');
+var $apply = GetIntrinsic('%Function.prototype.apply%');
+var $call = GetIntrinsic('%Function.prototype.call%');
+var $reflectApply = GetIntrinsic('%Reflect.apply%', true) || bind.call($call, $apply);
+
+var $defineProperty = require('es-define-property');
+var $max = GetIntrinsic('%Math.max%');
+
+module.exports = function callBind(originalFunction) {
+ if (typeof originalFunction !== 'function') {
+ throw new $TypeError('a function is required');
+ }
+ var func = $reflectApply(bind, $call, arguments);
+ return setFunctionLength(
+ func,
+ 1 + $max(0, originalFunction.length - (arguments.length - 1)),
+ true
+ );
+};
+
+var applyBind = function applyBind() {
+ return $reflectApply(bind, $apply, arguments);
+};
+
+if ($defineProperty) {
+ $defineProperty(module.exports, 'apply', { value: applyBind });
+} else {
+ module.exports.apply = applyBind;
+}
diff --git a/node_modules/call-bind/package.json b/node_modules/call-bind/package.json
new file mode 100644
index 0000000..5ba88ff
--- /dev/null
+++ b/node_modules/call-bind/package.json
@@ -0,0 +1,95 @@
+{
+ "name": "call-bind",
+ "version": "1.0.7",
+ "description": "Robustly `.call.bind()` a function",
+ "main": "index.js",
+ "exports": {
+ ".": "./index.js",
+ "./callBound": "./callBound.js",
+ "./package.json": "./package.json"
+ },
+ "scripts": {
+ "prepack": "npmignore --auto --commentLines=auto",
+ "prepublish": "not-in-publish || npm run prepublishOnly",
+ "prepublishOnly": "safe-publish-latest",
+ "lint": "eslint --ext=.js,.mjs .",
+ "postlint": "evalmd README.md",
+ "pretest": "npm run lint",
+ "tests-only": "nyc tape 'test/**/*.js'",
+ "test": "npm run tests-only",
+ "posttest": "aud --production",
+ "version": "auto-changelog && git add CHANGELOG.md",
+ "postversion": "auto-changelog && git add CHANGELOG.md && git commit --no-edit --amend && git tag -f \"v$(node -e \"console.log(require('./package.json').version)\")\""
+ },
+ "repository": {
+ "type": "git",
+ "url": "git+https://github.com/ljharb/call-bind.git"
+ },
+ "keywords": [
+ "javascript",
+ "ecmascript",
+ "es",
+ "js",
+ "callbind",
+ "callbound",
+ "call",
+ "bind",
+ "bound",
+ "call-bind",
+ "call-bound",
+ "function",
+ "es-abstract"
+ ],
+ "author": "Jordan Harband ",
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ },
+ "license": "MIT",
+ "bugs": {
+ "url": "https://github.com/ljharb/call-bind/issues"
+ },
+ "homepage": "https://github.com/ljharb/call-bind#readme",
+ "devDependencies": {
+ "@ljharb/eslint-config": "^21.1.0",
+ "aud": "^2.0.4",
+ "auto-changelog": "^2.4.0",
+ "es-value-fixtures": "^1.4.2",
+ "eslint": "=8.8.0",
+ "evalmd": "^0.0.19",
+ "for-each": "^0.3.3",
+ "gopd": "^1.0.1",
+ "has-strict-mode": "^1.0.1",
+ "in-publish": "^2.0.1",
+ "npmignore": "^0.3.1",
+ "nyc": "^10.3.2",
+ "object-inspect": "^1.13.1",
+ "safe-publish-latest": "^2.0.0",
+ "tape": "^5.7.4"
+ },
+ "dependencies": {
+ "es-define-property": "^1.0.0",
+ "es-errors": "^1.3.0",
+ "function-bind": "^1.1.2",
+ "get-intrinsic": "^1.2.4",
+ "set-function-length": "^1.2.1"
+ },
+ "testling": {
+ "files": "test/index.js"
+ },
+ "auto-changelog": {
+ "output": "CHANGELOG.md",
+ "template": "keepachangelog",
+ "unreleased": false,
+ "commitLimit": false,
+ "backfillLimit": false,
+ "hideCredit": true
+ },
+ "publishConfig": {
+ "ignore": [
+ ".github/workflows"
+ ]
+ },
+ "engines": {
+ "node": ">= 0.4"
+ }
+}
diff --git a/node_modules/call-bind/test/callBound.js b/node_modules/call-bind/test/callBound.js
new file mode 100644
index 0000000..c32319d
--- /dev/null
+++ b/node_modules/call-bind/test/callBound.js
@@ -0,0 +1,54 @@
+'use strict';
+
+var test = require('tape');
+
+var callBound = require('../callBound');
+
+test('callBound', function (t) {
+ // static primitive
+ t.equal(callBound('Array.length'), Array.length, 'Array.length yields itself');
+ t.equal(callBound('%Array.length%'), Array.length, '%Array.length% yields itself');
+
+ // static non-function object
+ t.equal(callBound('Array.prototype'), Array.prototype, 'Array.prototype yields itself');
+ t.equal(callBound('%Array.prototype%'), Array.prototype, '%Array.prototype% yields itself');
+ t.equal(callBound('Array.constructor'), Array.constructor, 'Array.constructor yields itself');
+ t.equal(callBound('%Array.constructor%'), Array.constructor, '%Array.constructor% yields itself');
+
+ // static function
+ t.equal(callBound('Date.parse'), Date.parse, 'Date.parse yields itself');
+ t.equal(callBound('%Date.parse%'), Date.parse, '%Date.parse% yields itself');
+
+ // prototype primitive
+ t.equal(callBound('Error.prototype.message'), Error.prototype.message, 'Error.prototype.message yields itself');
+ t.equal(callBound('%Error.prototype.message%'), Error.prototype.message, '%Error.prototype.message% yields itself');
+
+ // prototype function
+ t.notEqual(callBound('Object.prototype.toString'), Object.prototype.toString, 'Object.prototype.toString does not yield itself');
+ t.notEqual(callBound('%Object.prototype.toString%'), Object.prototype.toString, '%Object.prototype.toString% does not yield itself');
+ t.equal(callBound('Object.prototype.toString')(true), Object.prototype.toString.call(true), 'call-bound Object.prototype.toString calls into the original');
+ t.equal(callBound('%Object.prototype.toString%')(true), Object.prototype.toString.call(true), 'call-bound %Object.prototype.toString% calls into the original');
+
+ t['throws'](
+ function () { callBound('does not exist'); },
+ SyntaxError,
+ 'nonexistent intrinsic throws'
+ );
+ t['throws'](
+ function () { callBound('does not exist', true); },
+ SyntaxError,
+ 'allowMissing arg still throws for unknown intrinsic'
+ );
+
+ t.test('real but absent intrinsic', { skip: typeof WeakRef !== 'undefined' }, function (st) {
+ st['throws'](
+ function () { callBound('WeakRef'); },
+ TypeError,
+ 'real but absent intrinsic throws'
+ );
+ st.equal(callBound('WeakRef', true), undefined, 'allowMissing arg avoids exception');
+ st.end();
+ });
+
+ t.end();
+});
diff --git a/node_modules/call-bind/test/index.js b/node_modules/call-bind/test/index.js
new file mode 100644
index 0000000..1fd4668
--- /dev/null
+++ b/node_modules/call-bind/test/index.js
@@ -0,0 +1,80 @@
+'use strict';
+
+var callBind = require('../');
+var bind = require('function-bind');
+var gOPD = require('gopd');
+var hasStrictMode = require('has-strict-mode')();
+var forEach = require('for-each');
+var inspect = require('object-inspect');
+var v = require('es-value-fixtures');
+
+var test = require('tape');
+
+/*
+ * older engines have length nonconfigurable
+ * in io.js v3, it is configurable except on bound functions, hence the .bind()
+ */
+var functionsHaveConfigurableLengths = !!(
+ gOPD
+ && Object.getOwnPropertyDescriptor
+ && Object.getOwnPropertyDescriptor(bind.call(function () {}), 'length').configurable
+);
+
+test('callBind', function (t) {
+ forEach(v.nonFunctions, function (nonFunction) {
+ t['throws'](
+ function () { callBind(nonFunction); },
+ TypeError,
+ inspect(nonFunction) + ' is not a function'
+ );
+ });
+
+ var sentinel = { sentinel: true };
+ var func = function (a, b) {
+ // eslint-disable-next-line no-invalid-this
+ return [!hasStrictMode && this === global ? undefined : this, a, b];
+ };
+ t.equal(func.length, 2, 'original function length is 2');
+ t.deepEqual(func(), [undefined, undefined, undefined], 'unbound func with too few args');
+ t.deepEqual(func(1, 2), [undefined, 1, 2], 'unbound func with right args');
+ t.deepEqual(func(1, 2, 3), [undefined, 1, 2], 'unbound func with too many args');
+
+ var bound = callBind(func);
+ t.equal(bound.length, func.length + 1, 'function length is preserved', { skip: !functionsHaveConfigurableLengths });
+ t.deepEqual(bound(), [undefined, undefined, undefined], 'bound func with too few args');
+ t.deepEqual(bound(1, 2), [hasStrictMode ? 1 : Object(1), 2, undefined], 'bound func with right args');
+ t.deepEqual(bound(1, 2, 3), [hasStrictMode ? 1 : Object(1), 2, 3], 'bound func with too many args');
+
+ var boundR = callBind(func, sentinel);
+ t.equal(boundR.length, func.length, 'function length is preserved', { skip: !functionsHaveConfigurableLengths });
+ t.deepEqual(boundR(), [sentinel, undefined, undefined], 'bound func with receiver, with too few args');
+ t.deepEqual(boundR(1, 2), [sentinel, 1, 2], 'bound func with receiver, with right args');
+ t.deepEqual(boundR(1, 2, 3), [sentinel, 1, 2], 'bound func with receiver, with too many args');
+
+ var boundArg = callBind(func, sentinel, 1);
+ t.equal(boundArg.length, func.length - 1, 'function length is preserved', { skip: !functionsHaveConfigurableLengths });
+ t.deepEqual(boundArg(), [sentinel, 1, undefined], 'bound func with receiver and arg, with too few args');
+ t.deepEqual(boundArg(2), [sentinel, 1, 2], 'bound func with receiver and arg, with right arg');
+ t.deepEqual(boundArg(2, 3), [sentinel, 1, 2], 'bound func with receiver and arg, with too many args');
+
+ t.test('callBind.apply', function (st) {
+ var aBound = callBind.apply(func);
+ st.deepEqual(aBound(sentinel), [sentinel, undefined, undefined], 'apply-bound func with no args');
+ st.deepEqual(aBound(sentinel, [1], 4), [sentinel, 1, undefined], 'apply-bound func with too few args');
+ st.deepEqual(aBound(sentinel, [1, 2], 4), [sentinel, 1, 2], 'apply-bound func with right args');
+
+ var aBoundArg = callBind.apply(func);
+ st.deepEqual(aBoundArg(sentinel, [1, 2, 3], 4), [sentinel, 1, 2], 'apply-bound func with too many args');
+ st.deepEqual(aBoundArg(sentinel, [1, 2], 4), [sentinel, 1, 2], 'apply-bound func with right args');
+ st.deepEqual(aBoundArg(sentinel, [1], 4), [sentinel, 1, undefined], 'apply-bound func with too few args');
+
+ var aBoundR = callBind.apply(func, sentinel);
+ st.deepEqual(aBoundR([1, 2, 3], 4), [sentinel, 1, 2], 'apply-bound func with receiver and too many args');
+ st.deepEqual(aBoundR([1, 2], 4), [sentinel, 1, 2], 'apply-bound func with receiver and right args');
+ st.deepEqual(aBoundR([1], 4), [sentinel, 1, undefined], 'apply-bound func with receiver and too few args');
+
+ st.end();
+ });
+
+ t.end();
+});
diff --git a/node_modules/content-disposition/HISTORY.md b/node_modules/content-disposition/HISTORY.md
new file mode 100644
index 0000000..488effa
--- /dev/null
+++ b/node_modules/content-disposition/HISTORY.md
@@ -0,0 +1,60 @@
+0.5.4 / 2021-12-10
+==================
+
+ * deps: safe-buffer@5.2.1
+
+0.5.3 / 2018-12-17
+==================
+
+ * Use `safe-buffer` for improved Buffer API
+
+0.5.2 / 2016-12-08
+==================
+
+ * Fix `parse` to accept any linear whitespace character
+
+0.5.1 / 2016-01-17
+==================
+
+ * perf: enable strict mode
+
+0.5.0 / 2014-10-11
+==================
+
+ * Add `parse` function
+
+0.4.0 / 2014-09-21
+==================
+
+ * Expand non-Unicode `filename` to the full ISO-8859-1 charset
+
+0.3.0 / 2014-09-20
+==================
+
+ * Add `fallback` option
+ * Add `type` option
+
+0.2.0 / 2014-09-19
+==================
+
+ * Reduce ambiguity of file names with hex escape in buggy browsers
+
+0.1.2 / 2014-09-19
+==================
+
+ * Fix periodic invalid Unicode filename header
+
+0.1.1 / 2014-09-19
+==================
+
+ * Fix invalid characters appearing in `filename*` parameter
+
+0.1.0 / 2014-09-18
+==================
+
+ * Make the `filename` argument optional
+
+0.0.0 / 2014-09-18
+==================
+
+ * Initial release
diff --git a/node_modules/content-disposition/LICENSE b/node_modules/content-disposition/LICENSE
new file mode 100644
index 0000000..84441fb
--- /dev/null
+++ b/node_modules/content-disposition/LICENSE
@@ -0,0 +1,22 @@
+(The MIT License)
+
+Copyright (c) 2014-2017 Douglas Christopher Wilson
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/node_modules/content-disposition/README.md b/node_modules/content-disposition/README.md
new file mode 100644
index 0000000..3a0bb05
--- /dev/null
+++ b/node_modules/content-disposition/README.md
@@ -0,0 +1,142 @@
+# content-disposition
+
+[![NPM Version][npm-image]][npm-url]
+[![NPM Downloads][downloads-image]][downloads-url]
+[![Node.js Version][node-version-image]][node-version-url]
+[![Build Status][github-actions-ci-image]][github-actions-ci-url]
+[![Test Coverage][coveralls-image]][coveralls-url]
+
+Create and parse HTTP `Content-Disposition` header
+
+## Installation
+
+```sh
+$ npm install content-disposition
+```
+
+## API
+
+```js
+var contentDisposition = require('content-disposition')
+```
+
+### contentDisposition(filename, options)
+
+Create an attachment `Content-Disposition` header value using the given file name,
+if supplied. The `filename` is optional and if no file name is desired, but you
+want to specify `options`, set `filename` to `undefined`.
+
+```js
+res.setHeader('Content-Disposition', contentDisposition('∫ maths.pdf'))
+```
+
+**note** HTTP headers are of the ISO-8859-1 character set. If you are writing this
+header through a means different from `setHeader` in Node.js, you'll want to specify
+the `'binary'` encoding in Node.js.
+
+#### Options
+
+`contentDisposition` accepts these properties in the options object.
+
+##### fallback
+
+If the `filename` option is outside ISO-8859-1, then the file name is actually
+stored in a supplemental field for clients that support Unicode file names and
+a ISO-8859-1 version of the file name is automatically generated.
+
+This specifies the ISO-8859-1 file name to override the automatic generation or
+disables the generation all together, defaults to `true`.
+
+ - A string will specify the ISO-8859-1 file name to use in place of automatic
+ generation.
+ - `false` will disable including a ISO-8859-1 file name and only include the
+ Unicode version (unless the file name is already ISO-8859-1).
+ - `true` will enable automatic generation if the file name is outside ISO-8859-1.
+
+If the `filename` option is ISO-8859-1 and this option is specified and has a
+different value, then the `filename` option is encoded in the extended field
+and this set as the fallback field, even though they are both ISO-8859-1.
+
+##### type
+
+Specifies the disposition type, defaults to `"attachment"`. This can also be
+`"inline"`, or any other value (all values except inline are treated like
+`attachment`, but can convey additional information if both parties agree to
+it). The type is normalized to lower-case.
+
+### contentDisposition.parse(string)
+
+```js
+var disposition = contentDisposition.parse('attachment; filename="EURO rates.txt"; filename*=UTF-8\'\'%e2%82%ac%20rates.txt')
+```
+
+Parse a `Content-Disposition` header string. This automatically handles extended
+("Unicode") parameters by decoding them and providing them under the standard
+parameter name. This will return an object with the following properties (examples
+are shown for the string `'attachment; filename="EURO rates.txt"; filename*=UTF-8\'\'%e2%82%ac%20rates.txt'`):
+
+ - `type`: The disposition type (always lower case). Example: `'attachment'`
+
+ - `parameters`: An object of the parameters in the disposition (name of parameter
+ always lower case and extended versions replace non-extended versions). Example:
+ `{filename: "€ rates.txt"}`
+
+## Examples
+
+### Send a file for download
+
+```js
+var contentDisposition = require('content-disposition')
+var destroy = require('destroy')
+var fs = require('fs')
+var http = require('http')
+var onFinished = require('on-finished')
+
+var filePath = '/path/to/public/plans.pdf'
+
+http.createServer(function onRequest (req, res) {
+ // set headers
+ res.setHeader('Content-Type', 'application/pdf')
+ res.setHeader('Content-Disposition', contentDisposition(filePath))
+
+ // send file
+ var stream = fs.createReadStream(filePath)
+ stream.pipe(res)
+ onFinished(res, function () {
+ destroy(stream)
+ })
+})
+```
+
+## Testing
+
+```sh
+$ npm test
+```
+
+## References
+
+- [RFC 2616: Hypertext Transfer Protocol -- HTTP/1.1][rfc-2616]
+- [RFC 5987: Character Set and Language Encoding for Hypertext Transfer Protocol (HTTP) Header Field Parameters][rfc-5987]
+- [RFC 6266: Use of the Content-Disposition Header Field in the Hypertext Transfer Protocol (HTTP)][rfc-6266]
+- [Test Cases for HTTP Content-Disposition header field (RFC 6266) and the Encodings defined in RFCs 2047, 2231 and 5987][tc-2231]
+
+[rfc-2616]: https://tools.ietf.org/html/rfc2616
+[rfc-5987]: https://tools.ietf.org/html/rfc5987
+[rfc-6266]: https://tools.ietf.org/html/rfc6266
+[tc-2231]: http://greenbytes.de/tech/tc2231/
+
+## License
+
+[MIT](LICENSE)
+
+[npm-image]: https://img.shields.io/npm/v/content-disposition.svg
+[npm-url]: https://npmjs.org/package/content-disposition
+[node-version-image]: https://img.shields.io/node/v/content-disposition.svg
+[node-version-url]: https://nodejs.org/en/download
+[coveralls-image]: https://img.shields.io/coveralls/jshttp/content-disposition.svg
+[coveralls-url]: https://coveralls.io/r/jshttp/content-disposition?branch=master
+[downloads-image]: https://img.shields.io/npm/dm/content-disposition.svg
+[downloads-url]: https://npmjs.org/package/content-disposition
+[github-actions-ci-image]: https://img.shields.io/github/workflow/status/jshttp/content-disposition/ci/master?label=ci
+[github-actions-ci-url]: https://github.com/jshttp/content-disposition?query=workflow%3Aci
diff --git a/node_modules/content-disposition/index.js b/node_modules/content-disposition/index.js
new file mode 100644
index 0000000..ecec899
--- /dev/null
+++ b/node_modules/content-disposition/index.js
@@ -0,0 +1,458 @@
+/*!
+ * content-disposition
+ * Copyright(c) 2014-2017 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+'use strict'
+
+/**
+ * Module exports.
+ * @public
+ */
+
+module.exports = contentDisposition
+module.exports.parse = parse
+
+/**
+ * Module dependencies.
+ * @private
+ */
+
+var basename = require('path').basename
+var Buffer = require('safe-buffer').Buffer
+
+/**
+ * RegExp to match non attr-char, *after* encodeURIComponent (i.e. not including "%")
+ * @private
+ */
+
+var ENCODE_URL_ATTR_CHAR_REGEXP = /[\x00-\x20"'()*,/:;<=>?@[\\\]{}\x7f]/g // eslint-disable-line no-control-regex
+
+/**
+ * RegExp to match percent encoding escape.
+ * @private
+ */
+
+var HEX_ESCAPE_REGEXP = /%[0-9A-Fa-f]{2}/
+var HEX_ESCAPE_REPLACE_REGEXP = /%([0-9A-Fa-f]{2})/g
+
+/**
+ * RegExp to match non-latin1 characters.
+ * @private
+ */
+
+var NON_LATIN1_REGEXP = /[^\x20-\x7e\xa0-\xff]/g
+
+/**
+ * RegExp to match quoted-pair in RFC 2616
+ *
+ * quoted-pair = "\" CHAR
+ * CHAR =
+ * @private
+ */
+
+var QESC_REGEXP = /\\([\u0000-\u007f])/g // eslint-disable-line no-control-regex
+
+/**
+ * RegExp to match chars that must be quoted-pair in RFC 2616
+ * @private
+ */
+
+var QUOTE_REGEXP = /([\\"])/g
+
+/**
+ * RegExp for various RFC 2616 grammar
+ *
+ * parameter = token "=" ( token | quoted-string )
+ * token = 1*
+ * separators = "(" | ")" | "<" | ">" | "@"
+ * | "," | ";" | ":" | "\" | <">
+ * | "/" | "[" | "]" | "?" | "="
+ * | "{" | "}" | SP | HT
+ * quoted-string = ( <"> *(qdtext | quoted-pair ) <"> )
+ * qdtext = >
+ * quoted-pair = "\" CHAR
+ * CHAR =
+ * TEXT =
+ * LWS = [CRLF] 1*( SP | HT )
+ * CRLF = CR LF
+ * CR =
+ * LF =
+ * SP =
+ * HT =
+ * CTL =
+ * OCTET =
+ * @private
+ */
+
+var PARAM_REGEXP = /;[\x09\x20]*([!#$%&'*+.0-9A-Z^_`a-z|~-]+)[\x09\x20]*=[\x09\x20]*("(?:[\x20!\x23-\x5b\x5d-\x7e\x80-\xff]|\\[\x20-\x7e])*"|[!#$%&'*+.0-9A-Z^_`a-z|~-]+)[\x09\x20]*/g // eslint-disable-line no-control-regex
+var TEXT_REGEXP = /^[\x20-\x7e\x80-\xff]+$/
+var TOKEN_REGEXP = /^[!#$%&'*+.0-9A-Z^_`a-z|~-]+$/
+
+/**
+ * RegExp for various RFC 5987 grammar
+ *
+ * ext-value = charset "'" [ language ] "'" value-chars
+ * charset = "UTF-8" / "ISO-8859-1" / mime-charset
+ * mime-charset = 1*mime-charsetc
+ * mime-charsetc = ALPHA / DIGIT
+ * / "!" / "#" / "$" / "%" / "&"
+ * / "+" / "-" / "^" / "_" / "`"
+ * / "{" / "}" / "~"
+ * language = ( 2*3ALPHA [ extlang ] )
+ * / 4ALPHA
+ * / 5*8ALPHA
+ * extlang = *3( "-" 3ALPHA )
+ * value-chars = *( pct-encoded / attr-char )
+ * pct-encoded = "%" HEXDIG HEXDIG
+ * attr-char = ALPHA / DIGIT
+ * / "!" / "#" / "$" / "&" / "+" / "-" / "."
+ * / "^" / "_" / "`" / "|" / "~"
+ * @private
+ */
+
+var EXT_VALUE_REGEXP = /^([A-Za-z0-9!#$%&+\-^_`{}~]+)'(?:[A-Za-z]{2,3}(?:-[A-Za-z]{3}){0,3}|[A-Za-z]{4,8}|)'((?:%[0-9A-Fa-f]{2}|[A-Za-z0-9!#$&+.^_`|~-])+)$/
+
+/**
+ * RegExp for various RFC 6266 grammar
+ *
+ * disposition-type = "inline" | "attachment" | disp-ext-type
+ * disp-ext-type = token
+ * disposition-parm = filename-parm | disp-ext-parm
+ * filename-parm = "filename" "=" value
+ * | "filename*" "=" ext-value
+ * disp-ext-parm = token "=" value
+ * | ext-token "=" ext-value
+ * ext-token =
+ * @private
+ */
+
+var DISPOSITION_TYPE_REGEXP = /^([!#$%&'*+.0-9A-Z^_`a-z|~-]+)[\x09\x20]*(?:$|;)/ // eslint-disable-line no-control-regex
+
+/**
+ * Create an attachment Content-Disposition header.
+ *
+ * @param {string} [filename]
+ * @param {object} [options]
+ * @param {string} [options.type=attachment]
+ * @param {string|boolean} [options.fallback=true]
+ * @return {string}
+ * @public
+ */
+
+function contentDisposition (filename, options) {
+ var opts = options || {}
+
+ // get type
+ var type = opts.type || 'attachment'
+
+ // get parameters
+ var params = createparams(filename, opts.fallback)
+
+ // format into string
+ return format(new ContentDisposition(type, params))
+}
+
+/**
+ * Create parameters object from filename and fallback.
+ *
+ * @param {string} [filename]
+ * @param {string|boolean} [fallback=true]
+ * @return {object}
+ * @private
+ */
+
+function createparams (filename, fallback) {
+ if (filename === undefined) {
+ return
+ }
+
+ var params = {}
+
+ if (typeof filename !== 'string') {
+ throw new TypeError('filename must be a string')
+ }
+
+ // fallback defaults to true
+ if (fallback === undefined) {
+ fallback = true
+ }
+
+ if (typeof fallback !== 'string' && typeof fallback !== 'boolean') {
+ throw new TypeError('fallback must be a string or boolean')
+ }
+
+ if (typeof fallback === 'string' && NON_LATIN1_REGEXP.test(fallback)) {
+ throw new TypeError('fallback must be ISO-8859-1 string')
+ }
+
+ // restrict to file base name
+ var name = basename(filename)
+
+ // determine if name is suitable for quoted string
+ var isQuotedString = TEXT_REGEXP.test(name)
+
+ // generate fallback name
+ var fallbackName = typeof fallback !== 'string'
+ ? fallback && getlatin1(name)
+ : basename(fallback)
+ var hasFallback = typeof fallbackName === 'string' && fallbackName !== name
+
+ // set extended filename parameter
+ if (hasFallback || !isQuotedString || HEX_ESCAPE_REGEXP.test(name)) {
+ params['filename*'] = name
+ }
+
+ // set filename parameter
+ if (isQuotedString || hasFallback) {
+ params.filename = hasFallback
+ ? fallbackName
+ : name
+ }
+
+ return params
+}
+
+/**
+ * Format object to Content-Disposition header.
+ *
+ * @param {object} obj
+ * @param {string} obj.type
+ * @param {object} [obj.parameters]
+ * @return {string}
+ * @private
+ */
+
+function format (obj) {
+ var parameters = obj.parameters
+ var type = obj.type
+
+ if (!type || typeof type !== 'string' || !TOKEN_REGEXP.test(type)) {
+ throw new TypeError('invalid type')
+ }
+
+ // start with normalized type
+ var string = String(type).toLowerCase()
+
+ // append parameters
+ if (parameters && typeof parameters === 'object') {
+ var param
+ var params = Object.keys(parameters).sort()
+
+ for (var i = 0; i < params.length; i++) {
+ param = params[i]
+
+ var val = param.substr(-1) === '*'
+ ? ustring(parameters[param])
+ : qstring(parameters[param])
+
+ string += '; ' + param + '=' + val
+ }
+ }
+
+ return string
+}
+
+/**
+ * Decode a RFC 5987 field value (gracefully).
+ *
+ * @param {string} str
+ * @return {string}
+ * @private
+ */
+
+function decodefield (str) {
+ var match = EXT_VALUE_REGEXP.exec(str)
+
+ if (!match) {
+ throw new TypeError('invalid extended field value')
+ }
+
+ var charset = match[1].toLowerCase()
+ var encoded = match[2]
+ var value
+
+ // to binary string
+ var binary = encoded.replace(HEX_ESCAPE_REPLACE_REGEXP, pdecode)
+
+ switch (charset) {
+ case 'iso-8859-1':
+ value = getlatin1(binary)
+ break
+ case 'utf-8':
+ value = Buffer.from(binary, 'binary').toString('utf8')
+ break
+ default:
+ throw new TypeError('unsupported charset in extended field')
+ }
+
+ return value
+}
+
+/**
+ * Get ISO-8859-1 version of string.
+ *
+ * @param {string} val
+ * @return {string}
+ * @private
+ */
+
+function getlatin1 (val) {
+ // simple Unicode -> ISO-8859-1 transformation
+ return String(val).replace(NON_LATIN1_REGEXP, '?')
+}
+
+/**
+ * Parse Content-Disposition header string.
+ *
+ * @param {string} string
+ * @return {object}
+ * @public
+ */
+
+function parse (string) {
+ if (!string || typeof string !== 'string') {
+ throw new TypeError('argument string is required')
+ }
+
+ var match = DISPOSITION_TYPE_REGEXP.exec(string)
+
+ if (!match) {
+ throw new TypeError('invalid type format')
+ }
+
+ // normalize type
+ var index = match[0].length
+ var type = match[1].toLowerCase()
+
+ var key
+ var names = []
+ var params = {}
+ var value
+
+ // calculate index to start at
+ index = PARAM_REGEXP.lastIndex = match[0].substr(-1) === ';'
+ ? index - 1
+ : index
+
+ // match parameters
+ while ((match = PARAM_REGEXP.exec(string))) {
+ if (match.index !== index) {
+ throw new TypeError('invalid parameter format')
+ }
+
+ index += match[0].length
+ key = match[1].toLowerCase()
+ value = match[2]
+
+ if (names.indexOf(key) !== -1) {
+ throw new TypeError('invalid duplicate parameter')
+ }
+
+ names.push(key)
+
+ if (key.indexOf('*') + 1 === key.length) {
+ // decode extended value
+ key = key.slice(0, -1)
+ value = decodefield(value)
+
+ // overwrite existing value
+ params[key] = value
+ continue
+ }
+
+ if (typeof params[key] === 'string') {
+ continue
+ }
+
+ if (value[0] === '"') {
+ // remove quotes and escapes
+ value = value
+ .substr(1, value.length - 2)
+ .replace(QESC_REGEXP, '$1')
+ }
+
+ params[key] = value
+ }
+
+ if (index !== -1 && index !== string.length) {
+ throw new TypeError('invalid parameter format')
+ }
+
+ return new ContentDisposition(type, params)
+}
+
+/**
+ * Percent decode a single character.
+ *
+ * @param {string} str
+ * @param {string} hex
+ * @return {string}
+ * @private
+ */
+
+function pdecode (str, hex) {
+ return String.fromCharCode(parseInt(hex, 16))
+}
+
+/**
+ * Percent encode a single character.
+ *
+ * @param {string} char
+ * @return {string}
+ * @private
+ */
+
+function pencode (char) {
+ return '%' + String(char)
+ .charCodeAt(0)
+ .toString(16)
+ .toUpperCase()
+}
+
+/**
+ * Quote a string for HTTP.
+ *
+ * @param {string} val
+ * @return {string}
+ * @private
+ */
+
+function qstring (val) {
+ var str = String(val)
+
+ return '"' + str.replace(QUOTE_REGEXP, '\\$1') + '"'
+}
+
+/**
+ * Encode a Unicode string for HTTP (RFC 5987).
+ *
+ * @param {string} val
+ * @return {string}
+ * @private
+ */
+
+function ustring (val) {
+ var str = String(val)
+
+ // percent encode as UTF-8
+ var encoded = encodeURIComponent(str)
+ .replace(ENCODE_URL_ATTR_CHAR_REGEXP, pencode)
+
+ return 'UTF-8\'\'' + encoded
+}
+
+/**
+ * Class for parsed Content-Disposition header for v8 optimization
+ *
+ * @public
+ * @param {string} type
+ * @param {object} parameters
+ * @constructor
+ */
+
+function ContentDisposition (type, parameters) {
+ this.type = type
+ this.parameters = parameters
+}
diff --git a/node_modules/content-disposition/package.json b/node_modules/content-disposition/package.json
new file mode 100644
index 0000000..43c70ce
--- /dev/null
+++ b/node_modules/content-disposition/package.json
@@ -0,0 +1,44 @@
+{
+ "name": "content-disposition",
+ "description": "Create and parse Content-Disposition header",
+ "version": "0.5.4",
+ "author": "Douglas Christopher Wilson ",
+ "license": "MIT",
+ "keywords": [
+ "content-disposition",
+ "http",
+ "rfc6266",
+ "res"
+ ],
+ "repository": "jshttp/content-disposition",
+ "dependencies": {
+ "safe-buffer": "5.2.1"
+ },
+ "devDependencies": {
+ "deep-equal": "1.0.1",
+ "eslint": "7.32.0",
+ "eslint-config-standard": "13.0.1",
+ "eslint-plugin-import": "2.25.3",
+ "eslint-plugin-markdown": "2.2.1",
+ "eslint-plugin-node": "11.1.0",
+ "eslint-plugin-promise": "5.2.0",
+ "eslint-plugin-standard": "4.1.0",
+ "istanbul": "0.4.5",
+ "mocha": "9.1.3"
+ },
+ "files": [
+ "LICENSE",
+ "HISTORY.md",
+ "README.md",
+ "index.js"
+ ],
+ "engines": {
+ "node": ">= 0.6"
+ },
+ "scripts": {
+ "lint": "eslint .",
+ "test": "mocha --reporter spec --bail --check-leaks test/",
+ "test-ci": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/",
+ "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/"
+ }
+}
diff --git a/node_modules/content-type/HISTORY.md b/node_modules/content-type/HISTORY.md
new file mode 100644
index 0000000..4583671
--- /dev/null
+++ b/node_modules/content-type/HISTORY.md
@@ -0,0 +1,29 @@
+1.0.5 / 2023-01-29
+==================
+
+ * perf: skip value escaping when unnecessary
+
+1.0.4 / 2017-09-11
+==================
+
+ * perf: skip parameter parsing when no parameters
+
+1.0.3 / 2017-09-10
+==================
+
+ * perf: remove argument reassignment
+
+1.0.2 / 2016-05-09
+==================
+
+ * perf: enable strict mode
+
+1.0.1 / 2015-02-13
+==================
+
+ * Improve missing `Content-Type` header error message
+
+1.0.0 / 2015-02-01
+==================
+
+ * Initial implementation, derived from `media-typer@0.3.0`
diff --git a/node_modules/content-type/LICENSE b/node_modules/content-type/LICENSE
new file mode 100644
index 0000000..34b1a2d
--- /dev/null
+++ b/node_modules/content-type/LICENSE
@@ -0,0 +1,22 @@
+(The MIT License)
+
+Copyright (c) 2015 Douglas Christopher Wilson
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/node_modules/content-type/README.md b/node_modules/content-type/README.md
new file mode 100644
index 0000000..c1a922a
--- /dev/null
+++ b/node_modules/content-type/README.md
@@ -0,0 +1,94 @@
+# content-type
+
+[![NPM Version][npm-version-image]][npm-url]
+[![NPM Downloads][npm-downloads-image]][npm-url]
+[![Node.js Version][node-image]][node-url]
+[![Build Status][ci-image]][ci-url]
+[![Coverage Status][coveralls-image]][coveralls-url]
+
+Create and parse HTTP Content-Type header according to RFC 7231
+
+## Installation
+
+```sh
+$ npm install content-type
+```
+
+## API
+
+```js
+var contentType = require('content-type')
+```
+
+### contentType.parse(string)
+
+```js
+var obj = contentType.parse('image/svg+xml; charset=utf-8')
+```
+
+Parse a `Content-Type` header. This will return an object with the following
+properties (examples are shown for the string `'image/svg+xml; charset=utf-8'`):
+
+ - `type`: The media type (the type and subtype, always lower case).
+ Example: `'image/svg+xml'`
+
+ - `parameters`: An object of the parameters in the media type (name of parameter
+ always lower case). Example: `{charset: 'utf-8'}`
+
+Throws a `TypeError` if the string is missing or invalid.
+
+### contentType.parse(req)
+
+```js
+var obj = contentType.parse(req)
+```
+
+Parse the `Content-Type` header from the given `req`. Short-cut for
+`contentType.parse(req.headers['content-type'])`.
+
+Throws a `TypeError` if the `Content-Type` header is missing or invalid.
+
+### contentType.parse(res)
+
+```js
+var obj = contentType.parse(res)
+```
+
+Parse the `Content-Type` header set on the given `res`. Short-cut for
+`contentType.parse(res.getHeader('content-type'))`.
+
+Throws a `TypeError` if the `Content-Type` header is missing or invalid.
+
+### contentType.format(obj)
+
+```js
+var str = contentType.format({
+ type: 'image/svg+xml',
+ parameters: { charset: 'utf-8' }
+})
+```
+
+Format an object into a `Content-Type` header. This will return a string of the
+content type for the given object with the following properties (examples are
+shown that produce the string `'image/svg+xml; charset=utf-8'`):
+
+ - `type`: The media type (will be lower-cased). Example: `'image/svg+xml'`
+
+ - `parameters`: An object of the parameters in the media type (name of the
+ parameter will be lower-cased). Example: `{charset: 'utf-8'}`
+
+Throws a `TypeError` if the object contains an invalid type or parameter names.
+
+## License
+
+[MIT](LICENSE)
+
+[ci-image]: https://badgen.net/github/checks/jshttp/content-type/master?label=ci
+[ci-url]: https://github.com/jshttp/content-type/actions/workflows/ci.yml
+[coveralls-image]: https://badgen.net/coveralls/c/github/jshttp/content-type/master
+[coveralls-url]: https://coveralls.io/r/jshttp/content-type?branch=master
+[node-image]: https://badgen.net/npm/node/content-type
+[node-url]: https://nodejs.org/en/download
+[npm-downloads-image]: https://badgen.net/npm/dm/content-type
+[npm-url]: https://npmjs.org/package/content-type
+[npm-version-image]: https://badgen.net/npm/v/content-type
diff --git a/node_modules/content-type/index.js b/node_modules/content-type/index.js
new file mode 100644
index 0000000..41840e7
--- /dev/null
+++ b/node_modules/content-type/index.js
@@ -0,0 +1,225 @@
+/*!
+ * content-type
+ * Copyright(c) 2015 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+'use strict'
+
+/**
+ * RegExp to match *( ";" parameter ) in RFC 7231 sec 3.1.1.1
+ *
+ * parameter = token "=" ( token / quoted-string )
+ * token = 1*tchar
+ * tchar = "!" / "#" / "$" / "%" / "&" / "'" / "*"
+ * / "+" / "-" / "." / "^" / "_" / "`" / "|" / "~"
+ * / DIGIT / ALPHA
+ * ; any VCHAR, except delimiters
+ * quoted-string = DQUOTE *( qdtext / quoted-pair ) DQUOTE
+ * qdtext = HTAB / SP / %x21 / %x23-5B / %x5D-7E / obs-text
+ * obs-text = %x80-FF
+ * quoted-pair = "\" ( HTAB / SP / VCHAR / obs-text )
+ */
+var PARAM_REGEXP = /; *([!#$%&'*+.^_`|~0-9A-Za-z-]+) *= *("(?:[\u000b\u0020\u0021\u0023-\u005b\u005d-\u007e\u0080-\u00ff]|\\[\u000b\u0020-\u00ff])*"|[!#$%&'*+.^_`|~0-9A-Za-z-]+) */g // eslint-disable-line no-control-regex
+var TEXT_REGEXP = /^[\u000b\u0020-\u007e\u0080-\u00ff]+$/ // eslint-disable-line no-control-regex
+var TOKEN_REGEXP = /^[!#$%&'*+.^_`|~0-9A-Za-z-]+$/
+
+/**
+ * RegExp to match quoted-pair in RFC 7230 sec 3.2.6
+ *
+ * quoted-pair = "\" ( HTAB / SP / VCHAR / obs-text )
+ * obs-text = %x80-FF
+ */
+var QESC_REGEXP = /\\([\u000b\u0020-\u00ff])/g // eslint-disable-line no-control-regex
+
+/**
+ * RegExp to match chars that must be quoted-pair in RFC 7230 sec 3.2.6
+ */
+var QUOTE_REGEXP = /([\\"])/g
+
+/**
+ * RegExp to match type in RFC 7231 sec 3.1.1.1
+ *
+ * media-type = type "/" subtype
+ * type = token
+ * subtype = token
+ */
+var TYPE_REGEXP = /^[!#$%&'*+.^_`|~0-9A-Za-z-]+\/[!#$%&'*+.^_`|~0-9A-Za-z-]+$/
+
+/**
+ * Module exports.
+ * @public
+ */
+
+exports.format = format
+exports.parse = parse
+
+/**
+ * Format object to media type.
+ *
+ * @param {object} obj
+ * @return {string}
+ * @public
+ */
+
+function format (obj) {
+ if (!obj || typeof obj !== 'object') {
+ throw new TypeError('argument obj is required')
+ }
+
+ var parameters = obj.parameters
+ var type = obj.type
+
+ if (!type || !TYPE_REGEXP.test(type)) {
+ throw new TypeError('invalid type')
+ }
+
+ var string = type
+
+ // append parameters
+ if (parameters && typeof parameters === 'object') {
+ var param
+ var params = Object.keys(parameters).sort()
+
+ for (var i = 0; i < params.length; i++) {
+ param = params[i]
+
+ if (!TOKEN_REGEXP.test(param)) {
+ throw new TypeError('invalid parameter name')
+ }
+
+ string += '; ' + param + '=' + qstring(parameters[param])
+ }
+ }
+
+ return string
+}
+
+/**
+ * Parse media type to object.
+ *
+ * @param {string|object} string
+ * @return {Object}
+ * @public
+ */
+
+function parse (string) {
+ if (!string) {
+ throw new TypeError('argument string is required')
+ }
+
+ // support req/res-like objects as argument
+ var header = typeof string === 'object'
+ ? getcontenttype(string)
+ : string
+
+ if (typeof header !== 'string') {
+ throw new TypeError('argument string is required to be a string')
+ }
+
+ var index = header.indexOf(';')
+ var type = index !== -1
+ ? header.slice(0, index).trim()
+ : header.trim()
+
+ if (!TYPE_REGEXP.test(type)) {
+ throw new TypeError('invalid media type')
+ }
+
+ var obj = new ContentType(type.toLowerCase())
+
+ // parse parameters
+ if (index !== -1) {
+ var key
+ var match
+ var value
+
+ PARAM_REGEXP.lastIndex = index
+
+ while ((match = PARAM_REGEXP.exec(header))) {
+ if (match.index !== index) {
+ throw new TypeError('invalid parameter format')
+ }
+
+ index += match[0].length
+ key = match[1].toLowerCase()
+ value = match[2]
+
+ if (value.charCodeAt(0) === 0x22 /* " */) {
+ // remove quotes
+ value = value.slice(1, -1)
+
+ // remove escapes
+ if (value.indexOf('\\') !== -1) {
+ value = value.replace(QESC_REGEXP, '$1')
+ }
+ }
+
+ obj.parameters[key] = value
+ }
+
+ if (index !== header.length) {
+ throw new TypeError('invalid parameter format')
+ }
+ }
+
+ return obj
+}
+
+/**
+ * Get content-type from req/res objects.
+ *
+ * @param {object}
+ * @return {Object}
+ * @private
+ */
+
+function getcontenttype (obj) {
+ var header
+
+ if (typeof obj.getHeader === 'function') {
+ // res-like
+ header = obj.getHeader('content-type')
+ } else if (typeof obj.headers === 'object') {
+ // req-like
+ header = obj.headers && obj.headers['content-type']
+ }
+
+ if (typeof header !== 'string') {
+ throw new TypeError('content-type header is missing from object')
+ }
+
+ return header
+}
+
+/**
+ * Quote a string if necessary.
+ *
+ * @param {string} val
+ * @return {string}
+ * @private
+ */
+
+function qstring (val) {
+ var str = String(val)
+
+ // no need to quote tokens
+ if (TOKEN_REGEXP.test(str)) {
+ return str
+ }
+
+ if (str.length > 0 && !TEXT_REGEXP.test(str)) {
+ throw new TypeError('invalid parameter value')
+ }
+
+ return '"' + str.replace(QUOTE_REGEXP, '\\$1') + '"'
+}
+
+/**
+ * Class to represent a content type.
+ * @private
+ */
+function ContentType (type) {
+ this.parameters = Object.create(null)
+ this.type = type
+}
diff --git a/node_modules/content-type/package.json b/node_modules/content-type/package.json
new file mode 100644
index 0000000..9db19f6
--- /dev/null
+++ b/node_modules/content-type/package.json
@@ -0,0 +1,42 @@
+{
+ "name": "content-type",
+ "description": "Create and parse HTTP Content-Type header",
+ "version": "1.0.5",
+ "author": "Douglas Christopher Wilson ",
+ "license": "MIT",
+ "keywords": [
+ "content-type",
+ "http",
+ "req",
+ "res",
+ "rfc7231"
+ ],
+ "repository": "jshttp/content-type",
+ "devDependencies": {
+ "deep-equal": "1.0.1",
+ "eslint": "8.32.0",
+ "eslint-config-standard": "15.0.1",
+ "eslint-plugin-import": "2.27.5",
+ "eslint-plugin-node": "11.1.0",
+ "eslint-plugin-promise": "6.1.1",
+ "eslint-plugin-standard": "4.1.0",
+ "mocha": "10.2.0",
+ "nyc": "15.1.0"
+ },
+ "files": [
+ "LICENSE",
+ "HISTORY.md",
+ "README.md",
+ "index.js"
+ ],
+ "engines": {
+ "node": ">= 0.6"
+ },
+ "scripts": {
+ "lint": "eslint .",
+ "test": "mocha --reporter spec --check-leaks --bail test/",
+ "test-ci": "nyc --reporter=lcovonly --reporter=text npm test",
+ "test-cov": "nyc --reporter=html --reporter=text npm test",
+ "version": "node scripts/version-history.js && git add HISTORY.md"
+ }
+}
diff --git a/node_modules/cookie-signature/.npmignore b/node_modules/cookie-signature/.npmignore
new file mode 100644
index 0000000..f1250e5
--- /dev/null
+++ b/node_modules/cookie-signature/.npmignore
@@ -0,0 +1,4 @@
+support
+test
+examples
+*.sock
diff --git a/node_modules/cookie-signature/History.md b/node_modules/cookie-signature/History.md
new file mode 100644
index 0000000..78513cc
--- /dev/null
+++ b/node_modules/cookie-signature/History.md
@@ -0,0 +1,38 @@
+1.0.6 / 2015-02-03
+==================
+
+* use `npm test` instead of `make test` to run tests
+* clearer assertion messages when checking input
+
+
+1.0.5 / 2014-09-05
+==================
+
+* add license to package.json
+
+1.0.4 / 2014-06-25
+==================
+
+ * corrected avoidance of timing attacks (thanks @tenbits!)
+
+1.0.3 / 2014-01-28
+==================
+
+ * [incorrect] fix for timing attacks
+
+1.0.2 / 2014-01-28
+==================
+
+ * fix missing repository warning
+ * fix typo in test
+
+1.0.1 / 2013-04-15
+==================
+
+ * Revert "Changed underlying HMAC algo. to sha512."
+ * Revert "Fix for timing attacks on MAC verification."
+
+0.0.1 / 2010-01-03
+==================
+
+ * Initial release
diff --git a/node_modules/cookie-signature/Readme.md b/node_modules/cookie-signature/Readme.md
new file mode 100644
index 0000000..2559e84
--- /dev/null
+++ b/node_modules/cookie-signature/Readme.md
@@ -0,0 +1,42 @@
+
+# cookie-signature
+
+ Sign and unsign cookies.
+
+## Example
+
+```js
+var cookie = require('cookie-signature');
+
+var val = cookie.sign('hello', 'tobiiscool');
+val.should.equal('hello.DGDUkGlIkCzPz+C0B064FNgHdEjox7ch8tOBGslZ5QI');
+
+var val = cookie.sign('hello', 'tobiiscool');
+cookie.unsign(val, 'tobiiscool').should.equal('hello');
+cookie.unsign(val, 'luna').should.be.false;
+```
+
+## License
+
+(The MIT License)
+
+Copyright (c) 2012 LearnBoost <tj@learnboost.com>
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
\ No newline at end of file
diff --git a/node_modules/cookie-signature/index.js b/node_modules/cookie-signature/index.js
new file mode 100644
index 0000000..b8c9463
--- /dev/null
+++ b/node_modules/cookie-signature/index.js
@@ -0,0 +1,51 @@
+/**
+ * Module dependencies.
+ */
+
+var crypto = require('crypto');
+
+/**
+ * Sign the given `val` with `secret`.
+ *
+ * @param {String} val
+ * @param {String} secret
+ * @return {String}
+ * @api private
+ */
+
+exports.sign = function(val, secret){
+ if ('string' != typeof val) throw new TypeError("Cookie value must be provided as a string.");
+ if ('string' != typeof secret) throw new TypeError("Secret string must be provided.");
+ return val + '.' + crypto
+ .createHmac('sha256', secret)
+ .update(val)
+ .digest('base64')
+ .replace(/\=+$/, '');
+};
+
+/**
+ * Unsign and decode the given `val` with `secret`,
+ * returning `false` if the signature is invalid.
+ *
+ * @param {String} val
+ * @param {String} secret
+ * @return {String|Boolean}
+ * @api private
+ */
+
+exports.unsign = function(val, secret){
+ if ('string' != typeof val) throw new TypeError("Signed cookie string must be provided.");
+ if ('string' != typeof secret) throw new TypeError("Secret string must be provided.");
+ var str = val.slice(0, val.lastIndexOf('.'))
+ , mac = exports.sign(str, secret);
+
+ return sha1(mac) == sha1(val) ? str : false;
+};
+
+/**
+ * Private
+ */
+
+function sha1(str){
+ return crypto.createHash('sha1').update(str).digest('hex');
+}
diff --git a/node_modules/cookie-signature/package.json b/node_modules/cookie-signature/package.json
new file mode 100644
index 0000000..29c4498
--- /dev/null
+++ b/node_modules/cookie-signature/package.json
@@ -0,0 +1,18 @@
+{
+ "name": "cookie-signature",
+ "version": "1.0.6",
+ "description": "Sign and unsign cookies",
+ "keywords": ["cookie", "sign", "unsign"],
+ "author": "TJ Holowaychuk ",
+ "license": "MIT",
+ "repository": { "type": "git", "url": "https://github.com/visionmedia/node-cookie-signature.git"},
+ "dependencies": {},
+ "devDependencies": {
+ "mocha": "*",
+ "should": "*"
+ },
+ "scripts": {
+ "test": "mocha --require should --reporter spec"
+ },
+ "main": "index"
+}
diff --git a/node_modules/cookie/LICENSE b/node_modules/cookie/LICENSE
new file mode 100644
index 0000000..058b6b4
--- /dev/null
+++ b/node_modules/cookie/LICENSE
@@ -0,0 +1,24 @@
+(The MIT License)
+
+Copyright (c) 2012-2014 Roman Shtylman
+Copyright (c) 2015 Douglas Christopher Wilson
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
+
diff --git a/node_modules/cookie/README.md b/node_modules/cookie/README.md
new file mode 100644
index 0000000..71fdac1
--- /dev/null
+++ b/node_modules/cookie/README.md
@@ -0,0 +1,317 @@
+# cookie
+
+[![NPM Version][npm-version-image]][npm-url]
+[![NPM Downloads][npm-downloads-image]][npm-url]
+[![Node.js Version][node-image]][node-url]
+[![Build Status][ci-image]][ci-url]
+[![Coverage Status][coveralls-image]][coveralls-url]
+
+Basic HTTP cookie parser and serializer for HTTP servers.
+
+## Installation
+
+This is a [Node.js](https://nodejs.org/en/) module available through the
+[npm registry](https://www.npmjs.com/). Installation is done using the
+[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally):
+
+```sh
+$ npm install cookie
+```
+
+## API
+
+```js
+var cookie = require('cookie');
+```
+
+### cookie.parse(str, options)
+
+Parse an HTTP `Cookie` header string and returning an object of all cookie name-value pairs.
+The `str` argument is the string representing a `Cookie` header value and `options` is an
+optional object containing additional parsing options.
+
+```js
+var cookies = cookie.parse('foo=bar; equation=E%3Dmc%5E2');
+// { foo: 'bar', equation: 'E=mc^2' }
+```
+
+#### Options
+
+`cookie.parse` accepts these properties in the options object.
+
+##### decode
+
+Specifies a function that will be used to decode a cookie's value. Since the value of a cookie
+has a limited character set (and must be a simple string), this function can be used to decode
+a previously-encoded cookie value into a JavaScript string or other object.
+
+The default function is the global `decodeURIComponent`, which will decode any URL-encoded
+sequences into their byte representations.
+
+**note** if an error is thrown from this function, the original, non-decoded cookie value will
+be returned as the cookie's value.
+
+### cookie.serialize(name, value, options)
+
+Serialize a cookie name-value pair into a `Set-Cookie` header string. The `name` argument is the
+name for the cookie, the `value` argument is the value to set the cookie to, and the `options`
+argument is an optional object containing additional serialization options.
+
+```js
+var setCookie = cookie.serialize('foo', 'bar');
+// foo=bar
+```
+
+#### Options
+
+`cookie.serialize` accepts these properties in the options object.
+
+##### domain
+
+Specifies the value for the [`Domain` `Set-Cookie` attribute][rfc-6265-5.2.3]. By default, no
+domain is set, and most clients will consider the cookie to apply to only the current domain.
+
+##### encode
+
+Specifies a function that will be used to encode a cookie's value. Since value of a cookie
+has a limited character set (and must be a simple string), this function can be used to encode
+a value into a string suited for a cookie's value.
+
+The default function is the global `encodeURIComponent`, which will encode a JavaScript string
+into UTF-8 byte sequences and then URL-encode any that fall outside of the cookie range.
+
+##### expires
+
+Specifies the `Date` object to be the value for the [`Expires` `Set-Cookie` attribute][rfc-6265-5.2.1].
+By default, no expiration is set, and most clients will consider this a "non-persistent cookie" and
+will delete it on a condition like exiting a web browser application.
+
+**note** the [cookie storage model specification][rfc-6265-5.3] states that if both `expires` and
+`maxAge` are set, then `maxAge` takes precedence, but it is possible not all clients by obey this,
+so if both are set, they should point to the same date and time.
+
+##### httpOnly
+
+Specifies the `boolean` value for the [`HttpOnly` `Set-Cookie` attribute][rfc-6265-5.2.6]. When truthy,
+the `HttpOnly` attribute is set, otherwise it is not. By default, the `HttpOnly` attribute is not set.
+
+**note** be careful when setting this to `true`, as compliant clients will not allow client-side
+JavaScript to see the cookie in `document.cookie`.
+
+##### maxAge
+
+Specifies the `number` (in seconds) to be the value for the [`Max-Age` `Set-Cookie` attribute][rfc-6265-5.2.2].
+The given number will be converted to an integer by rounding down. By default, no maximum age is set.
+
+**note** the [cookie storage model specification][rfc-6265-5.3] states that if both `expires` and
+`maxAge` are set, then `maxAge` takes precedence, but it is possible not all clients by obey this,
+so if both are set, they should point to the same date and time.
+
+##### partitioned
+
+Specifies the `boolean` value for the [`Partitioned` `Set-Cookie`](rfc-cutler-httpbis-partitioned-cookies)
+attribute. When truthy, the `Partitioned` attribute is set, otherwise it is not. By default, the
+`Partitioned` attribute is not set.
+
+**note** This is an attribute that has not yet been fully standardized, and may change in the future.
+This also means many clients may ignore this attribute until they understand it.
+
+More information about can be found in [the proposal](https://github.com/privacycg/CHIPS).
+
+##### path
+
+Specifies the value for the [`Path` `Set-Cookie` attribute][rfc-6265-5.2.4]. By default, the path
+is considered the ["default path"][rfc-6265-5.1.4].
+
+##### priority
+
+Specifies the `string` to be the value for the [`Priority` `Set-Cookie` attribute][rfc-west-cookie-priority-00-4.1].
+
+ - `'low'` will set the `Priority` attribute to `Low`.
+ - `'medium'` will set the `Priority` attribute to `Medium`, the default priority when not set.
+ - `'high'` will set the `Priority` attribute to `High`.
+
+More information about the different priority levels can be found in
+[the specification][rfc-west-cookie-priority-00-4.1].
+
+**note** This is an attribute that has not yet been fully standardized, and may change in the future.
+This also means many clients may ignore this attribute until they understand it.
+
+##### sameSite
+
+Specifies the `boolean` or `string` to be the value for the [`SameSite` `Set-Cookie` attribute][rfc-6265bis-09-5.4.7].
+
+ - `true` will set the `SameSite` attribute to `Strict` for strict same site enforcement.
+ - `false` will not set the `SameSite` attribute.
+ - `'lax'` will set the `SameSite` attribute to `Lax` for lax same site enforcement.
+ - `'none'` will set the `SameSite` attribute to `None` for an explicit cross-site cookie.
+ - `'strict'` will set the `SameSite` attribute to `Strict` for strict same site enforcement.
+
+More information about the different enforcement levels can be found in
+[the specification][rfc-6265bis-09-5.4.7].
+
+**note** This is an attribute that has not yet been fully standardized, and may change in the future.
+This also means many clients may ignore this attribute until they understand it.
+
+##### secure
+
+Specifies the `boolean` value for the [`Secure` `Set-Cookie` attribute][rfc-6265-5.2.5]. When truthy,
+the `Secure` attribute is set, otherwise it is not. By default, the `Secure` attribute is not set.
+
+**note** be careful when setting this to `true`, as compliant clients will not send the cookie back to
+the server in the future if the browser does not have an HTTPS connection.
+
+## Example
+
+The following example uses this module in conjunction with the Node.js core HTTP server
+to prompt a user for their name and display it back on future visits.
+
+```js
+var cookie = require('cookie');
+var escapeHtml = require('escape-html');
+var http = require('http');
+var url = require('url');
+
+function onRequest(req, res) {
+ // Parse the query string
+ var query = url.parse(req.url, true, true).query;
+
+ if (query && query.name) {
+ // Set a new cookie with the name
+ res.setHeader('Set-Cookie', cookie.serialize('name', String(query.name), {
+ httpOnly: true,
+ maxAge: 60 * 60 * 24 * 7 // 1 week
+ }));
+
+ // Redirect back after setting cookie
+ res.statusCode = 302;
+ res.setHeader('Location', req.headers.referer || '/');
+ res.end();
+ return;
+ }
+
+ // Parse the cookies on the request
+ var cookies = cookie.parse(req.headers.cookie || '');
+
+ // Get the visitor name set in the cookie
+ var name = cookies.name;
+
+ res.setHeader('Content-Type', 'text/html; charset=UTF-8');
+
+ if (name) {
+ res.write('Welcome back, ' + escapeHtml(name) + ' !
');
+ } else {
+ res.write('Hello, new visitor!
');
+ }
+
+ res.write('');
+}
+
+http.createServer(onRequest).listen(3000);
+```
+
+## Testing
+
+```sh
+$ npm test
+```
+
+## Benchmark
+
+```
+$ npm run bench
+
+> cookie@0.5.0 bench
+> node benchmark/index.js
+
+ node@18.18.2
+ acorn@8.10.0
+ ada@2.6.0
+ ares@1.19.1
+ brotli@1.0.9
+ cldr@43.1
+ icu@73.2
+ llhttp@6.0.11
+ modules@108
+ napi@9
+ nghttp2@1.57.0
+ nghttp3@0.7.0
+ ngtcp2@0.8.1
+ openssl@3.0.10+quic
+ simdutf@3.2.14
+ tz@2023c
+ undici@5.26.3
+ unicode@15.0
+ uv@1.44.2
+ uvwasi@0.0.18
+ v8@10.2.154.26-node.26
+ zlib@1.2.13.1-motley
+
+> node benchmark/parse-top.js
+
+ cookie.parse - top sites
+
+ 14 tests completed.
+
+ parse accounts.google.com x 2,588,913 ops/sec ±0.74% (186 runs sampled)
+ parse apple.com x 2,370,002 ops/sec ±0.69% (186 runs sampled)
+ parse cloudflare.com x 2,213,102 ops/sec ±0.88% (188 runs sampled)
+ parse docs.google.com x 2,194,157 ops/sec ±1.03% (184 runs sampled)
+ parse drive.google.com x 2,265,084 ops/sec ±0.79% (187 runs sampled)
+ parse en.wikipedia.org x 457,099 ops/sec ±0.81% (186 runs sampled)
+ parse linkedin.com x 504,407 ops/sec ±0.89% (186 runs sampled)
+ parse maps.google.com x 1,230,959 ops/sec ±0.98% (186 runs sampled)
+ parse microsoft.com x 926,294 ops/sec ±0.88% (184 runs sampled)
+ parse play.google.com x 2,311,338 ops/sec ±0.83% (185 runs sampled)
+ parse support.google.com x 1,508,850 ops/sec ±0.86% (186 runs sampled)
+ parse www.google.com x 1,022,582 ops/sec ±1.32% (182 runs sampled)
+ parse youtu.be x 332,136 ops/sec ±1.02% (185 runs sampled)
+ parse youtube.com x 323,833 ops/sec ±0.77% (183 runs sampled)
+
+> node benchmark/parse.js
+
+ cookie.parse - generic
+
+ 6 tests completed.
+
+ simple x 3,214,032 ops/sec ±1.61% (183 runs sampled)
+ decode x 587,237 ops/sec ±1.16% (187 runs sampled)
+ unquote x 2,954,618 ops/sec ±1.35% (183 runs sampled)
+ duplicates x 857,008 ops/sec ±0.89% (187 runs sampled)
+ 10 cookies x 292,133 ops/sec ±0.89% (187 runs sampled)
+ 100 cookies x 22,610 ops/sec ±0.68% (187 runs sampled)
+```
+
+## References
+
+- [RFC 6265: HTTP State Management Mechanism][rfc-6265]
+- [Same-site Cookies][rfc-6265bis-09-5.4.7]
+
+[rfc-cutler-httpbis-partitioned-cookies]: https://tools.ietf.org/html/draft-cutler-httpbis-partitioned-cookies/
+[rfc-west-cookie-priority-00-4.1]: https://tools.ietf.org/html/draft-west-cookie-priority-00#section-4.1
+[rfc-6265bis-09-5.4.7]: https://tools.ietf.org/html/draft-ietf-httpbis-rfc6265bis-09#section-5.4.7
+[rfc-6265]: https://tools.ietf.org/html/rfc6265
+[rfc-6265-5.1.4]: https://tools.ietf.org/html/rfc6265#section-5.1.4
+[rfc-6265-5.2.1]: https://tools.ietf.org/html/rfc6265#section-5.2.1
+[rfc-6265-5.2.2]: https://tools.ietf.org/html/rfc6265#section-5.2.2
+[rfc-6265-5.2.3]: https://tools.ietf.org/html/rfc6265#section-5.2.3
+[rfc-6265-5.2.4]: https://tools.ietf.org/html/rfc6265#section-5.2.4
+[rfc-6265-5.2.5]: https://tools.ietf.org/html/rfc6265#section-5.2.5
+[rfc-6265-5.2.6]: https://tools.ietf.org/html/rfc6265#section-5.2.6
+[rfc-6265-5.3]: https://tools.ietf.org/html/rfc6265#section-5.3
+
+## License
+
+[MIT](LICENSE)
+
+[ci-image]: https://badgen.net/github/checks/jshttp/cookie/master?label=ci
+[ci-url]: https://github.com/jshttp/cookie/actions/workflows/ci.yml
+[coveralls-image]: https://badgen.net/coveralls/c/github/jshttp/cookie/master
+[coveralls-url]: https://coveralls.io/r/jshttp/cookie?branch=master
+[node-image]: https://badgen.net/npm/node/cookie
+[node-url]: https://nodejs.org/en/download
+[npm-downloads-image]: https://badgen.net/npm/dm/cookie
+[npm-url]: https://npmjs.org/package/cookie
+[npm-version-image]: https://badgen.net/npm/v/cookie
diff --git a/node_modules/cookie/SECURITY.md b/node_modules/cookie/SECURITY.md
new file mode 100644
index 0000000..fd4a6c5
--- /dev/null
+++ b/node_modules/cookie/SECURITY.md
@@ -0,0 +1,25 @@
+# Security Policies and Procedures
+
+## Reporting a Bug
+
+The `cookie` team and community take all security bugs seriously. Thank
+you for improving the security of the project. We appreciate your efforts and
+responsible disclosure and will make every effort to acknowledge your
+contributions.
+
+Report security bugs by emailing the current owner(s) of `cookie`. This
+information can be found in the npm registry using the command
+`npm owner ls cookie`.
+If unsure or unable to get the information from the above, open an issue
+in the [project issue tracker](https://github.com/jshttp/cookie/issues)
+asking for the current contact information.
+
+To ensure the timely response to your report, please ensure that the entirety
+of the report is contained within the email body and not solely behind a web
+link or an attachment.
+
+At least one owner will acknowledge your email within 48 hours, and will send a
+more detailed response within 48 hours indicating the next steps in handling
+your report. After the initial reply to your report, the owners will
+endeavor to keep you informed of the progress towards a fix and full
+announcement, and may ask for additional information or guidance.
diff --git a/node_modules/cookie/index.js b/node_modules/cookie/index.js
new file mode 100644
index 0000000..51a58cb
--- /dev/null
+++ b/node_modules/cookie/index.js
@@ -0,0 +1,334 @@
+/*!
+ * cookie
+ * Copyright(c) 2012-2014 Roman Shtylman
+ * Copyright(c) 2015 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+'use strict';
+
+/**
+ * Module exports.
+ * @public
+ */
+
+exports.parse = parse;
+exports.serialize = serialize;
+
+/**
+ * Module variables.
+ * @private
+ */
+
+var __toString = Object.prototype.toString
+
+/**
+ * RegExp to match cookie-name in RFC 6265 sec 4.1.1
+ * This refers out to the obsoleted definition of token in RFC 2616 sec 2.2
+ * which has been replaced by the token definition in RFC 7230 appendix B.
+ *
+ * cookie-name = token
+ * token = 1*tchar
+ * tchar = "!" / "#" / "$" / "%" / "&" / "'" /
+ * "*" / "+" / "-" / "." / "^" / "_" /
+ * "`" / "|" / "~" / DIGIT / ALPHA
+ */
+
+var cookieNameRegExp = /^[!#$%&'*+\-.^_`|~0-9A-Za-z]+$/;
+
+/**
+ * RegExp to match cookie-value in RFC 6265 sec 4.1.1
+ *
+ * cookie-value = *cookie-octet / ( DQUOTE *cookie-octet DQUOTE )
+ * cookie-octet = %x21 / %x23-2B / %x2D-3A / %x3C-5B / %x5D-7E
+ * ; US-ASCII characters excluding CTLs,
+ * ; whitespace DQUOTE, comma, semicolon,
+ * ; and backslash
+ */
+
+var cookieValueRegExp = /^("?)[\u0021\u0023-\u002B\u002D-\u003A\u003C-\u005B\u005D-\u007E]*\1$/;
+
+/**
+ * RegExp to match domain-value in RFC 6265 sec 4.1.1
+ *
+ * domain-value =
+ * ; defined in [RFC1034], Section 3.5, as
+ * ; enhanced by [RFC1123], Section 2.1
+ * = | "."
+ * = [ [ ] ]
+ * Labels must be 63 characters or less.
+ * 'let-dig' not 'letter' in the first char, per RFC1123
+ * = |
+ * = | "-"
+ * = |
+ * = any one of the 52 alphabetic characters A through Z in
+ * upper case and a through z in lower case
+ * = any one of the ten digits 0 through 9
+ *
+ * Keep support for leading dot: https://github.com/jshttp/cookie/issues/173
+ *
+ * > (Note that a leading %x2E ("."), if present, is ignored even though that
+ * character is not permitted, but a trailing %x2E ("."), if present, will
+ * cause the user agent to ignore the attribute.)
+ */
+
+var domainValueRegExp = /^([.]?[a-z0-9]([a-z0-9-]{0,61}[a-z0-9])?)([.][a-z0-9]([a-z0-9-]{0,61}[a-z0-9])?)*$/i;
+
+/**
+ * RegExp to match path-value in RFC 6265 sec 4.1.1
+ *
+ * path-value =
+ * CHAR = %x01-7F
+ * ; defined in RFC 5234 appendix B.1
+ */
+
+var pathValueRegExp = /^[\u0020-\u003A\u003D-\u007E]*$/;
+
+/**
+ * Parse a cookie header.
+ *
+ * Parse the given cookie header string into an object
+ * The object has the various cookies as keys(names) => values
+ *
+ * @param {string} str
+ * @param {object} [opt]
+ * @return {object}
+ * @public
+ */
+
+function parse(str, opt) {
+ if (typeof str !== 'string') {
+ throw new TypeError('argument str must be a string');
+ }
+
+ var obj = {};
+ var len = str.length;
+ // RFC 6265 sec 4.1.1, RFC 2616 2.2 defines a cookie name consists of one char minimum, plus '='.
+ if (len < 2) return obj;
+
+ var dec = (opt && opt.decode) || decode;
+ var index = 0;
+ var eqIdx = 0;
+ var endIdx = 0;
+
+ do {
+ eqIdx = str.indexOf('=', index);
+ if (eqIdx === -1) break; // No more cookie pairs.
+
+ endIdx = str.indexOf(';', index);
+
+ if (endIdx === -1) {
+ endIdx = len;
+ } else if (eqIdx > endIdx) {
+ // backtrack on prior semicolon
+ index = str.lastIndexOf(';', eqIdx - 1) + 1;
+ continue;
+ }
+
+ var keyStartIdx = startIndex(str, index, eqIdx);
+ var keyEndIdx = endIndex(str, eqIdx, keyStartIdx);
+ var key = str.slice(keyStartIdx, keyEndIdx);
+
+ // only assign once
+ if (!obj.hasOwnProperty(key)) {
+ var valStartIdx = startIndex(str, eqIdx + 1, endIdx);
+ var valEndIdx = endIndex(str, endIdx, valStartIdx);
+
+ if (str.charCodeAt(valStartIdx) === 0x22 /* " */ && str.charCodeAt(valEndIdx - 1) === 0x22 /* " */) {
+ valStartIdx++;
+ valEndIdx--;
+ }
+
+ var val = str.slice(valStartIdx, valEndIdx);
+ obj[key] = tryDecode(val, dec);
+ }
+
+ index = endIdx + 1
+ } while (index < len);
+
+ return obj;
+}
+
+function startIndex(str, index, max) {
+ do {
+ var code = str.charCodeAt(index);
+ if (code !== 0x20 /* */ && code !== 0x09 /* \t */) return index;
+ } while (++index < max);
+ return max;
+}
+
+function endIndex(str, index, min) {
+ while (index > min) {
+ var code = str.charCodeAt(--index);
+ if (code !== 0x20 /* */ && code !== 0x09 /* \t */) return index + 1;
+ }
+ return min;
+}
+
+/**
+ * Serialize data into a cookie header.
+ *
+ * Serialize a name value pair into a cookie string suitable for
+ * http headers. An optional options object specifies cookie parameters.
+ *
+ * serialize('foo', 'bar', { httpOnly: true })
+ * => "foo=bar; httpOnly"
+ *
+ * @param {string} name
+ * @param {string} val
+ * @param {object} [opt]
+ * @return {string}
+ * @public
+ */
+
+function serialize(name, val, opt) {
+ var enc = (opt && opt.encode) || encodeURIComponent;
+
+ if (typeof enc !== 'function') {
+ throw new TypeError('option encode is invalid');
+ }
+
+ if (!cookieNameRegExp.test(name)) {
+ throw new TypeError('argument name is invalid');
+ }
+
+ var value = enc(val);
+
+ if (!cookieValueRegExp.test(value)) {
+ throw new TypeError('argument val is invalid');
+ }
+
+ var str = name + '=' + value;
+ if (!opt) return str;
+
+ if (null != opt.maxAge) {
+ var maxAge = Math.floor(opt.maxAge);
+
+ if (!isFinite(maxAge)) {
+ throw new TypeError('option maxAge is invalid')
+ }
+
+ str += '; Max-Age=' + maxAge;
+ }
+
+ if (opt.domain) {
+ if (!domainValueRegExp.test(opt.domain)) {
+ throw new TypeError('option domain is invalid');
+ }
+
+ str += '; Domain=' + opt.domain;
+ }
+
+ if (opt.path) {
+ if (!pathValueRegExp.test(opt.path)) {
+ throw new TypeError('option path is invalid');
+ }
+
+ str += '; Path=' + opt.path;
+ }
+
+ if (opt.expires) {
+ var expires = opt.expires
+
+ if (!isDate(expires) || isNaN(expires.valueOf())) {
+ throw new TypeError('option expires is invalid');
+ }
+
+ str += '; Expires=' + expires.toUTCString()
+ }
+
+ if (opt.httpOnly) {
+ str += '; HttpOnly';
+ }
+
+ if (opt.secure) {
+ str += '; Secure';
+ }
+
+ if (opt.partitioned) {
+ str += '; Partitioned'
+ }
+
+ if (opt.priority) {
+ var priority = typeof opt.priority === 'string'
+ ? opt.priority.toLowerCase() : opt.priority;
+
+ switch (priority) {
+ case 'low':
+ str += '; Priority=Low'
+ break
+ case 'medium':
+ str += '; Priority=Medium'
+ break
+ case 'high':
+ str += '; Priority=High'
+ break
+ default:
+ throw new TypeError('option priority is invalid')
+ }
+ }
+
+ if (opt.sameSite) {
+ var sameSite = typeof opt.sameSite === 'string'
+ ? opt.sameSite.toLowerCase() : opt.sameSite;
+
+ switch (sameSite) {
+ case true:
+ str += '; SameSite=Strict';
+ break;
+ case 'lax':
+ str += '; SameSite=Lax';
+ break;
+ case 'strict':
+ str += '; SameSite=Strict';
+ break;
+ case 'none':
+ str += '; SameSite=None';
+ break;
+ default:
+ throw new TypeError('option sameSite is invalid');
+ }
+ }
+
+ return str;
+}
+
+/**
+ * URL-decode string value. Optimized to skip native call when no %.
+ *
+ * @param {string} str
+ * @returns {string}
+ */
+
+function decode (str) {
+ return str.indexOf('%') !== -1
+ ? decodeURIComponent(str)
+ : str
+}
+
+/**
+ * Determine if value is a Date.
+ *
+ * @param {*} val
+ * @private
+ */
+
+function isDate (val) {
+ return __toString.call(val) === '[object Date]';
+}
+
+/**
+ * Try decoding a string using a decoding function.
+ *
+ * @param {string} str
+ * @param {function} decode
+ * @private
+ */
+
+function tryDecode(str, decode) {
+ try {
+ return decode(str);
+ } catch (e) {
+ return str;
+ }
+}
diff --git a/node_modules/cookie/package.json b/node_modules/cookie/package.json
new file mode 100644
index 0000000..f498ea7
--- /dev/null
+++ b/node_modules/cookie/package.json
@@ -0,0 +1,44 @@
+{
+ "name": "cookie",
+ "description": "HTTP server cookie parsing and serialization",
+ "version": "0.7.1",
+ "author": "Roman Shtylman ",
+ "contributors": [
+ "Douglas Christopher Wilson "
+ ],
+ "license": "MIT",
+ "keywords": [
+ "cookie",
+ "cookies"
+ ],
+ "repository": "jshttp/cookie",
+ "devDependencies": {
+ "beautify-benchmark": "0.2.4",
+ "benchmark": "2.1.4",
+ "eslint": "8.53.0",
+ "eslint-plugin-markdown": "3.0.1",
+ "mocha": "10.2.0",
+ "nyc": "15.1.0",
+ "safe-buffer": "5.2.1",
+ "top-sites": "1.1.194"
+ },
+ "files": [
+ "HISTORY.md",
+ "LICENSE",
+ "README.md",
+ "SECURITY.md",
+ "index.js"
+ ],
+ "main": "index.js",
+ "engines": {
+ "node": ">= 0.6"
+ },
+ "scripts": {
+ "bench": "node benchmark/index.js",
+ "lint": "eslint .",
+ "test": "mocha --reporter spec --bail --check-leaks test/",
+ "test-ci": "nyc --reporter=lcov --reporter=text npm test",
+ "test-cov": "nyc --reporter=html --reporter=text npm test",
+ "update-bench": "node scripts/update-benchmark.js"
+ }
+}
diff --git a/node_modules/debug/.coveralls.yml b/node_modules/debug/.coveralls.yml
new file mode 100644
index 0000000..20a7068
--- /dev/null
+++ b/node_modules/debug/.coveralls.yml
@@ -0,0 +1 @@
+repo_token: SIAeZjKYlHK74rbcFvNHMUzjRiMpflxve
diff --git a/node_modules/debug/.eslintrc b/node_modules/debug/.eslintrc
new file mode 100644
index 0000000..8a37ae2
--- /dev/null
+++ b/node_modules/debug/.eslintrc
@@ -0,0 +1,11 @@
+{
+ "env": {
+ "browser": true,
+ "node": true
+ },
+ "rules": {
+ "no-console": 0,
+ "no-empty": [1, { "allowEmptyCatch": true }]
+ },
+ "extends": "eslint:recommended"
+}
diff --git a/node_modules/debug/.npmignore b/node_modules/debug/.npmignore
new file mode 100644
index 0000000..5f60eec
--- /dev/null
+++ b/node_modules/debug/.npmignore
@@ -0,0 +1,9 @@
+support
+test
+examples
+example
+*.sock
+dist
+yarn.lock
+coverage
+bower.json
diff --git a/node_modules/debug/.travis.yml b/node_modules/debug/.travis.yml
new file mode 100644
index 0000000..6c6090c
--- /dev/null
+++ b/node_modules/debug/.travis.yml
@@ -0,0 +1,14 @@
+
+language: node_js
+node_js:
+ - "6"
+ - "5"
+ - "4"
+
+install:
+ - make node_modules
+
+script:
+ - make lint
+ - make test
+ - make coveralls
diff --git a/node_modules/debug/CHANGELOG.md b/node_modules/debug/CHANGELOG.md
new file mode 100644
index 0000000..eadaa18
--- /dev/null
+++ b/node_modules/debug/CHANGELOG.md
@@ -0,0 +1,362 @@
+
+2.6.9 / 2017-09-22
+==================
+
+ * remove ReDoS regexp in %o formatter (#504)
+
+2.6.8 / 2017-05-18
+==================
+
+ * Fix: Check for undefined on browser globals (#462, @marbemac)
+
+2.6.7 / 2017-05-16
+==================
+
+ * Fix: Update ms to 2.0.0 to fix regular expression denial of service vulnerability (#458, @hubdotcom)
+ * Fix: Inline extend function in node implementation (#452, @dougwilson)
+ * Docs: Fix typo (#455, @msasad)
+
+2.6.5 / 2017-04-27
+==================
+
+ * Fix: null reference check on window.documentElement.style.WebkitAppearance (#447, @thebigredgeek)
+ * Misc: clean up browser reference checks (#447, @thebigredgeek)
+ * Misc: add npm-debug.log to .gitignore (@thebigredgeek)
+
+
+2.6.4 / 2017-04-20
+==================
+
+ * Fix: bug that would occure if process.env.DEBUG is a non-string value. (#444, @LucianBuzzo)
+ * Chore: ignore bower.json in npm installations. (#437, @joaovieira)
+ * Misc: update "ms" to v0.7.3 (@tootallnate)
+
+2.6.3 / 2017-03-13
+==================
+
+ * Fix: Electron reference to `process.env.DEBUG` (#431, @paulcbetts)
+ * Docs: Changelog fix (@thebigredgeek)
+
+2.6.2 / 2017-03-10
+==================
+
+ * Fix: DEBUG_MAX_ARRAY_LENGTH (#420, @slavaGanzin)
+ * Docs: Add backers and sponsors from Open Collective (#422, @piamancini)
+ * Docs: Add Slackin invite badge (@tootallnate)
+
+2.6.1 / 2017-02-10
+==================
+
+ * Fix: Module's `export default` syntax fix for IE8 `Expected identifier` error
+ * Fix: Whitelist DEBUG_FD for values 1 and 2 only (#415, @pi0)
+ * Fix: IE8 "Expected identifier" error (#414, @vgoma)
+ * Fix: Namespaces would not disable once enabled (#409, @musikov)
+
+2.6.0 / 2016-12-28
+==================
+
+ * Fix: added better null pointer checks for browser useColors (@thebigredgeek)
+ * Improvement: removed explicit `window.debug` export (#404, @tootallnate)
+ * Improvement: deprecated `DEBUG_FD` environment variable (#405, @tootallnate)
+
+2.5.2 / 2016-12-25
+==================
+
+ * Fix: reference error on window within webworkers (#393, @KlausTrainer)
+ * Docs: fixed README typo (#391, @lurch)
+ * Docs: added notice about v3 api discussion (@thebigredgeek)
+
+2.5.1 / 2016-12-20
+==================
+
+ * Fix: babel-core compatibility
+
+2.5.0 / 2016-12-20
+==================
+
+ * Fix: wrong reference in bower file (@thebigredgeek)
+ * Fix: webworker compatibility (@thebigredgeek)
+ * Fix: output formatting issue (#388, @kribblo)
+ * Fix: babel-loader compatibility (#383, @escwald)
+ * Misc: removed built asset from repo and publications (@thebigredgeek)
+ * Misc: moved source files to /src (#378, @yamikuronue)
+ * Test: added karma integration and replaced babel with browserify for browser tests (#378, @yamikuronue)
+ * Test: coveralls integration (#378, @yamikuronue)
+ * Docs: simplified language in the opening paragraph (#373, @yamikuronue)
+
+2.4.5 / 2016-12-17
+==================
+
+ * Fix: `navigator` undefined in Rhino (#376, @jochenberger)
+ * Fix: custom log function (#379, @hsiliev)
+ * Improvement: bit of cleanup + linting fixes (@thebigredgeek)
+ * Improvement: rm non-maintainted `dist/` dir (#375, @freewil)
+ * Docs: simplified language in the opening paragraph. (#373, @yamikuronue)
+
+2.4.4 / 2016-12-14
+==================
+
+ * Fix: work around debug being loaded in preload scripts for electron (#368, @paulcbetts)
+
+2.4.3 / 2016-12-14
+==================
+
+ * Fix: navigation.userAgent error for react native (#364, @escwald)
+
+2.4.2 / 2016-12-14
+==================
+
+ * Fix: browser colors (#367, @tootallnate)
+ * Misc: travis ci integration (@thebigredgeek)
+ * Misc: added linting and testing boilerplate with sanity check (@thebigredgeek)
+
+2.4.1 / 2016-12-13
+==================
+
+ * Fix: typo that broke the package (#356)
+
+2.4.0 / 2016-12-13
+==================
+
+ * Fix: bower.json references unbuilt src entry point (#342, @justmatt)
+ * Fix: revert "handle regex special characters" (@tootallnate)
+ * Feature: configurable util.inspect()`options for NodeJS (#327, @tootallnate)
+ * Feature: %O`(big O) pretty-prints objects (#322, @tootallnate)
+ * Improvement: allow colors in workers (#335, @botverse)
+ * Improvement: use same color for same namespace. (#338, @lchenay)
+
+2.3.3 / 2016-11-09
+==================
+
+ * Fix: Catch `JSON.stringify()` errors (#195, Jovan Alleyne)
+ * Fix: Returning `localStorage` saved values (#331, Levi Thomason)
+ * Improvement: Don't create an empty object when no `process` (Nathan Rajlich)
+
+2.3.2 / 2016-11-09
+==================
+
+ * Fix: be super-safe in index.js as well (@TooTallNate)
+ * Fix: should check whether process exists (Tom Newby)
+
+2.3.1 / 2016-11-09
+==================
+
+ * Fix: Added electron compatibility (#324, @paulcbetts)
+ * Improvement: Added performance optimizations (@tootallnate)
+ * Readme: Corrected PowerShell environment variable example (#252, @gimre)
+ * Misc: Removed yarn lock file from source control (#321, @fengmk2)
+
+2.3.0 / 2016-11-07
+==================
+
+ * Fix: Consistent placement of ms diff at end of output (#215, @gorangajic)
+ * Fix: Escaping of regex special characters in namespace strings (#250, @zacronos)
+ * Fix: Fixed bug causing crash on react-native (#282, @vkarpov15)
+ * Feature: Enabled ES6+ compatible import via default export (#212 @bucaran)
+ * Feature: Added %O formatter to reflect Chrome's console.log capability (#279, @oncletom)
+ * Package: Update "ms" to 0.7.2 (#315, @DevSide)
+ * Package: removed superfluous version property from bower.json (#207 @kkirsche)
+ * Readme: fix USE_COLORS to DEBUG_COLORS
+ * Readme: Doc fixes for format string sugar (#269, @mlucool)
+ * Readme: Updated docs for DEBUG_FD and DEBUG_COLORS environment variables (#232, @mattlyons0)
+ * Readme: doc fixes for PowerShell (#271 #243, @exoticknight @unreadable)
+ * Readme: better docs for browser support (#224, @matthewmueller)
+ * Tooling: Added yarn integration for development (#317, @thebigredgeek)
+ * Misc: Renamed History.md to CHANGELOG.md (@thebigredgeek)
+ * Misc: Added license file (#226 #274, @CantemoInternal @sdaitzman)
+ * Misc: Updated contributors (@thebigredgeek)
+
+2.2.0 / 2015-05-09
+==================
+
+ * package: update "ms" to v0.7.1 (#202, @dougwilson)
+ * README: add logging to file example (#193, @DanielOchoa)
+ * README: fixed a typo (#191, @amir-s)
+ * browser: expose `storage` (#190, @stephenmathieson)
+ * Makefile: add a `distclean` target (#189, @stephenmathieson)
+
+2.1.3 / 2015-03-13
+==================
+
+ * Updated stdout/stderr example (#186)
+ * Updated example/stdout.js to match debug current behaviour
+ * Renamed example/stderr.js to stdout.js
+ * Update Readme.md (#184)
+ * replace high intensity foreground color for bold (#182, #183)
+
+2.1.2 / 2015-03-01
+==================
+
+ * dist: recompile
+ * update "ms" to v0.7.0
+ * package: update "browserify" to v9.0.3
+ * component: fix "ms.js" repo location
+ * changed bower package name
+ * updated documentation about using debug in a browser
+ * fix: security error on safari (#167, #168, @yields)
+
+2.1.1 / 2014-12-29
+==================
+
+ * browser: use `typeof` to check for `console` existence
+ * browser: check for `console.log` truthiness (fix IE 8/9)
+ * browser: add support for Chrome apps
+ * Readme: added Windows usage remarks
+ * Add `bower.json` to properly support bower install
+
+2.1.0 / 2014-10-15
+==================
+
+ * node: implement `DEBUG_FD` env variable support
+ * package: update "browserify" to v6.1.0
+ * package: add "license" field to package.json (#135, @panuhorsmalahti)
+
+2.0.0 / 2014-09-01
+==================
+
+ * package: update "browserify" to v5.11.0
+ * node: use stderr rather than stdout for logging (#29, @stephenmathieson)
+
+1.0.4 / 2014-07-15
+==================
+
+ * dist: recompile
+ * example: remove `console.info()` log usage
+ * example: add "Content-Type" UTF-8 header to browser example
+ * browser: place %c marker after the space character
+ * browser: reset the "content" color via `color: inherit`
+ * browser: add colors support for Firefox >= v31
+ * debug: prefer an instance `log()` function over the global one (#119)
+ * Readme: update documentation about styled console logs for FF v31 (#116, @wryk)
+
+1.0.3 / 2014-07-09
+==================
+
+ * Add support for multiple wildcards in namespaces (#122, @seegno)
+ * browser: fix lint
+
+1.0.2 / 2014-06-10
+==================
+
+ * browser: update color palette (#113, @gscottolson)
+ * common: make console logging function configurable (#108, @timoxley)
+ * node: fix %o colors on old node <= 0.8.x
+ * Makefile: find node path using shell/which (#109, @timoxley)
+
+1.0.1 / 2014-06-06
+==================
+
+ * browser: use `removeItem()` to clear localStorage
+ * browser, node: don't set DEBUG if namespaces is undefined (#107, @leedm777)
+ * package: add "contributors" section
+ * node: fix comment typo
+ * README: list authors
+
+1.0.0 / 2014-06-04
+==================
+
+ * make ms diff be global, not be scope
+ * debug: ignore empty strings in enable()
+ * node: make DEBUG_COLORS able to disable coloring
+ * *: export the `colors` array
+ * npmignore: don't publish the `dist` dir
+ * Makefile: refactor to use browserify
+ * package: add "browserify" as a dev dependency
+ * Readme: add Web Inspector Colors section
+ * node: reset terminal color for the debug content
+ * node: map "%o" to `util.inspect()`
+ * browser: map "%j" to `JSON.stringify()`
+ * debug: add custom "formatters"
+ * debug: use "ms" module for humanizing the diff
+ * Readme: add "bash" syntax highlighting
+ * browser: add Firebug color support
+ * browser: add colors for WebKit browsers
+ * node: apply log to `console`
+ * rewrite: abstract common logic for Node & browsers
+ * add .jshintrc file
+
+0.8.1 / 2014-04-14
+==================
+
+ * package: re-add the "component" section
+
+0.8.0 / 2014-03-30
+==================
+
+ * add `enable()` method for nodejs. Closes #27
+ * change from stderr to stdout
+ * remove unnecessary index.js file
+
+0.7.4 / 2013-11-13
+==================
+
+ * remove "browserify" key from package.json (fixes something in browserify)
+
+0.7.3 / 2013-10-30
+==================
+
+ * fix: catch localStorage security error when cookies are blocked (Chrome)
+ * add debug(err) support. Closes #46
+ * add .browser prop to package.json. Closes #42
+
+0.7.2 / 2013-02-06
+==================
+
+ * fix package.json
+ * fix: Mobile Safari (private mode) is broken with debug
+ * fix: Use unicode to send escape character to shell instead of octal to work with strict mode javascript
+
+0.7.1 / 2013-02-05
+==================
+
+ * add repository URL to package.json
+ * add DEBUG_COLORED to force colored output
+ * add browserify support
+ * fix component. Closes #24
+
+0.7.0 / 2012-05-04
+==================
+
+ * Added .component to package.json
+ * Added debug.component.js build
+
+0.6.0 / 2012-03-16
+==================
+
+ * Added support for "-" prefix in DEBUG [Vinay Pulim]
+ * Added `.enabled` flag to the node version [TooTallNate]
+
+0.5.0 / 2012-02-02
+==================
+
+ * Added: humanize diffs. Closes #8
+ * Added `debug.disable()` to the CS variant
+ * Removed padding. Closes #10
+ * Fixed: persist client-side variant again. Closes #9
+
+0.4.0 / 2012-02-01
+==================
+
+ * Added browser variant support for older browsers [TooTallNate]
+ * Added `debug.enable('project:*')` to browser variant [TooTallNate]
+ * Added padding to diff (moved it to the right)
+
+0.3.0 / 2012-01-26
+==================
+
+ * Added millisecond diff when isatty, otherwise UTC string
+
+0.2.0 / 2012-01-22
+==================
+
+ * Added wildcard support
+
+0.1.0 / 2011-12-02
+==================
+
+ * Added: remove colors unless stderr isatty [TooTallNate]
+
+0.0.1 / 2010-01-03
+==================
+
+ * Initial release
diff --git a/node_modules/debug/LICENSE b/node_modules/debug/LICENSE
new file mode 100644
index 0000000..658c933
--- /dev/null
+++ b/node_modules/debug/LICENSE
@@ -0,0 +1,19 @@
+(The MIT License)
+
+Copyright (c) 2014 TJ Holowaychuk
+
+Permission is hereby granted, free of charge, to any person obtaining a copy of this software
+and associated documentation files (the 'Software'), to deal in the Software without restriction,
+including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense,
+and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so,
+subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all copies or substantial
+portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT
+LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY,
+WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
+
diff --git a/node_modules/debug/Makefile b/node_modules/debug/Makefile
new file mode 100644
index 0000000..584da8b
--- /dev/null
+++ b/node_modules/debug/Makefile
@@ -0,0 +1,50 @@
+# get Makefile directory name: http://stackoverflow.com/a/5982798/376773
+THIS_MAKEFILE_PATH:=$(word $(words $(MAKEFILE_LIST)),$(MAKEFILE_LIST))
+THIS_DIR:=$(shell cd $(dir $(THIS_MAKEFILE_PATH));pwd)
+
+# BIN directory
+BIN := $(THIS_DIR)/node_modules/.bin
+
+# Path
+PATH := node_modules/.bin:$(PATH)
+SHELL := /bin/bash
+
+# applications
+NODE ?= $(shell which node)
+YARN ?= $(shell which yarn)
+PKG ?= $(if $(YARN),$(YARN),$(NODE) $(shell which npm))
+BROWSERIFY ?= $(NODE) $(BIN)/browserify
+
+.FORCE:
+
+install: node_modules
+
+node_modules: package.json
+ @NODE_ENV= $(PKG) install
+ @touch node_modules
+
+lint: .FORCE
+ eslint browser.js debug.js index.js node.js
+
+test-node: .FORCE
+ istanbul cover node_modules/mocha/bin/_mocha -- test/**.js
+
+test-browser: .FORCE
+ mkdir -p dist
+
+ @$(BROWSERIFY) \
+ --standalone debug \
+ . > dist/debug.js
+
+ karma start --single-run
+ rimraf dist
+
+test: .FORCE
+ concurrently \
+ "make test-node" \
+ "make test-browser"
+
+coveralls:
+ cat ./coverage/lcov.info | ./node_modules/coveralls/bin/coveralls.js
+
+.PHONY: all install clean distclean
diff --git a/node_modules/debug/README.md b/node_modules/debug/README.md
new file mode 100644
index 0000000..f67be6b
--- /dev/null
+++ b/node_modules/debug/README.md
@@ -0,0 +1,312 @@
+# debug
+[](https://travis-ci.org/visionmedia/debug) [](https://coveralls.io/github/visionmedia/debug?branch=master) [](https://visionmedia-community-slackin.now.sh/) [](#backers)
+[](#sponsors)
+
+
+
+A tiny node.js debugging utility modelled after node core's debugging technique.
+
+**Discussion around the V3 API is under way [here](https://github.com/visionmedia/debug/issues/370)**
+
+## Installation
+
+```bash
+$ npm install debug
+```
+
+## Usage
+
+`debug` exposes a function; simply pass this function the name of your module, and it will return a decorated version of `console.error` for you to pass debug statements to. This will allow you to toggle the debug output for different parts of your module as well as the module as a whole.
+
+Example _app.js_:
+
+```js
+var debug = require('debug')('http')
+ , http = require('http')
+ , name = 'My App';
+
+// fake app
+
+debug('booting %s', name);
+
+http.createServer(function(req, res){
+ debug(req.method + ' ' + req.url);
+ res.end('hello\n');
+}).listen(3000, function(){
+ debug('listening');
+});
+
+// fake worker of some kind
+
+require('./worker');
+```
+
+Example _worker.js_:
+
+```js
+var debug = require('debug')('worker');
+
+setInterval(function(){
+ debug('doing some work');
+}, 1000);
+```
+
+ The __DEBUG__ environment variable is then used to enable these based on space or comma-delimited names. Here are some examples:
+
+ 
+
+ 
+
+#### Windows note
+
+ On Windows the environment variable is set using the `set` command.
+
+ ```cmd
+ set DEBUG=*,-not_this
+ ```
+
+ Note that PowerShell uses different syntax to set environment variables.
+
+ ```cmd
+ $env:DEBUG = "*,-not_this"
+ ```
+
+Then, run the program to be debugged as usual.
+
+## Millisecond diff
+
+ When actively developing an application it can be useful to see when the time spent between one `debug()` call and the next. Suppose for example you invoke `debug()` before requesting a resource, and after as well, the "+NNNms" will show you how much time was spent between calls.
+
+ 
+
+ When stdout is not a TTY, `Date#toUTCString()` is used, making it more useful for logging the debug information as shown below:
+
+ 
+
+## Conventions
+
+ If you're using this in one or more of your libraries, you _should_ use the name of your library so that developers may toggle debugging as desired without guessing names. If you have more than one debuggers you _should_ prefix them with your library name and use ":" to separate features. For example "bodyParser" from Connect would then be "connect:bodyParser".
+
+## Wildcards
+
+ The `*` character may be used as a wildcard. Suppose for example your library has debuggers named "connect:bodyParser", "connect:compress", "connect:session", instead of listing all three with `DEBUG=connect:bodyParser,connect:compress,connect:session`, you may simply do `DEBUG=connect:*`, or to run everything using this module simply use `DEBUG=*`.
+
+ You can also exclude specific debuggers by prefixing them with a "-" character. For example, `DEBUG=*,-connect:*` would include all debuggers except those starting with "connect:".
+
+## Environment Variables
+
+ When running through Node.js, you can set a few environment variables that will
+ change the behavior of the debug logging:
+
+| Name | Purpose |
+|-----------|-------------------------------------------------|
+| `DEBUG` | Enables/disables specific debugging namespaces. |
+| `DEBUG_COLORS`| Whether or not to use colors in the debug output. |
+| `DEBUG_DEPTH` | Object inspection depth. |
+| `DEBUG_SHOW_HIDDEN` | Shows hidden properties on inspected objects. |
+
+
+ __Note:__ The environment variables beginning with `DEBUG_` end up being
+ converted into an Options object that gets used with `%o`/`%O` formatters.
+ See the Node.js documentation for
+ [`util.inspect()`](https://nodejs.org/api/util.html#util_util_inspect_object_options)
+ for the complete list.
+
+## Formatters
+
+
+ Debug uses [printf-style](https://wikipedia.org/wiki/Printf_format_string) formatting. Below are the officially supported formatters:
+
+| Formatter | Representation |
+|-----------|----------------|
+| `%O` | Pretty-print an Object on multiple lines. |
+| `%o` | Pretty-print an Object all on a single line. |
+| `%s` | String. |
+| `%d` | Number (both integer and float). |
+| `%j` | JSON. Replaced with the string '[Circular]' if the argument contains circular references. |
+| `%%` | Single percent sign ('%'). This does not consume an argument. |
+
+### Custom formatters
+
+ You can add custom formatters by extending the `debug.formatters` object. For example, if you wanted to add support for rendering a Buffer as hex with `%h`, you could do something like:
+
+```js
+const createDebug = require('debug')
+createDebug.formatters.h = (v) => {
+ return v.toString('hex')
+}
+
+// …elsewhere
+const debug = createDebug('foo')
+debug('this is hex: %h', new Buffer('hello world'))
+// foo this is hex: 68656c6c6f20776f726c6421 +0ms
+```
+
+## Browser support
+ You can build a browser-ready script using [browserify](https://github.com/substack/node-browserify),
+ or just use the [browserify-as-a-service](https://wzrd.in/) [build](https://wzrd.in/standalone/debug@latest),
+ if you don't want to build it yourself.
+
+ Debug's enable state is currently persisted by `localStorage`.
+ Consider the situation shown below where you have `worker:a` and `worker:b`,
+ and wish to debug both. You can enable this using `localStorage.debug`:
+
+```js
+localStorage.debug = 'worker:*'
+```
+
+And then refresh the page.
+
+```js
+a = debug('worker:a');
+b = debug('worker:b');
+
+setInterval(function(){
+ a('doing some work');
+}, 1000);
+
+setInterval(function(){
+ b('doing some work');
+}, 1200);
+```
+
+#### Web Inspector Colors
+
+ Colors are also enabled on "Web Inspectors" that understand the `%c` formatting
+ option. These are WebKit web inspectors, Firefox ([since version
+ 31](https://hacks.mozilla.org/2014/05/editable-box-model-multiple-selection-sublime-text-keys-much-more-firefox-developer-tools-episode-31/))
+ and the Firebug plugin for Firefox (any version).
+
+ Colored output looks something like:
+
+ 
+
+
+## Output streams
+
+ By default `debug` will log to stderr, however this can be configured per-namespace by overriding the `log` method:
+
+Example _stdout.js_:
+
+```js
+var debug = require('debug');
+var error = debug('app:error');
+
+// by default stderr is used
+error('goes to stderr!');
+
+var log = debug('app:log');
+// set this namespace to log via console.log
+log.log = console.log.bind(console); // don't forget to bind to console!
+log('goes to stdout');
+error('still goes to stderr!');
+
+// set all output to go via console.info
+// overrides all per-namespace log settings
+debug.log = console.info.bind(console);
+error('now goes to stdout via console.info');
+log('still goes to stdout, but via console.info now');
+```
+
+
+## Authors
+
+ - TJ Holowaychuk
+ - Nathan Rajlich
+ - Andrew Rhyne
+
+## Backers
+
+Support us with a monthly donation and help us continue our activities. [[Become a backer](https://opencollective.com/debug#backer)]
+
+",
+ "contributors": [
+ "Nathan Rajlich (http://n8.io)",
+ "Andrew Rhyne "
+ ],
+ "license": "MIT",
+ "dependencies": {
+ "ms": "2.0.0"
+ },
+ "devDependencies": {
+ "browserify": "9.0.3",
+ "chai": "^3.5.0",
+ "concurrently": "^3.1.0",
+ "coveralls": "^2.11.15",
+ "eslint": "^3.12.1",
+ "istanbul": "^0.4.5",
+ "karma": "^1.3.0",
+ "karma-chai": "^0.1.0",
+ "karma-mocha": "^1.3.0",
+ "karma-phantomjs-launcher": "^1.0.2",
+ "karma-sinon": "^1.0.5",
+ "mocha": "^3.2.0",
+ "mocha-lcov-reporter": "^1.2.0",
+ "rimraf": "^2.5.4",
+ "sinon": "^1.17.6",
+ "sinon-chai": "^2.8.0"
+ },
+ "main": "./src/index.js",
+ "browser": "./src/browser.js",
+ "component": {
+ "scripts": {
+ "debug/index.js": "browser.js",
+ "debug/debug.js": "debug.js"
+ }
+ }
+}
diff --git a/node_modules/debug/src/browser.js b/node_modules/debug/src/browser.js
new file mode 100644
index 0000000..7106924
--- /dev/null
+++ b/node_modules/debug/src/browser.js
@@ -0,0 +1,185 @@
+/**
+ * This is the web browser implementation of `debug()`.
+ *
+ * Expose `debug()` as the module.
+ */
+
+exports = module.exports = require('./debug');
+exports.log = log;
+exports.formatArgs = formatArgs;
+exports.save = save;
+exports.load = load;
+exports.useColors = useColors;
+exports.storage = 'undefined' != typeof chrome
+ && 'undefined' != typeof chrome.storage
+ ? chrome.storage.local
+ : localstorage();
+
+/**
+ * Colors.
+ */
+
+exports.colors = [
+ 'lightseagreen',
+ 'forestgreen',
+ 'goldenrod',
+ 'dodgerblue',
+ 'darkorchid',
+ 'crimson'
+];
+
+/**
+ * Currently only WebKit-based Web Inspectors, Firefox >= v31,
+ * and the Firebug extension (any Firefox version) are known
+ * to support "%c" CSS customizations.
+ *
+ * TODO: add a `localStorage` variable to explicitly enable/disable colors
+ */
+
+function useColors() {
+ // NB: In an Electron preload script, document will be defined but not fully
+ // initialized. Since we know we're in Chrome, we'll just detect this case
+ // explicitly
+ if (typeof window !== 'undefined' && window.process && window.process.type === 'renderer') {
+ return true;
+ }
+
+ // is webkit? http://stackoverflow.com/a/16459606/376773
+ // document is undefined in react-native: https://github.com/facebook/react-native/pull/1632
+ return (typeof document !== 'undefined' && document.documentElement && document.documentElement.style && document.documentElement.style.WebkitAppearance) ||
+ // is firebug? http://stackoverflow.com/a/398120/376773
+ (typeof window !== 'undefined' && window.console && (window.console.firebug || (window.console.exception && window.console.table))) ||
+ // is firefox >= v31?
+ // https://developer.mozilla.org/en-US/docs/Tools/Web_Console#Styling_messages
+ (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/firefox\/(\d+)/) && parseInt(RegExp.$1, 10) >= 31) ||
+ // double check webkit in userAgent just in case we are in a worker
+ (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/applewebkit\/(\d+)/));
+}
+
+/**
+ * Map %j to `JSON.stringify()`, since no Web Inspectors do that by default.
+ */
+
+exports.formatters.j = function(v) {
+ try {
+ return JSON.stringify(v);
+ } catch (err) {
+ return '[UnexpectedJSONParseError]: ' + err.message;
+ }
+};
+
+
+/**
+ * Colorize log arguments if enabled.
+ *
+ * @api public
+ */
+
+function formatArgs(args) {
+ var useColors = this.useColors;
+
+ args[0] = (useColors ? '%c' : '')
+ + this.namespace
+ + (useColors ? ' %c' : ' ')
+ + args[0]
+ + (useColors ? '%c ' : ' ')
+ + '+' + exports.humanize(this.diff);
+
+ if (!useColors) return;
+
+ var c = 'color: ' + this.color;
+ args.splice(1, 0, c, 'color: inherit')
+
+ // the final "%c" is somewhat tricky, because there could be other
+ // arguments passed either before or after the %c, so we need to
+ // figure out the correct index to insert the CSS into
+ var index = 0;
+ var lastC = 0;
+ args[0].replace(/%[a-zA-Z%]/g, function(match) {
+ if ('%%' === match) return;
+ index++;
+ if ('%c' === match) {
+ // we only are interested in the *last* %c
+ // (the user may have provided their own)
+ lastC = index;
+ }
+ });
+
+ args.splice(lastC, 0, c);
+}
+
+/**
+ * Invokes `console.log()` when available.
+ * No-op when `console.log` is not a "function".
+ *
+ * @api public
+ */
+
+function log() {
+ // this hackery is required for IE8/9, where
+ // the `console.log` function doesn't have 'apply'
+ return 'object' === typeof console
+ && console.log
+ && Function.prototype.apply.call(console.log, console, arguments);
+}
+
+/**
+ * Save `namespaces`.
+ *
+ * @param {String} namespaces
+ * @api private
+ */
+
+function save(namespaces) {
+ try {
+ if (null == namespaces) {
+ exports.storage.removeItem('debug');
+ } else {
+ exports.storage.debug = namespaces;
+ }
+ } catch(e) {}
+}
+
+/**
+ * Load `namespaces`.
+ *
+ * @return {String} returns the previously persisted debug modes
+ * @api private
+ */
+
+function load() {
+ var r;
+ try {
+ r = exports.storage.debug;
+ } catch(e) {}
+
+ // If debug isn't set in LS, and we're in Electron, try to load $DEBUG
+ if (!r && typeof process !== 'undefined' && 'env' in process) {
+ r = process.env.DEBUG;
+ }
+
+ return r;
+}
+
+/**
+ * Enable namespaces listed in `localStorage.debug` initially.
+ */
+
+exports.enable(load());
+
+/**
+ * Localstorage attempts to return the localstorage.
+ *
+ * This is necessary because safari throws
+ * when a user disables cookies/localstorage
+ * and you attempt to access it.
+ *
+ * @return {LocalStorage}
+ * @api private
+ */
+
+function localstorage() {
+ try {
+ return window.localStorage;
+ } catch (e) {}
+}
diff --git a/node_modules/debug/src/debug.js b/node_modules/debug/src/debug.js
new file mode 100644
index 0000000..6a5e3fc
--- /dev/null
+++ b/node_modules/debug/src/debug.js
@@ -0,0 +1,202 @@
+
+/**
+ * This is the common logic for both the Node.js and web browser
+ * implementations of `debug()`.
+ *
+ * Expose `debug()` as the module.
+ */
+
+exports = module.exports = createDebug.debug = createDebug['default'] = createDebug;
+exports.coerce = coerce;
+exports.disable = disable;
+exports.enable = enable;
+exports.enabled = enabled;
+exports.humanize = require('ms');
+
+/**
+ * The currently active debug mode names, and names to skip.
+ */
+
+exports.names = [];
+exports.skips = [];
+
+/**
+ * Map of special "%n" handling functions, for the debug "format" argument.
+ *
+ * Valid key names are a single, lower or upper-case letter, i.e. "n" and "N".
+ */
+
+exports.formatters = {};
+
+/**
+ * Previous log timestamp.
+ */
+
+var prevTime;
+
+/**
+ * Select a color.
+ * @param {String} namespace
+ * @return {Number}
+ * @api private
+ */
+
+function selectColor(namespace) {
+ var hash = 0, i;
+
+ for (i in namespace) {
+ hash = ((hash << 5) - hash) + namespace.charCodeAt(i);
+ hash |= 0; // Convert to 32bit integer
+ }
+
+ return exports.colors[Math.abs(hash) % exports.colors.length];
+}
+
+/**
+ * Create a debugger with the given `namespace`.
+ *
+ * @param {String} namespace
+ * @return {Function}
+ * @api public
+ */
+
+function createDebug(namespace) {
+
+ function debug() {
+ // disabled?
+ if (!debug.enabled) return;
+
+ var self = debug;
+
+ // set `diff` timestamp
+ var curr = +new Date();
+ var ms = curr - (prevTime || curr);
+ self.diff = ms;
+ self.prev = prevTime;
+ self.curr = curr;
+ prevTime = curr;
+
+ // turn the `arguments` into a proper Array
+ var args = new Array(arguments.length);
+ for (var i = 0; i < args.length; i++) {
+ args[i] = arguments[i];
+ }
+
+ args[0] = exports.coerce(args[0]);
+
+ if ('string' !== typeof args[0]) {
+ // anything else let's inspect with %O
+ args.unshift('%O');
+ }
+
+ // apply any `formatters` transformations
+ var index = 0;
+ args[0] = args[0].replace(/%([a-zA-Z%])/g, function(match, format) {
+ // if we encounter an escaped % then don't increase the array index
+ if (match === '%%') return match;
+ index++;
+ var formatter = exports.formatters[format];
+ if ('function' === typeof formatter) {
+ var val = args[index];
+ match = formatter.call(self, val);
+
+ // now we need to remove `args[index]` since it's inlined in the `format`
+ args.splice(index, 1);
+ index--;
+ }
+ return match;
+ });
+
+ // apply env-specific formatting (colors, etc.)
+ exports.formatArgs.call(self, args);
+
+ var logFn = debug.log || exports.log || console.log.bind(console);
+ logFn.apply(self, args);
+ }
+
+ debug.namespace = namespace;
+ debug.enabled = exports.enabled(namespace);
+ debug.useColors = exports.useColors();
+ debug.color = selectColor(namespace);
+
+ // env-specific initialization logic for debug instances
+ if ('function' === typeof exports.init) {
+ exports.init(debug);
+ }
+
+ return debug;
+}
+
+/**
+ * Enables a debug mode by namespaces. This can include modes
+ * separated by a colon and wildcards.
+ *
+ * @param {String} namespaces
+ * @api public
+ */
+
+function enable(namespaces) {
+ exports.save(namespaces);
+
+ exports.names = [];
+ exports.skips = [];
+
+ var split = (typeof namespaces === 'string' ? namespaces : '').split(/[\s,]+/);
+ var len = split.length;
+
+ for (var i = 0; i < len; i++) {
+ if (!split[i]) continue; // ignore empty strings
+ namespaces = split[i].replace(/\*/g, '.*?');
+ if (namespaces[0] === '-') {
+ exports.skips.push(new RegExp('^' + namespaces.substr(1) + '$'));
+ } else {
+ exports.names.push(new RegExp('^' + namespaces + '$'));
+ }
+ }
+}
+
+/**
+ * Disable debug output.
+ *
+ * @api public
+ */
+
+function disable() {
+ exports.enable('');
+}
+
+/**
+ * Returns true if the given mode name is enabled, false otherwise.
+ *
+ * @param {String} name
+ * @return {Boolean}
+ * @api public
+ */
+
+function enabled(name) {
+ var i, len;
+ for (i = 0, len = exports.skips.length; i < len; i++) {
+ if (exports.skips[i].test(name)) {
+ return false;
+ }
+ }
+ for (i = 0, len = exports.names.length; i < len; i++) {
+ if (exports.names[i].test(name)) {
+ return true;
+ }
+ }
+ return false;
+}
+
+/**
+ * Coerce `val`.
+ *
+ * @param {Mixed} val
+ * @return {Mixed}
+ * @api private
+ */
+
+function coerce(val) {
+ if (val instanceof Error) return val.stack || val.message;
+ return val;
+}
diff --git a/node_modules/debug/src/index.js b/node_modules/debug/src/index.js
new file mode 100644
index 0000000..e12cf4d
--- /dev/null
+++ b/node_modules/debug/src/index.js
@@ -0,0 +1,10 @@
+/**
+ * Detect Electron renderer process, which is node, but we should
+ * treat as a browser.
+ */
+
+if (typeof process !== 'undefined' && process.type === 'renderer') {
+ module.exports = require('./browser.js');
+} else {
+ module.exports = require('./node.js');
+}
diff --git a/node_modules/debug/src/inspector-log.js b/node_modules/debug/src/inspector-log.js
new file mode 100644
index 0000000..60ea6c0
--- /dev/null
+++ b/node_modules/debug/src/inspector-log.js
@@ -0,0 +1,15 @@
+module.exports = inspectorLog;
+
+// black hole
+const nullStream = new (require('stream').Writable)();
+nullStream._write = () => {};
+
+/**
+ * Outputs a `console.log()` to the Node.js Inspector console *only*.
+ */
+function inspectorLog() {
+ const stdout = console._stdout;
+ console._stdout = nullStream;
+ console.log.apply(console, arguments);
+ console._stdout = stdout;
+}
diff --git a/node_modules/debug/src/node.js b/node_modules/debug/src/node.js
new file mode 100644
index 0000000..b15109c
--- /dev/null
+++ b/node_modules/debug/src/node.js
@@ -0,0 +1,248 @@
+/**
+ * Module dependencies.
+ */
+
+var tty = require('tty');
+var util = require('util');
+
+/**
+ * This is the Node.js implementation of `debug()`.
+ *
+ * Expose `debug()` as the module.
+ */
+
+exports = module.exports = require('./debug');
+exports.init = init;
+exports.log = log;
+exports.formatArgs = formatArgs;
+exports.save = save;
+exports.load = load;
+exports.useColors = useColors;
+
+/**
+ * Colors.
+ */
+
+exports.colors = [6, 2, 3, 4, 5, 1];
+
+/**
+ * Build up the default `inspectOpts` object from the environment variables.
+ *
+ * $ DEBUG_COLORS=no DEBUG_DEPTH=10 DEBUG_SHOW_HIDDEN=enabled node script.js
+ */
+
+exports.inspectOpts = Object.keys(process.env).filter(function (key) {
+ return /^debug_/i.test(key);
+}).reduce(function (obj, key) {
+ // camel-case
+ var prop = key
+ .substring(6)
+ .toLowerCase()
+ .replace(/_([a-z])/g, function (_, k) { return k.toUpperCase() });
+
+ // coerce string value into JS value
+ var val = process.env[key];
+ if (/^(yes|on|true|enabled)$/i.test(val)) val = true;
+ else if (/^(no|off|false|disabled)$/i.test(val)) val = false;
+ else if (val === 'null') val = null;
+ else val = Number(val);
+
+ obj[prop] = val;
+ return obj;
+}, {});
+
+/**
+ * The file descriptor to write the `debug()` calls to.
+ * Set the `DEBUG_FD` env variable to override with another value. i.e.:
+ *
+ * $ DEBUG_FD=3 node script.js 3>debug.log
+ */
+
+var fd = parseInt(process.env.DEBUG_FD, 10) || 2;
+
+if (1 !== fd && 2 !== fd) {
+ util.deprecate(function(){}, 'except for stderr(2) and stdout(1), any other usage of DEBUG_FD is deprecated. Override debug.log if you want to use a different log function (https://git.io/debug_fd)')()
+}
+
+var stream = 1 === fd ? process.stdout :
+ 2 === fd ? process.stderr :
+ createWritableStdioStream(fd);
+
+/**
+ * Is stdout a TTY? Colored output is enabled when `true`.
+ */
+
+function useColors() {
+ return 'colors' in exports.inspectOpts
+ ? Boolean(exports.inspectOpts.colors)
+ : tty.isatty(fd);
+}
+
+/**
+ * Map %o to `util.inspect()`, all on a single line.
+ */
+
+exports.formatters.o = function(v) {
+ this.inspectOpts.colors = this.useColors;
+ return util.inspect(v, this.inspectOpts)
+ .split('\n').map(function(str) {
+ return str.trim()
+ }).join(' ');
+};
+
+/**
+ * Map %o to `util.inspect()`, allowing multiple lines if needed.
+ */
+
+exports.formatters.O = function(v) {
+ this.inspectOpts.colors = this.useColors;
+ return util.inspect(v, this.inspectOpts);
+};
+
+/**
+ * Adds ANSI color escape codes if enabled.
+ *
+ * @api public
+ */
+
+function formatArgs(args) {
+ var name = this.namespace;
+ var useColors = this.useColors;
+
+ if (useColors) {
+ var c = this.color;
+ var prefix = ' \u001b[3' + c + ';1m' + name + ' ' + '\u001b[0m';
+
+ args[0] = prefix + args[0].split('\n').join('\n' + prefix);
+ args.push('\u001b[3' + c + 'm+' + exports.humanize(this.diff) + '\u001b[0m');
+ } else {
+ args[0] = new Date().toUTCString()
+ + ' ' + name + ' ' + args[0];
+ }
+}
+
+/**
+ * Invokes `util.format()` with the specified arguments and writes to `stream`.
+ */
+
+function log() {
+ return stream.write(util.format.apply(util, arguments) + '\n');
+}
+
+/**
+ * Save `namespaces`.
+ *
+ * @param {String} namespaces
+ * @api private
+ */
+
+function save(namespaces) {
+ if (null == namespaces) {
+ // If you set a process.env field to null or undefined, it gets cast to the
+ // string 'null' or 'undefined'. Just delete instead.
+ delete process.env.DEBUG;
+ } else {
+ process.env.DEBUG = namespaces;
+ }
+}
+
+/**
+ * Load `namespaces`.
+ *
+ * @return {String} returns the previously persisted debug modes
+ * @api private
+ */
+
+function load() {
+ return process.env.DEBUG;
+}
+
+/**
+ * Copied from `node/src/node.js`.
+ *
+ * XXX: It's lame that node doesn't expose this API out-of-the-box. It also
+ * relies on the undocumented `tty_wrap.guessHandleType()` which is also lame.
+ */
+
+function createWritableStdioStream (fd) {
+ var stream;
+ var tty_wrap = process.binding('tty_wrap');
+
+ // Note stream._type is used for test-module-load-list.js
+
+ switch (tty_wrap.guessHandleType(fd)) {
+ case 'TTY':
+ stream = new tty.WriteStream(fd);
+ stream._type = 'tty';
+
+ // Hack to have stream not keep the event loop alive.
+ // See https://github.com/joyent/node/issues/1726
+ if (stream._handle && stream._handle.unref) {
+ stream._handle.unref();
+ }
+ break;
+
+ case 'FILE':
+ var fs = require('fs');
+ stream = new fs.SyncWriteStream(fd, { autoClose: false });
+ stream._type = 'fs';
+ break;
+
+ case 'PIPE':
+ case 'TCP':
+ var net = require('net');
+ stream = new net.Socket({
+ fd: fd,
+ readable: false,
+ writable: true
+ });
+
+ // FIXME Should probably have an option in net.Socket to create a
+ // stream from an existing fd which is writable only. But for now
+ // we'll just add this hack and set the `readable` member to false.
+ // Test: ./node test/fixtures/echo.js < /etc/passwd
+ stream.readable = false;
+ stream.read = null;
+ stream._type = 'pipe';
+
+ // FIXME Hack to have stream not keep the event loop alive.
+ // See https://github.com/joyent/node/issues/1726
+ if (stream._handle && stream._handle.unref) {
+ stream._handle.unref();
+ }
+ break;
+
+ default:
+ // Probably an error on in uv_guess_handle()
+ throw new Error('Implement me. Unknown stream file type!');
+ }
+
+ // For supporting legacy API we put the FD here.
+ stream.fd = fd;
+
+ stream._isStdio = true;
+
+ return stream;
+}
+
+/**
+ * Init logic for `debug` instances.
+ *
+ * Create a new `inspectOpts` object in case `useColors` is set
+ * differently for a particular `debug` instance.
+ */
+
+function init (debug) {
+ debug.inspectOpts = {};
+
+ var keys = Object.keys(exports.inspectOpts);
+ for (var i = 0; i < keys.length; i++) {
+ debug.inspectOpts[keys[i]] = exports.inspectOpts[keys[i]];
+ }
+}
+
+/**
+ * Enable namespaces listed in `process.env.DEBUG` initially.
+ */
+
+exports.enable(load());
diff --git a/node_modules/define-data-property/.eslintrc b/node_modules/define-data-property/.eslintrc
new file mode 100644
index 0000000..75443e8
--- /dev/null
+++ b/node_modules/define-data-property/.eslintrc
@@ -0,0 +1,24 @@
+{
+ "root": true,
+
+ "extends": "@ljharb",
+
+ "rules": {
+ "complexity": 0,
+ "id-length": 0,
+ "new-cap": ["error", {
+ "capIsNewExceptions": [
+ "GetIntrinsic",
+ ],
+ }],
+ },
+
+ "overrides": [
+ {
+ "files": "test/**",
+ "rules": {
+ "max-lines-per-function": "off",
+ },
+ },
+ ],
+}
diff --git a/node_modules/define-data-property/.github/FUNDING.yml b/node_modules/define-data-property/.github/FUNDING.yml
new file mode 100644
index 0000000..3e17725
--- /dev/null
+++ b/node_modules/define-data-property/.github/FUNDING.yml
@@ -0,0 +1,12 @@
+# These are supported funding model platforms
+
+github: [ljharb]
+patreon: # Replace with a single Patreon username
+open_collective: # Replace with a single Open Collective username
+ko_fi: # Replace with a single Ko-fi username
+tidelift: npm/define-data-property
+community_bridge: # Replace with a single Community Bridge project-name e.g., cloud-foundry
+liberapay: # Replace with a single Liberapay username
+issuehunt: # Replace with a single IssueHunt username
+otechie: # Replace with a single Otechie username
+custom: # Replace with up to 4 custom sponsorship URLs e.g., ['link1', 'link2']
diff --git a/node_modules/define-data-property/.nycrc b/node_modules/define-data-property/.nycrc
new file mode 100644
index 0000000..1826526
--- /dev/null
+++ b/node_modules/define-data-property/.nycrc
@@ -0,0 +1,13 @@
+{
+ "all": true,
+ "check-coverage": false,
+ "reporter": ["text-summary", "text", "html", "json"],
+ "lines": 86,
+ "statements": 85.93,
+ "functions": 82.43,
+ "branches": 76.06,
+ "exclude": [
+ "coverage",
+ "test"
+ ]
+}
diff --git a/node_modules/define-data-property/CHANGELOG.md b/node_modules/define-data-property/CHANGELOG.md
new file mode 100644
index 0000000..4eed75e
--- /dev/null
+++ b/node_modules/define-data-property/CHANGELOG.md
@@ -0,0 +1,70 @@
+# Changelog
+
+All notable changes to this project will be documented in this file.
+
+The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.0.0/)
+and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0.html).
+
+## [v1.1.4](https://github.com/ljharb/define-data-property/compare/v1.1.3...v1.1.4) - 2024-02-13
+
+### Commits
+
+- [Refactor] use `es-define-property` [`90f2f4c`](https://github.com/ljharb/define-data-property/commit/90f2f4cc20298401e71c28e1e08888db12021453)
+- [Dev Deps] update `@types/object.getownpropertydescriptors` [`cd929d9`](https://github.com/ljharb/define-data-property/commit/cd929d9a04f5f2fdcfa9d5be140940b91a083153)
+
+## [v1.1.3](https://github.com/ljharb/define-data-property/compare/v1.1.2...v1.1.3) - 2024-02-12
+
+### Commits
+
+- [types] hand-write d.ts instead of emitting it [`0cbc988`](https://github.com/ljharb/define-data-property/commit/0cbc988203c105f2d97948327c7167ebd33bd318)
+- [meta] simplify `exports` [`690781e`](https://github.com/ljharb/define-data-property/commit/690781eed28bbf2d6766237efda0ba6dd591609e)
+- [Dev Deps] update `hasown`; clean up DT packages [`6cdfd1c`](https://github.com/ljharb/define-data-property/commit/6cdfd1cb2d91d791bfd18cda5d5cab232fd5d8fc)
+- [actions] cleanup [`3142bc6`](https://github.com/ljharb/define-data-property/commit/3142bc6a4bc406a51f5b04f31e98562a27f35ffd)
+- [meta] add `funding` [`8474423`](https://github.com/ljharb/define-data-property/commit/847442391a79779af3e0f1bf0b5bb923552b7804)
+- [Deps] update `get-intrinsic` [`3e9be00`](https://github.com/ljharb/define-data-property/commit/3e9be00e07784ba34e7c77d8bc0fdbc832ad61de)
+
+## [v1.1.2](https://github.com/ljharb/define-data-property/compare/v1.1.1...v1.1.2) - 2024-02-05
+
+### Commits
+
+- [Dev Deps] update @types packages, `object-inspect`, `tape`, `typescript` [`df41bf8`](https://github.com/ljharb/define-data-property/commit/df41bf84ca3456be6226055caab44e38e3a7fd2f)
+- [Dev Deps] update DT packages, `aud`, `npmignore`, `tape`, typescript` [`fab0e4e`](https://github.com/ljharb/define-data-property/commit/fab0e4ec709ee02b79f42d6db3ee5f26e0a34b8a)
+- [Dev Deps] use `hasown` instead of `has` [`aa51ef9`](https://github.com/ljharb/define-data-property/commit/aa51ef93f6403d49d9bb72a807bcdb6e418978c0)
+- [Refactor] use `es-errors`, so things that only need those do not need `get-intrinsic` [`d89be50`](https://github.com/ljharb/define-data-property/commit/d89be50571175888d391238605122679f7e65ffc)
+- [Deps] update `has-property-descriptors` [`7af887c`](https://github.com/ljharb/define-data-property/commit/7af887c9083b59b195b0079e04815cfed9fcee2b)
+- [Deps] update `get-intrinsic` [`bb8728e`](https://github.com/ljharb/define-data-property/commit/bb8728ec42cd998505a7157ae24853a560c20646)
+
+## [v1.1.1](https://github.com/ljharb/define-data-property/compare/v1.1.0...v1.1.1) - 2023-10-12
+
+### Commits
+
+- [Tests] fix tests in ES3 engines [`5c6920e`](https://github.com/ljharb/define-data-property/commit/5c6920edd1f52f675b02f417e539c28135b43f94)
+- [Dev Deps] update `@types/es-value-fixtures`, `@types/for-each`, `@types/gopd`, `@types/has-property-descriptors`, `tape`, `typescript` [`7d82dfc`](https://github.com/ljharb/define-data-property/commit/7d82dfc20f778b4465bba06335dd53f6f431aea3)
+- [Fix] IE 8 has a broken `Object.defineProperty` [`0672e1a`](https://github.com/ljharb/define-data-property/commit/0672e1af2a9fcc787e7c23b96dea60d290df5548)
+- [meta] emit types on prepack [`73acb1f`](https://github.com/ljharb/define-data-property/commit/73acb1f903c21b314ec7156bf10f73c7910530c0)
+- [Dev Deps] update `tape`, `typescript` [`9489a77`](https://github.com/ljharb/define-data-property/commit/9489a7738bf2ecf0ac71d5b78ec4ca6ad7ba0142)
+
+## [v1.1.0](https://github.com/ljharb/define-data-property/compare/v1.0.1...v1.1.0) - 2023-09-13
+
+### Commits
+
+- [New] add `loose` arg [`155235a`](https://github.com/ljharb/define-data-property/commit/155235a4c4d7741f6de01cd87c99599a56654b72)
+- [New] allow `null` to be passed for the non* args [`7d2fa5f`](https://github.com/ljharb/define-data-property/commit/7d2fa5f06be0392736c13b126f7cd38979f34792)
+
+## [v1.0.1](https://github.com/ljharb/define-data-property/compare/v1.0.0...v1.0.1) - 2023-09-12
+
+### Commits
+
+- [meta] add TS types [`43d763c`](https://github.com/ljharb/define-data-property/commit/43d763c6c883f652de1c9c02ef6216ee507ffa69)
+- [Dev Deps] update `@types/tape`, `typescript` [`f444985`](https://github.com/ljharb/define-data-property/commit/f444985811c36f3e6448a03ad2f9b7898917f4c7)
+- [meta] add `safe-publish-latest`, [`172bb10`](https://github.com/ljharb/define-data-property/commit/172bb10890896ebb160e64398f6ee55760107bee)
+
+## v1.0.0 - 2023-09-12
+
+### Commits
+
+- Initial implementation, tests, readme [`5b43d6b`](https://github.com/ljharb/define-data-property/commit/5b43d6b44e675a904810467a7d4e0adb7efc3196)
+- Initial commit [`35e577a`](https://github.com/ljharb/define-data-property/commit/35e577a6ba59a98befa97776d70d90f3bea9009d)
+- npm init [`82a0a04`](https://github.com/ljharb/define-data-property/commit/82a0a04a321ca7de220af02d41e2745e8a9962ed)
+- Only apps should have lockfiles [`96df244`](https://github.com/ljharb/define-data-property/commit/96df244a3c6f426f9a2437be825d1c6f5dd7158e)
+- [meta] use `npmignore` to autogenerate an npmignore file [`a87ff18`](https://github.com/ljharb/define-data-property/commit/a87ff18cb79e14c2eb5720486c4759fd9a189375)
diff --git a/node_modules/define-data-property/LICENSE b/node_modules/define-data-property/LICENSE
new file mode 100644
index 0000000..b4213ac
--- /dev/null
+++ b/node_modules/define-data-property/LICENSE
@@ -0,0 +1,21 @@
+MIT License
+
+Copyright (c) 2023 Jordan Harband
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
+SOFTWARE.
diff --git a/node_modules/define-data-property/README.md b/node_modules/define-data-property/README.md
new file mode 100644
index 0000000..f2304da
--- /dev/null
+++ b/node_modules/define-data-property/README.md
@@ -0,0 +1,67 @@
+# define-data-property [![Version Badge][npm-version-svg]][package-url]
+
+[![github actions][actions-image]][actions-url]
+[![coverage][codecov-image]][codecov-url]
+[![License][license-image]][license-url]
+[![Downloads][downloads-image]][downloads-url]
+
+[![npm badge][npm-badge-png]][package-url]
+
+Define a data property on an object. Will fall back to assignment in an engine without descriptors.
+
+The three `non*` argument can also be passed `null`, which will use the existing state if available.
+
+The `loose` argument will mean that if you attempt to set a non-normal data property, in an environment without descriptor support, it will fall back to normal assignment.
+
+## Usage
+
+```javascript
+var defineDataProperty = require('define-data-property');
+var assert = require('assert');
+
+var obj = {};
+defineDataProperty(obj, 'key', 'value');
+defineDataProperty(
+ obj,
+ 'key2',
+ 'value',
+ true, // nonEnumerable, optional
+ false, // nonWritable, optional
+ true, // nonConfigurable, optional
+ false // loose, optional
+);
+
+assert.deepEqual(
+ Object.getOwnPropertyDescriptors(obj),
+ {
+ key: {
+ configurable: true,
+ enumerable: true,
+ value: 'value',
+ writable: true,
+ },
+ key2: {
+ configurable: false,
+ enumerable: false,
+ value: 'value',
+ writable: true,
+ },
+ }
+);
+```
+
+[package-url]: https://npmjs.org/package/define-data-property
+[npm-version-svg]: https://versionbadg.es/ljharb/define-data-property.svg
+[deps-svg]: https://david-dm.org/ljharb/define-data-property.svg
+[deps-url]: https://david-dm.org/ljharb/define-data-property
+[dev-deps-svg]: https://david-dm.org/ljharb/define-data-property/dev-status.svg
+[dev-deps-url]: https://david-dm.org/ljharb/define-data-property#info=devDependencies
+[npm-badge-png]: https://nodei.co/npm/define-data-property.png?downloads=true&stars=true
+[license-image]: https://img.shields.io/npm/l/define-data-property.svg
+[license-url]: LICENSE
+[downloads-image]: https://img.shields.io/npm/dm/define-data-property.svg
+[downloads-url]: https://npm-stat.com/charts.html?package=define-data-property
+[codecov-image]: https://codecov.io/gh/ljharb/define-data-property/branch/main/graphs/badge.svg
+[codecov-url]: https://app.codecov.io/gh/ljharb/define-data-property/
+[actions-image]: https://img.shields.io/endpoint?url=https://github-actions-badge-u3jn4tfpocch.runkit.sh/ljharb/define-data-property
+[actions-url]: https://github.com/ljharb/define-data-property/actions
diff --git a/node_modules/define-data-property/index.d.ts b/node_modules/define-data-property/index.d.ts
new file mode 100644
index 0000000..b56a77d
--- /dev/null
+++ b/node_modules/define-data-property/index.d.ts
@@ -0,0 +1,12 @@
+
+declare function defineDataProperty(
+ obj: Record,
+ property: keyof typeof obj,
+ value: typeof obj[typeof property],
+ nonEnumerable?: boolean | null,
+ nonWritable?: boolean | null,
+ nonConfigurable?: boolean | null,
+ loose?: boolean
+): void;
+
+export = defineDataProperty;
\ No newline at end of file
diff --git a/node_modules/define-data-property/index.js b/node_modules/define-data-property/index.js
new file mode 100644
index 0000000..e1a38c0
--- /dev/null
+++ b/node_modules/define-data-property/index.js
@@ -0,0 +1,56 @@
+'use strict';
+
+var $defineProperty = require('es-define-property');
+
+var $SyntaxError = require('es-errors/syntax');
+var $TypeError = require('es-errors/type');
+
+var gopd = require('gopd');
+
+/** @type {import('.')} */
+module.exports = function defineDataProperty(
+ obj,
+ property,
+ value
+) {
+ if (!obj || (typeof obj !== 'object' && typeof obj !== 'function')) {
+ throw new $TypeError('`obj` must be an object or a function`');
+ }
+ if (typeof property !== 'string' && typeof property !== 'symbol') {
+ throw new $TypeError('`property` must be a string or a symbol`');
+ }
+ if (arguments.length > 3 && typeof arguments[3] !== 'boolean' && arguments[3] !== null) {
+ throw new $TypeError('`nonEnumerable`, if provided, must be a boolean or null');
+ }
+ if (arguments.length > 4 && typeof arguments[4] !== 'boolean' && arguments[4] !== null) {
+ throw new $TypeError('`nonWritable`, if provided, must be a boolean or null');
+ }
+ if (arguments.length > 5 && typeof arguments[5] !== 'boolean' && arguments[5] !== null) {
+ throw new $TypeError('`nonConfigurable`, if provided, must be a boolean or null');
+ }
+ if (arguments.length > 6 && typeof arguments[6] !== 'boolean') {
+ throw new $TypeError('`loose`, if provided, must be a boolean');
+ }
+
+ var nonEnumerable = arguments.length > 3 ? arguments[3] : null;
+ var nonWritable = arguments.length > 4 ? arguments[4] : null;
+ var nonConfigurable = arguments.length > 5 ? arguments[5] : null;
+ var loose = arguments.length > 6 ? arguments[6] : false;
+
+ /* @type {false | TypedPropertyDescriptor} */
+ var desc = !!gopd && gopd(obj, property);
+
+ if ($defineProperty) {
+ $defineProperty(obj, property, {
+ configurable: nonConfigurable === null && desc ? desc.configurable : !nonConfigurable,
+ enumerable: nonEnumerable === null && desc ? desc.enumerable : !nonEnumerable,
+ value: value,
+ writable: nonWritable === null && desc ? desc.writable : !nonWritable
+ });
+ } else if (loose || (!nonEnumerable && !nonWritable && !nonConfigurable)) {
+ // must fall back to [[Set]], and was not explicitly asked to make non-enumerable, non-writable, or non-configurable
+ obj[property] = value; // eslint-disable-line no-param-reassign
+ } else {
+ throw new $SyntaxError('This environment does not support defining a property as non-configurable, non-writable, or non-enumerable.');
+ }
+};
diff --git a/node_modules/define-data-property/package.json b/node_modules/define-data-property/package.json
new file mode 100644
index 0000000..eec4097
--- /dev/null
+++ b/node_modules/define-data-property/package.json
@@ -0,0 +1,106 @@
+{
+ "name": "define-data-property",
+ "version": "1.1.4",
+ "description": "Define a data property on an object. Will fall back to assignment in an engine without descriptors.",
+ "main": "index.js",
+ "types": "./index.d.ts",
+ "exports": {
+ ".": "./index.js",
+ "./package.json": "./package.json"
+ },
+ "sideEffects": false,
+ "scripts": {
+ "prepack": "npmignore --auto --commentLines=autogenerated",
+ "prepublish": "not-in-publish || npm run prepublishOnly",
+ "prepublishOnly": "safe-publish-latest",
+ "tsc": "tsc -p .",
+ "prelint": "evalmd README.md",
+ "lint": "eslint --ext=js,mjs .",
+ "postlint": "npm run tsc",
+ "pretest": "npm run lint",
+ "tests-only": "nyc tape 'test/**/*.js'",
+ "test": "npm run tests-only",
+ "posttest": "aud --production",
+ "version": "auto-changelog && git add CHANGELOG.md",
+ "postversion": "auto-changelog && git add CHANGELOG.md && git commit --no-edit --amend && git tag -f \"v$(node -e \"console.log(require('./package.json').version)\")\""
+ },
+ "repository": {
+ "type": "git",
+ "url": "git+https://github.com/ljharb/define-data-property.git"
+ },
+ "keywords": [
+ "define",
+ "data",
+ "property",
+ "object",
+ "accessor",
+ "javascript",
+ "ecmascript",
+ "enumerable",
+ "configurable",
+ "writable"
+ ],
+ "author": "Jordan Harband ",
+ "funding": {
+ "url": "https://github.com/sponsors/ljharb"
+ },
+ "license": "MIT",
+ "bugs": {
+ "url": "https://github.com/ljharb/define-data-property/issues"
+ },
+ "homepage": "https://github.com/ljharb/define-data-property#readme",
+ "dependencies": {
+ "es-define-property": "^1.0.0",
+ "es-errors": "^1.3.0",
+ "gopd": "^1.0.1"
+ },
+ "devDependencies": {
+ "@ljharb/eslint-config": "^21.1.0",
+ "@types/call-bind": "^1.0.5",
+ "@types/define-properties": "^1.1.5",
+ "@types/es-value-fixtures": "^1.4.4",
+ "@types/for-each": "^0.3.3",
+ "@types/get-intrinsic": "^1.2.2",
+ "@types/gopd": "^1.0.3",
+ "@types/has-property-descriptors": "^1.0.3",
+ "@types/object-inspect": "^1.8.4",
+ "@types/object.getownpropertydescriptors": "^2.1.4",
+ "@types/tape": "^5.6.4",
+ "aud": "^2.0.4",
+ "auto-changelog": "^2.4.0",
+ "es-value-fixtures": "^1.4.2",
+ "eslint": "=8.8.0",
+ "evalmd": "^0.0.19",
+ "for-each": "^0.3.3",
+ "hasown": "^2.0.1",
+ "in-publish": "^2.0.1",
+ "npmignore": "^0.3.1",
+ "nyc": "^10.3.2",
+ "object-inspect": "^1.13.1",
+ "object.getownpropertydescriptors": "^2.1.7",
+ "reflect.ownkeys": "^1.1.4",
+ "safe-publish-latest": "^2.0.0",
+ "tape": "^5.7.4",
+ "typescript": "next"
+ },
+ "engines": {
+ "node": ">= 0.4"
+ },
+ "testling": {
+ "files": "test/index.js"
+ },
+ "auto-changelog": {
+ "output": "CHANGELOG.md",
+ "template": "keepachangelog",
+ "unreleased": false,
+ "commitLimit": false,
+ "backfillLimit": false,
+ "hideCredit": true
+ },
+ "publishConfig": {
+ "ignore": [
+ ".github/workflows",
+ "types/reflect.ownkeys"
+ ]
+ }
+}
diff --git a/node_modules/define-data-property/test/index.js b/node_modules/define-data-property/test/index.js
new file mode 100644
index 0000000..68204c6
--- /dev/null
+++ b/node_modules/define-data-property/test/index.js
@@ -0,0 +1,392 @@
+'use strict';
+
+var test = require('tape');
+var v = require('es-value-fixtures');
+var forEach = require('for-each');
+var inspect = require('object-inspect');
+var hasOwn = require('hasown');
+var hasPropertyDescriptors = require('has-property-descriptors')();
+var getOwnPropertyDescriptors = require('object.getownpropertydescriptors');
+var ownKeys = require('reflect.ownkeys');
+
+var defineDataProperty = require('../');
+
+test('defineDataProperty', function (t) {
+ t.test('argument validation', function (st) {
+ forEach(v.primitives, function (nonObject) {
+ st['throws'](
+ // @ts-expect-error
+ function () { defineDataProperty(nonObject, 'key', 'value'); },
+ TypeError,
+ 'throws on non-object input: ' + inspect(nonObject)
+ );
+ });
+
+ forEach(v.nonPropertyKeys, function (nonPropertyKey) {
+ st['throws'](
+ // @ts-expect-error
+ function () { defineDataProperty({}, nonPropertyKey, 'value'); },
+ TypeError,
+ 'throws on non-PropertyKey input: ' + inspect(nonPropertyKey)
+ );
+ });
+
+ forEach(v.nonBooleans, function (nonBoolean) {
+ if (nonBoolean !== null) {
+ st['throws'](
+ // @ts-expect-error
+ function () { defineDataProperty({}, 'key', 'value', nonBoolean); },
+ TypeError,
+ 'throws on non-boolean nonEnumerable: ' + inspect(nonBoolean)
+ );
+
+ st['throws'](
+ // @ts-expect-error
+ function () { defineDataProperty({}, 'key', 'value', false, nonBoolean); },
+ TypeError,
+ 'throws on non-boolean nonWritable: ' + inspect(nonBoolean)
+ );
+
+ st['throws'](
+ // @ts-expect-error
+ function () { defineDataProperty({}, 'key', 'value', false, false, nonBoolean); },
+ TypeError,
+ 'throws on non-boolean nonConfigurable: ' + inspect(nonBoolean)
+ );
+ }
+ });
+
+ st.end();
+ });
+
+ t.test('normal data property', function (st) {
+ /** @type {Record} */
+ var obj = { existing: 'existing property' };
+ st.ok(hasOwn(obj, 'existing'), 'has initial own property');
+ st.equal(obj.existing, 'existing property', 'has expected initial value');
+
+ var res = defineDataProperty(obj, 'added', 'added property');
+ st.equal(res, void undefined, 'returns `undefined`');
+ st.ok(hasOwn(obj, 'added'), 'has expected own property');
+ st.equal(obj.added, 'added property', 'has expected value');
+
+ defineDataProperty(obj, 'existing', 'new value');
+ st.ok(hasOwn(obj, 'existing'), 'still has expected own property');
+ st.equal(obj.existing, 'new value', 'has new expected value');
+
+ defineDataProperty(obj, 'explicit1', 'new value', false);
+ st.ok(hasOwn(obj, 'explicit1'), 'has expected own property (explicit enumerable)');
+ st.equal(obj.explicit1, 'new value', 'has new expected value (explicit enumerable)');
+
+ defineDataProperty(obj, 'explicit2', 'new value', false, false);
+ st.ok(hasOwn(obj, 'explicit2'), 'has expected own property (explicit writable)');
+ st.equal(obj.explicit2, 'new value', 'has new expected value (explicit writable)');
+
+ defineDataProperty(obj, 'explicit3', 'new value', false, false, false);
+ st.ok(hasOwn(obj, 'explicit3'), 'has expected own property (explicit configurable)');
+ st.equal(obj.explicit3, 'new value', 'has new expected value (explicit configurable)');
+
+ st.end();
+ });
+
+ t.test('loose mode', { skip: !hasPropertyDescriptors }, function (st) {
+ var obj = { existing: 'existing property' };
+
+ defineDataProperty(obj, 'added', 'added value 1', true, null, null, true);
+ st.deepEqual(
+ getOwnPropertyDescriptors(obj),
+ {
+ existing: {
+ configurable: true,
+ enumerable: true,
+ value: 'existing property',
+ writable: true
+ },
+ added: {
+ configurable: true,
+ enumerable: !hasPropertyDescriptors,
+ value: 'added value 1',
+ writable: true
+ }
+ },
+ 'in loose mode, obj still adds property 1'
+ );
+
+ defineDataProperty(obj, 'added', 'added value 2', false, true, null, true);
+ st.deepEqual(
+ getOwnPropertyDescriptors(obj),
+ {
+ existing: {
+ configurable: true,
+ enumerable: true,
+ value: 'existing property',
+ writable: true
+ },
+ added: {
+ configurable: true,
+ enumerable: true,
+ value: 'added value 2',
+ writable: !hasPropertyDescriptors
+ }
+ },
+ 'in loose mode, obj still adds property 2'
+ );
+
+ defineDataProperty(obj, 'added', 'added value 3', false, false, true, true);
+ st.deepEqual(
+ getOwnPropertyDescriptors(obj),
+ {
+ existing: {
+ configurable: true,
+ enumerable: true,
+ value: 'existing property',
+ writable: true
+ },
+ added: {
+ configurable: !hasPropertyDescriptors,
+ enumerable: true,
+ value: 'added value 3',
+ writable: true
+ }
+ },
+ 'in loose mode, obj still adds property 3'
+ );
+
+ st.end();
+ });
+
+ t.test('non-normal data property, ES3', { skip: hasPropertyDescriptors }, function (st) {
+ /** @type {Record} */
+ var obj = { existing: 'existing property' };
+
+ st['throws'](
+ function () { defineDataProperty(obj, 'added', 'added value', true); },
+ SyntaxError,
+ 'nonEnumerable throws a Syntax Error'
+ );
+
+ st['throws'](
+ function () { defineDataProperty(obj, 'added', 'added value', false, true); },
+ SyntaxError,
+ 'nonWritable throws a Syntax Error'
+ );
+
+ st['throws'](
+ function () { defineDataProperty(obj, 'added', 'added value', false, false, true); },
+ SyntaxError,
+ 'nonWritable throws a Syntax Error'
+ );
+
+ st.deepEqual(
+ ownKeys(obj),
+ ['existing'],
+ 'obj still has expected keys'
+ );
+ st.equal(obj.existing, 'existing property', 'obj still has expected values');
+
+ st.end();
+ });
+
+ t.test('new non-normal data property, ES5+', { skip: !hasPropertyDescriptors }, function (st) {
+ /** @type {Record} */
+ var obj = { existing: 'existing property' };
+
+ defineDataProperty(obj, 'nonEnum', null, true);
+ defineDataProperty(obj, 'nonWrit', null, false, true);
+ defineDataProperty(obj, 'nonConf', null, false, false, true);
+
+ st.deepEqual(
+ getOwnPropertyDescriptors(obj),
+ {
+ existing: {
+ configurable: true,
+ enumerable: true,
+ value: 'existing property',
+ writable: true
+ },
+ nonEnum: {
+ configurable: true,
+ enumerable: false,
+ value: null,
+ writable: true
+ },
+ nonWrit: {
+ configurable: true,
+ enumerable: true,
+ value: null,
+ writable: false
+ },
+ nonConf: {
+ configurable: false,
+ enumerable: true,
+ value: null,
+ writable: true
+ }
+ },
+ 'obj has expected property descriptors'
+ );
+
+ st.end();
+ });
+
+ t.test('existing non-normal data property, ES5+', { skip: !hasPropertyDescriptors }, function (st) {
+ // test case changing an existing non-normal property
+
+ /** @type {Record} */
+ var obj = {};
+ Object.defineProperty(obj, 'nonEnum', { configurable: true, enumerable: false, value: null, writable: true });
+ Object.defineProperty(obj, 'nonWrit', { configurable: true, enumerable: true, value: null, writable: false });
+ Object.defineProperty(obj, 'nonConf', { configurable: false, enumerable: true, value: null, writable: true });
+
+ st.deepEqual(
+ getOwnPropertyDescriptors(obj),
+ {
+ nonEnum: {
+ configurable: true,
+ enumerable: false,
+ value: null,
+ writable: true
+ },
+ nonWrit: {
+ configurable: true,
+ enumerable: true,
+ value: null,
+ writable: false
+ },
+ nonConf: {
+ configurable: false,
+ enumerable: true,
+ value: null,
+ writable: true
+ }
+ },
+ 'obj initially has expected property descriptors'
+ );
+
+ defineDataProperty(obj, 'nonEnum', 'new value', false);
+ defineDataProperty(obj, 'nonWrit', 'new value', false, false);
+ st['throws'](
+ function () { defineDataProperty(obj, 'nonConf', 'new value', false, false, false); },
+ TypeError,
+ 'can not alter a nonconfigurable property'
+ );
+
+ st.deepEqual(
+ getOwnPropertyDescriptors(obj),
+ {
+ nonEnum: {
+ configurable: true,
+ enumerable: true,
+ value: 'new value',
+ writable: true
+ },
+ nonWrit: {
+ configurable: true,
+ enumerable: true,
+ value: 'new value',
+ writable: true
+ },
+ nonConf: {
+ configurable: false,
+ enumerable: true,
+ value: null,
+ writable: true
+ }
+ },
+ 'obj ends up with expected property descriptors'
+ );
+
+ st.end();
+ });
+
+ t.test('frozen object, ES5+', { skip: !hasPropertyDescriptors }, function (st) {
+ var frozen = Object.freeze({ existing: true });
+
+ st['throws'](
+ function () { defineDataProperty(frozen, 'existing', 'new value'); },
+ TypeError,
+ 'frozen object can not modify an existing property'
+ );
+
+ st['throws'](
+ function () { defineDataProperty(frozen, 'new', 'new property'); },
+ TypeError,
+ 'frozen object can not add a new property'
+ );
+
+ st.end();
+ });
+
+ t.test('sealed object, ES5+', { skip: !hasPropertyDescriptors }, function (st) {
+ var sealed = Object.seal({ existing: true });
+ st.deepEqual(
+ Object.getOwnPropertyDescriptor(sealed, 'existing'),
+ {
+ configurable: false,
+ enumerable: true,
+ value: true,
+ writable: true
+ },
+ 'existing value on sealed object has expected descriptor'
+ );
+
+ defineDataProperty(sealed, 'existing', 'new value');
+
+ st.deepEqual(
+ Object.getOwnPropertyDescriptor(sealed, 'existing'),
+ {
+ configurable: false,
+ enumerable: true,
+ value: 'new value',
+ writable: true
+ },
+ 'existing value on sealed object has changed descriptor'
+ );
+
+ st['throws'](
+ function () { defineDataProperty(sealed, 'new', 'new property'); },
+ TypeError,
+ 'sealed object can not add a new property'
+ );
+
+ st.end();
+ });
+
+ t.test('nonextensible object, ES5+', { skip: !hasPropertyDescriptors }, function (st) {
+ var nonExt = Object.preventExtensions({ existing: true });
+
+ st.deepEqual(
+ Object.getOwnPropertyDescriptor(nonExt, 'existing'),
+ {
+ configurable: true,
+ enumerable: true,
+ value: true,
+ writable: true
+ },
+ 'existing value on non-extensible object has expected descriptor'
+ );
+
+ defineDataProperty(nonExt, 'existing', 'new value', true);
+
+ st.deepEqual(
+ Object.getOwnPropertyDescriptor(nonExt, 'existing'),
+ {
+ configurable: true,
+ enumerable: false,
+ value: 'new value',
+ writable: true
+ },
+ 'existing value on non-extensible object has changed descriptor'
+ );
+
+ st['throws'](
+ function () { defineDataProperty(nonExt, 'new', 'new property'); },
+ TypeError,
+ 'non-extensible object can not add a new property'
+ );
+
+ st.end();
+ });
+
+ t.end();
+});
diff --git a/node_modules/define-data-property/tsconfig.json b/node_modules/define-data-property/tsconfig.json
new file mode 100644
index 0000000..69f060d
--- /dev/null
+++ b/node_modules/define-data-property/tsconfig.json
@@ -0,0 +1,59 @@
+{
+ "compilerOptions": {
+ /* Visit https://aka.ms/tsconfig to read more about this file */
+
+ /* Projects */
+
+ /* Language and Environment */
+ "target": "es2022", /* Set the JavaScript language version for emitted JavaScript and include compatible library declarations. */
+ // "lib": [], /* Specify a set of bundled library declaration files that describe the target runtime environment. */
+ // "noLib": true, /* Disable including any library files, including the default lib.d.ts. */
+ "useDefineForClassFields": true, /* Emit ECMAScript-standard-compliant class fields. */
+ // "moduleDetection": "auto", /* Control what method is used to detect module-format JS files. */
+
+ /* Modules */
+ "module": "commonjs", /* Specify what module code is generated. */
+ // "rootDir": "./", /* Specify the root folder within your source files. */
+ // "moduleResolution": "node10", /* Specify how TypeScript looks up a file from a given module specifier. */
+ // "baseUrl": "./", /* Specify the base directory to resolve non-relative module names. */
+ // "paths": {}, /* Specify a set of entries that re-map imports to additional lookup locations. */
+ // "rootDirs": [], /* Allow multiple folders to be treated as one when resolving modules. */
+ "typeRoots": ["types"], /* Specify multiple folders that act like './node_modules/@types'. */
+ "resolveJsonModule": true, /* Enable importing .json files. */
+
+ /* JavaScript Support */
+ "allowJs": true, /* Allow JavaScript files to be a part of your program. Use the 'checkJS' option to get errors from these files. */
+ "checkJs": true, /* Enable error reporting in type-checked JavaScript files. */
+ "maxNodeModuleJsDepth": 1, /* Specify the maximum folder depth used for checking JavaScript files from 'node_modules'. Only applicable with 'allowJs'. */
+
+ /* Emit */
+ "declaration": true, /* Generate .d.ts files from TypeScript and JavaScript files in your project. */
+ "declarationMap": true, /* Create sourcemaps for d.ts files. */
+ // "emitDeclarationOnly": true, /* Only output d.ts files and not JavaScript files. */
+ "noEmit": true, /* Disable emitting files from a compilation. */
+
+ /* Interop Constraints */
+ "allowSyntheticDefaultImports": true, /* Allow 'import x from y' when a module doesn't have a default export. */
+ "esModuleInterop": true, /* Emit additional JavaScript to ease support for importing CommonJS modules. This enables 'allowSyntheticDefaultImports' for type compatibility. */
+ "forceConsistentCasingInFileNames": true, /* Ensure that casing is correct in imports. */
+
+ /* Type Checking */
+ "strict": true, /* Enable all strict type-checking options. */
+ "noImplicitAny": true, /* Enable error reporting for expressions and declarations with an implied 'any' type. */
+ "noImplicitThis": true, /* Enable error reporting when 'this' is given the type 'any'. */
+ "useUnknownInCatchVariables": true, /* Default catch clause variables as 'unknown' instead of 'any'. */
+ "noUnusedLocals": true, /* Enable error reporting when local variables aren't read. */
+ "noUnusedParameters": true, /* Raise an error when a function parameter isn't read. */
+ "noImplicitReturns": true, /* Enable error reporting for codepaths that do not explicitly return in a function. */
+ "noFallthroughCasesInSwitch": true, /* Enable error reporting for fallthrough cases in switch statements. */
+ "noUncheckedIndexedAccess": true, /* Add 'undefined' to a type when accessed using an index. */
+ "noImplicitOverride": true, /* Ensure overriding members in derived classes are marked with an override modifier. */
+ // "noPropertyAccessFromIndexSignature": true, /* Enforces using indexed accessors for keys declared using an indexed type. */
+
+ /* Completeness */
+ // "skipLibCheck": true /* Skip type checking all .d.ts files. */
+ },
+ "exclude": [
+ "coverage"
+ ]
+}
diff --git a/node_modules/denque/CHANGELOG.md b/node_modules/denque/CHANGELOG.md
new file mode 100644
index 0000000..391a1f5
--- /dev/null
+++ b/node_modules/denque/CHANGELOG.md
@@ -0,0 +1,29 @@
+## 2.1.0
+
+ - fix: issue where `clear()` is still keeping references to the elements (#47)
+ - refactor: performance optimizations for growth and array copy (#43)
+ - refactor: performance optimizations for toArray and fromArray (#46)
+ - test: add additional benchmarks for queue growth and `toArray` (#45)
+
+## 2.0.1
+
+ - fix(types): incorrect return type on `size()`
+
+## 2.0.0
+
+ - fix!: `push` & `unshift` now accept `undefined` values to match behaviour of `Array` (fixes #25) (#35)
+ - This is only a **BREAKING** change if you are currently expecting `push(undefined)` and `unshift(undefined)` to do
+ nothing - the new behaviour now correctly adds undefined values to the queue.
+ - **Note**: behaviour of `push()` & `unshift()` (no arguments) remains unchanged (nothing gets added to the queue).
+ - **Note**: If you need to differentiate between `undefined` values in the queue and the return value of `pop()` then
+ check the queue `.length` before popping.
+ - fix: incorrect methods in types definition file
+
+## 1.5.1
+
+ - perf: minor performance tweak when growing queue size (#29)
+
+## 1.5.0
+
+ - feat: adds capacity option for circular buffers (#27)
+
diff --git a/node_modules/denque/LICENSE b/node_modules/denque/LICENSE
new file mode 100644
index 0000000..c9cde92
--- /dev/null
+++ b/node_modules/denque/LICENSE
@@ -0,0 +1,201 @@
+ Apache License
+ Version 2.0, January 2004
+ http://www.apache.org/licenses/
+
+ TERMS AND CONDITIONS FOR USE, REPRODUCTION, AND DISTRIBUTION
+
+ 1. Definitions.
+
+ "License" shall mean the terms and conditions for use, reproduction,
+ and distribution as defined by Sections 1 through 9 of this document.
+
+ "Licensor" shall mean the copyright owner or entity authorized by
+ the copyright owner that is granting the License.
+
+ "Legal Entity" shall mean the union of the acting entity and all
+ other entities that control, are controlled by, or are under common
+ control with that entity. For the purposes of this definition,
+ "control" means (i) the power, direct or indirect, to cause the
+ direction or management of such entity, whether by contract or
+ otherwise, or (ii) ownership of fifty percent (50%) or more of the
+ outstanding shares, or (iii) beneficial ownership of such entity.
+
+ "You" (or "Your") shall mean an individual or Legal Entity
+ exercising permissions granted by this License.
+
+ "Source" form shall mean the preferred form for making modifications,
+ including but not limited to software source code, documentation
+ source, and configuration files.
+
+ "Object" form shall mean any form resulting from mechanical
+ transformation or translation of a Source form, including but
+ not limited to compiled object code, generated documentation,
+ and conversions to other media types.
+
+ "Work" shall mean the work of authorship, whether in Source or
+ Object form, made available under the License, as indicated by a
+ copyright notice that is included in or attached to the work
+ (an example is provided in the Appendix below).
+
+ "Derivative Works" shall mean any work, whether in Source or Object
+ form, that is based on (or derived from) the Work and for which the
+ editorial revisions, annotations, elaborations, or other modifications
+ represent, as a whole, an original work of authorship. For the purposes
+ of this License, Derivative Works shall not include works that remain
+ separable from, or merely link (or bind by name) to the interfaces of,
+ the Work and Derivative Works thereof.
+
+ "Contribution" shall mean any work of authorship, including
+ the original version of the Work and any modifications or additions
+ to that Work or Derivative Works thereof, that is intentionally
+ submitted to Licensor for inclusion in the Work by the copyright owner
+ or by an individual or Legal Entity authorized to submit on behalf of
+ the copyright owner. For the purposes of this definition, "submitted"
+ means any form of electronic, verbal, or written communication sent
+ to the Licensor or its representatives, including but not limited to
+ communication on electronic mailing lists, source code control systems,
+ and issue tracking systems that are managed by, or on behalf of, the
+ Licensor for the purpose of discussing and improving the Work, but
+ excluding communication that is conspicuously marked or otherwise
+ designated in writing by the copyright owner as "Not a Contribution."
+
+ "Contributor" shall mean Licensor and any individual or Legal Entity
+ on behalf of whom a Contribution has been received by Licensor and
+ subsequently incorporated within the Work.
+
+ 2. Grant of Copyright License. Subject to the terms and conditions of
+ this License, each Contributor hereby grants to You a perpetual,
+ worldwide, non-exclusive, no-charge, royalty-free, irrevocable
+ copyright license to reproduce, prepare Derivative Works of,
+ publicly display, publicly perform, sublicense, and distribute the
+ Work and such Derivative Works in Source or Object form.
+
+ 3. Grant of Patent License. Subject to the terms and conditions of
+ this License, each Contributor hereby grants to You a perpetual,
+ worldwide, non-exclusive, no-charge, royalty-free, irrevocable
+ (except as stated in this section) patent license to make, have made,
+ use, offer to sell, sell, import, and otherwise transfer the Work,
+ where such license applies only to those patent claims licensable
+ by such Contributor that are necessarily infringed by their
+ Contribution(s) alone or by combination of their Contribution(s)
+ with the Work to which such Contribution(s) was submitted. If You
+ institute patent litigation against any entity (including a
+ cross-claim or counterclaim in a lawsuit) alleging that the Work
+ or a Contribution incorporated within the Work constitutes direct
+ or contributory patent infringement, then any patent licenses
+ granted to You under this License for that Work shall terminate
+ as of the date such litigation is filed.
+
+ 4. Redistribution. You may reproduce and distribute copies of the
+ Work or Derivative Works thereof in any medium, with or without
+ modifications, and in Source or Object form, provided that You
+ meet the following conditions:
+
+ (a) You must give any other recipients of the Work or
+ Derivative Works a copy of this License; and
+
+ (b) You must cause any modified files to carry prominent notices
+ stating that You changed the files; and
+
+ (c) You must retain, in the Source form of any Derivative Works
+ that You distribute, all copyright, patent, trademark, and
+ attribution notices from the Source form of the Work,
+ excluding those notices that do not pertain to any part of
+ the Derivative Works; and
+
+ (d) If the Work includes a "NOTICE" text file as part of its
+ distribution, then any Derivative Works that You distribute must
+ include a readable copy of the attribution notices contained
+ within such NOTICE file, excluding those notices that do not
+ pertain to any part of the Derivative Works, in at least one
+ of the following places: within a NOTICE text file distributed
+ as part of the Derivative Works; within the Source form or
+ documentation, if provided along with the Derivative Works; or,
+ within a display generated by the Derivative Works, if and
+ wherever such third-party notices normally appear. The contents
+ of the NOTICE file are for informational purposes only and
+ do not modify the License. You may add Your own attribution
+ notices within Derivative Works that You distribute, alongside
+ or as an addendum to the NOTICE text from the Work, provided
+ that such additional attribution notices cannot be construed
+ as modifying the License.
+
+ You may add Your own copyright statement to Your modifications and
+ may provide additional or different license terms and conditions
+ for use, reproduction, or distribution of Your modifications, or
+ for any such Derivative Works as a whole, provided Your use,
+ reproduction, and distribution of the Work otherwise complies with
+ the conditions stated in this License.
+
+ 5. Submission of Contributions. Unless You explicitly state otherwise,
+ any Contribution intentionally submitted for inclusion in the Work
+ by You to the Licensor shall be under the terms and conditions of
+ this License, without any additional terms or conditions.
+ Notwithstanding the above, nothing herein shall supersede or modify
+ the terms of any separate license agreement you may have executed
+ with Licensor regarding such Contributions.
+
+ 6. Trademarks. This License does not grant permission to use the trade
+ names, trademarks, service marks, or product names of the Licensor,
+ except as required for reasonable and customary use in describing the
+ origin of the Work and reproducing the content of the NOTICE file.
+
+ 7. Disclaimer of Warranty. Unless required by applicable law or
+ agreed to in writing, Licensor provides the Work (and each
+ Contributor provides its Contributions) on an "AS IS" BASIS,
+ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or
+ implied, including, without limitation, any warranties or conditions
+ of TITLE, NON-INFRINGEMENT, MERCHANTABILITY, or FITNESS FOR A
+ PARTICULAR PURPOSE. You are solely responsible for determining the
+ appropriateness of using or redistributing the Work and assume any
+ risks associated with Your exercise of permissions under this License.
+
+ 8. Limitation of Liability. In no event and under no legal theory,
+ whether in tort (including negligence), contract, or otherwise,
+ unless required by applicable law (such as deliberate and grossly
+ negligent acts) or agreed to in writing, shall any Contributor be
+ liable to You for damages, including any direct, indirect, special,
+ incidental, or consequential damages of any character arising as a
+ result of this License or out of the use or inability to use the
+ Work (including but not limited to damages for loss of goodwill,
+ work stoppage, computer failure or malfunction, or any and all
+ other commercial damages or losses), even if such Contributor
+ has been advised of the possibility of such damages.
+
+ 9. Accepting Warranty or Additional Liability. While redistributing
+ the Work or Derivative Works thereof, You may choose to offer,
+ and charge a fee for, acceptance of support, warranty, indemnity,
+ or other liability obligations and/or rights consistent with this
+ License. However, in accepting such obligations, You may act only
+ on Your own behalf and on Your sole responsibility, not on behalf
+ of any other Contributor, and only if You agree to indemnify,
+ defend, and hold each Contributor harmless for any liability
+ incurred by, or claims asserted against, such Contributor by reason
+ of your accepting any such warranty or additional liability.
+
+ END OF TERMS AND CONDITIONS
+
+ APPENDIX: How to apply the Apache License to your work.
+
+ To apply the Apache License to your work, attach the following
+ boilerplate notice, with the fields enclosed by brackets "[]"
+ replaced with your own identifying information. (Don't include
+ the brackets!) The text should be enclosed in the appropriate
+ comment syntax for the file format. We also recommend that a
+ file or class name and description of purpose be included on the
+ same "printed page" as the copyright notice for easier
+ identification within third-party archives.
+
+ Copyright 2018-present Invertase Limited
+
+ Licensed under the Apache License, Version 2.0 (the "License");
+ you may not use this file except in compliance with the License.
+ You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+ Unless required by applicable law or agreed to in writing, software
+ distributed under the License is distributed on an "AS IS" BASIS,
+ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ See the License for the specific language governing permissions and
+ limitations under the License.
diff --git a/node_modules/denque/README.md b/node_modules/denque/README.md
new file mode 100644
index 0000000..3c645d3
--- /dev/null
+++ b/node_modules/denque/README.md
@@ -0,0 +1,77 @@
+
+
Denque
+
+
+
+
+
+Denque is a well tested, extremely fast and lightweight [double-ended queue](http://en.wikipedia.org/wiki/Double-ended_queue)
+implementation with zero dependencies and includes TypeScript types.
+
+Double-ended queues can also be used as a:
+
+- [Stack](http://en.wikipedia.org/wiki/Stack_\(abstract_data_type\))
+- [Queue](http://en.wikipedia.org/wiki/Queue_\(data_structure\))
+
+This implementation is currently the fastest available, even faster than `double-ended-queue`, see the [benchmarks](https://docs.page/invertase/denque/benchmarks).
+
+Every queue operation is done at a constant `O(1)` - including random access from `.peekAt(index)`.
+
+**Works on all node versions >= v0.10**
+
+## Quick Start
+
+Install the package:
+
+```bash
+npm install denque
+```
+
+Create and consume a queue:
+
+```js
+const Denque = require("denque");
+
+const denque = new Denque([1,2,3,4]);
+denque.shift(); // 1
+denque.pop(); // 4
+```
+
+
+See the [API reference documentation](https://docs.page/invertase/denque/api) for more examples.
+
+---
+
+## Who's using it?
+
+- [Kafka Node.js client](https://www.npmjs.com/package/kafka-node)
+- [MariaDB Node.js client](https://www.npmjs.com/package/mariadb)
+- [MongoDB Node.js client](https://www.npmjs.com/package/mongodb)
+- [MySQL Node.js client](https://www.npmjs.com/package/mysql2)
+- [Redis Node.js clients](https://www.npmjs.com/package/redis)
+
+... and [many more](https://www.npmjs.com/browse/depended/denque).
+
+
+---
+
+## License
+
+- See [LICENSE](/LICENSE)
+
+---
+
+
+
+
+
+ Built and maintained by Invertase .
+
+
diff --git a/node_modules/denque/index.d.ts b/node_modules/denque/index.d.ts
new file mode 100644
index 0000000..e125dd4
--- /dev/null
+++ b/node_modules/denque/index.d.ts
@@ -0,0 +1,47 @@
+declare class Denque {
+ length: number;
+
+ constructor();
+
+ constructor(array: T[]);
+
+ constructor(array: T[], options: IDenqueOptions);
+
+ push(item: T): number;
+
+ unshift(item: T): number;
+
+ pop(): T | undefined;
+
+ shift(): T | undefined;
+
+ peekBack(): T | undefined;
+
+ peekFront(): T | undefined;
+
+ peekAt(index: number): T | undefined;
+
+ get(index: number): T | undefined;
+
+ remove(index: number, count: number): T[];
+
+ removeOne(index: number): T | undefined;
+
+ splice(index: number, count: number, ...item: T[]): T[] | undefined;
+
+ isEmpty(): boolean;
+
+ clear(): void;
+
+ size(): number;
+
+ toString(): string;
+
+ toArray(): T[];
+}
+
+interface IDenqueOptions {
+ capacity?: number
+}
+
+export = Denque;
diff --git a/node_modules/denque/index.js b/node_modules/denque/index.js
new file mode 100644
index 0000000..6b2e9d8
--- /dev/null
+++ b/node_modules/denque/index.js
@@ -0,0 +1,481 @@
+'use strict';
+
+/**
+ * Custom implementation of a double ended queue.
+ */
+function Denque(array, options) {
+ var options = options || {};
+ this._capacity = options.capacity;
+
+ this._head = 0;
+ this._tail = 0;
+
+ if (Array.isArray(array)) {
+ this._fromArray(array);
+ } else {
+ this._capacityMask = 0x3;
+ this._list = new Array(4);
+ }
+}
+
+/**
+ * --------------
+ * PUBLIC API
+ * -------------
+ */
+
+/**
+ * Returns the item at the specified index from the list.
+ * 0 is the first element, 1 is the second, and so on...
+ * Elements at negative values are that many from the end: -1 is one before the end
+ * (the last element), -2 is two before the end (one before last), etc.
+ * @param index
+ * @returns {*}
+ */
+Denque.prototype.peekAt = function peekAt(index) {
+ var i = index;
+ // expect a number or return undefined
+ if ((i !== (i | 0))) {
+ return void 0;
+ }
+ var len = this.size();
+ if (i >= len || i < -len) return undefined;
+ if (i < 0) i += len;
+ i = (this._head + i) & this._capacityMask;
+ return this._list[i];
+};
+
+/**
+ * Alias for peekAt()
+ * @param i
+ * @returns {*}
+ */
+Denque.prototype.get = function get(i) {
+ return this.peekAt(i);
+};
+
+/**
+ * Returns the first item in the list without removing it.
+ * @returns {*}
+ */
+Denque.prototype.peek = function peek() {
+ if (this._head === this._tail) return undefined;
+ return this._list[this._head];
+};
+
+/**
+ * Alias for peek()
+ * @returns {*}
+ */
+Denque.prototype.peekFront = function peekFront() {
+ return this.peek();
+};
+
+/**
+ * Returns the item that is at the back of the queue without removing it.
+ * Uses peekAt(-1)
+ */
+Denque.prototype.peekBack = function peekBack() {
+ return this.peekAt(-1);
+};
+
+/**
+ * Returns the current length of the queue
+ * @return {Number}
+ */
+Object.defineProperty(Denque.prototype, 'length', {
+ get: function length() {
+ return this.size();
+ }
+});
+
+/**
+ * Return the number of items on the list, or 0 if empty.
+ * @returns {number}
+ */
+Denque.prototype.size = function size() {
+ if (this._head === this._tail) return 0;
+ if (this._head < this._tail) return this._tail - this._head;
+ else return this._capacityMask + 1 - (this._head - this._tail);
+};
+
+/**
+ * Add an item at the beginning of the list.
+ * @param item
+ */
+Denque.prototype.unshift = function unshift(item) {
+ if (arguments.length === 0) return this.size();
+ var len = this._list.length;
+ this._head = (this._head - 1 + len) & this._capacityMask;
+ this._list[this._head] = item;
+ if (this._tail === this._head) this._growArray();
+ if (this._capacity && this.size() > this._capacity) this.pop();
+ if (this._head < this._tail) return this._tail - this._head;
+ else return this._capacityMask + 1 - (this._head - this._tail);
+};
+
+/**
+ * Remove and return the first item on the list,
+ * Returns undefined if the list is empty.
+ * @returns {*}
+ */
+Denque.prototype.shift = function shift() {
+ var head = this._head;
+ if (head === this._tail) return undefined;
+ var item = this._list[head];
+ this._list[head] = undefined;
+ this._head = (head + 1) & this._capacityMask;
+ if (head < 2 && this._tail > 10000 && this._tail <= this._list.length >>> 2) this._shrinkArray();
+ return item;
+};
+
+/**
+ * Add an item to the bottom of the list.
+ * @param item
+ */
+Denque.prototype.push = function push(item) {
+ if (arguments.length === 0) return this.size();
+ var tail = this._tail;
+ this._list[tail] = item;
+ this._tail = (tail + 1) & this._capacityMask;
+ if (this._tail === this._head) {
+ this._growArray();
+ }
+ if (this._capacity && this.size() > this._capacity) {
+ this.shift();
+ }
+ if (this._head < this._tail) return this._tail - this._head;
+ else return this._capacityMask + 1 - (this._head - this._tail);
+};
+
+/**
+ * Remove and return the last item on the list.
+ * Returns undefined if the list is empty.
+ * @returns {*}
+ */
+Denque.prototype.pop = function pop() {
+ var tail = this._tail;
+ if (tail === this._head) return undefined;
+ var len = this._list.length;
+ this._tail = (tail - 1 + len) & this._capacityMask;
+ var item = this._list[this._tail];
+ this._list[this._tail] = undefined;
+ if (this._head < 2 && tail > 10000 && tail <= len >>> 2) this._shrinkArray();
+ return item;
+};
+
+/**
+ * Remove and return the item at the specified index from the list.
+ * Returns undefined if the list is empty.
+ * @param index
+ * @returns {*}
+ */
+Denque.prototype.removeOne = function removeOne(index) {
+ var i = index;
+ // expect a number or return undefined
+ if ((i !== (i | 0))) {
+ return void 0;
+ }
+ if (this._head === this._tail) return void 0;
+ var size = this.size();
+ var len = this._list.length;
+ if (i >= size || i < -size) return void 0;
+ if (i < 0) i += size;
+ i = (this._head + i) & this._capacityMask;
+ var item = this._list[i];
+ var k;
+ if (index < size / 2) {
+ for (k = index; k > 0; k--) {
+ this._list[i] = this._list[i = (i - 1 + len) & this._capacityMask];
+ }
+ this._list[i] = void 0;
+ this._head = (this._head + 1 + len) & this._capacityMask;
+ } else {
+ for (k = size - 1 - index; k > 0; k--) {
+ this._list[i] = this._list[i = (i + 1 + len) & this._capacityMask];
+ }
+ this._list[i] = void 0;
+ this._tail = (this._tail - 1 + len) & this._capacityMask;
+ }
+ return item;
+};
+
+/**
+ * Remove number of items from the specified index from the list.
+ * Returns array of removed items.
+ * Returns undefined if the list is empty.
+ * @param index
+ * @param count
+ * @returns {array}
+ */
+Denque.prototype.remove = function remove(index, count) {
+ var i = index;
+ var removed;
+ var del_count = count;
+ // expect a number or return undefined
+ if ((i !== (i | 0))) {
+ return void 0;
+ }
+ if (this._head === this._tail) return void 0;
+ var size = this.size();
+ var len = this._list.length;
+ if (i >= size || i < -size || count < 1) return void 0;
+ if (i < 0) i += size;
+ if (count === 1 || !count) {
+ removed = new Array(1);
+ removed[0] = this.removeOne(i);
+ return removed;
+ }
+ if (i === 0 && i + count >= size) {
+ removed = this.toArray();
+ this.clear();
+ return removed;
+ }
+ if (i + count > size) count = size - i;
+ var k;
+ removed = new Array(count);
+ for (k = 0; k < count; k++) {
+ removed[k] = this._list[(this._head + i + k) & this._capacityMask];
+ }
+ i = (this._head + i) & this._capacityMask;
+ if (index + count === size) {
+ this._tail = (this._tail - count + len) & this._capacityMask;
+ for (k = count; k > 0; k--) {
+ this._list[i = (i + 1 + len) & this._capacityMask] = void 0;
+ }
+ return removed;
+ }
+ if (index === 0) {
+ this._head = (this._head + count + len) & this._capacityMask;
+ for (k = count - 1; k > 0; k--) {
+ this._list[i = (i + 1 + len) & this._capacityMask] = void 0;
+ }
+ return removed;
+ }
+ if (i < size / 2) {
+ this._head = (this._head + index + count + len) & this._capacityMask;
+ for (k = index; k > 0; k--) {
+ this.unshift(this._list[i = (i - 1 + len) & this._capacityMask]);
+ }
+ i = (this._head - 1 + len) & this._capacityMask;
+ while (del_count > 0) {
+ this._list[i = (i - 1 + len) & this._capacityMask] = void 0;
+ del_count--;
+ }
+ if (index < 0) this._tail = i;
+ } else {
+ this._tail = i;
+ i = (i + count + len) & this._capacityMask;
+ for (k = size - (count + index); k > 0; k--) {
+ this.push(this._list[i++]);
+ }
+ i = this._tail;
+ while (del_count > 0) {
+ this._list[i = (i + 1 + len) & this._capacityMask] = void 0;
+ del_count--;
+ }
+ }
+ if (this._head < 2 && this._tail > 10000 && this._tail <= len >>> 2) this._shrinkArray();
+ return removed;
+};
+
+/**
+ * Native splice implementation.
+ * Remove number of items from the specified index from the list and/or add new elements.
+ * Returns array of removed items or empty array if count == 0.
+ * Returns undefined if the list is empty.
+ *
+ * @param index
+ * @param count
+ * @param {...*} [elements]
+ * @returns {array}
+ */
+Denque.prototype.splice = function splice(index, count) {
+ var i = index;
+ // expect a number or return undefined
+ if ((i !== (i | 0))) {
+ return void 0;
+ }
+ var size = this.size();
+ if (i < 0) i += size;
+ if (i > size) return void 0;
+ if (arguments.length > 2) {
+ var k;
+ var temp;
+ var removed;
+ var arg_len = arguments.length;
+ var len = this._list.length;
+ var arguments_index = 2;
+ if (!size || i < size / 2) {
+ temp = new Array(i);
+ for (k = 0; k < i; k++) {
+ temp[k] = this._list[(this._head + k) & this._capacityMask];
+ }
+ if (count === 0) {
+ removed = [];
+ if (i > 0) {
+ this._head = (this._head + i + len) & this._capacityMask;
+ }
+ } else {
+ removed = this.remove(i, count);
+ this._head = (this._head + i + len) & this._capacityMask;
+ }
+ while (arg_len > arguments_index) {
+ this.unshift(arguments[--arg_len]);
+ }
+ for (k = i; k > 0; k--) {
+ this.unshift(temp[k - 1]);
+ }
+ } else {
+ temp = new Array(size - (i + count));
+ var leng = temp.length;
+ for (k = 0; k < leng; k++) {
+ temp[k] = this._list[(this._head + i + count + k) & this._capacityMask];
+ }
+ if (count === 0) {
+ removed = [];
+ if (i != size) {
+ this._tail = (this._head + i + len) & this._capacityMask;
+ }
+ } else {
+ removed = this.remove(i, count);
+ this._tail = (this._tail - leng + len) & this._capacityMask;
+ }
+ while (arguments_index < arg_len) {
+ this.push(arguments[arguments_index++]);
+ }
+ for (k = 0; k < leng; k++) {
+ this.push(temp[k]);
+ }
+ }
+ return removed;
+ } else {
+ return this.remove(i, count);
+ }
+};
+
+/**
+ * Soft clear - does not reset capacity.
+ */
+Denque.prototype.clear = function clear() {
+ this._list = new Array(this._list.length);
+ this._head = 0;
+ this._tail = 0;
+};
+
+/**
+ * Returns true or false whether the list is empty.
+ * @returns {boolean}
+ */
+Denque.prototype.isEmpty = function isEmpty() {
+ return this._head === this._tail;
+};
+
+/**
+ * Returns an array of all queue items.
+ * @returns {Array}
+ */
+Denque.prototype.toArray = function toArray() {
+ return this._copyArray(false);
+};
+
+/**
+ * -------------
+ * INTERNALS
+ * -------------
+ */
+
+/**
+ * Fills the queue with items from an array
+ * For use in the constructor
+ * @param array
+ * @private
+ */
+Denque.prototype._fromArray = function _fromArray(array) {
+ var length = array.length;
+ var capacity = this._nextPowerOf2(length);
+
+ this._list = new Array(capacity);
+ this._capacityMask = capacity - 1;
+ this._tail = length;
+
+ for (var i = 0; i < length; i++) this._list[i] = array[i];
+};
+
+/**
+ *
+ * @param fullCopy
+ * @param size Initialize the array with a specific size. Will default to the current list size
+ * @returns {Array}
+ * @private
+ */
+Denque.prototype._copyArray = function _copyArray(fullCopy, size) {
+ var src = this._list;
+ var capacity = src.length;
+ var length = this.length;
+ size = size | length;
+
+ // No prealloc requested and the buffer is contiguous
+ if (size == length && this._head < this._tail) {
+ // Simply do a fast slice copy
+ return this._list.slice(this._head, this._tail);
+ }
+
+ var dest = new Array(size);
+
+ var k = 0;
+ var i;
+ if (fullCopy || this._head > this._tail) {
+ for (i = this._head; i < capacity; i++) dest[k++] = src[i];
+ for (i = 0; i < this._tail; i++) dest[k++] = src[i];
+ } else {
+ for (i = this._head; i < this._tail; i++) dest[k++] = src[i];
+ }
+
+ return dest;
+}
+
+/**
+ * Grows the internal list array.
+ * @private
+ */
+Denque.prototype._growArray = function _growArray() {
+ if (this._head != 0) {
+ // double array size and copy existing data, head to end, then beginning to tail.
+ var newList = this._copyArray(true, this._list.length << 1);
+
+ this._tail = this._list.length;
+ this._head = 0;
+
+ this._list = newList;
+ } else {
+ this._tail = this._list.length;
+ this._list.length <<= 1;
+ }
+
+ this._capacityMask = (this._capacityMask << 1) | 1;
+};
+
+/**
+ * Shrinks the internal list array.
+ * @private
+ */
+Denque.prototype._shrinkArray = function _shrinkArray() {
+ this._list.length >>>= 1;
+ this._capacityMask >>>= 1;
+};
+
+/**
+ * Find the next power of 2, at least 4
+ * @private
+ * @param {number} num
+ * @returns {number}
+ */
+Denque.prototype._nextPowerOf2 = function _nextPowerOf2(num) {
+ var log2 = Math.log(num) / Math.log(2);
+ var nextPow2 = 1 << (log2 + 1);
+
+ return Math.max(nextPow2, 4);
+}
+
+module.exports = Denque;
diff --git a/node_modules/denque/package.json b/node_modules/denque/package.json
new file mode 100644
index 0000000..a635910
--- /dev/null
+++ b/node_modules/denque/package.json
@@ -0,0 +1,58 @@
+{
+ "name": "denque",
+ "version": "2.1.0",
+ "description": "The fastest javascript implementation of a double-ended queue. Used by the official Redis, MongoDB, MariaDB & MySQL libraries for Node.js and many other libraries. Maintains compatability with deque.",
+ "main": "index.js",
+ "engines": {
+ "node": ">=0.10"
+ },
+ "keywords": [
+ "data-structure",
+ "data-structures",
+ "queue",
+ "double",
+ "end",
+ "ended",
+ "deque",
+ "denque",
+ "double-ended-queue"
+ ],
+ "scripts": {
+ "test": "istanbul cover --report lcov _mocha && npm run typescript",
+ "coveralls": "cat ./coverage/lcov.info | coveralls",
+ "typescript": "tsc --project ./test/type/tsconfig.json",
+ "benchmark_thousand": "node benchmark/thousand",
+ "benchmark_2mil": "node benchmark/two_million",
+ "benchmark_splice": "node benchmark/splice",
+ "benchmark_remove": "node benchmark/remove",
+ "benchmark_removeOne": "node benchmark/removeOne",
+ "benchmark_growth": "node benchmark/growth",
+ "benchmark_toArray": "node benchmark/toArray",
+ "benchmark_fromArray": "node benchmark/fromArray"
+ },
+ "repository": {
+ "type": "git",
+ "url": "git+https://github.com/invertase/denque.git"
+ },
+ "license": "Apache-2.0",
+ "author": {
+ "name": "Invertase",
+ "email": "oss@invertase.io",
+ "url": "http://github.com/invertase/"
+ },
+ "contributors": [
+ "Mike Diarmid (Salakar) "
+ ],
+ "bugs": {
+ "url": "https://github.com/invertase/denque/issues"
+ },
+ "homepage": "https://docs.page/invertase/denque",
+ "devDependencies": {
+ "benchmark": "^2.1.4",
+ "codecov": "^3.8.3",
+ "double-ended-queue": "^2.1.0-0",
+ "istanbul": "^0.4.5",
+ "mocha": "^3.5.3",
+ "typescript": "^3.4.1"
+ }
+}
diff --git a/node_modules/depd/History.md b/node_modules/depd/History.md
new file mode 100644
index 0000000..cd9ebaa
--- /dev/null
+++ b/node_modules/depd/History.md
@@ -0,0 +1,103 @@
+2.0.0 / 2018-10-26
+==================
+
+ * Drop support for Node.js 0.6
+ * Replace internal `eval` usage with `Function` constructor
+ * Use instance methods on `process` to check for listeners
+
+1.1.2 / 2018-01-11
+==================
+
+ * perf: remove argument reassignment
+ * Support Node.js 0.6 to 9.x
+
+1.1.1 / 2017-07-27
+==================
+
+ * Remove unnecessary `Buffer` loading
+ * Support Node.js 0.6 to 8.x
+
+1.1.0 / 2015-09-14
+==================
+
+ * Enable strict mode in more places
+ * Support io.js 3.x
+ * Support io.js 2.x
+ * Support web browser loading
+ - Requires bundler like Browserify or webpack
+
+1.0.1 / 2015-04-07
+==================
+
+ * Fix `TypeError`s when under `'use strict'` code
+ * Fix useless type name on auto-generated messages
+ * Support io.js 1.x
+ * Support Node.js 0.12
+
+1.0.0 / 2014-09-17
+==================
+
+ * No changes
+
+0.4.5 / 2014-09-09
+==================
+
+ * Improve call speed to functions using the function wrapper
+ * Support Node.js 0.6
+
+0.4.4 / 2014-07-27
+==================
+
+ * Work-around v8 generating empty stack traces
+
+0.4.3 / 2014-07-26
+==================
+
+ * Fix exception when global `Error.stackTraceLimit` is too low
+
+0.4.2 / 2014-07-19
+==================
+
+ * Correct call site for wrapped functions and properties
+
+0.4.1 / 2014-07-19
+==================
+
+ * Improve automatic message generation for function properties
+
+0.4.0 / 2014-07-19
+==================
+
+ * Add `TRACE_DEPRECATION` environment variable
+ * Remove non-standard grey color from color output
+ * Support `--no-deprecation` argument
+ * Support `--trace-deprecation` argument
+ * Support `deprecate.property(fn, prop, message)`
+
+0.3.0 / 2014-06-16
+==================
+
+ * Add `NO_DEPRECATION` environment variable
+
+0.2.0 / 2014-06-15
+==================
+
+ * Add `deprecate.property(obj, prop, message)`
+ * Remove `supports-color` dependency for node.js 0.8
+
+0.1.0 / 2014-06-15
+==================
+
+ * Add `deprecate.function(fn, message)`
+ * Add `process.on('deprecation', fn)` emitter
+ * Automatically generate message when omitted from `deprecate()`
+
+0.0.1 / 2014-06-15
+==================
+
+ * Fix warning for dynamic calls at singe call site
+
+0.0.0 / 2014-06-15
+==================
+
+ * Initial implementation
diff --git a/node_modules/depd/LICENSE b/node_modules/depd/LICENSE
new file mode 100644
index 0000000..248de7a
--- /dev/null
+++ b/node_modules/depd/LICENSE
@@ -0,0 +1,22 @@
+(The MIT License)
+
+Copyright (c) 2014-2018 Douglas Christopher Wilson
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/node_modules/depd/Readme.md b/node_modules/depd/Readme.md
new file mode 100644
index 0000000..043d1ca
--- /dev/null
+++ b/node_modules/depd/Readme.md
@@ -0,0 +1,280 @@
+# depd
+
+[![NPM Version][npm-version-image]][npm-url]
+[![NPM Downloads][npm-downloads-image]][npm-url]
+[![Node.js Version][node-image]][node-url]
+[![Linux Build][travis-image]][travis-url]
+[![Windows Build][appveyor-image]][appveyor-url]
+[![Coverage Status][coveralls-image]][coveralls-url]
+
+Deprecate all the things
+
+> With great modules comes great responsibility; mark things deprecated!
+
+## Install
+
+This module is installed directly using `npm`:
+
+```sh
+$ npm install depd
+```
+
+This module can also be bundled with systems like
+[Browserify](http://browserify.org/) or [webpack](https://webpack.github.io/),
+though by default this module will alter it's API to no longer display or
+track deprecations.
+
+## API
+
+
+
+```js
+var deprecate = require('depd')('my-module')
+```
+
+This library allows you to display deprecation messages to your users.
+This library goes above and beyond with deprecation warnings by
+introspection of the call stack (but only the bits that it is interested
+in).
+
+Instead of just warning on the first invocation of a deprecated
+function and never again, this module will warn on the first invocation
+of a deprecated function per unique call site, making it ideal to alert
+users of all deprecated uses across the code base, rather than just
+whatever happens to execute first.
+
+The deprecation warnings from this module also include the file and line
+information for the call into the module that the deprecated function was
+in.
+
+**NOTE** this library has a similar interface to the `debug` module, and
+this module uses the calling file to get the boundary for the call stacks,
+so you should always create a new `deprecate` object in each file and not
+within some central file.
+
+### depd(namespace)
+
+Create a new deprecate function that uses the given namespace name in the
+messages and will display the call site prior to the stack entering the
+file this function was called from. It is highly suggested you use the
+name of your module as the namespace.
+
+### deprecate(message)
+
+Call this function from deprecated code to display a deprecation message.
+This message will appear once per unique caller site. Caller site is the
+first call site in the stack in a different file from the caller of this
+function.
+
+If the message is omitted, a message is generated for you based on the site
+of the `deprecate()` call and will display the name of the function called,
+similar to the name displayed in a stack trace.
+
+### deprecate.function(fn, message)
+
+Call this function to wrap a given function in a deprecation message on any
+call to the function. An optional message can be supplied to provide a custom
+message.
+
+### deprecate.property(obj, prop, message)
+
+Call this function to wrap a given property on object in a deprecation message
+on any accessing or setting of the property. An optional message can be supplied
+to provide a custom message.
+
+The method must be called on the object where the property belongs (not
+inherited from the prototype).
+
+If the property is a data descriptor, it will be converted to an accessor
+descriptor in order to display the deprecation message.
+
+### process.on('deprecation', fn)
+
+This module will allow easy capturing of deprecation errors by emitting the
+errors as the type "deprecation" on the global `process`. If there are no
+listeners for this type, the errors are written to STDERR as normal, but if
+there are any listeners, nothing will be written to STDERR and instead only
+emitted. From there, you can write the errors in a different format or to a
+logging source.
+
+The error represents the deprecation and is emitted only once with the same
+rules as writing to STDERR. The error has the following properties:
+
+ - `message` - This is the message given by the library
+ - `name` - This is always `'DeprecationError'`
+ - `namespace` - This is the namespace the deprecation came from
+ - `stack` - This is the stack of the call to the deprecated thing
+
+Example `error.stack` output:
+
+```
+DeprecationError: my-cool-module deprecated oldfunction
+ at Object. ([eval]-wrapper:6:22)
+ at Module._compile (module.js:456:26)
+ at evalScript (node.js:532:25)
+ at startup (node.js:80:7)
+ at node.js:902:3
+```
+
+### process.env.NO_DEPRECATION
+
+As a user of modules that are deprecated, the environment variable `NO_DEPRECATION`
+is provided as a quick solution to silencing deprecation warnings from being
+output. The format of this is similar to that of `DEBUG`:
+
+```sh
+$ NO_DEPRECATION=my-module,othermod node app.js
+```
+
+This will suppress deprecations from being output for "my-module" and "othermod".
+The value is a list of comma-separated namespaces. To suppress every warning
+across all namespaces, use the value `*` for a namespace.
+
+Providing the argument `--no-deprecation` to the `node` executable will suppress
+all deprecations (only available in Node.js 0.8 or higher).
+
+**NOTE** This will not suppress the deperecations given to any "deprecation"
+event listeners, just the output to STDERR.
+
+### process.env.TRACE_DEPRECATION
+
+As a user of modules that are deprecated, the environment variable `TRACE_DEPRECATION`
+is provided as a solution to getting more detailed location information in deprecation
+warnings by including the entire stack trace. The format of this is the same as
+`NO_DEPRECATION`:
+
+```sh
+$ TRACE_DEPRECATION=my-module,othermod node app.js
+```
+
+This will include stack traces for deprecations being output for "my-module" and
+"othermod". The value is a list of comma-separated namespaces. To trace every
+warning across all namespaces, use the value `*` for a namespace.
+
+Providing the argument `--trace-deprecation` to the `node` executable will trace
+all deprecations (only available in Node.js 0.8 or higher).
+
+**NOTE** This will not trace the deperecations silenced by `NO_DEPRECATION`.
+
+## Display
+
+
+
+When a user calls a function in your library that you mark deprecated, they
+will see the following written to STDERR (in the given colors, similar colors
+and layout to the `debug` module):
+
+```
+bright cyan bright yellow
+| | reset cyan
+| | | |
+▼ ▼ ▼ ▼
+my-cool-module deprecated oldfunction [eval]-wrapper:6:22
+▲ ▲ ▲ ▲
+| | | |
+namespace | | location of mycoolmod.oldfunction() call
+ | deprecation message
+ the word "deprecated"
+```
+
+If the user redirects their STDERR to a file or somewhere that does not support
+colors, they see (similar layout to the `debug` module):
+
+```
+Sun, 15 Jun 2014 05:21:37 GMT my-cool-module deprecated oldfunction at [eval]-wrapper:6:22
+▲ ▲ ▲ ▲ ▲
+| | | | |
+timestamp of message namespace | | location of mycoolmod.oldfunction() call
+ | deprecation message
+ the word "deprecated"
+```
+
+## Examples
+
+### Deprecating all calls to a function
+
+This will display a deprecated message about "oldfunction" being deprecated
+from "my-module" on STDERR.
+
+```js
+var deprecate = require('depd')('my-cool-module')
+
+// message automatically derived from function name
+// Object.oldfunction
+exports.oldfunction = deprecate.function(function oldfunction () {
+ // all calls to function are deprecated
+})
+
+// specific message
+exports.oldfunction = deprecate.function(function () {
+ // all calls to function are deprecated
+}, 'oldfunction')
+```
+
+### Conditionally deprecating a function call
+
+This will display a deprecated message about "weirdfunction" being deprecated
+from "my-module" on STDERR when called with less than 2 arguments.
+
+```js
+var deprecate = require('depd')('my-cool-module')
+
+exports.weirdfunction = function () {
+ if (arguments.length < 2) {
+ // calls with 0 or 1 args are deprecated
+ deprecate('weirdfunction args < 2')
+ }
+}
+```
+
+When calling `deprecate` as a function, the warning is counted per call site
+within your own module, so you can display different deprecations depending
+on different situations and the users will still get all the warnings:
+
+```js
+var deprecate = require('depd')('my-cool-module')
+
+exports.weirdfunction = function () {
+ if (arguments.length < 2) {
+ // calls with 0 or 1 args are deprecated
+ deprecate('weirdfunction args < 2')
+ } else if (typeof arguments[0] !== 'string') {
+ // calls with non-string first argument are deprecated
+ deprecate('weirdfunction non-string first arg')
+ }
+}
+```
+
+### Deprecating property access
+
+This will display a deprecated message about "oldprop" being deprecated
+from "my-module" on STDERR when accessed. A deprecation will be displayed
+when setting the value and when getting the value.
+
+```js
+var deprecate = require('depd')('my-cool-module')
+
+exports.oldprop = 'something'
+
+// message automatically derives from property name
+deprecate.property(exports, 'oldprop')
+
+// explicit message
+deprecate.property(exports, 'oldprop', 'oldprop >= 0.10')
+```
+
+## License
+
+[MIT](LICENSE)
+
+[appveyor-image]: https://badgen.net/appveyor/ci/dougwilson/nodejs-depd/master?label=windows
+[appveyor-url]: https://ci.appveyor.com/project/dougwilson/nodejs-depd
+[coveralls-image]: https://badgen.net/coveralls/c/github/dougwilson/nodejs-depd/master
+[coveralls-url]: https://coveralls.io/r/dougwilson/nodejs-depd?branch=master
+[node-image]: https://badgen.net/npm/node/depd
+[node-url]: https://nodejs.org/en/download/
+[npm-downloads-image]: https://badgen.net/npm/dm/depd
+[npm-url]: https://npmjs.org/package/depd
+[npm-version-image]: https://badgen.net/npm/v/depd
+[travis-image]: https://badgen.net/travis/dougwilson/nodejs-depd/master?label=linux
+[travis-url]: https://travis-ci.org/dougwilson/nodejs-depd
diff --git a/node_modules/depd/index.js b/node_modules/depd/index.js
new file mode 100644
index 0000000..1bf2fcf
--- /dev/null
+++ b/node_modules/depd/index.js
@@ -0,0 +1,538 @@
+/*!
+ * depd
+ * Copyright(c) 2014-2018 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+/**
+ * Module dependencies.
+ */
+
+var relative = require('path').relative
+
+/**
+ * Module exports.
+ */
+
+module.exports = depd
+
+/**
+ * Get the path to base files on.
+ */
+
+var basePath = process.cwd()
+
+/**
+ * Determine if namespace is contained in the string.
+ */
+
+function containsNamespace (str, namespace) {
+ var vals = str.split(/[ ,]+/)
+ var ns = String(namespace).toLowerCase()
+
+ for (var i = 0; i < vals.length; i++) {
+ var val = vals[i]
+
+ // namespace contained
+ if (val && (val === '*' || val.toLowerCase() === ns)) {
+ return true
+ }
+ }
+
+ return false
+}
+
+/**
+ * Convert a data descriptor to accessor descriptor.
+ */
+
+function convertDataDescriptorToAccessor (obj, prop, message) {
+ var descriptor = Object.getOwnPropertyDescriptor(obj, prop)
+ var value = descriptor.value
+
+ descriptor.get = function getter () { return value }
+
+ if (descriptor.writable) {
+ descriptor.set = function setter (val) { return (value = val) }
+ }
+
+ delete descriptor.value
+ delete descriptor.writable
+
+ Object.defineProperty(obj, prop, descriptor)
+
+ return descriptor
+}
+
+/**
+ * Create arguments string to keep arity.
+ */
+
+function createArgumentsString (arity) {
+ var str = ''
+
+ for (var i = 0; i < arity; i++) {
+ str += ', arg' + i
+ }
+
+ return str.substr(2)
+}
+
+/**
+ * Create stack string from stack.
+ */
+
+function createStackString (stack) {
+ var str = this.name + ': ' + this.namespace
+
+ if (this.message) {
+ str += ' deprecated ' + this.message
+ }
+
+ for (var i = 0; i < stack.length; i++) {
+ str += '\n at ' + stack[i].toString()
+ }
+
+ return str
+}
+
+/**
+ * Create deprecate for namespace in caller.
+ */
+
+function depd (namespace) {
+ if (!namespace) {
+ throw new TypeError('argument namespace is required')
+ }
+
+ var stack = getStack()
+ var site = callSiteLocation(stack[1])
+ var file = site[0]
+
+ function deprecate (message) {
+ // call to self as log
+ log.call(deprecate, message)
+ }
+
+ deprecate._file = file
+ deprecate._ignored = isignored(namespace)
+ deprecate._namespace = namespace
+ deprecate._traced = istraced(namespace)
+ deprecate._warned = Object.create(null)
+
+ deprecate.function = wrapfunction
+ deprecate.property = wrapproperty
+
+ return deprecate
+}
+
+/**
+ * Determine if event emitter has listeners of a given type.
+ *
+ * The way to do this check is done three different ways in Node.js >= 0.8
+ * so this consolidates them into a minimal set using instance methods.
+ *
+ * @param {EventEmitter} emitter
+ * @param {string} type
+ * @returns {boolean}
+ * @private
+ */
+
+function eehaslisteners (emitter, type) {
+ var count = typeof emitter.listenerCount !== 'function'
+ ? emitter.listeners(type).length
+ : emitter.listenerCount(type)
+
+ return count > 0
+}
+
+/**
+ * Determine if namespace is ignored.
+ */
+
+function isignored (namespace) {
+ if (process.noDeprecation) {
+ // --no-deprecation support
+ return true
+ }
+
+ var str = process.env.NO_DEPRECATION || ''
+
+ // namespace ignored
+ return containsNamespace(str, namespace)
+}
+
+/**
+ * Determine if namespace is traced.
+ */
+
+function istraced (namespace) {
+ if (process.traceDeprecation) {
+ // --trace-deprecation support
+ return true
+ }
+
+ var str = process.env.TRACE_DEPRECATION || ''
+
+ // namespace traced
+ return containsNamespace(str, namespace)
+}
+
+/**
+ * Display deprecation message.
+ */
+
+function log (message, site) {
+ var haslisteners = eehaslisteners(process, 'deprecation')
+
+ // abort early if no destination
+ if (!haslisteners && this._ignored) {
+ return
+ }
+
+ var caller
+ var callFile
+ var callSite
+ var depSite
+ var i = 0
+ var seen = false
+ var stack = getStack()
+ var file = this._file
+
+ if (site) {
+ // provided site
+ depSite = site
+ callSite = callSiteLocation(stack[1])
+ callSite.name = depSite.name
+ file = callSite[0]
+ } else {
+ // get call site
+ i = 2
+ depSite = callSiteLocation(stack[i])
+ callSite = depSite
+ }
+
+ // get caller of deprecated thing in relation to file
+ for (; i < stack.length; i++) {
+ caller = callSiteLocation(stack[i])
+ callFile = caller[0]
+
+ if (callFile === file) {
+ seen = true
+ } else if (callFile === this._file) {
+ file = this._file
+ } else if (seen) {
+ break
+ }
+ }
+
+ var key = caller
+ ? depSite.join(':') + '__' + caller.join(':')
+ : undefined
+
+ if (key !== undefined && key in this._warned) {
+ // already warned
+ return
+ }
+
+ this._warned[key] = true
+
+ // generate automatic message from call site
+ var msg = message
+ if (!msg) {
+ msg = callSite === depSite || !callSite.name
+ ? defaultMessage(depSite)
+ : defaultMessage(callSite)
+ }
+
+ // emit deprecation if listeners exist
+ if (haslisteners) {
+ var err = DeprecationError(this._namespace, msg, stack.slice(i))
+ process.emit('deprecation', err)
+ return
+ }
+
+ // format and write message
+ var format = process.stderr.isTTY
+ ? formatColor
+ : formatPlain
+ var output = format.call(this, msg, caller, stack.slice(i))
+ process.stderr.write(output + '\n', 'utf8')
+}
+
+/**
+ * Get call site location as array.
+ */
+
+function callSiteLocation (callSite) {
+ var file = callSite.getFileName() || ''
+ var line = callSite.getLineNumber()
+ var colm = callSite.getColumnNumber()
+
+ if (callSite.isEval()) {
+ file = callSite.getEvalOrigin() + ', ' + file
+ }
+
+ var site = [file, line, colm]
+
+ site.callSite = callSite
+ site.name = callSite.getFunctionName()
+
+ return site
+}
+
+/**
+ * Generate a default message from the site.
+ */
+
+function defaultMessage (site) {
+ var callSite = site.callSite
+ var funcName = site.name
+
+ // make useful anonymous name
+ if (!funcName) {
+ funcName = ''
+ }
+
+ var context = callSite.getThis()
+ var typeName = context && callSite.getTypeName()
+
+ // ignore useless type name
+ if (typeName === 'Object') {
+ typeName = undefined
+ }
+
+ // make useful type name
+ if (typeName === 'Function') {
+ typeName = context.name || typeName
+ }
+
+ return typeName && callSite.getMethodName()
+ ? typeName + '.' + funcName
+ : funcName
+}
+
+/**
+ * Format deprecation message without color.
+ */
+
+function formatPlain (msg, caller, stack) {
+ var timestamp = new Date().toUTCString()
+
+ var formatted = timestamp +
+ ' ' + this._namespace +
+ ' deprecated ' + msg
+
+ // add stack trace
+ if (this._traced) {
+ for (var i = 0; i < stack.length; i++) {
+ formatted += '\n at ' + stack[i].toString()
+ }
+
+ return formatted
+ }
+
+ if (caller) {
+ formatted += ' at ' + formatLocation(caller)
+ }
+
+ return formatted
+}
+
+/**
+ * Format deprecation message with color.
+ */
+
+function formatColor (msg, caller, stack) {
+ var formatted = '\x1b[36;1m' + this._namespace + '\x1b[22;39m' + // bold cyan
+ ' \x1b[33;1mdeprecated\x1b[22;39m' + // bold yellow
+ ' \x1b[0m' + msg + '\x1b[39m' // reset
+
+ // add stack trace
+ if (this._traced) {
+ for (var i = 0; i < stack.length; i++) {
+ formatted += '\n \x1b[36mat ' + stack[i].toString() + '\x1b[39m' // cyan
+ }
+
+ return formatted
+ }
+
+ if (caller) {
+ formatted += ' \x1b[36m' + formatLocation(caller) + '\x1b[39m' // cyan
+ }
+
+ return formatted
+}
+
+/**
+ * Format call site location.
+ */
+
+function formatLocation (callSite) {
+ return relative(basePath, callSite[0]) +
+ ':' + callSite[1] +
+ ':' + callSite[2]
+}
+
+/**
+ * Get the stack as array of call sites.
+ */
+
+function getStack () {
+ var limit = Error.stackTraceLimit
+ var obj = {}
+ var prep = Error.prepareStackTrace
+
+ Error.prepareStackTrace = prepareObjectStackTrace
+ Error.stackTraceLimit = Math.max(10, limit)
+
+ // capture the stack
+ Error.captureStackTrace(obj)
+
+ // slice this function off the top
+ var stack = obj.stack.slice(1)
+
+ Error.prepareStackTrace = prep
+ Error.stackTraceLimit = limit
+
+ return stack
+}
+
+/**
+ * Capture call site stack from v8.
+ */
+
+function prepareObjectStackTrace (obj, stack) {
+ return stack
+}
+
+/**
+ * Return a wrapped function in a deprecation message.
+ */
+
+function wrapfunction (fn, message) {
+ if (typeof fn !== 'function') {
+ throw new TypeError('argument fn must be a function')
+ }
+
+ var args = createArgumentsString(fn.length)
+ var stack = getStack()
+ var site = callSiteLocation(stack[1])
+
+ site.name = fn.name
+
+ // eslint-disable-next-line no-new-func
+ var deprecatedfn = new Function('fn', 'log', 'deprecate', 'message', 'site',
+ '"use strict"\n' +
+ 'return function (' + args + ') {' +
+ 'log.call(deprecate, message, site)\n' +
+ 'return fn.apply(this, arguments)\n' +
+ '}')(fn, log, this, message, site)
+
+ return deprecatedfn
+}
+
+/**
+ * Wrap property in a deprecation message.
+ */
+
+function wrapproperty (obj, prop, message) {
+ if (!obj || (typeof obj !== 'object' && typeof obj !== 'function')) {
+ throw new TypeError('argument obj must be object')
+ }
+
+ var descriptor = Object.getOwnPropertyDescriptor(obj, prop)
+
+ if (!descriptor) {
+ throw new TypeError('must call property on owner object')
+ }
+
+ if (!descriptor.configurable) {
+ throw new TypeError('property must be configurable')
+ }
+
+ var deprecate = this
+ var stack = getStack()
+ var site = callSiteLocation(stack[1])
+
+ // set site name
+ site.name = prop
+
+ // convert data descriptor
+ if ('value' in descriptor) {
+ descriptor = convertDataDescriptorToAccessor(obj, prop, message)
+ }
+
+ var get = descriptor.get
+ var set = descriptor.set
+
+ // wrap getter
+ if (typeof get === 'function') {
+ descriptor.get = function getter () {
+ log.call(deprecate, message, site)
+ return get.apply(this, arguments)
+ }
+ }
+
+ // wrap setter
+ if (typeof set === 'function') {
+ descriptor.set = function setter () {
+ log.call(deprecate, message, site)
+ return set.apply(this, arguments)
+ }
+ }
+
+ Object.defineProperty(obj, prop, descriptor)
+}
+
+/**
+ * Create DeprecationError for deprecation
+ */
+
+function DeprecationError (namespace, message, stack) {
+ var error = new Error()
+ var stackString
+
+ Object.defineProperty(error, 'constructor', {
+ value: DeprecationError
+ })
+
+ Object.defineProperty(error, 'message', {
+ configurable: true,
+ enumerable: false,
+ value: message,
+ writable: true
+ })
+
+ Object.defineProperty(error, 'name', {
+ enumerable: false,
+ configurable: true,
+ value: 'DeprecationError',
+ writable: true
+ })
+
+ Object.defineProperty(error, 'namespace', {
+ configurable: true,
+ enumerable: false,
+ value: namespace,
+ writable: true
+ })
+
+ Object.defineProperty(error, 'stack', {
+ configurable: true,
+ enumerable: false,
+ get: function () {
+ if (stackString !== undefined) {
+ return stackString
+ }
+
+ // prepare stack trace
+ return (stackString = createStackString.call(this, stack))
+ },
+ set: function setter (val) {
+ stackString = val
+ }
+ })
+
+ return error
+}
diff --git a/node_modules/depd/lib/browser/index.js b/node_modules/depd/lib/browser/index.js
new file mode 100644
index 0000000..6be45cc
--- /dev/null
+++ b/node_modules/depd/lib/browser/index.js
@@ -0,0 +1,77 @@
+/*!
+ * depd
+ * Copyright(c) 2015 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+'use strict'
+
+/**
+ * Module exports.
+ * @public
+ */
+
+module.exports = depd
+
+/**
+ * Create deprecate for namespace in caller.
+ */
+
+function depd (namespace) {
+ if (!namespace) {
+ throw new TypeError('argument namespace is required')
+ }
+
+ function deprecate (message) {
+ // no-op in browser
+ }
+
+ deprecate._file = undefined
+ deprecate._ignored = true
+ deprecate._namespace = namespace
+ deprecate._traced = false
+ deprecate._warned = Object.create(null)
+
+ deprecate.function = wrapfunction
+ deprecate.property = wrapproperty
+
+ return deprecate
+}
+
+/**
+ * Return a wrapped function in a deprecation message.
+ *
+ * This is a no-op version of the wrapper, which does nothing but call
+ * validation.
+ */
+
+function wrapfunction (fn, message) {
+ if (typeof fn !== 'function') {
+ throw new TypeError('argument fn must be a function')
+ }
+
+ return fn
+}
+
+/**
+ * Wrap property in a deprecation message.
+ *
+ * This is a no-op version of the wrapper, which does nothing but call
+ * validation.
+ */
+
+function wrapproperty (obj, prop, message) {
+ if (!obj || (typeof obj !== 'object' && typeof obj !== 'function')) {
+ throw new TypeError('argument obj must be object')
+ }
+
+ var descriptor = Object.getOwnPropertyDescriptor(obj, prop)
+
+ if (!descriptor) {
+ throw new TypeError('must call property on owner object')
+ }
+
+ if (!descriptor.configurable) {
+ throw new TypeError('property must be configurable')
+ }
+}
diff --git a/node_modules/depd/package.json b/node_modules/depd/package.json
new file mode 100644
index 0000000..3857e19
--- /dev/null
+++ b/node_modules/depd/package.json
@@ -0,0 +1,45 @@
+{
+ "name": "depd",
+ "description": "Deprecate all the things",
+ "version": "2.0.0",
+ "author": "Douglas Christopher Wilson ",
+ "license": "MIT",
+ "keywords": [
+ "deprecate",
+ "deprecated"
+ ],
+ "repository": "dougwilson/nodejs-depd",
+ "browser": "lib/browser/index.js",
+ "devDependencies": {
+ "benchmark": "2.1.4",
+ "beautify-benchmark": "0.2.4",
+ "eslint": "5.7.0",
+ "eslint-config-standard": "12.0.0",
+ "eslint-plugin-import": "2.14.0",
+ "eslint-plugin-markdown": "1.0.0-beta.7",
+ "eslint-plugin-node": "7.0.1",
+ "eslint-plugin-promise": "4.0.1",
+ "eslint-plugin-standard": "4.0.0",
+ "istanbul": "0.4.5",
+ "mocha": "5.2.0",
+ "safe-buffer": "5.1.2",
+ "uid-safe": "2.1.5"
+ },
+ "files": [
+ "lib/",
+ "History.md",
+ "LICENSE",
+ "index.js",
+ "Readme.md"
+ ],
+ "engines": {
+ "node": ">= 0.8"
+ },
+ "scripts": {
+ "bench": "node benchmark/index.js",
+ "lint": "eslint --plugin markdown --ext js,md .",
+ "test": "mocha --reporter spec --bail test/",
+ "test-ci": "istanbul cover --print=none node_modules/mocha/bin/_mocha -- --reporter spec test/ && istanbul report lcovonly text-summary",
+ "test-cov": "istanbul cover --print=none node_modules/mocha/bin/_mocha -- --reporter dot test/ && istanbul report lcov text-summary"
+ }
+}
diff --git a/node_modules/destroy/LICENSE b/node_modules/destroy/LICENSE
new file mode 100644
index 0000000..0e2c35f
--- /dev/null
+++ b/node_modules/destroy/LICENSE
@@ -0,0 +1,23 @@
+
+The MIT License (MIT)
+
+Copyright (c) 2014 Jonathan Ong me@jongleberry.com
+Copyright (c) 2015-2022 Douglas Christopher Wilson doug@somethingdoug.com
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE.
diff --git a/node_modules/destroy/README.md b/node_modules/destroy/README.md
new file mode 100644
index 0000000..e7701ae
--- /dev/null
+++ b/node_modules/destroy/README.md
@@ -0,0 +1,63 @@
+# destroy
+
+[![NPM version][npm-image]][npm-url]
+[![Build Status][github-actions-ci-image]][github-actions-ci-url]
+[![Test coverage][coveralls-image]][coveralls-url]
+[![License][license-image]][license-url]
+[![Downloads][downloads-image]][downloads-url]
+
+Destroy a stream.
+
+This module is meant to ensure a stream gets destroyed, handling different APIs
+and Node.js bugs.
+
+## API
+
+```js
+var destroy = require('destroy')
+```
+
+### destroy(stream [, suppress])
+
+Destroy the given stream, and optionally suppress any future `error` events.
+
+In most cases, this is identical to a simple `stream.destroy()` call. The rules
+are as follows for a given stream:
+
+ 1. If the `stream` is an instance of `ReadStream`, then call `stream.destroy()`
+ and add a listener to the `open` event to call `stream.close()` if it is
+ fired. This is for a Node.js bug that will leak a file descriptor if
+ `.destroy()` is called before `open`.
+ 2. If the `stream` is an instance of a zlib stream, then call `stream.destroy()`
+ and close the underlying zlib handle if open, otherwise call `stream.close()`.
+ This is for consistency across Node.js versions and a Node.js bug that will
+ leak a native zlib handle.
+ 3. If the `stream` is not an instance of `Stream`, then nothing happens.
+ 4. If the `stream` has a `.destroy()` method, then call it.
+
+The function returns the `stream` passed in as the argument.
+
+## Example
+
+```js
+var destroy = require('destroy')
+
+var fs = require('fs')
+var stream = fs.createReadStream('package.json')
+
+// ... and later
+destroy(stream)
+```
+
+[npm-image]: https://img.shields.io/npm/v/destroy.svg?style=flat-square
+[npm-url]: https://npmjs.org/package/destroy
+[github-tag]: http://img.shields.io/github/tag/stream-utils/destroy.svg?style=flat-square
+[github-url]: https://github.com/stream-utils/destroy/tags
+[coveralls-image]: https://img.shields.io/coveralls/stream-utils/destroy.svg?style=flat-square
+[coveralls-url]: https://coveralls.io/r/stream-utils/destroy?branch=master
+[license-image]: http://img.shields.io/npm/l/destroy.svg?style=flat-square
+[license-url]: LICENSE.md
+[downloads-image]: http://img.shields.io/npm/dm/destroy.svg?style=flat-square
+[downloads-url]: https://npmjs.org/package/destroy
+[github-actions-ci-image]: https://img.shields.io/github/workflow/status/stream-utils/destroy/ci/master?label=ci&style=flat-square
+[github-actions-ci-url]: https://github.com/stream-utils/destroy/actions/workflows/ci.yml
diff --git a/node_modules/destroy/index.js b/node_modules/destroy/index.js
new file mode 100644
index 0000000..7fd5c09
--- /dev/null
+++ b/node_modules/destroy/index.js
@@ -0,0 +1,209 @@
+/*!
+ * destroy
+ * Copyright(c) 2014 Jonathan Ong
+ * Copyright(c) 2015-2022 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+'use strict'
+
+/**
+ * Module dependencies.
+ * @private
+ */
+
+var EventEmitter = require('events').EventEmitter
+var ReadStream = require('fs').ReadStream
+var Stream = require('stream')
+var Zlib = require('zlib')
+
+/**
+ * Module exports.
+ * @public
+ */
+
+module.exports = destroy
+
+/**
+ * Destroy the given stream, and optionally suppress any future `error` events.
+ *
+ * @param {object} stream
+ * @param {boolean} suppress
+ * @public
+ */
+
+function destroy (stream, suppress) {
+ if (isFsReadStream(stream)) {
+ destroyReadStream(stream)
+ } else if (isZlibStream(stream)) {
+ destroyZlibStream(stream)
+ } else if (hasDestroy(stream)) {
+ stream.destroy()
+ }
+
+ if (isEventEmitter(stream) && suppress) {
+ stream.removeAllListeners('error')
+ stream.addListener('error', noop)
+ }
+
+ return stream
+}
+
+/**
+ * Destroy a ReadStream.
+ *
+ * @param {object} stream
+ * @private
+ */
+
+function destroyReadStream (stream) {
+ stream.destroy()
+
+ if (typeof stream.close === 'function') {
+ // node.js core bug work-around
+ stream.on('open', onOpenClose)
+ }
+}
+
+/**
+ * Close a Zlib stream.
+ *
+ * Zlib streams below Node.js 4.5.5 have a buggy implementation
+ * of .close() when zlib encountered an error.
+ *
+ * @param {object} stream
+ * @private
+ */
+
+function closeZlibStream (stream) {
+ if (stream._hadError === true) {
+ var prop = stream._binding === null
+ ? '_binding'
+ : '_handle'
+
+ stream[prop] = {
+ close: function () { this[prop] = null }
+ }
+ }
+
+ stream.close()
+}
+
+/**
+ * Destroy a Zlib stream.
+ *
+ * Zlib streams don't have a destroy function in Node.js 6. On top of that
+ * simply calling destroy on a zlib stream in Node.js 8+ will result in a
+ * memory leak. So until that is fixed, we need to call both close AND destroy.
+ *
+ * PR to fix memory leak: https://github.com/nodejs/node/pull/23734
+ *
+ * In Node.js 6+8, it's important that destroy is called before close as the
+ * stream would otherwise emit the error 'zlib binding closed'.
+ *
+ * @param {object} stream
+ * @private
+ */
+
+function destroyZlibStream (stream) {
+ if (typeof stream.destroy === 'function') {
+ // node.js core bug work-around
+ // istanbul ignore if: node.js 0.8
+ if (stream._binding) {
+ // node.js < 0.10.0
+ stream.destroy()
+ if (stream._processing) {
+ stream._needDrain = true
+ stream.once('drain', onDrainClearBinding)
+ } else {
+ stream._binding.clear()
+ }
+ } else if (stream._destroy && stream._destroy !== Stream.Transform.prototype._destroy) {
+ // node.js >= 12, ^11.1.0, ^10.15.1
+ stream.destroy()
+ } else if (stream._destroy && typeof stream.close === 'function') {
+ // node.js 7, 8
+ stream.destroyed = true
+ stream.close()
+ } else {
+ // fallback
+ // istanbul ignore next
+ stream.destroy()
+ }
+ } else if (typeof stream.close === 'function') {
+ // node.js < 8 fallback
+ closeZlibStream(stream)
+ }
+}
+
+/**
+ * Determine if stream has destroy.
+ * @private
+ */
+
+function hasDestroy (stream) {
+ return stream instanceof Stream &&
+ typeof stream.destroy === 'function'
+}
+
+/**
+ * Determine if val is EventEmitter.
+ * @private
+ */
+
+function isEventEmitter (val) {
+ return val instanceof EventEmitter
+}
+
+/**
+ * Determine if stream is fs.ReadStream stream.
+ * @private
+ */
+
+function isFsReadStream (stream) {
+ return stream instanceof ReadStream
+}
+
+/**
+ * Determine if stream is Zlib stream.
+ * @private
+ */
+
+function isZlibStream (stream) {
+ return stream instanceof Zlib.Gzip ||
+ stream instanceof Zlib.Gunzip ||
+ stream instanceof Zlib.Deflate ||
+ stream instanceof Zlib.DeflateRaw ||
+ stream instanceof Zlib.Inflate ||
+ stream instanceof Zlib.InflateRaw ||
+ stream instanceof Zlib.Unzip
+}
+
+/**
+ * No-op function.
+ * @private
+ */
+
+function noop () {}
+
+/**
+ * On drain handler to clear binding.
+ * @private
+ */
+
+// istanbul ignore next: node.js 0.8
+function onDrainClearBinding () {
+ this._binding.clear()
+}
+
+/**
+ * On open handler to close stream.
+ * @private
+ */
+
+function onOpenClose () {
+ if (typeof this.fd === 'number') {
+ // actually close down the fd
+ this.close()
+ }
+}
diff --git a/node_modules/destroy/package.json b/node_modules/destroy/package.json
new file mode 100644
index 0000000..c85e438
--- /dev/null
+++ b/node_modules/destroy/package.json
@@ -0,0 +1,48 @@
+{
+ "name": "destroy",
+ "description": "destroy a stream if possible",
+ "version": "1.2.0",
+ "author": {
+ "name": "Jonathan Ong",
+ "email": "me@jongleberry.com",
+ "url": "http://jongleberry.com",
+ "twitter": "https://twitter.com/jongleberry"
+ },
+ "contributors": [
+ "Douglas Christopher Wilson "
+ ],
+ "license": "MIT",
+ "repository": "stream-utils/destroy",
+ "devDependencies": {
+ "eslint": "7.32.0",
+ "eslint-config-standard": "14.1.1",
+ "eslint-plugin-import": "2.25.4",
+ "eslint-plugin-node": "11.1.0",
+ "eslint-plugin-promise": "5.2.0",
+ "eslint-plugin-standard": "4.1.0",
+ "mocha": "9.2.2",
+ "nyc": "15.1.0"
+ },
+ "engines": {
+ "node": ">= 0.8",
+ "npm": "1.2.8000 || >= 1.4.16"
+ },
+ "scripts": {
+ "lint": "eslint .",
+ "test": "mocha --reporter spec",
+ "test-ci": "nyc --reporter=lcovonly --reporter=text npm test",
+ "test-cov": "nyc --reporter=html --reporter=text npm test"
+ },
+ "files": [
+ "index.js",
+ "LICENSE"
+ ],
+ "keywords": [
+ "stream",
+ "streams",
+ "destroy",
+ "cleanup",
+ "leak",
+ "fd"
+ ]
+}
diff --git a/node_modules/ecdsa-sig-formatter/CODEOWNERS b/node_modules/ecdsa-sig-formatter/CODEOWNERS
new file mode 100644
index 0000000..4451d3d
--- /dev/null
+++ b/node_modules/ecdsa-sig-formatter/CODEOWNERS
@@ -0,0 +1 @@
+* @omsmith
diff --git a/node_modules/ecdsa-sig-formatter/LICENSE b/node_modules/ecdsa-sig-formatter/LICENSE
new file mode 100644
index 0000000..8754ed6
--- /dev/null
+++ b/node_modules/ecdsa-sig-formatter/LICENSE
@@ -0,0 +1,201 @@
+Apache License
+ Version 2.0, January 2004
+ http://www.apache.org/licenses/
+
+ TERMS AND CONDITIONS FOR USE, REPRODUCTION, AND DISTRIBUTION
+
+ 1. Definitions.
+
+ "License" shall mean the terms and conditions for use, reproduction,
+ and distribution as defined by Sections 1 through 9 of this document.
+
+ "Licensor" shall mean the copyright owner or entity authorized by
+ the copyright owner that is granting the License.
+
+ "Legal Entity" shall mean the union of the acting entity and all
+ other entities that control, are controlled by, or are under common
+ control with that entity. For the purposes of this definition,
+ "control" means (i) the power, direct or indirect, to cause the
+ direction or management of such entity, whether by contract or
+ otherwise, or (ii) ownership of fifty percent (50%) or more of the
+ outstanding shares, or (iii) beneficial ownership of such entity.
+
+ "You" (or "Your") shall mean an individual or Legal Entity
+ exercising permissions granted by this License.
+
+ "Source" form shall mean the preferred form for making modifications,
+ including but not limited to software source code, documentation
+ source, and configuration files.
+
+ "Object" form shall mean any form resulting from mechanical
+ transformation or translation of a Source form, including but
+ not limited to compiled object code, generated documentation,
+ and conversions to other media types.
+
+ "Work" shall mean the work of authorship, whether in Source or
+ Object form, made available under the License, as indicated by a
+ copyright notice that is included in or attached to the work
+ (an example is provided in the Appendix below).
+
+ "Derivative Works" shall mean any work, whether in Source or Object
+ form, that is based on (or derived from) the Work and for which the
+ editorial revisions, annotations, elaborations, or other modifications
+ represent, as a whole, an original work of authorship. For the purposes
+ of this License, Derivative Works shall not include works that remain
+ separable from, or merely link (or bind by name) to the interfaces of,
+ the Work and Derivative Works thereof.
+
+ "Contribution" shall mean any work of authorship, including
+ the original version of the Work and any modifications or additions
+ to that Work or Derivative Works thereof, that is intentionally
+ submitted to Licensor for inclusion in the Work by the copyright owner
+ or by an individual or Legal Entity authorized to submit on behalf of
+ the copyright owner. For the purposes of this definition, "submitted"
+ means any form of electronic, verbal, or written communication sent
+ to the Licensor or its representatives, including but not limited to
+ communication on electronic mailing lists, source code control systems,
+ and issue tracking systems that are managed by, or on behalf of, the
+ Licensor for the purpose of discussing and improving the Work, but
+ excluding communication that is conspicuously marked or otherwise
+ designated in writing by the copyright owner as "Not a Contribution."
+
+ "Contributor" shall mean Licensor and any individual or Legal Entity
+ on behalf of whom a Contribution has been received by Licensor and
+ subsequently incorporated within the Work.
+
+ 2. Grant of Copyright License. Subject to the terms and conditions of
+ this License, each Contributor hereby grants to You a perpetual,
+ worldwide, non-exclusive, no-charge, royalty-free, irrevocable
+ copyright license to reproduce, prepare Derivative Works of,
+ publicly display, publicly perform, sublicense, and distribute the
+ Work and such Derivative Works in Source or Object form.
+
+ 3. Grant of Patent License. Subject to the terms and conditions of
+ this License, each Contributor hereby grants to You a perpetual,
+ worldwide, non-exclusive, no-charge, royalty-free, irrevocable
+ (except as stated in this section) patent license to make, have made,
+ use, offer to sell, sell, import, and otherwise transfer the Work,
+ where such license applies only to those patent claims licensable
+ by such Contributor that are necessarily infringed by their
+ Contribution(s) alone or by combination of their Contribution(s)
+ with the Work to which such Contribution(s) was submitted. If You
+ institute patent litigation against any entity (including a
+ cross-claim or counterclaim in a lawsuit) alleging that the Work
+ or a Contribution incorporated within the Work constitutes direct
+ or contributory patent infringement, then any patent licenses
+ granted to You under this License for that Work shall terminate
+ as of the date such litigation is filed.
+
+ 4. Redistribution. You may reproduce and distribute copies of the
+ Work or Derivative Works thereof in any medium, with or without
+ modifications, and in Source or Object form, provided that You
+ meet the following conditions:
+
+ (a) You must give any other recipients of the Work or
+ Derivative Works a copy of this License; and
+
+ (b) You must cause any modified files to carry prominent notices
+ stating that You changed the files; and
+
+ (c) You must retain, in the Source form of any Derivative Works
+ that You distribute, all copyright, patent, trademark, and
+ attribution notices from the Source form of the Work,
+ excluding those notices that do not pertain to any part of
+ the Derivative Works; and
+
+ (d) If the Work includes a "NOTICE" text file as part of its
+ distribution, then any Derivative Works that You distribute must
+ include a readable copy of the attribution notices contained
+ within such NOTICE file, excluding those notices that do not
+ pertain to any part of the Derivative Works, in at least one
+ of the following places: within a NOTICE text file distributed
+ as part of the Derivative Works; within the Source form or
+ documentation, if provided along with the Derivative Works; or,
+ within a display generated by the Derivative Works, if and
+ wherever such third-party notices normally appear. The contents
+ of the NOTICE file are for informational purposes only and
+ do not modify the License. You may add Your own attribution
+ notices within Derivative Works that You distribute, alongside
+ or as an addendum to the NOTICE text from the Work, provided
+ that such additional attribution notices cannot be construed
+ as modifying the License.
+
+ You may add Your own copyright statement to Your modifications and
+ may provide additional or different license terms and conditions
+ for use, reproduction, or distribution of Your modifications, or
+ for any such Derivative Works as a whole, provided Your use,
+ reproduction, and distribution of the Work otherwise complies with
+ the conditions stated in this License.
+
+ 5. Submission of Contributions. Unless You explicitly state otherwise,
+ any Contribution intentionally submitted for inclusion in the Work
+ by You to the Licensor shall be under the terms and conditions of
+ this License, without any additional terms or conditions.
+ Notwithstanding the above, nothing herein shall supersede or modify
+ the terms of any separate license agreement you may have executed
+ with Licensor regarding such Contributions.
+
+ 6. Trademarks. This License does not grant permission to use the trade
+ names, trademarks, service marks, or product names of the Licensor,
+ except as required for reasonable and customary use in describing the
+ origin of the Work and reproducing the content of the NOTICE file.
+
+ 7. Disclaimer of Warranty. Unless required by applicable law or
+ agreed to in writing, Licensor provides the Work (and each
+ Contributor provides its Contributions) on an "AS IS" BASIS,
+ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or
+ implied, including, without limitation, any warranties or conditions
+ of TITLE, NON-INFRINGEMENT, MERCHANTABILITY, or FITNESS FOR A
+ PARTICULAR PURPOSE. You are solely responsible for determining the
+ appropriateness of using or redistributing the Work and assume any
+ risks associated with Your exercise of permissions under this License.
+
+ 8. Limitation of Liability. In no event and under no legal theory,
+ whether in tort (including negligence), contract, or otherwise,
+ unless required by applicable law (such as deliberate and grossly
+ negligent acts) or agreed to in writing, shall any Contributor be
+ liable to You for damages, including any direct, indirect, special,
+ incidental, or consequential damages of any character arising as a
+ result of this License or out of the use or inability to use the
+ Work (including but not limited to damages for loss of goodwill,
+ work stoppage, computer failure or malfunction, or any and all
+ other commercial damages or losses), even if such Contributor
+ has been advised of the possibility of such damages.
+
+ 9. Accepting Warranty or Additional Liability. While redistributing
+ the Work or Derivative Works thereof, You may choose to offer,
+ and charge a fee for, acceptance of support, warranty, indemnity,
+ or other liability obligations and/or rights consistent with this
+ License. However, in accepting such obligations, You may act only
+ on Your own behalf and on Your sole responsibility, not on behalf
+ of any other Contributor, and only if You agree to indemnify,
+ defend, and hold each Contributor harmless for any liability
+ incurred by, or claims asserted against, such Contributor by reason
+ of your accepting any such warranty or additional liability.
+
+ END OF TERMS AND CONDITIONS
+
+ APPENDIX: How to apply the Apache License to your work.
+
+ To apply the Apache License to your work, attach the following
+ boilerplate notice, with the fields enclosed by brackets "{}"
+ replaced with your own identifying information. (Don't include
+ the brackets!) The text should be enclosed in the appropriate
+ comment syntax for the file format. We also recommend that a
+ file or class name and description of purpose be included on the
+ same "printed page" as the copyright notice for easier
+ identification within third-party archives.
+
+ Copyright 2015 D2L Corporation
+
+ Licensed under the Apache License, Version 2.0 (the "License");
+ you may not use this file except in compliance with the License.
+ You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+ Unless required by applicable law or agreed to in writing, software
+ distributed under the License is distributed on an "AS IS" BASIS,
+ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ See the License for the specific language governing permissions and
+ limitations under the License.
diff --git a/node_modules/ecdsa-sig-formatter/README.md b/node_modules/ecdsa-sig-formatter/README.md
new file mode 100644
index 0000000..daa95d6
--- /dev/null
+++ b/node_modules/ecdsa-sig-formatter/README.md
@@ -0,0 +1,65 @@
+# ecdsa-sig-formatter
+
+[](https://travis-ci.org/Brightspace/node-ecdsa-sig-formatter) [](https://coveralls.io/r/Brightspace/node-ecdsa-sig-formatter)
+
+Translate between JOSE and ASN.1/DER encodings for ECDSA signatures
+
+## Install
+```sh
+npm install ecdsa-sig-formatter --save
+```
+
+## Usage
+```js
+var format = require('ecdsa-sig-formatter');
+
+var derSignature = '..'; // asn.1/DER encoded ecdsa signature
+
+var joseSignature = format.derToJose(derSignature);
+
+```
+
+### API
+
+---
+
+#### `.derToJose(Buffer|String signature, String alg)` -> `String`
+
+Convert the ASN.1/DER encoded signature to a JOSE-style concatenated signature.
+Returns a _base64 url_ encoded `String`.
+
+* If _signature_ is a `String`, it should be _base64_ encoded
+* _alg_ must be one of _ES256_, _ES384_ or _ES512_
+
+---
+
+#### `.joseToDer(Buffer|String signature, String alg)` -> `Buffer`
+
+Convert the JOSE-style concatenated signature to an ASN.1/DER encoded
+signature. Returns a `Buffer`
+
+* If _signature_ is a `String`, it should be _base64 url_ encoded
+* _alg_ must be one of _ES256_, _ES384_ or _ES512_
+
+## Contributing
+
+1. **Fork** the repository. Committing directly against this repository is
+ highly discouraged.
+
+2. Make your modifications in a branch, updating and writing new unit tests
+ as necessary in the `spec` directory.
+
+3. Ensure that all tests pass with `npm test`
+
+4. `rebase` your changes against master. *Do not merge*.
+
+5. Submit a pull request to this repository. Wait for tests to run and someone
+ to chime in.
+
+### Code Style
+
+This repository is configured with [EditorConfig][EditorConfig] and
+[ESLint][ESLint] rules.
+
+[EditorConfig]: http://editorconfig.org/
+[ESLint]: http://eslint.org
diff --git a/node_modules/ecdsa-sig-formatter/package.json b/node_modules/ecdsa-sig-formatter/package.json
new file mode 100644
index 0000000..6fb5ebf
--- /dev/null
+++ b/node_modules/ecdsa-sig-formatter/package.json
@@ -0,0 +1,46 @@
+{
+ "name": "ecdsa-sig-formatter",
+ "version": "1.0.11",
+ "description": "Translate ECDSA signatures between ASN.1/DER and JOSE-style concatenation",
+ "main": "src/ecdsa-sig-formatter.js",
+ "scripts": {
+ "check-style": "eslint .",
+ "pretest": "npm run check-style",
+ "test": "istanbul cover --root src _mocha -- spec",
+ "report-cov": "cat ./coverage/lcov.info | coveralls"
+ },
+ "typings": "./src/ecdsa-sig-formatter.d.ts",
+ "repository": {
+ "type": "git",
+ "url": "git+ssh://git@github.com/Brightspace/node-ecdsa-sig-formatter.git"
+ },
+ "keywords": [
+ "ecdsa",
+ "der",
+ "asn.1",
+ "jwt",
+ "jwa",
+ "jsonwebtoken",
+ "jose"
+ ],
+ "author": "D2L Corporation",
+ "license": "Apache-2.0",
+ "bugs": {
+ "url": "https://github.com/Brightspace/node-ecdsa-sig-formatter/issues"
+ },
+ "homepage": "https://github.com/Brightspace/node-ecdsa-sig-formatter#readme",
+ "dependencies": {
+ "safe-buffer": "^5.0.1"
+ },
+ "devDependencies": {
+ "bench": "^0.3.6",
+ "chai": "^3.5.0",
+ "coveralls": "^2.11.9",
+ "eslint": "^2.12.0",
+ "eslint-config-brightspace": "^0.2.1",
+ "istanbul": "^0.4.3",
+ "jwk-to-pem": "^1.2.5",
+ "mocha": "^2.5.3",
+ "native-crypto": "^1.7.0"
+ }
+}
diff --git a/node_modules/ecdsa-sig-formatter/src/ecdsa-sig-formatter.d.ts b/node_modules/ecdsa-sig-formatter/src/ecdsa-sig-formatter.d.ts
new file mode 100644
index 0000000..9693aa0
--- /dev/null
+++ b/node_modules/ecdsa-sig-formatter/src/ecdsa-sig-formatter.d.ts
@@ -0,0 +1,17 @@
+/// "
+ ],
+ "license": "MIT",
+ "repository": "jonathanong/ee-first",
+ "devDependencies": {
+ "istanbul": "0.3.9",
+ "mocha": "2.2.5"
+ },
+ "files": [
+ "index.js",
+ "LICENSE"
+ ],
+ "scripts": {
+ "test": "mocha --reporter spec --bail --check-leaks test/",
+ "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/",
+ "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/"
+ }
+}
diff --git a/node_modules/encodeurl/LICENSE b/node_modules/encodeurl/LICENSE
new file mode 100644
index 0000000..8812229
--- /dev/null
+++ b/node_modules/encodeurl/LICENSE
@@ -0,0 +1,22 @@
+(The MIT License)
+
+Copyright (c) 2016 Douglas Christopher Wilson
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/node_modules/encodeurl/README.md b/node_modules/encodeurl/README.md
new file mode 100644
index 0000000..3842493
--- /dev/null
+++ b/node_modules/encodeurl/README.md
@@ -0,0 +1,109 @@
+# Encode URL
+
+Encode a URL to a percent-encoded form, excluding already-encoded sequences.
+
+## Installation
+
+```sh
+npm install encodeurl
+```
+
+## API
+
+```js
+var encodeUrl = require('encodeurl')
+```
+
+### encodeUrl(url)
+
+Encode a URL to a percent-encoded form, excluding already-encoded sequences.
+
+This function accepts a URL and encodes all the non-URL code points (as UTF-8 byte sequences). It will not encode the "%" character unless it is not part of a valid sequence (`%20` will be left as-is, but `%foo` will be encoded as `%25foo`).
+
+This encode is meant to be "safe" and does not throw errors. It will try as hard as it can to properly encode the given URL, including replacing any raw, unpaired surrogate pairs with the Unicode replacement character prior to encoding.
+
+## Examples
+
+### Encode a URL containing user-controlled data
+
+```js
+var encodeUrl = require('encodeurl')
+var escapeHtml = require('escape-html')
+
+http.createServer(function onRequest (req, res) {
+ // get encoded form of inbound url
+ var url = encodeUrl(req.url)
+
+ // create html message
+ var body = 'Location ' + escapeHtml(url) + ' not found
'
+
+ // send a 404
+ res.statusCode = 404
+ res.setHeader('Content-Type', 'text/html; charset=UTF-8')
+ res.setHeader('Content-Length', String(Buffer.byteLength(body, 'utf-8')))
+ res.end(body, 'utf-8')
+})
+```
+
+### Encode a URL for use in a header field
+
+```js
+var encodeUrl = require('encodeurl')
+var escapeHtml = require('escape-html')
+var url = require('url')
+
+http.createServer(function onRequest (req, res) {
+ // parse inbound url
+ var href = url.parse(req)
+
+ // set new host for redirect
+ href.host = 'localhost'
+ href.protocol = 'https:'
+ href.slashes = true
+
+ // create location header
+ var location = encodeUrl(url.format(href))
+
+ // create html message
+ var body = 'Redirecting to new site: ' + escapeHtml(location) + '
'
+
+ // send a 301
+ res.statusCode = 301
+ res.setHeader('Content-Type', 'text/html; charset=UTF-8')
+ res.setHeader('Content-Length', String(Buffer.byteLength(body, 'utf-8')))
+ res.setHeader('Location', location)
+ res.end(body, 'utf-8')
+})
+```
+
+## Similarities
+
+This function is _similar_ to the intrinsic function `encodeURI`. However, it will not encode:
+
+* The `\`, `^`, or `|` characters
+* The `%` character when it's part of a valid sequence
+* `[` and `]` (for IPv6 hostnames)
+* Replaces raw, unpaired surrogate pairs with the Unicode replacement character
+
+As a result, the encoding aligns closely with the behavior in the [WHATWG URL specification][whatwg-url]. However, this package only encodes strings and does not do any URL parsing or formatting.
+
+It is expected that any output from `new URL(url)` will not change when used with this package, as the output has already been encoded. Additionally, if we were to encode before `new URL(url)`, we do not expect the before and after encoded formats to be parsed any differently.
+
+## Testing
+
+```sh
+$ npm test
+$ npm run lint
+```
+
+## References
+
+- [RFC 3986: Uniform Resource Identifier (URI): Generic Syntax][rfc-3986]
+- [WHATWG URL Living Standard][whatwg-url]
+
+[rfc-3986]: https://tools.ietf.org/html/rfc3986
+[whatwg-url]: https://url.spec.whatwg.org/
+
+## License
+
+[MIT](LICENSE)
diff --git a/node_modules/encodeurl/index.js b/node_modules/encodeurl/index.js
new file mode 100644
index 0000000..a49ee5a
--- /dev/null
+++ b/node_modules/encodeurl/index.js
@@ -0,0 +1,60 @@
+/*!
+ * encodeurl
+ * Copyright(c) 2016 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+'use strict'
+
+/**
+ * Module exports.
+ * @public
+ */
+
+module.exports = encodeUrl
+
+/**
+ * RegExp to match non-URL code points, *after* encoding (i.e. not including "%")
+ * and including invalid escape sequences.
+ * @private
+ */
+
+var ENCODE_CHARS_REGEXP = /(?:[^\x21\x23-\x3B\x3D\x3F-\x5F\x61-\x7A\x7C\x7E]|%(?:[^0-9A-Fa-f]|[0-9A-Fa-f][^0-9A-Fa-f]|$))+/g
+
+/**
+ * RegExp to match unmatched surrogate pair.
+ * @private
+ */
+
+var UNMATCHED_SURROGATE_PAIR_REGEXP = /(^|[^\uD800-\uDBFF])[\uDC00-\uDFFF]|[\uD800-\uDBFF]([^\uDC00-\uDFFF]|$)/g
+
+/**
+ * String to replace unmatched surrogate pair with.
+ * @private
+ */
+
+var UNMATCHED_SURROGATE_PAIR_REPLACE = '$1\uFFFD$2'
+
+/**
+ * Encode a URL to a percent-encoded form, excluding already-encoded sequences.
+ *
+ * This function will take an already-encoded URL and encode all the non-URL
+ * code points. This function will not encode the "%" character unless it is
+ * not part of a valid sequence (`%20` will be left as-is, but `%foo` will
+ * be encoded as `%25foo`).
+ *
+ * This encode is meant to be "safe" and does not throw errors. It will try as
+ * hard as it can to properly encode the given URL, including replacing any raw,
+ * unpaired surrogate pairs with the Unicode replacement character prior to
+ * encoding.
+ *
+ * @param {string} url
+ * @return {string}
+ * @public
+ */
+
+function encodeUrl (url) {
+ return String(url)
+ .replace(UNMATCHED_SURROGATE_PAIR_REGEXP, UNMATCHED_SURROGATE_PAIR_REPLACE)
+ .replace(ENCODE_CHARS_REGEXP, encodeURI)
+}
diff --git a/node_modules/encodeurl/package.json b/node_modules/encodeurl/package.json
new file mode 100644
index 0000000..3133822
--- /dev/null
+++ b/node_modules/encodeurl/package.json
@@ -0,0 +1,40 @@
+{
+ "name": "encodeurl",
+ "description": "Encode a URL to a percent-encoded form, excluding already-encoded sequences",
+ "version": "2.0.0",
+ "contributors": [
+ "Douglas Christopher Wilson "
+ ],
+ "license": "MIT",
+ "keywords": [
+ "encode",
+ "encodeurl",
+ "url"
+ ],
+ "repository": "pillarjs/encodeurl",
+ "devDependencies": {
+ "eslint": "5.11.1",
+ "eslint-config-standard": "12.0.0",
+ "eslint-plugin-import": "2.14.0",
+ "eslint-plugin-node": "7.0.1",
+ "eslint-plugin-promise": "4.0.1",
+ "eslint-plugin-standard": "4.0.0",
+ "istanbul": "0.4.5",
+ "mocha": "2.5.3"
+ },
+ "files": [
+ "LICENSE",
+ "HISTORY.md",
+ "README.md",
+ "index.js"
+ ],
+ "engines": {
+ "node": ">= 0.8"
+ },
+ "scripts": {
+ "lint": "eslint .",
+ "test": "mocha --reporter spec --bail --check-leaks test/",
+ "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/",
+ "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/"
+ }
+}
diff --git a/node_modules/es-define-property/.eslintrc b/node_modules/es-define-property/.eslintrc
new file mode 100644
index 0000000..46f3b12
--- /dev/null
+++ b/node_modules/es-define-property/.eslintrc
@@ -0,0 +1,13 @@
+{
+ "root": true,
+
+ "extends": "@ljharb",
+
+ "rules": {
+ "new-cap": ["error", {
+ "capIsNewExceptions": [
+ "GetIntrinsic",
+ ],
+ }],
+ },
+}
diff --git a/node_modules/es-define-property/.github/FUNDING.yml b/node_modules/es-define-property/.github/FUNDING.yml
new file mode 100644
index 0000000..4445451
--- /dev/null
+++ b/node_modules/es-define-property/.github/FUNDING.yml
@@ -0,0 +1,12 @@
+# These are supported funding model platforms
+
+github: [ljharb]
+patreon: # Replace with a single Patreon username
+open_collective: # Replace with a single Open Collective username
+ko_fi: # Replace with a single Ko-fi username
+tidelift: npm/es-define-property
+community_bridge: # Replace with a single Community Bridge project-name e.g., cloud-foundry
+liberapay: # Replace with a single Liberapay username
+issuehunt: # Replace with a single IssueHunt username
+otechie: # Replace with a single Otechie username
+custom: # Replace with a single custom sponsorship URL
diff --git a/node_modules/es-define-property/.nycrc b/node_modules/es-define-property/.nycrc
new file mode 100644
index 0000000..bdd626c
--- /dev/null
+++ b/node_modules/es-define-property/.nycrc
@@ -0,0 +1,9 @@
+{
+ "all": true,
+ "check-coverage": false,
+ "reporter": ["text-summary", "text", "html", "json"],
+ "exclude": [
+ "coverage",
+ "test"
+ ]
+}
diff --git a/node_modules/es-define-property/CHANGELOG.md b/node_modules/es-define-property/CHANGELOG.md
new file mode 100644
index 0000000..4dce2ec
--- /dev/null
+++ b/node_modules/es-define-property/CHANGELOG.md
@@ -0,0 +1,15 @@
+# Changelog
+
+All notable changes to this project will be documented in this file.
+
+The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.0.0/)
+and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0.html).
+
+## v1.0.0 - 2024-02-12
+
+### Commits
+
+- Initial implementation, tests, readme, types [`3e154e1`](https://github.com/ljharb/es-define-property/commit/3e154e11a2fee09127220f5e503bf2c0a31dd480)
+- Initial commit [`07d98de`](https://github.com/ljharb/es-define-property/commit/07d98de34a4dc31ff5e83a37c0c3f49e0d85cd50)
+- npm init [`c4eb634`](https://github.com/ljharb/es-define-property/commit/c4eb6348b0d3886aac36cef34ad2ee0665ea6f3e)
+- Only apps should have lockfiles [`7af86ec`](https://github.com/ljharb/es-define-property/commit/7af86ec1d311ec0b17fdfe616a25f64276903856)
diff --git a/node_modules/es-define-property/LICENSE b/node_modules/es-define-property/LICENSE
new file mode 100644
index 0000000..f82f389
--- /dev/null
+++ b/node_modules/es-define-property/LICENSE
@@ -0,0 +1,21 @@
+MIT License
+
+Copyright (c) 2024 Jordan Harband
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
+SOFTWARE.
diff --git a/node_modules/es-define-property/README.md b/node_modules/es-define-property/README.md
new file mode 100644
index 0000000..9b291bd
--- /dev/null
+++ b/node_modules/es-define-property/README.md
@@ -0,0 +1,49 @@
+# es-define-property [![Version Badge][npm-version-svg]][package-url]
+
+[![github actions][actions-image]][actions-url]
+[![coverage][codecov-image]][codecov-url]
+[![License][license-image]][license-url]
+[![Downloads][downloads-image]][downloads-url]
+
+[![npm badge][npm-badge-png]][package-url]
+
+`Object.defineProperty`, but not IE 8's broken one.
+
+## Example
+
+```js
+const assert = require('assert');
+
+const $defineProperty = require('es-define-property');
+
+if ($defineProperty) {
+ assert.equal($defineProperty, Object.defineProperty);
+} else if (Object.defineProperty) {
+ assert.equal($defineProperty, false, 'this is IE 8');
+} else {
+ assert.equal($defineProperty, false, 'this is an ES3 engine');
+}
+```
+
+## Tests
+Simply clone the repo, `npm install`, and run `npm test`
+
+## Security
+
+Please email [@ljharb](https://github.com/ljharb) or see https://tidelift.com/security if you have a potential security vulnerability to report.
+
+[package-url]: https://npmjs.org/package/es-define-property
+[npm-version-svg]: https://versionbadg.es/ljharb/es-define-property.svg
+[deps-svg]: https://david-dm.org/ljharb/es-define-property.svg
+[deps-url]: https://david-dm.org/ljharb/es-define-property
+[dev-deps-svg]: https://david-dm.org/ljharb/es-define-property/dev-status.svg
+[dev-deps-url]: https://david-dm.org/ljharb/es-define-property#info=devDependencies
+[npm-badge-png]: https://nodei.co/npm/es-define-property.png?downloads=true&stars=true
+[license-image]: https://img.shields.io/npm/l/es-define-property.svg
+[license-url]: LICENSE
+[downloads-image]: https://img.shields.io/npm/dm/es-define-property.svg
+[downloads-url]: https://npm-stat.com/charts.html?package=es-define-property
+[codecov-image]: https://codecov.io/gh/ljharb/es-define-property/branch/main/graphs/badge.svg
+[codecov-url]: https://app.codecov.io/gh/ljharb/es-define-property/
+[actions-image]: https://img.shields.io/endpoint?url=https://github-actions-badge-u3jn4tfpocch.runkit.sh/ljharb/es-define-property
+[actions-url]: https://github.com/ljharb/es-define-property/actions
diff --git a/node_modules/es-define-property/index.d.ts b/node_modules/es-define-property/index.d.ts
new file mode 100644
index 0000000..6012247
--- /dev/null
+++ b/node_modules/es-define-property/index.d.ts
@@ -0,0 +1,3 @@
+declare const defineProperty: false | typeof Object.defineProperty;
+
+export = defineProperty;
\ No newline at end of file
diff --git a/node_modules/es-define-property/index.js b/node_modules/es-define-property/index.js
new file mode 100644
index 0000000..f32737d
--- /dev/null
+++ b/node_modules/es-define-property/index.js
@@ -0,0 +1,16 @@
+'use strict';
+
+var GetIntrinsic = require('get-intrinsic');
+
+/** @type {import('.')} */
+var $defineProperty = GetIntrinsic('%Object.defineProperty%', true) || false;
+if ($defineProperty) {
+ try {
+ $defineProperty({}, 'a', { value: 1 });
+ } catch (e) {
+ // IE 8 has a broken defineProperty
+ $defineProperty = false;
+ }
+}
+
+module.exports = $defineProperty;
diff --git a/node_modules/es-define-property/package.json b/node_modules/es-define-property/package.json
new file mode 100644
index 0000000..45bc90f
--- /dev/null
+++ b/node_modules/es-define-property/package.json
@@ -0,0 +1,81 @@
+{
+ "name": "es-define-property",
+ "version": "1.0.0",
+ "description": "`Object.defineProperty`, but not IE 8's broken one.",
+ "main": "index.js",
+ "types": "./index.d.ts",
+ "exports": {
+ ".": "./index.js",
+ "./package.json": "./package.json"
+ },
+ "sideEffects": false,
+ "scripts": {
+ "prepack": "npmignore --auto --commentLines=autogenerated",
+ "prepublish": "not-in-publish || npm run prepublishOnly",
+ "prepublishOnly": "safe-publish-latest",
+ "prelint": "evalmd README.md",
+ "lint": "eslint --ext=js,mjs .",
+ "postlint": "tsc -p .",
+ "pretest": "npm run lint",
+ "tests-only": "nyc tape 'test/**/*.js'",
+ "test": "npm run tests-only",
+ "posttest": "aud --production",
+ "version": "auto-changelog && git add CHANGELOG.md",
+ "postversion": "auto-changelog && git add CHANGELOG.md && git commit --no-edit --amend && git tag -f \"v$(node -e \"console.log(require('./package.json').version)\")\""
+ },
+ "repository": {
+ "type": "git",
+ "url": "git+https://github.com/ljharb/es-define-property.git"
+ },
+ "keywords": [
+ "javascript",
+ "ecmascript",
+ "object",
+ "define",
+ "property",
+ "defineProperty",
+ "Object.defineProperty"
+ ],
+ "author": "Jordan Harband ",
+ "license": "MIT",
+ "bugs": {
+ "url": "https://github.com/ljharb/es-define-property/issues"
+ },
+ "homepage": "https://github.com/ljharb/es-define-property#readme",
+ "dependencies": {
+ "get-intrinsic": "^1.2.4"
+ },
+ "devDependencies": {
+ "@ljharb/eslint-config": "^21.1.0",
+ "@types/get-intrinsic": "^1.2.2",
+ "@types/gopd": "^1.0.3",
+ "@types/tape": "^5.6.4",
+ "aud": "^2.0.4",
+ "auto-changelog": "^2.4.0",
+ "eslint": "^8.8.0",
+ "evalmd": "^0.0.19",
+ "gopd": "^1.0.1",
+ "in-publish": "^2.0.1",
+ "npmignore": "^0.3.1",
+ "nyc": "^10.3.2",
+ "safe-publish-latest": "^2.0.0",
+ "tape": "^5.7.4",
+ "typescript": "next"
+ },
+ "engines": {
+ "node": ">= 0.4"
+ },
+ "auto-changelog": {
+ "output": "CHANGELOG.md",
+ "template": "keepachangelog",
+ "unreleased": false,
+ "commitLimit": false,
+ "backfillLimit": false,
+ "hideCredit": true
+ },
+ "publishConfig": {
+ "ignore": [
+ ".github/workflows"
+ ]
+ }
+}
diff --git a/node_modules/es-define-property/test/index.js b/node_modules/es-define-property/test/index.js
new file mode 100644
index 0000000..dbc054e
--- /dev/null
+++ b/node_modules/es-define-property/test/index.js
@@ -0,0 +1,55 @@
+'use strict';
+
+var $defineProperty = require('../');
+
+var test = require('tape');
+var gOPD = require('gopd');
+
+test('defineProperty: supported', { skip: !$defineProperty }, function (t) {
+ t.plan(4);
+
+ t.equal(typeof $defineProperty, 'function', 'defineProperty is supported');
+ if ($defineProperty && gOPD) { // this `if` check is just to shut TS up
+ var o = { a: 1 };
+
+ $defineProperty(o, 'b', { enumerable: true, value: 2 });
+ t.deepEqual(
+ gOPD(o, 'b'),
+ {
+ configurable: false,
+ enumerable: true,
+ value: 2,
+ writable: false
+ },
+ 'property descriptor is as expected'
+ );
+
+ $defineProperty(o, 'c', { enumerable: false, value: 3, writable: true });
+ t.deepEqual(
+ gOPD(o, 'c'),
+ {
+ configurable: false,
+ enumerable: false,
+ value: 3,
+ writable: true
+ },
+ 'property descriptor is as expected'
+ );
+ }
+
+ t.equal($defineProperty, Object.defineProperty, 'defineProperty is Object.defineProperty');
+
+ t.end();
+});
+
+test('defineProperty: not supported', { skip: !!$defineProperty }, function (t) {
+ t.notOk($defineProperty, 'defineProperty is not supported');
+
+ t.match(
+ typeof $defineProperty,
+ /^(?:undefined|boolean)$/,
+ '`typeof defineProperty` is `undefined` or `boolean`'
+ );
+
+ t.end();
+});
diff --git a/node_modules/es-define-property/tsconfig.json b/node_modules/es-define-property/tsconfig.json
new file mode 100644
index 0000000..fdfa155
--- /dev/null
+++ b/node_modules/es-define-property/tsconfig.json
@@ -0,0 +1,50 @@
+{
+ "compilerOptions": {
+ /* Visit https://aka.ms/tsconfig.json to read more about this file */
+
+ /* Projects */
+
+ /* Language and Environment */
+ "target": "es2022", /* Set the JavaScript language version for emitted JavaScript and include compatible library declarations. */
+ // "lib": [], /* Specify a set of bundled library declaration files that describe the target runtime environment. */
+ // "noLib": true, /* Disable including any library files, including the default lib.d.ts. */
+ "useDefineForClassFields": true, /* Emit ECMAScript-standard-compliant class fields. */
+ // "moduleDetection": "auto", /* Control what method is used to detect module-format JS files. */
+
+ /* Modules */
+ "module": "commonjs", /* Specify what module code is generated. */
+ // "rootDir": "./", /* Specify the root folder within your source files. */
+ // "moduleResolution": "node", /* Specify how TypeScript looks up a file from a given module specifier. */
+ // "baseUrl": "./", /* Specify the base directory to resolve non-relative module names. */
+ // "paths": {}, /* Specify a set of entries that re-map imports to additional lookup locations. */
+ // "rootDirs": [], /* Allow multiple folders to be treated as one when resolving modules. */
+ // "typeRoots": ["types"], /* Specify multiple folders that act like `./node_modules/@types`. */
+ "resolveJsonModule": true, /* Enable importing .json files. */
+ // "allowArbitraryExtensions": true, /* Enable importing files with any extension, provided a declaration file is present. */
+
+ /* JavaScript Support */
+ "allowJs": true, /* Allow JavaScript files to be a part of your program. Use the `checkJS` option to get errors from these files. */
+ "checkJs": true, /* Enable error reporting in type-checked JavaScript files. */
+ "maxNodeModuleJsDepth": 1, /* Specify the maximum folder depth used for checking JavaScript files from `node_modules`. Only applicable with `allowJs`. */
+
+ /* Emit */
+ "declaration": true, /* Generate .d.ts files from TypeScript and JavaScript files in your project. */
+ "declarationMap": true, /* Create sourcemaps for d.ts files. */
+ "noEmit": true, /* Disable emitting files from a compilation. */
+
+ /* Interop Constraints */
+ "allowSyntheticDefaultImports": true, /* Allow `import x from y` when a module doesn't have a default export. */
+ "esModuleInterop": true, /* Emit additional JavaScript to ease support for importing CommonJS modules. This enables `allowSyntheticDefaultImports` for type compatibility. */
+ "forceConsistentCasingInFileNames": true, /* Ensure that casing is correct in imports. */
+
+ /* Type Checking */
+ "strict": true, /* Enable all strict type-checking options. */
+
+ /* Completeness */
+ // "skipLibCheck": true /* Skip type checking all .d.ts files. */
+ },
+ "exclude": [
+ "coverage",
+ "test/list-exports"
+ ],
+}
diff --git a/node_modules/es-errors/.eslintrc b/node_modules/es-errors/.eslintrc
new file mode 100644
index 0000000..3b5d9e9
--- /dev/null
+++ b/node_modules/es-errors/.eslintrc
@@ -0,0 +1,5 @@
+{
+ "root": true,
+
+ "extends": "@ljharb",
+}
diff --git a/node_modules/es-errors/.github/FUNDING.yml b/node_modules/es-errors/.github/FUNDING.yml
new file mode 100644
index 0000000..f1b8805
--- /dev/null
+++ b/node_modules/es-errors/.github/FUNDING.yml
@@ -0,0 +1,12 @@
+# These are supported funding model platforms
+
+github: [ljharb]
+patreon: # Replace with a single Patreon username
+open_collective: # Replace with a single Open Collective username
+ko_fi: # Replace with a single Ko-fi username
+tidelift: npm/es-errors
+community_bridge: # Replace with a single Community Bridge project-name e.g., cloud-foundry
+liberapay: # Replace with a single Liberapay username
+issuehunt: # Replace with a single IssueHunt username
+otechie: # Replace with a single Otechie username
+custom: # Replace with a single custom sponsorship URL
diff --git a/node_modules/es-errors/CHANGELOG.md b/node_modules/es-errors/CHANGELOG.md
new file mode 100644
index 0000000..204a9e9
--- /dev/null
+++ b/node_modules/es-errors/CHANGELOG.md
@@ -0,0 +1,40 @@
+# Changelog
+
+All notable changes to this project will be documented in this file.
+
+The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.0.0/)
+and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0.html).
+
+## [v1.3.0](https://github.com/ljharb/es-errors/compare/v1.2.1...v1.3.0) - 2024-02-05
+
+### Commits
+
+- [New] add `EvalError` and `URIError` [`1927627`](https://github.com/ljharb/es-errors/commit/1927627ba68cb6c829d307231376c967db53acdf)
+
+## [v1.2.1](https://github.com/ljharb/es-errors/compare/v1.2.0...v1.2.1) - 2024-02-04
+
+### Commits
+
+- [Fix] add missing `exports` entry [`5bb5f28`](https://github.com/ljharb/es-errors/commit/5bb5f280f98922701109d6ebb82eea2257cecc7e)
+
+## [v1.2.0](https://github.com/ljharb/es-errors/compare/v1.1.0...v1.2.0) - 2024-02-04
+
+### Commits
+
+- [New] add `ReferenceError` [`6d8cf5b`](https://github.com/ljharb/es-errors/commit/6d8cf5bbb6f3f598d02cf6f30e468ba2caa8e143)
+
+## [v1.1.0](https://github.com/ljharb/es-errors/compare/v1.0.0...v1.1.0) - 2024-02-04
+
+### Commits
+
+- [New] add base Error [`2983ab6`](https://github.com/ljharb/es-errors/commit/2983ab65f7bc5441276cb021dc3aa03c78881698)
+
+## v1.0.0 - 2024-02-03
+
+### Commits
+
+- Initial implementation, tests, readme, type [`8f47631`](https://github.com/ljharb/es-errors/commit/8f476317e9ad76f40ad648081829b1a1a3a1288b)
+- Initial commit [`ea5d099`](https://github.com/ljharb/es-errors/commit/ea5d099ef18e550509ab9e2be000526afd81c385)
+- npm init [`6f5ebf9`](https://github.com/ljharb/es-errors/commit/6f5ebf9cead474dadd72b9e63dad315820a089ae)
+- Only apps should have lockfiles [`e1a0aeb`](https://github.com/ljharb/es-errors/commit/e1a0aeb7b80f5cfc56be54d6b2100e915d47def8)
+- [meta] add `sideEffects` flag [`a9c7d46`](https://github.com/ljharb/es-errors/commit/a9c7d460a492f1d8a241c836bc25a322a19cc043)
diff --git a/node_modules/es-errors/LICENSE b/node_modules/es-errors/LICENSE
new file mode 100644
index 0000000..f82f389
--- /dev/null
+++ b/node_modules/es-errors/LICENSE
@@ -0,0 +1,21 @@
+MIT License
+
+Copyright (c) 2024 Jordan Harband
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
+SOFTWARE.
diff --git a/node_modules/es-errors/README.md b/node_modules/es-errors/README.md
new file mode 100644
index 0000000..8dbfacf
--- /dev/null
+++ b/node_modules/es-errors/README.md
@@ -0,0 +1,55 @@
+# es-errors [![Version Badge][npm-version-svg]][package-url]
+
+[![github actions][actions-image]][actions-url]
+[![coverage][codecov-image]][codecov-url]
+[![License][license-image]][license-url]
+[![Downloads][downloads-image]][downloads-url]
+
+[![npm badge][npm-badge-png]][package-url]
+
+A simple cache for a few of the JS Error constructors.
+
+## Example
+
+```js
+const assert = require('assert');
+
+const Base = require('es-errors');
+const Eval = require('es-errors/eval');
+const Range = require('es-errors/range');
+const Ref = require('es-errors/ref');
+const Syntax = require('es-errors/syntax');
+const Type = require('es-errors/type');
+const URI = require('es-errors/uri');
+
+assert.equal(Base, Error);
+assert.equal(Eval, EvalError);
+assert.equal(Range, RangeError);
+assert.equal(Ref, ReferenceError);
+assert.equal(Syntax, SyntaxError);
+assert.equal(Type, TypeError);
+assert.equal(URI, URIError);
+```
+
+## Tests
+Simply clone the repo, `npm install`, and run `npm test`
+
+## Security
+
+Please email [@ljharb](https://github.com/ljharb) or see https://tidelift.com/security if you have a potential security vulnerability to report.
+
+[package-url]: https://npmjs.org/package/es-errors
+[npm-version-svg]: https://versionbadg.es/ljharb/es-errors.svg
+[deps-svg]: https://david-dm.org/ljharb/es-errors.svg
+[deps-url]: https://david-dm.org/ljharb/es-errors
+[dev-deps-svg]: https://david-dm.org/ljharb/es-errors/dev-status.svg
+[dev-deps-url]: https://david-dm.org/ljharb/es-errors#info=devDependencies
+[npm-badge-png]: https://nodei.co/npm/es-errors.png?downloads=true&stars=true
+[license-image]: https://img.shields.io/npm/l/es-errors.svg
+[license-url]: LICENSE
+[downloads-image]: https://img.shields.io/npm/dm/es-errors.svg
+[downloads-url]: https://npm-stat.com/charts.html?package=es-errors
+[codecov-image]: https://codecov.io/gh/ljharb/es-errors/branch/main/graphs/badge.svg
+[codecov-url]: https://app.codecov.io/gh/ljharb/es-errors/
+[actions-image]: https://img.shields.io/endpoint?url=https://github-actions-badge-u3jn4tfpocch.runkit.sh/ljharb/es-errors
+[actions-url]: https://github.com/ljharb/es-errors/actions
diff --git a/node_modules/es-errors/eval.d.ts b/node_modules/es-errors/eval.d.ts
new file mode 100644
index 0000000..e4210e0
--- /dev/null
+++ b/node_modules/es-errors/eval.d.ts
@@ -0,0 +1,3 @@
+declare const EvalError: EvalErrorConstructor;
+
+export = EvalError;
diff --git a/node_modules/es-errors/eval.js b/node_modules/es-errors/eval.js
new file mode 100644
index 0000000..725ccb6
--- /dev/null
+++ b/node_modules/es-errors/eval.js
@@ -0,0 +1,4 @@
+'use strict';
+
+/** @type {import('./eval')} */
+module.exports = EvalError;
diff --git a/node_modules/es-errors/index.d.ts b/node_modules/es-errors/index.d.ts
new file mode 100644
index 0000000..69bdbc9
--- /dev/null
+++ b/node_modules/es-errors/index.d.ts
@@ -0,0 +1,3 @@
+declare const Error: ErrorConstructor;
+
+export = Error;
diff --git a/node_modules/es-errors/index.js b/node_modules/es-errors/index.js
new file mode 100644
index 0000000..cc0c521
--- /dev/null
+++ b/node_modules/es-errors/index.js
@@ -0,0 +1,4 @@
+'use strict';
+
+/** @type {import('.')} */
+module.exports = Error;
diff --git a/node_modules/es-errors/package.json b/node_modules/es-errors/package.json
new file mode 100644
index 0000000..ff8c2a5
--- /dev/null
+++ b/node_modules/es-errors/package.json
@@ -0,0 +1,80 @@
+{
+ "name": "es-errors",
+ "version": "1.3.0",
+ "description": "A simple cache for a few of the JS Error constructors.",
+ "main": "index.js",
+ "exports": {
+ ".": "./index.js",
+ "./eval": "./eval.js",
+ "./range": "./range.js",
+ "./ref": "./ref.js",
+ "./syntax": "./syntax.js",
+ "./type": "./type.js",
+ "./uri": "./uri.js",
+ "./package.json": "./package.json"
+ },
+ "sideEffects": false,
+ "scripts": {
+ "prepack": "npmignore --auto --commentLines=autogenerated",
+ "prepublishOnly": "safe-publish-latest",
+ "prepublish": "not-in-publish || npm run prepublishOnly",
+ "pretest": "npm run lint",
+ "test": "npm run tests-only",
+ "tests-only": "nyc tape 'test/**/*.js'",
+ "posttest": "aud --production",
+ "prelint": "evalmd README.md",
+ "lint": "eslint --ext=js,mjs .",
+ "postlint": "tsc -p . && eclint check $(git ls-files | xargs find 2> /dev/null | grep -vE 'node_modules|\\.git' | grep -v dist/)",
+ "version": "auto-changelog && git add CHANGELOG.md",
+ "postversion": "auto-changelog && git add CHANGELOG.md && git commit --no-edit --amend && git tag -f \"v$(node -e \"console.log(require('./package.json').version)\")\""
+ },
+ "repository": {
+ "type": "git",
+ "url": "git+https://github.com/ljharb/es-errors.git"
+ },
+ "keywords": [
+ "javascript",
+ "ecmascript",
+ "error",
+ "typeerror",
+ "syntaxerror",
+ "rangeerror"
+ ],
+ "author": "Jordan Harband ",
+ "license": "MIT",
+ "bugs": {
+ "url": "https://github.com/ljharb/es-errors/issues"
+ },
+ "homepage": "https://github.com/ljharb/es-errors#readme",
+ "devDependencies": {
+ "@ljharb/eslint-config": "^21.1.0",
+ "@types/tape": "^5.6.4",
+ "aud": "^2.0.4",
+ "auto-changelog": "^2.4.0",
+ "eclint": "^2.8.1",
+ "eslint": "^8.8.0",
+ "evalmd": "^0.0.19",
+ "in-publish": "^2.0.1",
+ "npmignore": "^0.3.1",
+ "nyc": "^10.3.2",
+ "safe-publish-latest": "^2.0.0",
+ "tape": "^5.7.4",
+ "typescript": "next"
+ },
+ "auto-changelog": {
+ "output": "CHANGELOG.md",
+ "template": "keepachangelog",
+ "unreleased": false,
+ "commitLimit": false,
+ "backfillLimit": false,
+ "hideCredit": true
+ },
+ "publishConfig": {
+ "ignore": [
+ ".github/workflows"
+ ]
+ },
+ "engines": {
+ "node": ">= 0.4"
+ }
+}
diff --git a/node_modules/es-errors/range.d.ts b/node_modules/es-errors/range.d.ts
new file mode 100644
index 0000000..3a12e86
--- /dev/null
+++ b/node_modules/es-errors/range.d.ts
@@ -0,0 +1,3 @@
+declare const RangeError: RangeErrorConstructor;
+
+export = RangeError;
diff --git a/node_modules/es-errors/range.js b/node_modules/es-errors/range.js
new file mode 100644
index 0000000..2044fe0
--- /dev/null
+++ b/node_modules/es-errors/range.js
@@ -0,0 +1,4 @@
+'use strict';
+
+/** @type {import('./range')} */
+module.exports = RangeError;
diff --git a/node_modules/es-errors/ref.d.ts b/node_modules/es-errors/ref.d.ts
new file mode 100644
index 0000000..a13107e
--- /dev/null
+++ b/node_modules/es-errors/ref.d.ts
@@ -0,0 +1,3 @@
+declare const ReferenceError: ReferenceErrorConstructor;
+
+export = ReferenceError;
diff --git a/node_modules/es-errors/ref.js b/node_modules/es-errors/ref.js
new file mode 100644
index 0000000..d7c430f
--- /dev/null
+++ b/node_modules/es-errors/ref.js
@@ -0,0 +1,4 @@
+'use strict';
+
+/** @type {import('./ref')} */
+module.exports = ReferenceError;
diff --git a/node_modules/es-errors/syntax.d.ts b/node_modules/es-errors/syntax.d.ts
new file mode 100644
index 0000000..6a0c53c
--- /dev/null
+++ b/node_modules/es-errors/syntax.d.ts
@@ -0,0 +1,3 @@
+declare const SyntaxError: SyntaxErrorConstructor;
+
+export = SyntaxError;
diff --git a/node_modules/es-errors/syntax.js b/node_modules/es-errors/syntax.js
new file mode 100644
index 0000000..5f5fdde
--- /dev/null
+++ b/node_modules/es-errors/syntax.js
@@ -0,0 +1,4 @@
+'use strict';
+
+/** @type {import('./syntax')} */
+module.exports = SyntaxError;
diff --git a/node_modules/es-errors/test/index.js b/node_modules/es-errors/test/index.js
new file mode 100644
index 0000000..1ff0277
--- /dev/null
+++ b/node_modules/es-errors/test/index.js
@@ -0,0 +1,19 @@
+'use strict';
+
+var test = require('tape');
+
+var E = require('../');
+var R = require('../range');
+var Ref = require('../ref');
+var S = require('../syntax');
+var T = require('../type');
+
+test('errors', function (t) {
+ t.equal(E, Error);
+ t.equal(R, RangeError);
+ t.equal(Ref, ReferenceError);
+ t.equal(S, SyntaxError);
+ t.equal(T, TypeError);
+
+ t.end();
+});
diff --git a/node_modules/es-errors/tsconfig.json b/node_modules/es-errors/tsconfig.json
new file mode 100644
index 0000000..99dfeb6
--- /dev/null
+++ b/node_modules/es-errors/tsconfig.json
@@ -0,0 +1,49 @@
+{
+ "compilerOptions": {
+ /* Visit https://aka.ms/tsconfig.json to read more about this file */
+
+ /* Projects */
+
+ /* Language and Environment */
+ "target": "es5", /* Set the JavaScript language version for emitted JavaScript and include compatible library declarations. */
+ // "lib": [], /* Specify a set of bundled library declaration files that describe the target runtime environment. */
+ // "noLib": true, /* Disable including any library files, including the default lib.d.ts. */
+ "useDefineForClassFields": true, /* Emit ECMAScript-standard-compliant class fields. */
+ // "moduleDetection": "auto", /* Control what method is used to detect module-format JS files. */
+
+ /* Modules */
+ "module": "commonjs", /* Specify what module code is generated. */
+ // "rootDir": "./", /* Specify the root folder within your source files. */
+ // "moduleResolution": "node", /* Specify how TypeScript looks up a file from a given module specifier. */
+ // "baseUrl": "./", /* Specify the base directory to resolve non-relative module names. */
+ // "paths": {}, /* Specify a set of entries that re-map imports to additional lookup locations. */
+ // "rootDirs": [], /* Allow multiple folders to be treated as one when resolving modules. */
+ // "typeRoots": ["types"], /* Specify multiple folders that act like `./node_modules/@types`. */
+ "resolveJsonModule": true, /* Enable importing .json files. */
+ // "allowArbitraryExtensions": true, /* Enable importing files with any extension, provided a declaration file is present. */
+
+ /* JavaScript Support */
+ "allowJs": true, /* Allow JavaScript files to be a part of your program. Use the `checkJS` option to get errors from these files. */
+ "checkJs": true, /* Enable error reporting in type-checked JavaScript files. */
+ "maxNodeModuleJsDepth": 1, /* Specify the maximum folder depth used for checking JavaScript files from `node_modules`. Only applicable with `allowJs`. */
+
+ /* Emit */
+ "declaration": true, /* Generate .d.ts files from TypeScript and JavaScript files in your project. */
+ "declarationMap": true, /* Create sourcemaps for d.ts files. */
+ "noEmit": true, /* Disable emitting files from a compilation. */
+
+ /* Interop Constraints */
+ "allowSyntheticDefaultImports": true, /* Allow `import x from y` when a module doesn't have a default export. */
+ "esModuleInterop": true, /* Emit additional JavaScript to ease support for importing CommonJS modules. This enables `allowSyntheticDefaultImports` for type compatibility. */
+ "forceConsistentCasingInFileNames": true, /* Ensure that casing is correct in imports. */
+
+ /* Type Checking */
+ "strict": true, /* Enable all strict type-checking options. */
+
+ /* Completeness */
+ // "skipLibCheck": true /* Skip type checking all .d.ts files. */
+ },
+ "exclude": [
+ "coverage",
+ ],
+}
diff --git a/node_modules/es-errors/type.d.ts b/node_modules/es-errors/type.d.ts
new file mode 100644
index 0000000..576fb51
--- /dev/null
+++ b/node_modules/es-errors/type.d.ts
@@ -0,0 +1,3 @@
+declare const TypeError: TypeErrorConstructor
+
+export = TypeError;
diff --git a/node_modules/es-errors/type.js b/node_modules/es-errors/type.js
new file mode 100644
index 0000000..9769e44
--- /dev/null
+++ b/node_modules/es-errors/type.js
@@ -0,0 +1,4 @@
+'use strict';
+
+/** @type {import('./type')} */
+module.exports = TypeError;
diff --git a/node_modules/es-errors/uri.d.ts b/node_modules/es-errors/uri.d.ts
new file mode 100644
index 0000000..c3261c9
--- /dev/null
+++ b/node_modules/es-errors/uri.d.ts
@@ -0,0 +1,3 @@
+declare const URIError: URIErrorConstructor;
+
+export = URIError;
diff --git a/node_modules/es-errors/uri.js b/node_modules/es-errors/uri.js
new file mode 100644
index 0000000..e9cd1c7
--- /dev/null
+++ b/node_modules/es-errors/uri.js
@@ -0,0 +1,4 @@
+'use strict';
+
+/** @type {import('./uri')} */
+module.exports = URIError;
diff --git a/node_modules/escape-html/LICENSE b/node_modules/escape-html/LICENSE
new file mode 100644
index 0000000..2e70de9
--- /dev/null
+++ b/node_modules/escape-html/LICENSE
@@ -0,0 +1,24 @@
+(The MIT License)
+
+Copyright (c) 2012-2013 TJ Holowaychuk
+Copyright (c) 2015 Andreas Lubbe
+Copyright (c) 2015 Tiancheng "Timothy" Gu
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/node_modules/escape-html/Readme.md b/node_modules/escape-html/Readme.md
new file mode 100644
index 0000000..653d9ea
--- /dev/null
+++ b/node_modules/escape-html/Readme.md
@@ -0,0 +1,43 @@
+
+# escape-html
+
+ Escape string for use in HTML
+
+## Example
+
+```js
+var escape = require('escape-html');
+var html = escape('foo & bar');
+// -> foo & bar
+```
+
+## Benchmark
+
+```
+$ npm run-script bench
+
+> escape-html@1.0.3 bench nodejs-escape-html
+> node benchmark/index.js
+
+
+ http_parser@1.0
+ node@0.10.33
+ v8@3.14.5.9
+ ares@1.9.0-DEV
+ uv@0.10.29
+ zlib@1.2.3
+ modules@11
+ openssl@1.0.1j
+
+ 1 test completed.
+ 2 tests completed.
+ 3 tests completed.
+
+ no special characters x 19,435,271 ops/sec ±0.85% (187 runs sampled)
+ single special character x 6,132,421 ops/sec ±0.67% (194 runs sampled)
+ many special characters x 3,175,826 ops/sec ±0.65% (193 runs sampled)
+```
+
+## License
+
+ MIT
\ No newline at end of file
diff --git a/node_modules/escape-html/index.js b/node_modules/escape-html/index.js
new file mode 100644
index 0000000..bf9e226
--- /dev/null
+++ b/node_modules/escape-html/index.js
@@ -0,0 +1,78 @@
+/*!
+ * escape-html
+ * Copyright(c) 2012-2013 TJ Holowaychuk
+ * Copyright(c) 2015 Andreas Lubbe
+ * Copyright(c) 2015 Tiancheng "Timothy" Gu
+ * MIT Licensed
+ */
+
+'use strict';
+
+/**
+ * Module variables.
+ * @private
+ */
+
+var matchHtmlRegExp = /["'&<>]/;
+
+/**
+ * Module exports.
+ * @public
+ */
+
+module.exports = escapeHtml;
+
+/**
+ * Escape special characters in the given string of html.
+ *
+ * @param {string} string The string to escape for inserting into HTML
+ * @return {string}
+ * @public
+ */
+
+function escapeHtml(string) {
+ var str = '' + string;
+ var match = matchHtmlRegExp.exec(str);
+
+ if (!match) {
+ return str;
+ }
+
+ var escape;
+ var html = '';
+ var index = 0;
+ var lastIndex = 0;
+
+ for (index = match.index; index < str.length; index++) {
+ switch (str.charCodeAt(index)) {
+ case 34: // "
+ escape = '"';
+ break;
+ case 38: // &
+ escape = '&';
+ break;
+ case 39: // '
+ escape = ''';
+ break;
+ case 60: // <
+ escape = '<';
+ break;
+ case 62: // >
+ escape = '>';
+ break;
+ default:
+ continue;
+ }
+
+ if (lastIndex !== index) {
+ html += str.substring(lastIndex, index);
+ }
+
+ lastIndex = index + 1;
+ html += escape;
+ }
+
+ return lastIndex !== index
+ ? html + str.substring(lastIndex, index)
+ : html;
+}
diff --git a/node_modules/escape-html/package.json b/node_modules/escape-html/package.json
new file mode 100644
index 0000000..57ec7bd
--- /dev/null
+++ b/node_modules/escape-html/package.json
@@ -0,0 +1,24 @@
+{
+ "name": "escape-html",
+ "description": "Escape string for use in HTML",
+ "version": "1.0.3",
+ "license": "MIT",
+ "keywords": [
+ "escape",
+ "html",
+ "utility"
+ ],
+ "repository": "component/escape-html",
+ "devDependencies": {
+ "benchmark": "1.0.0",
+ "beautify-benchmark": "0.2.4"
+ },
+ "files": [
+ "LICENSE",
+ "Readme.md",
+ "index.js"
+ ],
+ "scripts": {
+ "bench": "node benchmark/index.js"
+ }
+}
diff --git a/node_modules/etag/HISTORY.md b/node_modules/etag/HISTORY.md
new file mode 100644
index 0000000..222b293
--- /dev/null
+++ b/node_modules/etag/HISTORY.md
@@ -0,0 +1,83 @@
+1.8.1 / 2017-09-12
+==================
+
+ * perf: replace regular expression with substring
+
+1.8.0 / 2017-02-18
+==================
+
+ * Use SHA1 instead of MD5 for ETag hashing
+ - Improves performance for larger entities
+ - Works with FIPS 140-2 OpenSSL configuration
+
+1.7.0 / 2015-06-08
+==================
+
+ * Always include entity length in ETags for hash length extensions
+ * Generate non-Stats ETags using MD5 only (no longer CRC32)
+ * Improve stat performance by removing hashing
+ * Remove base64 padding in ETags to shorten
+ * Use MD5 instead of MD4 in weak ETags over 1KB
+
+1.6.0 / 2015-05-10
+==================
+
+ * Improve support for JXcore
+ * Remove requirement of `atime` in the stats object
+ * Support "fake" stats objects in environments without `fs`
+
+1.5.1 / 2014-11-19
+==================
+
+ * deps: crc@3.2.1
+ - Minor fixes
+
+1.5.0 / 2014-10-14
+==================
+
+ * Improve string performance
+ * Slightly improve speed for weak ETags over 1KB
+
+1.4.0 / 2014-09-21
+==================
+
+ * Support "fake" stats objects
+ * Support Node.js 0.6
+
+1.3.1 / 2014-09-14
+==================
+
+ * Use the (new and improved) `crc` for crc32
+
+1.3.0 / 2014-08-29
+==================
+
+ * Default strings to strong ETags
+ * Improve speed for weak ETags over 1KB
+
+1.2.1 / 2014-08-29
+==================
+
+ * Use the (much faster) `buffer-crc32` for crc32
+
+1.2.0 / 2014-08-24
+==================
+
+ * Add support for file stat objects
+
+1.1.0 / 2014-08-24
+==================
+
+ * Add fast-path for empty entity
+ * Add weak ETag generation
+ * Shrink size of generated ETags
+
+1.0.1 / 2014-08-24
+==================
+
+ * Fix behavior of string containing Unicode
+
+1.0.0 / 2014-05-18
+==================
+
+ * Initial release
diff --git a/node_modules/etag/LICENSE b/node_modules/etag/LICENSE
new file mode 100644
index 0000000..cab251c
--- /dev/null
+++ b/node_modules/etag/LICENSE
@@ -0,0 +1,22 @@
+(The MIT License)
+
+Copyright (c) 2014-2016 Douglas Christopher Wilson
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/node_modules/etag/README.md b/node_modules/etag/README.md
new file mode 100644
index 0000000..09c2169
--- /dev/null
+++ b/node_modules/etag/README.md
@@ -0,0 +1,159 @@
+# etag
+
+[![NPM Version][npm-image]][npm-url]
+[![NPM Downloads][downloads-image]][downloads-url]
+[![Node.js Version][node-version-image]][node-version-url]
+[![Build Status][travis-image]][travis-url]
+[![Test Coverage][coveralls-image]][coveralls-url]
+
+Create simple HTTP ETags
+
+This module generates HTTP ETags (as defined in RFC 7232) for use in
+HTTP responses.
+
+## Installation
+
+This is a [Node.js](https://nodejs.org/en/) module available through the
+[npm registry](https://www.npmjs.com/). Installation is done using the
+[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally):
+
+```sh
+$ npm install etag
+```
+
+## API
+
+
+
+```js
+var etag = require('etag')
+```
+
+### etag(entity, [options])
+
+Generate a strong ETag for the given entity. This should be the complete
+body of the entity. Strings, `Buffer`s, and `fs.Stats` are accepted. By
+default, a strong ETag is generated except for `fs.Stats`, which will
+generate a weak ETag (this can be overwritten by `options.weak`).
+
+
+
+```js
+res.setHeader('ETag', etag(body))
+```
+
+#### Options
+
+`etag` accepts these properties in the options object.
+
+##### weak
+
+Specifies if the generated ETag will include the weak validator mark (that
+is, the leading `W/`). The actual entity tag is the same. The default value
+is `false`, unless the `entity` is `fs.Stats`, in which case it is `true`.
+
+## Testing
+
+```sh
+$ npm test
+```
+
+## Benchmark
+
+```bash
+$ npm run-script bench
+
+> etag@1.8.1 bench nodejs-etag
+> node benchmark/index.js
+
+ http_parser@2.7.0
+ node@6.11.1
+ v8@5.1.281.103
+ uv@1.11.0
+ zlib@1.2.11
+ ares@1.10.1-DEV
+ icu@58.2
+ modules@48
+ openssl@1.0.2k
+
+> node benchmark/body0-100b.js
+
+ 100B body
+
+ 4 tests completed.
+
+ buffer - strong x 258,647 ops/sec ±1.07% (180 runs sampled)
+ buffer - weak x 263,812 ops/sec ±0.61% (184 runs sampled)
+ string - strong x 259,955 ops/sec ±1.19% (185 runs sampled)
+ string - weak x 264,356 ops/sec ±1.09% (184 runs sampled)
+
+> node benchmark/body1-1kb.js
+
+ 1KB body
+
+ 4 tests completed.
+
+ buffer - strong x 189,018 ops/sec ±1.12% (182 runs sampled)
+ buffer - weak x 190,586 ops/sec ±0.81% (186 runs sampled)
+ string - strong x 144,272 ops/sec ±0.96% (188 runs sampled)
+ string - weak x 145,380 ops/sec ±1.43% (187 runs sampled)
+
+> node benchmark/body2-5kb.js
+
+ 5KB body
+
+ 4 tests completed.
+
+ buffer - strong x 92,435 ops/sec ±0.42% (188 runs sampled)
+ buffer - weak x 92,373 ops/sec ±0.58% (189 runs sampled)
+ string - strong x 48,850 ops/sec ±0.56% (186 runs sampled)
+ string - weak x 49,380 ops/sec ±0.56% (190 runs sampled)
+
+> node benchmark/body3-10kb.js
+
+ 10KB body
+
+ 4 tests completed.
+
+ buffer - strong x 55,989 ops/sec ±0.93% (188 runs sampled)
+ buffer - weak x 56,148 ops/sec ±0.55% (190 runs sampled)
+ string - strong x 27,345 ops/sec ±0.43% (188 runs sampled)
+ string - weak x 27,496 ops/sec ±0.45% (190 runs sampled)
+
+> node benchmark/body4-100kb.js
+
+ 100KB body
+
+ 4 tests completed.
+
+ buffer - strong x 7,083 ops/sec ±0.22% (190 runs sampled)
+ buffer - weak x 7,115 ops/sec ±0.26% (191 runs sampled)
+ string - strong x 3,068 ops/sec ±0.34% (190 runs sampled)
+ string - weak x 3,096 ops/sec ±0.35% (190 runs sampled)
+
+> node benchmark/stats.js
+
+ stat
+
+ 4 tests completed.
+
+ real - strong x 871,642 ops/sec ±0.34% (189 runs sampled)
+ real - weak x 867,613 ops/sec ±0.39% (190 runs sampled)
+ fake - strong x 401,051 ops/sec ±0.40% (189 runs sampled)
+ fake - weak x 400,100 ops/sec ±0.47% (188 runs sampled)
+```
+
+## License
+
+[MIT](LICENSE)
+
+[npm-image]: https://img.shields.io/npm/v/etag.svg
+[npm-url]: https://npmjs.org/package/etag
+[node-version-image]: https://img.shields.io/node/v/etag.svg
+[node-version-url]: https://nodejs.org/en/download/
+[travis-image]: https://img.shields.io/travis/jshttp/etag/master.svg
+[travis-url]: https://travis-ci.org/jshttp/etag
+[coveralls-image]: https://img.shields.io/coveralls/jshttp/etag/master.svg
+[coveralls-url]: https://coveralls.io/r/jshttp/etag?branch=master
+[downloads-image]: https://img.shields.io/npm/dm/etag.svg
+[downloads-url]: https://npmjs.org/package/etag
diff --git a/node_modules/etag/index.js b/node_modules/etag/index.js
new file mode 100644
index 0000000..2a585c9
--- /dev/null
+++ b/node_modules/etag/index.js
@@ -0,0 +1,131 @@
+/*!
+ * etag
+ * Copyright(c) 2014-2016 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+'use strict'
+
+/**
+ * Module exports.
+ * @public
+ */
+
+module.exports = etag
+
+/**
+ * Module dependencies.
+ * @private
+ */
+
+var crypto = require('crypto')
+var Stats = require('fs').Stats
+
+/**
+ * Module variables.
+ * @private
+ */
+
+var toString = Object.prototype.toString
+
+/**
+ * Generate an entity tag.
+ *
+ * @param {Buffer|string} entity
+ * @return {string}
+ * @private
+ */
+
+function entitytag (entity) {
+ if (entity.length === 0) {
+ // fast-path empty
+ return '"0-2jmj7l5rSw0yVb/vlWAYkK/YBwk"'
+ }
+
+ // compute hash of entity
+ var hash = crypto
+ .createHash('sha1')
+ .update(entity, 'utf8')
+ .digest('base64')
+ .substring(0, 27)
+
+ // compute length of entity
+ var len = typeof entity === 'string'
+ ? Buffer.byteLength(entity, 'utf8')
+ : entity.length
+
+ return '"' + len.toString(16) + '-' + hash + '"'
+}
+
+/**
+ * Create a simple ETag.
+ *
+ * @param {string|Buffer|Stats} entity
+ * @param {object} [options]
+ * @param {boolean} [options.weak]
+ * @return {String}
+ * @public
+ */
+
+function etag (entity, options) {
+ if (entity == null) {
+ throw new TypeError('argument entity is required')
+ }
+
+ // support fs.Stats object
+ var isStats = isstats(entity)
+ var weak = options && typeof options.weak === 'boolean'
+ ? options.weak
+ : isStats
+
+ // validate argument
+ if (!isStats && typeof entity !== 'string' && !Buffer.isBuffer(entity)) {
+ throw new TypeError('argument entity must be string, Buffer, or fs.Stats')
+ }
+
+ // generate entity tag
+ var tag = isStats
+ ? stattag(entity)
+ : entitytag(entity)
+
+ return weak
+ ? 'W/' + tag
+ : tag
+}
+
+/**
+ * Determine if object is a Stats object.
+ *
+ * @param {object} obj
+ * @return {boolean}
+ * @api private
+ */
+
+function isstats (obj) {
+ // genuine fs.Stats
+ if (typeof Stats === 'function' && obj instanceof Stats) {
+ return true
+ }
+
+ // quack quack
+ return obj && typeof obj === 'object' &&
+ 'ctime' in obj && toString.call(obj.ctime) === '[object Date]' &&
+ 'mtime' in obj && toString.call(obj.mtime) === '[object Date]' &&
+ 'ino' in obj && typeof obj.ino === 'number' &&
+ 'size' in obj && typeof obj.size === 'number'
+}
+
+/**
+ * Generate a tag for a stat.
+ *
+ * @param {object} stat
+ * @return {string}
+ * @private
+ */
+
+function stattag (stat) {
+ var mtime = stat.mtime.getTime().toString(16)
+ var size = stat.size.toString(16)
+
+ return '"' + size + '-' + mtime + '"'
+}
diff --git a/node_modules/etag/package.json b/node_modules/etag/package.json
new file mode 100644
index 0000000..b06ab80
--- /dev/null
+++ b/node_modules/etag/package.json
@@ -0,0 +1,47 @@
+{
+ "name": "etag",
+ "description": "Create simple HTTP ETags",
+ "version": "1.8.1",
+ "contributors": [
+ "Douglas Christopher Wilson ",
+ "David Björklund "
+ ],
+ "license": "MIT",
+ "keywords": [
+ "etag",
+ "http",
+ "res"
+ ],
+ "repository": "jshttp/etag",
+ "devDependencies": {
+ "beautify-benchmark": "0.2.4",
+ "benchmark": "2.1.4",
+ "eslint": "3.19.0",
+ "eslint-config-standard": "10.2.1",
+ "eslint-plugin-import": "2.7.0",
+ "eslint-plugin-markdown": "1.0.0-beta.6",
+ "eslint-plugin-node": "5.1.1",
+ "eslint-plugin-promise": "3.5.0",
+ "eslint-plugin-standard": "3.0.1",
+ "istanbul": "0.4.5",
+ "mocha": "1.21.5",
+ "safe-buffer": "5.1.1",
+ "seedrandom": "2.4.3"
+ },
+ "files": [
+ "LICENSE",
+ "HISTORY.md",
+ "README.md",
+ "index.js"
+ ],
+ "engines": {
+ "node": ">= 0.6"
+ },
+ "scripts": {
+ "bench": "node benchmark/index.js",
+ "lint": "eslint --plugin markdown --ext js,md .",
+ "test": "mocha --reporter spec --bail --check-leaks test/",
+ "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/",
+ "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/"
+ }
+}
diff --git a/node_modules/express-session/HISTORY.md b/node_modules/express-session/HISTORY.md
new file mode 100644
index 0000000..57c68d3
--- /dev/null
+++ b/node_modules/express-session/HISTORY.md
@@ -0,0 +1,470 @@
+1.18.1 / 2024-10-08
+==========
+
+ * deps: cookie@0.7.2
+ - Fix object assignment of `hasOwnProperty`
+ * deps: cookie@0.7.1
+ - Allow leading dot for domain
+ - Although not permitted in the spec, some users expect this to work and user agents ignore the leading dot according to spec
+ - Add fast path for `serialize` without options, use `obj.hasOwnProperty` when parsing
+ * deps: cookie@0.7.0
+ - perf: parse cookies ~10% faster
+ - fix: narrow the validation of cookies to match RFC6265
+ - fix: add `main` to `package.json` for rspack
+
+1.18.0 / 2024-01-28
+===================
+
+ * Add debug log for pathname mismatch
+ * Add `partitioned` to `cookie` options
+ * Add `priority` to `cookie` options
+ * Fix handling errors from setting cookie
+ * Support any type in `secret` that `crypto.createHmac` supports
+ * deps: cookie@0.6.0
+ - Fix `expires` option to reject invalid dates
+ - perf: improve default decode speed
+ - perf: remove slow string split in parse
+ * deps: cookie-signature@1.0.7
+
+1.17.3 / 2022-05-11
+===================
+
+ * Fix resaving already-saved new session at end of request
+ * deps: cookie@0.4.2
+
+1.17.2 / 2021-05-19
+===================
+
+ * Fix `res.end` patch to always commit headers
+ * deps: cookie@0.4.1
+ * deps: safe-buffer@5.2.1
+
+1.17.1 / 2020-04-16
+===================
+
+ * Fix internal method wrapping error on failed reloads
+
+1.17.0 / 2019-10-10
+===================
+
+ * deps: cookie@0.4.0
+ - Add `SameSite=None` support
+ * deps: safe-buffer@5.2.0
+
+1.16.2 / 2019-06-12
+===================
+
+ * Fix restoring `cookie.originalMaxAge` when store returns `Date`
+ * deps: parseurl@~1.3.3
+
+1.16.1 / 2019-04-11
+===================
+
+ * Fix error passing `data` option to `Cookie` constructor
+ * Fix uncaught error from bad session data
+
+1.16.0 / 2019-04-10
+===================
+
+ * Catch invalid `cookie.maxAge` value earlier
+ * Deprecate setting `cookie.maxAge` to a `Date` object
+ * Fix issue where `resave: false` may not save altered sessions
+ * Remove `utils-merge` dependency
+ * Use `safe-buffer` for improved Buffer API
+ * Use `Set-Cookie` as cookie header name for compatibility
+ * deps: depd@~2.0.0
+ - Replace internal `eval` usage with `Function` constructor
+ - Use instance methods on `process` to check for listeners
+ - perf: remove argument reassignment
+ * deps: on-headers@~1.0.2
+ - Fix `res.writeHead` patch missing return value
+
+1.15.6 / 2017-09-26
+===================
+
+ * deps: debug@2.6.9
+ * deps: parseurl@~1.3.2
+ - perf: reduce overhead for full URLs
+ - perf: unroll the "fast-path" `RegExp`
+ * deps: uid-safe@~2.1.5
+ - perf: remove only trailing `=`
+ * deps: utils-merge@1.0.1
+
+1.15.5 / 2017-08-02
+===================
+
+ * Fix `TypeError` when `req.url` is an empty string
+ * deps: depd@~1.1.1
+ - Remove unnecessary `Buffer` loading
+
+1.15.4 / 2017-07-18
+===================
+
+ * deps: debug@2.6.8
+
+1.15.3 / 2017-05-17
+===================
+
+ * deps: debug@2.6.7
+ - deps: ms@2.0.0
+
+1.15.2 / 2017-03-26
+===================
+
+ * deps: debug@2.6.3
+ - Fix `DEBUG_MAX_ARRAY_LENGTH`
+ * deps: uid-safe@~2.1.4
+ - Remove `base64-url` dependency
+
+1.15.1 / 2017-02-10
+===================
+
+ * deps: debug@2.6.1
+ - Fix deprecation messages in WebStorm and other editors
+ - Undeprecate `DEBUG_FD` set to `1` or `2`
+
+1.15.0 / 2017-01-22
+===================
+
+ * Fix detecting modified session when session contains "cookie" property
+ * Fix resaving already-saved reloaded session at end of request
+ * deps: crc@3.4.4
+ - perf: use `Buffer.from` when available
+ * deps: debug@2.6.0
+ - Allow colors in workers
+ - Deprecated `DEBUG_FD` environment variable
+ - Use same color for same namespace
+ - Fix error when running under React Native
+ - deps: ms@0.7.2
+ * perf: remove unreachable branch in set-cookie method
+
+1.14.2 / 2016-10-30
+===================
+
+ * deps: crc@3.4.1
+ - Fix deprecation warning in Node.js 7.x
+ * deps: uid-safe@~2.1.3
+ - deps: base64-url@1.3.3
+
+1.14.1 / 2016-08-24
+===================
+
+ * Fix not always resetting session max age before session save
+ * Fix the cookie `sameSite` option to actually alter the `Set-Cookie`
+ * deps: uid-safe@~2.1.2
+ - deps: base64-url@1.3.2
+
+1.14.0 / 2016-07-01
+===================
+
+ * Correctly inherit from `EventEmitter` class in `Store` base class
+ * Fix issue where `Set-Cookie` `Expires` was not always updated
+ * Methods are no longer enumerable on `req.session` object
+ * deps: cookie@0.3.1
+ - Add `sameSite` option
+ - Improve error message when `encode` is not a function
+ - Improve error message when `expires` is not a `Date`
+ - perf: enable strict mode
+ - perf: use for loop in parse
+ - perf: use string concatination for serialization
+ * deps: parseurl@~1.3.1
+ - perf: enable strict mode
+ * deps: uid-safe@~2.1.1
+ - Use `random-bytes` for byte source
+ - deps: base64-url@1.2.2
+ * perf: enable strict mode
+ * perf: remove argument reassignment
+
+1.13.0 / 2016-01-10
+===================
+
+ * Fix `rolling: true` to not set cookie when no session exists
+ - Better `saveUninitialized: false` + `rolling: true` behavior
+ * deps: crc@3.4.0
+
+1.12.1 / 2015-10-29
+===================
+
+ * deps: cookie@0.2.3
+ - Fix cookie `Max-Age` to never be a floating point number
+
+1.12.0 / 2015-10-25
+===================
+
+ * Support the value `'auto'` in the `cookie.secure` option
+ * deps: cookie@0.2.2
+ - Throw on invalid values provided to `serialize`
+ * deps: depd@~1.1.0
+ - Enable strict mode in more places
+ - Support web browser loading
+ * deps: on-headers@~1.0.1
+ - perf: enable strict mode
+
+1.11.3 / 2015-05-22
+===================
+
+ * deps: cookie@0.1.3
+ - Slight optimizations
+ * deps: crc@3.3.0
+
+1.11.2 / 2015-05-10
+===================
+
+ * deps: debug@~2.2.0
+ - deps: ms@0.7.1
+ * deps: uid-safe@~2.0.0
+
+1.11.1 / 2015-04-08
+===================
+
+ * Fix mutating `options.secret` value
+
+1.11.0 / 2015-04-07
+===================
+
+ * Support an array in `secret` option for key rotation
+ * deps: depd@~1.0.1
+
+1.10.4 / 2015-03-15
+===================
+
+ * deps: debug@~2.1.3
+ - Fix high intensity foreground color for bold
+ - deps: ms@0.7.0
+
+1.10.3 / 2015-02-16
+===================
+
+ * deps: cookie-signature@1.0.6
+ * deps: uid-safe@1.1.0
+ - Use `crypto.randomBytes`, if available
+ - deps: base64-url@1.2.1
+
+1.10.2 / 2015-01-31
+===================
+
+ * deps: uid-safe@1.0.3
+ - Fix error branch that would throw
+ - deps: base64-url@1.2.0
+
+1.10.1 / 2015-01-08
+===================
+
+ * deps: uid-safe@1.0.2
+ - Remove dependency on `mz`
+
+1.10.0 / 2015-01-05
+===================
+
+ * Add `store.touch` interface for session stores
+ * Fix `MemoryStore` expiration with `resave: false`
+ * deps: debug@~2.1.1
+
+1.9.3 / 2014-12-02
+==================
+
+ * Fix error when `req.sessionID` contains a non-string value
+
+1.9.2 / 2014-11-22
+==================
+
+ * deps: crc@3.2.1
+ - Minor fixes
+
+1.9.1 / 2014-10-22
+==================
+
+ * Remove unnecessary empty write call
+ - Fixes Node.js 0.11.14 behavior change
+ - Helps work-around Node.js 0.10.1 zlib bug
+
+1.9.0 / 2014-09-16
+==================
+
+ * deps: debug@~2.1.0
+ - Implement `DEBUG_FD` env variable support
+ * deps: depd@~1.0.0
+
+1.8.2 / 2014-09-15
+==================
+
+ * Use `crc` instead of `buffer-crc32` for speed
+ * deps: depd@0.4.5
+
+1.8.1 / 2014-09-08
+==================
+
+ * Keep `req.session.save` non-enumerable
+ * Prevent session prototype methods from being overwritten
+
+1.8.0 / 2014-09-07
+==================
+
+ * Do not resave already-saved session at end of request
+ * deps: cookie-signature@1.0.5
+ * deps: debug@~2.0.0
+
+1.7.6 / 2014-08-18
+==================
+
+ * Fix exception on `res.end(null)` calls
+
+1.7.5 / 2014-08-10
+==================
+
+ * Fix parsing original URL
+ * deps: on-headers@~1.0.0
+ * deps: parseurl@~1.3.0
+
+1.7.4 / 2014-08-05
+==================
+
+ * Fix response end delay for non-chunked responses
+
+1.7.3 / 2014-08-05
+==================
+
+ * Fix `res.end` patch to call correct upstream `res.write`
+
+1.7.2 / 2014-07-27
+==================
+
+ * deps: depd@0.4.4
+ - Work-around v8 generating empty stack traces
+
+1.7.1 / 2014-07-26
+==================
+
+ * deps: depd@0.4.3
+ - Fix exception when global `Error.stackTraceLimit` is too low
+
+1.7.0 / 2014-07-22
+==================
+
+ * Improve session-ending error handling
+ - Errors are passed to `next(err)` instead of `console.error`
+ * deps: debug@1.0.4
+ * deps: depd@0.4.2
+ - Add `TRACE_DEPRECATION` environment variable
+ - Remove non-standard grey color from color output
+ - Support `--no-deprecation` argument
+ - Support `--trace-deprecation` argument
+
+1.6.5 / 2014-07-11
+==================
+
+ * Do not require `req.originalUrl`
+ * deps: debug@1.0.3
+ - Add support for multiple wildcards in namespaces
+
+1.6.4 / 2014-07-07
+==================
+
+ * Fix blank responses for stores with synchronous operations
+
+1.6.3 / 2014-07-04
+==================
+
+ * Fix resave deprecation message
+
+1.6.2 / 2014-07-04
+==================
+
+ * Fix confusing option deprecation messages
+
+1.6.1 / 2014-06-28
+==================
+
+ * Fix saveUninitialized deprecation message
+
+1.6.0 / 2014-06-28
+==================
+
+ * Add deprecation message to undefined `resave` option
+ * Add deprecation message to undefined `saveUninitialized` option
+ * Fix `res.end` patch to return correct value
+ * Fix `res.end` patch to handle multiple `res.end` calls
+ * Reject cookies with missing signatures
+
+1.5.2 / 2014-06-26
+==================
+
+ * deps: cookie-signature@1.0.4
+ - fix for timing attacks
+
+1.5.1 / 2014-06-21
+==================
+
+ * Move hard-to-track-down `req.secret` deprecation message
+
+1.5.0 / 2014-06-19
+==================
+
+ * Debug name is now "express-session"
+ * Deprecate integration with `cookie-parser` middleware
+ * Deprecate looking for secret in `req.secret`
+ * Directly read cookies; `cookie-parser` no longer required
+ * Directly set cookies; `res.cookie` no longer required
+ * Generate session IDs with `uid-safe`, faster and even less collisions
+
+1.4.0 / 2014-06-17
+==================
+
+ * Add `genid` option to generate custom session IDs
+ * Add `saveUninitialized` option to control saving uninitialized sessions
+ * Add `unset` option to control unsetting `req.session`
+ * Generate session IDs with `rand-token` by default; reduce collisions
+ * deps: buffer-crc32@0.2.3
+
+1.3.1 / 2014-06-14
+==================
+
+ * Add description in package for npmjs.org listing
+
+1.3.0 / 2014-06-14
+==================
+
+ * Integrate with express "trust proxy" by default
+ * deps: debug@1.0.2
+
+1.2.1 / 2014-05-27
+==================
+
+ * Fix `resave` such that `resave: true` works
+
+1.2.0 / 2014-05-19
+==================
+
+ * Add `resave` option to control saving unmodified sessions
+
+1.1.0 / 2014-05-12
+==================
+
+ * Add `name` option; replacement for `key` option
+ * Use `setImmediate` in MemoryStore for node.js >= 0.10
+
+1.0.4 / 2014-04-27
+==================
+
+ * deps: debug@0.8.1
+
+1.0.3 / 2014-04-19
+==================
+
+ * Use `res.cookie()` instead of `res.setHeader()`
+ * deps: cookie@0.1.2
+
+1.0.2 / 2014-02-23
+==================
+
+ * Add missing dependency to `package.json`
+
+1.0.1 / 2014-02-15
+==================
+
+ * Add missing dependencies to `package.json`
+
+1.0.0 / 2014-02-15
+==================
+
+ * Genesis from `connect`
diff --git a/node_modules/express-session/LICENSE b/node_modules/express-session/LICENSE
new file mode 100644
index 0000000..9b59ff8
--- /dev/null
+++ b/node_modules/express-session/LICENSE
@@ -0,0 +1,24 @@
+(The MIT License)
+
+Copyright (c) 2010 Sencha Inc.
+Copyright (c) 2011 TJ Holowaychuk
+Copyright (c) 2014-2015 Douglas Christopher Wilson
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/node_modules/express-session/README.md b/node_modules/express-session/README.md
new file mode 100644
index 0000000..65a37e6
--- /dev/null
+++ b/node_modules/express-session/README.md
@@ -0,0 +1,1032 @@
+# express-session
+
+[![NPM Version][npm-version-image]][npm-url]
+[![NPM Downloads][npm-downloads-image]][node-url]
+[![Build Status][ci-image]][ci-url]
+[![Test Coverage][coveralls-image]][coveralls-url]
+
+## Installation
+
+This is a [Node.js](https://nodejs.org/en/) module available through the
+[npm registry](https://www.npmjs.com/). Installation is done using the
+[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally):
+
+```sh
+$ npm install express-session
+```
+
+## API
+
+```js
+var session = require('express-session')
+```
+
+### session(options)
+
+Create a session middleware with the given `options`.
+
+**Note** Session data is _not_ saved in the cookie itself, just the session ID.
+Session data is stored server-side.
+
+**Note** Since version 1.5.0, the [`cookie-parser` middleware](https://www.npmjs.com/package/cookie-parser)
+no longer needs to be used for this module to work. This module now directly reads
+and writes cookies on `req`/`res`. Using `cookie-parser` may result in issues
+if the `secret` is not the same between this module and `cookie-parser`.
+
+**Warning** The default server-side session storage, `MemoryStore`, is _purposely_
+not designed for a production environment. It will leak memory under most
+conditions, does not scale past a single process, and is meant for debugging and
+developing.
+
+For a list of stores, see [compatible session stores](#compatible-session-stores).
+
+#### Options
+
+`express-session` accepts these properties in the options object.
+
+##### cookie
+
+Settings object for the session ID cookie. The default value is
+`{ path: '/', httpOnly: true, secure: false, maxAge: null }`.
+
+The following are options that can be set in this object.
+
+##### cookie.domain
+
+Specifies the value for the `Domain` `Set-Cookie` attribute. By default, no domain
+is set, and most clients will consider the cookie to apply to only the current
+domain.
+
+##### cookie.expires
+
+Specifies the `Date` object to be the value for the `Expires` `Set-Cookie` attribute.
+By default, no expiration is set, and most clients will consider this a
+"non-persistent cookie" and will delete it on a condition like exiting a web browser
+application.
+
+**Note** If both `expires` and `maxAge` are set in the options, then the last one
+defined in the object is what is used.
+
+**Note** The `expires` option should not be set directly; instead only use the `maxAge`
+option.
+
+##### cookie.httpOnly
+
+Specifies the `boolean` value for the `HttpOnly` `Set-Cookie` attribute. When truthy,
+the `HttpOnly` attribute is set, otherwise it is not. By default, the `HttpOnly`
+attribute is set.
+
+**Note** be careful when setting this to `true`, as compliant clients will not allow
+client-side JavaScript to see the cookie in `document.cookie`.
+
+##### cookie.maxAge
+
+Specifies the `number` (in milliseconds) to use when calculating the `Expires`
+`Set-Cookie` attribute. This is done by taking the current server time and adding
+`maxAge` milliseconds to the value to calculate an `Expires` datetime. By default,
+no maximum age is set.
+
+**Note** If both `expires` and `maxAge` are set in the options, then the last one
+defined in the object is what is used.
+
+##### cookie.partitioned
+
+Specifies the `boolean` value for the [`Partitioned` `Set-Cookie`](rfc-cutler-httpbis-partitioned-cookies)
+attribute. When truthy, the `Partitioned` attribute is set, otherwise it is not.
+By default, the `Partitioned` attribute is not set.
+
+**Note** This is an attribute that has not yet been fully standardized, and may
+change in the future. This also means many clients may ignore this attribute until
+they understand it.
+
+More information about can be found in [the proposal](https://github.com/privacycg/CHIPS).
+
+##### cookie.path
+
+Specifies the value for the `Path` `Set-Cookie`. By default, this is set to `'/'`, which
+is the root path of the domain.
+
+##### cookie.priority
+
+Specifies the `string` to be the value for the [`Priority` `Set-Cookie` attribute][rfc-west-cookie-priority-00-4.1].
+
+ - `'low'` will set the `Priority` attribute to `Low`.
+ - `'medium'` will set the `Priority` attribute to `Medium`, the default priority when not set.
+ - `'high'` will set the `Priority` attribute to `High`.
+
+More information about the different priority levels can be found in
+[the specification][rfc-west-cookie-priority-00-4.1].
+
+**Note** This is an attribute that has not yet been fully standardized, and may change in the future.
+This also means many clients may ignore this attribute until they understand it.
+
+##### cookie.sameSite
+
+Specifies the `boolean` or `string` to be the value for the `SameSite` `Set-Cookie` attribute.
+By default, this is `false`.
+
+ - `true` will set the `SameSite` attribute to `Strict` for strict same site enforcement.
+ - `false` will not set the `SameSite` attribute.
+ - `'lax'` will set the `SameSite` attribute to `Lax` for lax same site enforcement.
+ - `'none'` will set the `SameSite` attribute to `None` for an explicit cross-site cookie.
+ - `'strict'` will set the `SameSite` attribute to `Strict` for strict same site enforcement.
+
+More information about the different enforcement levels can be found in
+[the specification][rfc-6265bis-03-4.1.2.7].
+
+**Note** This is an attribute that has not yet been fully standardized, and may change in
+the future. This also means many clients may ignore this attribute until they understand it.
+
+**Note** There is a [draft spec](https://tools.ietf.org/html/draft-west-cookie-incrementalism-01)
+that requires that the `Secure` attribute be set to `true` when the `SameSite` attribute has been
+set to `'none'`. Some web browsers or other clients may be adopting this specification.
+
+##### cookie.secure
+
+Specifies the `boolean` value for the `Secure` `Set-Cookie` attribute. When truthy,
+the `Secure` attribute is set, otherwise it is not. By default, the `Secure`
+attribute is not set.
+
+**Note** be careful when setting this to `true`, as compliant clients will not send
+the cookie back to the server in the future if the browser does not have an HTTPS
+connection.
+
+Please note that `secure: true` is a **recommended** option. However, it requires
+an https-enabled website, i.e., HTTPS is necessary for secure cookies. If `secure`
+is set, and you access your site over HTTP, the cookie will not be set. If you
+have your node.js behind a proxy and are using `secure: true`, you need to set
+"trust proxy" in express:
+
+```js
+var app = express()
+app.set('trust proxy', 1) // trust first proxy
+app.use(session({
+ secret: 'keyboard cat',
+ resave: false,
+ saveUninitialized: true,
+ cookie: { secure: true }
+}))
+```
+
+For using secure cookies in production, but allowing for testing in development,
+the following is an example of enabling this setup based on `NODE_ENV` in express:
+
+```js
+var app = express()
+var sess = {
+ secret: 'keyboard cat',
+ cookie: {}
+}
+
+if (app.get('env') === 'production') {
+ app.set('trust proxy', 1) // trust first proxy
+ sess.cookie.secure = true // serve secure cookies
+}
+
+app.use(session(sess))
+```
+
+The `cookie.secure` option can also be set to the special value `'auto'` to have
+this setting automatically match the determined security of the connection. Be
+careful when using this setting if the site is available both as HTTP and HTTPS,
+as once the cookie is set on HTTPS, it will no longer be visible over HTTP. This
+is useful when the Express `"trust proxy"` setting is properly setup to simplify
+development vs production configuration.
+
+##### genid
+
+Function to call to generate a new session ID. Provide a function that returns
+a string that will be used as a session ID. The function is given `req` as the
+first argument if you want to use some value attached to `req` when generating
+the ID.
+
+The default value is a function which uses the `uid-safe` library to generate IDs.
+
+**NOTE** be careful to generate unique IDs so your sessions do not conflict.
+
+```js
+app.use(session({
+ genid: function(req) {
+ return genuuid() // use UUIDs for session IDs
+ },
+ secret: 'keyboard cat'
+}))
+```
+
+##### name
+
+The name of the session ID cookie to set in the response (and read from in the
+request).
+
+The default value is `'connect.sid'`.
+
+**Note** if you have multiple apps running on the same hostname (this is just
+the name, i.e. `localhost` or `127.0.0.1`; different schemes and ports do not
+name a different hostname), then you need to separate the session cookies from
+each other. The simplest method is to simply set different `name`s per app.
+
+##### proxy
+
+Trust the reverse proxy when setting secure cookies (via the "X-Forwarded-Proto"
+header).
+
+The default value is `undefined`.
+
+ - `true` The "X-Forwarded-Proto" header will be used.
+ - `false` All headers are ignored and the connection is considered secure only
+ if there is a direct TLS/SSL connection.
+ - `undefined` Uses the "trust proxy" setting from express
+
+##### resave
+
+Forces the session to be saved back to the session store, even if the session
+was never modified during the request. Depending on your store this may be
+necessary, but it can also create race conditions where a client makes two
+parallel requests to your server and changes made to the session in one
+request may get overwritten when the other request ends, even if it made no
+changes (this behavior also depends on what store you're using).
+
+The default value is `true`, but using the default has been deprecated,
+as the default will change in the future. Please research into this setting
+and choose what is appropriate to your use-case. Typically, you'll want
+`false`.
+
+How do I know if this is necessary for my store? The best way to know is to
+check with your store if it implements the `touch` method. If it does, then
+you can safely set `resave: false`. If it does not implement the `touch`
+method and your store sets an expiration date on stored sessions, then you
+likely need `resave: true`.
+
+##### rolling
+
+Force the session identifier cookie to be set on every response. The expiration
+is reset to the original [`maxAge`](#cookiemaxage), resetting the expiration
+countdown.
+
+The default value is `false`.
+
+With this enabled, the session identifier cookie will expire in
+[`maxAge`](#cookiemaxage) since the last response was sent instead of in
+[`maxAge`](#cookiemaxage) since the session was last modified by the server.
+
+This is typically used in conjuction with short, non-session-length
+[`maxAge`](#cookiemaxage) values to provide a quick timeout of the session data
+with reduced potential of it occurring during on going server interactions.
+
+**Note** When this option is set to `true` but the `saveUninitialized` option is
+set to `false`, the cookie will not be set on a response with an uninitialized
+session. This option only modifies the behavior when an existing session was
+loaded for the request.
+
+##### saveUninitialized
+
+Forces a session that is "uninitialized" to be saved to the store. A session is
+uninitialized when it is new but not modified. Choosing `false` is useful for
+implementing login sessions, reducing server storage usage, or complying with
+laws that require permission before setting a cookie. Choosing `false` will also
+help with race conditions where a client makes multiple parallel requests
+without a session.
+
+The default value is `true`, but using the default has been deprecated, as the
+default will change in the future. Please research into this setting and
+choose what is appropriate to your use-case.
+
+**Note** if you are using Session in conjunction with PassportJS, Passport
+will add an empty Passport object to the session for use after a user is
+authenticated, which will be treated as a modification to the session, causing
+it to be saved. *This has been fixed in PassportJS 0.3.0*
+
+##### secret
+
+**Required option**
+
+This is the secret used to sign the session ID cookie. The secret can be any type
+of value that is supported by Node.js `crypto.createHmac` (like a string or a
+`Buffer`). This can be either a single secret, or an array of multiple secrets. If
+an array of secrets is provided, only the first element will be used to sign the
+session ID cookie, while all the elements will be considered when verifying the
+signature in requests. The secret itself should be not easily parsed by a human and
+would best be a random set of characters. A best practice may include:
+
+ - The use of environment variables to store the secret, ensuring the secret itself
+ does not exist in your repository.
+ - Periodic updates of the secret, while ensuring the previous secret is in the
+ array.
+
+Using a secret that cannot be guessed will reduce the ability to hijack a session to
+only guessing the session ID (as determined by the `genid` option).
+
+Changing the secret value will invalidate all existing sessions. In order to rotate
+the secret without invalidating sessions, provide an array of secrets, with the new
+secret as first element of the array, and including previous secrets as the later
+elements.
+
+**Note** HMAC-256 is used to sign the session ID. For this reason, the secret should
+contain at least 32 bytes of entropy.
+
+##### store
+
+The session store instance, defaults to a new `MemoryStore` instance.
+
+##### unset
+
+Control the result of unsetting `req.session` (through `delete`, setting to `null`,
+etc.).
+
+The default value is `'keep'`.
+
+ - `'destroy'` The session will be destroyed (deleted) when the response ends.
+ - `'keep'` The session in the store will be kept, but modifications made during
+ the request are ignored and not saved.
+
+### req.session
+
+To store or access session data, simply use the request property `req.session`,
+which is (generally) serialized as JSON by the store, so nested objects
+are typically fine. For example below is a user-specific view counter:
+
+```js
+// Use the session middleware
+app.use(session({ secret: 'keyboard cat', cookie: { maxAge: 60000 }}))
+
+// Access the session as req.session
+app.get('/', function(req, res, next) {
+ if (req.session.views) {
+ req.session.views++
+ res.setHeader('Content-Type', 'text/html')
+ res.write('views: ' + req.session.views + '
')
+ res.write('expires in: ' + (req.session.cookie.maxAge / 1000) + 's
')
+ res.end()
+ } else {
+ req.session.views = 1
+ res.end('welcome to the session demo. refresh!')
+ }
+})
+```
+
+#### Session.regenerate(callback)
+
+To regenerate the session simply invoke the method. Once complete,
+a new SID and `Session` instance will be initialized at `req.session`
+and the `callback` will be invoked.
+
+```js
+req.session.regenerate(function(err) {
+ // will have a new session here
+})
+```
+
+#### Session.destroy(callback)
+
+Destroys the session and will unset the `req.session` property.
+Once complete, the `callback` will be invoked.
+
+```js
+req.session.destroy(function(err) {
+ // cannot access session here
+})
+```
+
+#### Session.reload(callback)
+
+Reloads the session data from the store and re-populates the
+`req.session` object. Once complete, the `callback` will be invoked.
+
+```js
+req.session.reload(function(err) {
+ // session updated
+})
+```
+
+#### Session.save(callback)
+
+Save the session back to the store, replacing the contents on the store with the
+contents in memory (though a store may do something else--consult the store's
+documentation for exact behavior).
+
+This method is automatically called at the end of the HTTP response if the
+session data has been altered (though this behavior can be altered with various
+options in the middleware constructor). Because of this, typically this method
+does not need to be called.
+
+There are some cases where it is useful to call this method, for example,
+redirects, long-lived requests or in WebSockets.
+
+```js
+req.session.save(function(err) {
+ // session saved
+})
+```
+
+#### Session.touch()
+
+Updates the `.maxAge` property. Typically this is
+not necessary to call, as the session middleware does this for you.
+
+### req.session.id
+
+Each session has a unique ID associated with it. This property is an
+alias of [`req.sessionID`](#reqsessionid-1) and cannot be modified.
+It has been added to make the session ID accessible from the `session`
+object.
+
+### req.session.cookie
+
+Each session has a unique cookie object accompany it. This allows
+you to alter the session cookie per visitor. For example we can
+set `req.session.cookie.expires` to `false` to enable the cookie
+to remain for only the duration of the user-agent.
+
+#### Cookie.maxAge
+
+Alternatively `req.session.cookie.maxAge` will return the time
+remaining in milliseconds, which we may also re-assign a new value
+to adjust the `.expires` property appropriately. The following
+are essentially equivalent
+
+```js
+var hour = 3600000
+req.session.cookie.expires = new Date(Date.now() + hour)
+req.session.cookie.maxAge = hour
+```
+
+For example when `maxAge` is set to `60000` (one minute), and 30 seconds
+has elapsed it will return `30000` until the current request has completed,
+at which time `req.session.touch()` is called to reset
+`req.session.cookie.maxAge` to its original value.
+
+```js
+req.session.cookie.maxAge // => 30000
+```
+
+#### Cookie.originalMaxAge
+
+The `req.session.cookie.originalMaxAge` property returns the original
+`maxAge` (time-to-live), in milliseconds, of the session cookie.
+
+### req.sessionID
+
+To get the ID of the loaded session, access the request property
+`req.sessionID`. This is simply a read-only value set when a session
+is loaded/created.
+
+## Session Store Implementation
+
+Every session store _must_ be an `EventEmitter` and implement specific
+methods. The following methods are the list of **required**, **recommended**,
+and **optional**.
+
+ * Required methods are ones that this module will always call on the store.
+ * Recommended methods are ones that this module will call on the store if
+ available.
+ * Optional methods are ones this module does not call at all, but helps
+ present uniform stores to users.
+
+For an example implementation view the [connect-redis](http://github.com/visionmedia/connect-redis) repo.
+
+### store.all(callback)
+
+**Optional**
+
+This optional method is used to get all sessions in the store as an array. The
+`callback` should be called as `callback(error, sessions)`.
+
+### store.destroy(sid, callback)
+
+**Required**
+
+This required method is used to destroy/delete a session from the store given
+a session ID (`sid`). The `callback` should be called as `callback(error)` once
+the session is destroyed.
+
+### store.clear(callback)
+
+**Optional**
+
+This optional method is used to delete all sessions from the store. The
+`callback` should be called as `callback(error)` once the store is cleared.
+
+### store.length(callback)
+
+**Optional**
+
+This optional method is used to get the count of all sessions in the store.
+The `callback` should be called as `callback(error, len)`.
+
+### store.get(sid, callback)
+
+**Required**
+
+This required method is used to get a session from the store given a session
+ID (`sid`). The `callback` should be called as `callback(error, session)`.
+
+The `session` argument should be a session if found, otherwise `null` or
+`undefined` if the session was not found (and there was no error). A special
+case is made when `error.code === 'ENOENT'` to act like `callback(null, null)`.
+
+### store.set(sid, session, callback)
+
+**Required**
+
+This required method is used to upsert a session into the store given a
+session ID (`sid`) and session (`session`) object. The callback should be
+called as `callback(error)` once the session has been set in the store.
+
+### store.touch(sid, session, callback)
+
+**Recommended**
+
+This recommended method is used to "touch" a given session given a
+session ID (`sid`) and session (`session`) object. The `callback` should be
+called as `callback(error)` once the session has been touched.
+
+This is primarily used when the store will automatically delete idle sessions
+and this method is used to signal to the store the given session is active,
+potentially resetting the idle timer.
+
+## Compatible Session Stores
+
+The following modules implement a session store that is compatible with this
+module. Please make a PR to add additional modules :)
+
+[![★][aerospike-session-store-image] aerospike-session-store][aerospike-session-store-url] A session store using [Aerospike](http://www.aerospike.com/).
+
+[aerospike-session-store-url]: https://www.npmjs.com/package/aerospike-session-store
+[aerospike-session-store-image]: https://badgen.net/github/stars/aerospike/aerospike-session-store-expressjs?label=%E2%98%85
+
+[![★][better-sqlite3-session-store-image] better-sqlite3-session-store][better-sqlite3-session-store-url] A session store based on [better-sqlite3](https://github.com/JoshuaWise/better-sqlite3).
+
+[better-sqlite3-session-store-url]: https://www.npmjs.com/package/better-sqlite3-session-store
+[better-sqlite3-session-store-image]: https://badgen.net/github/stars/timdaub/better-sqlite3-session-store?label=%E2%98%85
+
+[![★][cassandra-store-image] cassandra-store][cassandra-store-url] An Apache Cassandra-based session store.
+
+[cassandra-store-url]: https://www.npmjs.com/package/cassandra-store
+[cassandra-store-image]: https://badgen.net/github/stars/webcc/cassandra-store?label=%E2%98%85
+
+[![★][cluster-store-image] cluster-store][cluster-store-url] A wrapper for using in-process / embedded
+stores - such as SQLite (via knex), leveldb, files, or memory - with node cluster (desirable for Raspberry Pi 2
+and other multi-core embedded devices).
+
+[cluster-store-url]: https://www.npmjs.com/package/cluster-store
+[cluster-store-image]: https://badgen.net/github/stars/coolaj86/cluster-store?label=%E2%98%85
+
+[![★][connect-arango-image] connect-arango][connect-arango-url] An ArangoDB-based session store.
+
+[connect-arango-url]: https://www.npmjs.com/package/connect-arango
+[connect-arango-image]: https://badgen.net/github/stars/AlexanderArvidsson/connect-arango?label=%E2%98%85
+
+[![★][connect-azuretables-image] connect-azuretables][connect-azuretables-url] An [Azure Table Storage](https://azure.microsoft.com/en-gb/services/storage/tables/)-based session store.
+
+[connect-azuretables-url]: https://www.npmjs.com/package/connect-azuretables
+[connect-azuretables-image]: https://badgen.net/github/stars/mike-goodwin/connect-azuretables?label=%E2%98%85
+
+[![★][connect-cloudant-store-image] connect-cloudant-store][connect-cloudant-store-url] An [IBM Cloudant](https://cloudant.com/)-based session store.
+
+[connect-cloudant-store-url]: https://www.npmjs.com/package/connect-cloudant-store
+[connect-cloudant-store-image]: https://badgen.net/github/stars/adriantanasa/connect-cloudant-store?label=%E2%98%85
+
+[![★][connect-cosmosdb-image] connect-cosmosdb][connect-cosmosdb-url] An Azure [Cosmos DB](https://azure.microsoft.com/en-us/products/cosmos-db/)-based session store.
+
+[connect-cosmosdb-url]: https://www.npmjs.com/package/connect-cosmosdb
+[connect-cosmosdb-image]: https://badgen.net/github/stars/thekillingspree/connect-cosmosdb?label=%E2%98%85
+
+[![★][connect-couchbase-image] connect-couchbase][connect-couchbase-url] A [couchbase](http://www.couchbase.com/)-based session store.
+
+[connect-couchbase-url]: https://www.npmjs.com/package/connect-couchbase
+[connect-couchbase-image]: https://badgen.net/github/stars/christophermina/connect-couchbase?label=%E2%98%85
+
+[![★][connect-datacache-image] connect-datacache][connect-datacache-url] An [IBM Bluemix Data Cache](http://www.ibm.com/cloud-computing/bluemix/)-based session store.
+
+[connect-datacache-url]: https://www.npmjs.com/package/connect-datacache
+[connect-datacache-image]: https://badgen.net/github/stars/adriantanasa/connect-datacache?label=%E2%98%85
+
+[![★][@google-cloud/connect-datastore-image] @google-cloud/connect-datastore][@google-cloud/connect-datastore-url] A [Google Cloud Datastore](https://cloud.google.com/datastore/docs/concepts/overview)-based session store.
+
+[@google-cloud/connect-datastore-url]: https://www.npmjs.com/package/@google-cloud/connect-datastore
+[@google-cloud/connect-datastore-image]: https://badgen.net/github/stars/GoogleCloudPlatform/cloud-datastore-session-node?label=%E2%98%85
+
+[![★][connect-db2-image] connect-db2][connect-db2-url] An IBM DB2-based session store built using [ibm_db](https://www.npmjs.com/package/ibm_db) module.
+
+[connect-db2-url]: https://www.npmjs.com/package/connect-db2
+[connect-db2-image]: https://badgen.net/github/stars/wallali/connect-db2?label=%E2%98%85
+
+[![★][connect-dynamodb-image] connect-dynamodb][connect-dynamodb-url] A DynamoDB-based session store.
+
+[connect-dynamodb-url]: https://www.npmjs.com/package/connect-dynamodb
+[connect-dynamodb-image]: https://badgen.net/github/stars/ca98am79/connect-dynamodb?label=%E2%98%85
+
+[![★][@google-cloud/connect-firestore-image] @google-cloud/connect-firestore][@google-cloud/connect-firestore-url] A [Google Cloud Firestore](https://cloud.google.com/firestore/docs/overview)-based session store.
+
+[@google-cloud/connect-firestore-url]: https://www.npmjs.com/package/@google-cloud/connect-firestore
+[@google-cloud/connect-firestore-image]: https://badgen.net/github/stars/googleapis/nodejs-firestore-session?label=%E2%98%85
+
+[![★][connect-hazelcast-image] connect-hazelcast][connect-hazelcast-url] Hazelcast session store for Connect and Express.
+
+[connect-hazelcast-url]: https://www.npmjs.com/package/connect-hazelcast
+[connect-hazelcast-image]: https://badgen.net/github/stars/huseyinbabal/connect-hazelcast?label=%E2%98%85
+
+[![★][connect-loki-image] connect-loki][connect-loki-url] A Loki.js-based session store.
+
+[connect-loki-url]: https://www.npmjs.com/package/connect-loki
+[connect-loki-image]: https://badgen.net/github/stars/Requarks/connect-loki?label=%E2%98%85
+
+[![★][connect-lowdb-image] connect-lowdb][connect-lowdb-url] A lowdb-based session store.
+
+[connect-lowdb-url]: https://www.npmjs.com/package/connect-lowdb
+[connect-lowdb-image]: https://badgen.net/github/stars/travishorn/connect-lowdb?label=%E2%98%85
+
+[![★][connect-memcached-image] connect-memcached][connect-memcached-url] A memcached-based session store.
+
+[connect-memcached-url]: https://www.npmjs.com/package/connect-memcached
+[connect-memcached-image]: https://badgen.net/github/stars/balor/connect-memcached?label=%E2%98%85
+
+[![★][connect-memjs-image] connect-memjs][connect-memjs-url] A memcached-based session store using
+[memjs](https://www.npmjs.com/package/memjs) as the memcached client.
+
+[connect-memjs-url]: https://www.npmjs.com/package/connect-memjs
+[connect-memjs-image]: https://badgen.net/github/stars/liamdon/connect-memjs?label=%E2%98%85
+
+[![★][connect-ml-image] connect-ml][connect-ml-url] A MarkLogic Server-based session store.
+
+[connect-ml-url]: https://www.npmjs.com/package/connect-ml
+[connect-ml-image]: https://badgen.net/github/stars/bluetorch/connect-ml?label=%E2%98%85
+
+[![★][connect-monetdb-image] connect-monetdb][connect-monetdb-url] A MonetDB-based session store.
+
+[connect-monetdb-url]: https://www.npmjs.com/package/connect-monetdb
+[connect-monetdb-image]: https://badgen.net/github/stars/MonetDB/npm-connect-monetdb?label=%E2%98%85
+
+[![★][connect-mongo-image] connect-mongo][connect-mongo-url] A MongoDB-based session store.
+
+[connect-mongo-url]: https://www.npmjs.com/package/connect-mongo
+[connect-mongo-image]: https://badgen.net/github/stars/kcbanner/connect-mongo?label=%E2%98%85
+
+[![★][connect-mongodb-session-image] connect-mongodb-session][connect-mongodb-session-url] Lightweight MongoDB-based session store built and maintained by MongoDB.
+
+[connect-mongodb-session-url]: https://www.npmjs.com/package/connect-mongodb-session
+[connect-mongodb-session-image]: https://badgen.net/github/stars/mongodb-js/connect-mongodb-session?label=%E2%98%85
+
+[![★][connect-mssql-v2-image] connect-mssql-v2][connect-mssql-v2-url] A Microsoft SQL Server-based session store based on [connect-mssql](https://www.npmjs.com/package/connect-mssql).
+
+[connect-mssql-v2-url]: https://www.npmjs.com/package/connect-mssql-v2
+[connect-mssql-v2-image]: https://badgen.net/github/stars/jluboff/connect-mssql-v2?label=%E2%98%85
+
+[![★][connect-neo4j-image] connect-neo4j][connect-neo4j-url] A [Neo4j](https://neo4j.com)-based session store.
+
+[connect-neo4j-url]: https://www.npmjs.com/package/connect-neo4j
+[connect-neo4j-image]: https://badgen.net/github/stars/MaxAndersson/connect-neo4j?label=%E2%98%85
+
+[![★][connect-ottoman-image] connect-ottoman][connect-ottoman-url] A [couchbase ottoman](http://www.couchbase.com/)-based session store.
+
+[connect-ottoman-url]: https://www.npmjs.com/package/connect-ottoman
+[connect-ottoman-image]: https://badgen.net/github/stars/noiissyboy/connect-ottoman?label=%E2%98%85
+
+[![★][connect-pg-simple-image] connect-pg-simple][connect-pg-simple-url] A PostgreSQL-based session store.
+
+[connect-pg-simple-url]: https://www.npmjs.com/package/connect-pg-simple
+[connect-pg-simple-image]: https://badgen.net/github/stars/voxpelli/node-connect-pg-simple?label=%E2%98%85
+
+[![★][connect-redis-image] connect-redis][connect-redis-url] A Redis-based session store.
+
+[connect-redis-url]: https://www.npmjs.com/package/connect-redis
+[connect-redis-image]: https://badgen.net/github/stars/tj/connect-redis?label=%E2%98%85
+
+[![★][connect-session-firebase-image] connect-session-firebase][connect-session-firebase-url] A session store based on the [Firebase Realtime Database](https://firebase.google.com/docs/database/)
+
+[connect-session-firebase-url]: https://www.npmjs.com/package/connect-session-firebase
+[connect-session-firebase-image]: https://badgen.net/github/stars/benweier/connect-session-firebase?label=%E2%98%85
+
+[![★][connect-session-knex-image] connect-session-knex][connect-session-knex-url] A session store using
+[Knex.js](http://knexjs.org/), which is a SQL query builder for PostgreSQL, MySQL, MariaDB, SQLite3, and Oracle.
+
+[connect-session-knex-url]: https://www.npmjs.com/package/connect-session-knex
+[connect-session-knex-image]: https://badgen.net/github/stars/llambda/connect-session-knex?label=%E2%98%85
+
+[![★][connect-session-sequelize-image] connect-session-sequelize][connect-session-sequelize-url] A session store using
+[Sequelize.js](http://sequelizejs.com/), which is a Node.js / io.js ORM for PostgreSQL, MySQL, SQLite and MSSQL.
+
+[connect-session-sequelize-url]: https://www.npmjs.com/package/connect-session-sequelize
+[connect-session-sequelize-image]: https://badgen.net/github/stars/mweibel/connect-session-sequelize?label=%E2%98%85
+
+[![★][connect-sqlite3-image] connect-sqlite3][connect-sqlite3-url] A [SQLite3](https://github.com/mapbox/node-sqlite3) session store modeled after the TJ's `connect-redis` store.
+
+[connect-sqlite3-url]: https://www.npmjs.com/package/connect-sqlite3
+[connect-sqlite3-image]: https://badgen.net/github/stars/rawberg/connect-sqlite3?label=%E2%98%85
+
+[![★][connect-typeorm-image] connect-typeorm][connect-typeorm-url] A [TypeORM](https://github.com/typeorm/typeorm)-based session store.
+
+[connect-typeorm-url]: https://www.npmjs.com/package/connect-typeorm
+[connect-typeorm-image]: https://badgen.net/github/stars/makepost/connect-typeorm?label=%E2%98%85
+
+[![★][couchdb-expression-image] couchdb-expression][couchdb-expression-url] A [CouchDB](https://couchdb.apache.org/)-based session store.
+
+[couchdb-expression-url]: https://www.npmjs.com/package/couchdb-expression
+[couchdb-expression-image]: https://badgen.net/github/stars/tkshnwesper/couchdb-expression?label=%E2%98%85
+
+[![★][dynamodb-store-image] dynamodb-store][dynamodb-store-url] A DynamoDB-based session store.
+
+[dynamodb-store-url]: https://www.npmjs.com/package/dynamodb-store
+[dynamodb-store-image]: https://badgen.net/github/stars/rafaelrpinto/dynamodb-store?label=%E2%98%85
+
+[![★][dynamodb-store-v3-image] dynamodb-store-v3][dynamodb-store-v3-url] Implementation of a session store using DynamoDB backed by the [AWS SDK for JavaScript v3](https://github.com/aws/aws-sdk-js-v3).
+
+[dynamodb-store-v3-url]: https://www.npmjs.com/package/dynamodb-store-v3
+[dynamodb-store-v3-image]: https://badgen.net/github/stars/FryDay/dynamodb-store-v3?label=%E2%98%85
+
+[![★][express-etcd-image] express-etcd][express-etcd-url] An [etcd](https://github.com/stianeikeland/node-etcd) based session store.
+
+[express-etcd-url]: https://www.npmjs.com/package/express-etcd
+[express-etcd-image]: https://badgen.net/github/stars/gildean/express-etcd?label=%E2%98%85
+
+[![★][express-mysql-session-image] express-mysql-session][express-mysql-session-url] A session store using native
+[MySQL](https://www.mysql.com/) via the [node-mysql](https://github.com/felixge/node-mysql) module.
+
+[express-mysql-session-url]: https://www.npmjs.com/package/express-mysql-session
+[express-mysql-session-image]: https://badgen.net/github/stars/chill117/express-mysql-session?label=%E2%98%85
+
+[![★][express-nedb-session-image] express-nedb-session][express-nedb-session-url] A NeDB-based session store.
+
+[express-nedb-session-url]: https://www.npmjs.com/package/express-nedb-session
+[express-nedb-session-image]: https://badgen.net/github/stars/louischatriot/express-nedb-session?label=%E2%98%85
+
+[![★][express-oracle-session-image] express-oracle-session][express-oracle-session-url] A session store using native
+[oracle](https://www.oracle.com/) via the [node-oracledb](https://www.npmjs.com/package/oracledb) module.
+
+[express-oracle-session-url]: https://www.npmjs.com/package/express-oracle-session
+[express-oracle-session-image]: https://badgen.net/github/stars/slumber86/express-oracle-session?label=%E2%98%85
+
+[![★][express-session-cache-manager-image] express-session-cache-manager][express-session-cache-manager-url]
+A store that implements [cache-manager](https://www.npmjs.com/package/cache-manager), which supports
+a [variety of storage types](https://www.npmjs.com/package/cache-manager#store-engines).
+
+[express-session-cache-manager-url]: https://www.npmjs.com/package/express-session-cache-manager
+[express-session-cache-manager-image]: https://badgen.net/github/stars/theogravity/express-session-cache-manager?label=%E2%98%85
+
+[![★][express-session-etcd3-image] express-session-etcd3][express-session-etcd3-url] An [etcd3](https://github.com/mixer/etcd3) based session store.
+
+[express-session-etcd3-url]: https://www.npmjs.com/package/express-session-etcd3
+[express-session-etcd3-image]: https://badgen.net/github/stars/willgm/express-session-etcd3?label=%E2%98%85
+
+[![★][express-session-level-image] express-session-level][express-session-level-url] A [LevelDB](https://github.com/Level/levelup) based session store.
+
+[express-session-level-url]: https://www.npmjs.com/package/express-session-level
+[express-session-level-image]: https://badgen.net/github/stars/tgohn/express-session-level?label=%E2%98%85
+
+[![★][express-session-rsdb-image] express-session-rsdb][express-session-rsdb-url] Session store based on Rocket-Store: A very simple, super fast and yet powerfull, flat file database.
+
+[express-session-rsdb-url]: https://www.npmjs.com/package/express-session-rsdb
+[express-session-rsdb-image]: https://badgen.net/github/stars/paragi/express-session-rsdb?label=%E2%98%85
+
+[![★][express-sessions-image] express-sessions][express-sessions-url] A session store supporting both MongoDB and Redis.
+
+[express-sessions-url]: https://www.npmjs.com/package/express-sessions
+[express-sessions-image]: https://badgen.net/github/stars/konteck/express-sessions?label=%E2%98%85
+
+[![★][firestore-store-image] firestore-store][firestore-store-url] A [Firestore](https://github.com/hendrysadrak/firestore-store)-based session store.
+
+[firestore-store-url]: https://www.npmjs.com/package/firestore-store
+[firestore-store-image]: https://badgen.net/github/stars/hendrysadrak/firestore-store?label=%E2%98%85
+
+[![★][fortune-session-image] fortune-session][fortune-session-url] A [Fortune.js](https://github.com/fortunejs/fortune)
+based session store. Supports all backends supported by Fortune (MongoDB, Redis, Postgres, NeDB).
+
+[fortune-session-url]: https://www.npmjs.com/package/fortune-session
+[fortune-session-image]: https://badgen.net/github/stars/aliceklipper/fortune-session?label=%E2%98%85
+
+[![★][hazelcast-store-image] hazelcast-store][hazelcast-store-url] A Hazelcast-based session store built on the [Hazelcast Node Client](https://www.npmjs.com/package/hazelcast-client).
+
+[hazelcast-store-url]: https://www.npmjs.com/package/hazelcast-store
+[hazelcast-store-image]: https://badgen.net/github/stars/jackspaniel/hazelcast-store?label=%E2%98%85
+
+[![★][level-session-store-image] level-session-store][level-session-store-url] A LevelDB-based session store.
+
+[level-session-store-url]: https://www.npmjs.com/package/level-session-store
+[level-session-store-image]: https://badgen.net/github/stars/toddself/level-session-store?label=%E2%98%85
+
+[![★][lowdb-session-store-image] lowdb-session-store][lowdb-session-store-url] A [lowdb](https://www.npmjs.com/package/lowdb)-based session store.
+
+[lowdb-session-store-url]: https://www.npmjs.com/package/lowdb-session-store
+[lowdb-session-store-image]: https://badgen.net/github/stars/fhellwig/lowdb-session-store?label=%E2%98%85
+
+[![★][medea-session-store-image] medea-session-store][medea-session-store-url] A Medea-based session store.
+
+[medea-session-store-url]: https://www.npmjs.com/package/medea-session-store
+[medea-session-store-image]: https://badgen.net/github/stars/BenjaminVadant/medea-session-store?label=%E2%98%85
+
+[![★][memorystore-image] memorystore][memorystore-url] A memory session store made for production.
+
+[memorystore-url]: https://www.npmjs.com/package/memorystore
+[memorystore-image]: https://badgen.net/github/stars/roccomuso/memorystore?label=%E2%98%85
+
+[![★][mssql-session-store-image] mssql-session-store][mssql-session-store-url] A SQL Server-based session store.
+
+[mssql-session-store-url]: https://www.npmjs.com/package/mssql-session-store
+[mssql-session-store-image]: https://badgen.net/github/stars/jwathen/mssql-session-store?label=%E2%98%85
+
+[![★][nedb-session-store-image] nedb-session-store][nedb-session-store-url] An alternate NeDB-based (either in-memory or file-persisted) session store.
+
+[nedb-session-store-url]: https://www.npmjs.com/package/nedb-session-store
+[nedb-session-store-image]: https://badgen.net/github/stars/JamesMGreene/nedb-session-store?label=%E2%98%85
+
+[![★][@quixo3/prisma-session-store-image] @quixo3/prisma-session-store][@quixo3/prisma-session-store-url] A session store for the [Prisma Framework](https://www.prisma.io).
+
+[@quixo3/prisma-session-store-url]: https://www.npmjs.com/package/@quixo3/prisma-session-store
+[@quixo3/prisma-session-store-image]: https://badgen.net/github/stars/kleydon/prisma-session-store?label=%E2%98%85
+
+[![★][restsession-image] restsession][restsession-url] Store sessions utilizing a RESTful API
+
+[restsession-url]: https://www.npmjs.com/package/restsession
+[restsession-image]: https://badgen.net/github/stars/jankal/restsession?label=%E2%98%85
+
+[![★][sequelstore-connect-image] sequelstore-connect][sequelstore-connect-url] A session store using [Sequelize.js](http://sequelizejs.com/).
+
+[sequelstore-connect-url]: https://www.npmjs.com/package/sequelstore-connect
+[sequelstore-connect-image]: https://badgen.net/github/stars/MattMcFarland/sequelstore-connect?label=%E2%98%85
+
+[![★][session-file-store-image] session-file-store][session-file-store-url] A file system-based session store.
+
+[session-file-store-url]: https://www.npmjs.com/package/session-file-store
+[session-file-store-image]: https://badgen.net/github/stars/valery-barysok/session-file-store?label=%E2%98%85
+
+[![★][session-pouchdb-store-image] session-pouchdb-store][session-pouchdb-store-url] Session store for PouchDB / CouchDB. Accepts embedded, custom, or remote PouchDB instance and realtime synchronization.
+
+[session-pouchdb-store-url]: https://www.npmjs.com/package/session-pouchdb-store
+[session-pouchdb-store-image]: https://badgen.net/github/stars/solzimer/session-pouchdb-store?label=%E2%98%85
+
+[![★][@cyclic.sh/session-store-image] @cyclic.sh/session-store][@cyclic.sh/session-store-url] A DynamoDB-based session store for [Cyclic.sh](https://www.cyclic.sh/) apps.
+
+[@cyclic.sh/session-store-url]: https://www.npmjs.com/package/@cyclic.sh/session-store
+[@cyclic.sh/session-store-image]: https://badgen.net/github/stars/cyclic-software/session-store?label=%E2%98%85
+
+[![★][@databunker/session-store-image] @databunker/session-store][@databunker/session-store-url] A [Databunker](https://databunker.org/)-based encrypted session store.
+
+[@databunker/session-store-url]: https://www.npmjs.com/package/@databunker/session-store
+[@databunker/session-store-image]: https://badgen.net/github/stars/securitybunker/databunker-session-store?label=%E2%98%85
+
+[![★][sessionstore-image] sessionstore][sessionstore-url] A session store that works with various databases.
+
+[sessionstore-url]: https://www.npmjs.com/package/sessionstore
+[sessionstore-image]: https://badgen.net/github/stars/adrai/sessionstore?label=%E2%98%85
+
+[![★][tch-nedb-session-image] tch-nedb-session][tch-nedb-session-url] A file system session store based on NeDB.
+
+[tch-nedb-session-url]: https://www.npmjs.com/package/tch-nedb-session
+[tch-nedb-session-image]: https://badgen.net/github/stars/tomaschyly/NeDBSession?label=%E2%98%85
+
+## Examples
+
+### View counter
+
+A simple example using `express-session` to store page views for a user.
+
+```js
+var express = require('express')
+var parseurl = require('parseurl')
+var session = require('express-session')
+
+var app = express()
+
+app.use(session({
+ secret: 'keyboard cat',
+ resave: false,
+ saveUninitialized: true
+}))
+
+app.use(function (req, res, next) {
+ if (!req.session.views) {
+ req.session.views = {}
+ }
+
+ // get the url pathname
+ var pathname = parseurl(req).pathname
+
+ // count the views
+ req.session.views[pathname] = (req.session.views[pathname] || 0) + 1
+
+ next()
+})
+
+app.get('/foo', function (req, res, next) {
+ res.send('you viewed this page ' + req.session.views['/foo'] + ' times')
+})
+
+app.get('/bar', function (req, res, next) {
+ res.send('you viewed this page ' + req.session.views['/bar'] + ' times')
+})
+
+app.listen(3000)
+```
+
+### User login
+
+A simple example using `express-session` to keep a user log in session.
+
+```js
+var escapeHtml = require('escape-html')
+var express = require('express')
+var session = require('express-session')
+
+var app = express()
+
+app.use(session({
+ secret: 'keyboard cat',
+ resave: false,
+ saveUninitialized: true
+}))
+
+// middleware to test if authenticated
+function isAuthenticated (req, res, next) {
+ if (req.session.user) next()
+ else next('route')
+}
+
+app.get('/', isAuthenticated, function (req, res) {
+ // this is only called when there is an authentication user due to isAuthenticated
+ res.send('hello, ' + escapeHtml(req.session.user) + '!' +
+ ' Logout ')
+})
+
+app.get('/', function (req, res) {
+ res.send('')
+})
+
+app.post('/login', express.urlencoded({ extended: false }), function (req, res) {
+ // login logic to validate req.body.user and req.body.pass
+ // would be implemented here. for this example any combo works
+
+ // regenerate the session, which is good practice to help
+ // guard against forms of session fixation
+ req.session.regenerate(function (err) {
+ if (err) next(err)
+
+ // store user information in session, typically a user id
+ req.session.user = req.body.user
+
+ // save the session before redirection to ensure page
+ // load does not happen before session is saved
+ req.session.save(function (err) {
+ if (err) return next(err)
+ res.redirect('/')
+ })
+ })
+})
+
+app.get('/logout', function (req, res, next) {
+ // logout logic
+
+ // clear the user from the session object and save.
+ // this will ensure that re-using the old session id
+ // does not have a logged in user
+ req.session.user = null
+ req.session.save(function (err) {
+ if (err) next(err)
+
+ // regenerate the session, which is good practice to help
+ // guard against forms of session fixation
+ req.session.regenerate(function (err) {
+ if (err) next(err)
+ res.redirect('/')
+ })
+ })
+})
+
+app.listen(3000)
+```
+
+## Debugging
+
+This module uses the [debug](https://www.npmjs.com/package/debug) module
+internally to log information about session operations.
+
+To see all the internal logs, set the `DEBUG` environment variable to
+`express-session` when launching your app (`npm start`, in this example):
+
+```sh
+$ DEBUG=express-session npm start
+```
+
+On Windows, use the corresponding command;
+
+```sh
+> set DEBUG=express-session & npm start
+```
+
+## License
+
+[MIT](LICENSE)
+
+[rfc-6265bis-03-4.1.2.7]: https://tools.ietf.org/html/draft-ietf-httpbis-rfc6265bis-03#section-4.1.2.7
+[rfc-cutler-httpbis-partitioned-cookies]: https://tools.ietf.org/html/draft-cutler-httpbis-partitioned-cookies/
+[rfc-west-cookie-priority-00-4.1]: https://tools.ietf.org/html/draft-west-cookie-priority-00#section-4.1
+[ci-image]: https://badgen.net/github/checks/expressjs/session/master?label=ci
+[ci-url]: https://github.com/expressjs/session/actions?query=workflow%3Aci
+[coveralls-image]: https://badgen.net/coveralls/c/github/expressjs/session/master
+[coveralls-url]: https://coveralls.io/r/expressjs/session?branch=master
+[node-url]: https://nodejs.org/en/download
+[npm-downloads-image]: https://badgen.net/npm/dm/express-session
+[npm-url]: https://npmjs.org/package/express-session
+[npm-version-image]: https://badgen.net/npm/v/express-session
diff --git a/node_modules/express-session/index.js b/node_modules/express-session/index.js
new file mode 100644
index 0000000..d41b237
--- /dev/null
+++ b/node_modules/express-session/index.js
@@ -0,0 +1,693 @@
+/*!
+ * express-session
+ * Copyright(c) 2010 Sencha Inc.
+ * Copyright(c) 2011 TJ Holowaychuk
+ * Copyright(c) 2014-2015 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+'use strict';
+
+/**
+ * Module dependencies.
+ * @private
+ */
+
+var Buffer = require('safe-buffer').Buffer
+var cookie = require('cookie');
+var crypto = require('crypto')
+var debug = require('debug')('express-session');
+var deprecate = require('depd')('express-session');
+var onHeaders = require('on-headers')
+var parseUrl = require('parseurl');
+var signature = require('cookie-signature')
+var uid = require('uid-safe').sync
+
+var Cookie = require('./session/cookie')
+var MemoryStore = require('./session/memory')
+var Session = require('./session/session')
+var Store = require('./session/store')
+
+// environment
+
+var env = process.env.NODE_ENV;
+
+/**
+ * Expose the middleware.
+ */
+
+exports = module.exports = session;
+
+/**
+ * Expose constructors.
+ */
+
+exports.Store = Store;
+exports.Cookie = Cookie;
+exports.Session = Session;
+exports.MemoryStore = MemoryStore;
+
+/**
+ * Warning message for `MemoryStore` usage in production.
+ * @private
+ */
+
+var warning = 'Warning: connect.session() MemoryStore is not\n'
+ + 'designed for a production environment, as it will leak\n'
+ + 'memory, and will not scale past a single process.';
+
+/**
+ * Node.js 0.8+ async implementation.
+ * @private
+ */
+
+/* istanbul ignore next */
+var defer = typeof setImmediate === 'function'
+ ? setImmediate
+ : function(fn){ process.nextTick(fn.bind.apply(fn, arguments)) }
+
+/**
+ * Setup session store with the given `options`.
+ *
+ * @param {Object} [options]
+ * @param {Object} [options.cookie] Options for cookie
+ * @param {Function} [options.genid]
+ * @param {String} [options.name=connect.sid] Session ID cookie name
+ * @param {Boolean} [options.proxy]
+ * @param {Boolean} [options.resave] Resave unmodified sessions back to the store
+ * @param {Boolean} [options.rolling] Enable/disable rolling session expiration
+ * @param {Boolean} [options.saveUninitialized] Save uninitialized sessions to the store
+ * @param {String|Array} [options.secret] Secret for signing session ID
+ * @param {Object} [options.store=MemoryStore] Session store
+ * @param {String} [options.unset]
+ * @return {Function} middleware
+ * @public
+ */
+
+function session(options) {
+ var opts = options || {}
+
+ // get the cookie options
+ var cookieOptions = opts.cookie || {}
+
+ // get the session id generate function
+ var generateId = opts.genid || generateSessionId
+
+ // get the session cookie name
+ var name = opts.name || opts.key || 'connect.sid'
+
+ // get the session store
+ var store = opts.store || new MemoryStore()
+
+ // get the trust proxy setting
+ var trustProxy = opts.proxy
+
+ // get the resave session option
+ var resaveSession = opts.resave;
+
+ // get the rolling session option
+ var rollingSessions = Boolean(opts.rolling)
+
+ // get the save uninitialized session option
+ var saveUninitializedSession = opts.saveUninitialized
+
+ // get the cookie signing secret
+ var secret = opts.secret
+
+ if (typeof generateId !== 'function') {
+ throw new TypeError('genid option must be a function');
+ }
+
+ if (resaveSession === undefined) {
+ deprecate('undefined resave option; provide resave option');
+ resaveSession = true;
+ }
+
+ if (saveUninitializedSession === undefined) {
+ deprecate('undefined saveUninitialized option; provide saveUninitialized option');
+ saveUninitializedSession = true;
+ }
+
+ if (opts.unset && opts.unset !== 'destroy' && opts.unset !== 'keep') {
+ throw new TypeError('unset option must be "destroy" or "keep"');
+ }
+
+ // TODO: switch to "destroy" on next major
+ var unsetDestroy = opts.unset === 'destroy'
+
+ if (Array.isArray(secret) && secret.length === 0) {
+ throw new TypeError('secret option array must contain one or more strings');
+ }
+
+ if (secret && !Array.isArray(secret)) {
+ secret = [secret];
+ }
+
+ if (!secret) {
+ deprecate('req.secret; provide secret option');
+ }
+
+ // notify user that this store is not
+ // meant for a production environment
+ /* istanbul ignore next: not tested */
+ if (env === 'production' && store instanceof MemoryStore) {
+ console.warn(warning);
+ }
+
+ // generates the new session
+ store.generate = function(req){
+ req.sessionID = generateId(req);
+ req.session = new Session(req);
+ req.session.cookie = new Cookie(cookieOptions);
+
+ if (cookieOptions.secure === 'auto') {
+ req.session.cookie.secure = issecure(req, trustProxy);
+ }
+ };
+
+ var storeImplementsTouch = typeof store.touch === 'function';
+
+ // register event listeners for the store to track readiness
+ var storeReady = true
+ store.on('disconnect', function ondisconnect() {
+ storeReady = false
+ })
+ store.on('connect', function onconnect() {
+ storeReady = true
+ })
+
+ return function session(req, res, next) {
+ // self-awareness
+ if (req.session) {
+ next()
+ return
+ }
+
+ // Handle connection as if there is no session if
+ // the store has temporarily disconnected etc
+ if (!storeReady) {
+ debug('store is disconnected')
+ next()
+ return
+ }
+
+ // pathname mismatch
+ var originalPath = parseUrl.original(req).pathname || '/'
+ if (originalPath.indexOf(cookieOptions.path || '/') !== 0) {
+ debug('pathname mismatch')
+ next()
+ return
+ }
+
+ // ensure a secret is available or bail
+ if (!secret && !req.secret) {
+ next(new Error('secret option required for sessions'));
+ return;
+ }
+
+ // backwards compatibility for signed cookies
+ // req.secret is passed from the cookie parser middleware
+ var secrets = secret || [req.secret];
+
+ var originalHash;
+ var originalId;
+ var savedHash;
+ var touched = false
+
+ // expose store
+ req.sessionStore = store;
+
+ // get the session ID from the cookie
+ var cookieId = req.sessionID = getcookie(req, name, secrets);
+
+ // set-cookie
+ onHeaders(res, function(){
+ if (!req.session) {
+ debug('no session');
+ return;
+ }
+
+ if (!shouldSetCookie(req)) {
+ return;
+ }
+
+ // only send secure cookies via https
+ if (req.session.cookie.secure && !issecure(req, trustProxy)) {
+ debug('not secured');
+ return;
+ }
+
+ if (!touched) {
+ // touch session
+ req.session.touch()
+ touched = true
+ }
+
+ // set cookie
+ try {
+ setcookie(res, name, req.sessionID, secrets[0], req.session.cookie.data)
+ } catch (err) {
+ defer(next, err)
+ }
+ });
+
+ // proxy end() to commit the session
+ var _end = res.end;
+ var _write = res.write;
+ var ended = false;
+ res.end = function end(chunk, encoding) {
+ if (ended) {
+ return false;
+ }
+
+ ended = true;
+
+ var ret;
+ var sync = true;
+
+ function writeend() {
+ if (sync) {
+ ret = _end.call(res, chunk, encoding);
+ sync = false;
+ return;
+ }
+
+ _end.call(res);
+ }
+
+ function writetop() {
+ if (!sync) {
+ return ret;
+ }
+
+ if (!res._header) {
+ res._implicitHeader()
+ }
+
+ if (chunk == null) {
+ ret = true;
+ return ret;
+ }
+
+ var contentLength = Number(res.getHeader('Content-Length'));
+
+ if (!isNaN(contentLength) && contentLength > 0) {
+ // measure chunk
+ chunk = !Buffer.isBuffer(chunk)
+ ? Buffer.from(chunk, encoding)
+ : chunk;
+ encoding = undefined;
+
+ if (chunk.length !== 0) {
+ debug('split response');
+ ret = _write.call(res, chunk.slice(0, chunk.length - 1));
+ chunk = chunk.slice(chunk.length - 1, chunk.length);
+ return ret;
+ }
+ }
+
+ ret = _write.call(res, chunk, encoding);
+ sync = false;
+
+ return ret;
+ }
+
+ if (shouldDestroy(req)) {
+ // destroy session
+ debug('destroying');
+ store.destroy(req.sessionID, function ondestroy(err) {
+ if (err) {
+ defer(next, err);
+ }
+
+ debug('destroyed');
+ writeend();
+ });
+
+ return writetop();
+ }
+
+ // no session to save
+ if (!req.session) {
+ debug('no session');
+ return _end.call(res, chunk, encoding);
+ }
+
+ if (!touched) {
+ // touch session
+ req.session.touch()
+ touched = true
+ }
+
+ if (shouldSave(req)) {
+ req.session.save(function onsave(err) {
+ if (err) {
+ defer(next, err);
+ }
+
+ writeend();
+ });
+
+ return writetop();
+ } else if (storeImplementsTouch && shouldTouch(req)) {
+ // store implements touch method
+ debug('touching');
+ store.touch(req.sessionID, req.session, function ontouch(err) {
+ if (err) {
+ defer(next, err);
+ }
+
+ debug('touched');
+ writeend();
+ });
+
+ return writetop();
+ }
+
+ return _end.call(res, chunk, encoding);
+ };
+
+ // generate the session
+ function generate() {
+ store.generate(req);
+ originalId = req.sessionID;
+ originalHash = hash(req.session);
+ wrapmethods(req.session);
+ }
+
+ // inflate the session
+ function inflate (req, sess) {
+ store.createSession(req, sess)
+ originalId = req.sessionID
+ originalHash = hash(sess)
+
+ if (!resaveSession) {
+ savedHash = originalHash
+ }
+
+ wrapmethods(req.session)
+ }
+
+ function rewrapmethods (sess, callback) {
+ return function () {
+ if (req.session !== sess) {
+ wrapmethods(req.session)
+ }
+
+ callback.apply(this, arguments)
+ }
+ }
+
+ // wrap session methods
+ function wrapmethods(sess) {
+ var _reload = sess.reload
+ var _save = sess.save;
+
+ function reload(callback) {
+ debug('reloading %s', this.id)
+ _reload.call(this, rewrapmethods(this, callback))
+ }
+
+ function save() {
+ debug('saving %s', this.id);
+ savedHash = hash(this);
+ _save.apply(this, arguments);
+ }
+
+ Object.defineProperty(sess, 'reload', {
+ configurable: true,
+ enumerable: false,
+ value: reload,
+ writable: true
+ })
+
+ Object.defineProperty(sess, 'save', {
+ configurable: true,
+ enumerable: false,
+ value: save,
+ writable: true
+ });
+ }
+
+ // check if session has been modified
+ function isModified(sess) {
+ return originalId !== sess.id || originalHash !== hash(sess);
+ }
+
+ // check if session has been saved
+ function isSaved(sess) {
+ return originalId === sess.id && savedHash === hash(sess);
+ }
+
+ // determine if session should be destroyed
+ function shouldDestroy(req) {
+ return req.sessionID && unsetDestroy && req.session == null;
+ }
+
+ // determine if session should be saved to store
+ function shouldSave(req) {
+ // cannot set cookie without a session ID
+ if (typeof req.sessionID !== 'string') {
+ debug('session ignored because of bogus req.sessionID %o', req.sessionID);
+ return false;
+ }
+
+ return !saveUninitializedSession && !savedHash && cookieId !== req.sessionID
+ ? isModified(req.session)
+ : !isSaved(req.session)
+ }
+
+ // determine if session should be touched
+ function shouldTouch(req) {
+ // cannot set cookie without a session ID
+ if (typeof req.sessionID !== 'string') {
+ debug('session ignored because of bogus req.sessionID %o', req.sessionID);
+ return false;
+ }
+
+ return cookieId === req.sessionID && !shouldSave(req);
+ }
+
+ // determine if cookie should be set on response
+ function shouldSetCookie(req) {
+ // cannot set cookie without a session ID
+ if (typeof req.sessionID !== 'string') {
+ return false;
+ }
+
+ return cookieId !== req.sessionID
+ ? saveUninitializedSession || isModified(req.session)
+ : rollingSessions || req.session.cookie.expires != null && isModified(req.session);
+ }
+
+ // generate a session if the browser doesn't send a sessionID
+ if (!req.sessionID) {
+ debug('no SID sent, generating session');
+ generate();
+ next();
+ return;
+ }
+
+ // generate the session object
+ debug('fetching %s', req.sessionID);
+ store.get(req.sessionID, function(err, sess){
+ // error handling
+ if (err && err.code !== 'ENOENT') {
+ debug('error %j', err);
+ next(err)
+ return
+ }
+
+ try {
+ if (err || !sess) {
+ debug('no session found')
+ generate()
+ } else {
+ debug('session found')
+ inflate(req, sess)
+ }
+ } catch (e) {
+ next(e)
+ return
+ }
+
+ next()
+ });
+ };
+};
+
+/**
+ * Generate a session ID for a new session.
+ *
+ * @return {String}
+ * @private
+ */
+
+function generateSessionId(sess) {
+ return uid(24);
+}
+
+/**
+ * Get the session ID cookie from request.
+ *
+ * @return {string}
+ * @private
+ */
+
+function getcookie(req, name, secrets) {
+ var header = req.headers.cookie;
+ var raw;
+ var val;
+
+ // read from cookie header
+ if (header) {
+ var cookies = cookie.parse(header);
+
+ raw = cookies[name];
+
+ if (raw) {
+ if (raw.substr(0, 2) === 's:') {
+ val = unsigncookie(raw.slice(2), secrets);
+
+ if (val === false) {
+ debug('cookie signature invalid');
+ val = undefined;
+ }
+ } else {
+ debug('cookie unsigned')
+ }
+ }
+ }
+
+ // back-compat read from cookieParser() signedCookies data
+ if (!val && req.signedCookies) {
+ val = req.signedCookies[name];
+
+ if (val) {
+ deprecate('cookie should be available in req.headers.cookie');
+ }
+ }
+
+ // back-compat read from cookieParser() cookies data
+ if (!val && req.cookies) {
+ raw = req.cookies[name];
+
+ if (raw) {
+ if (raw.substr(0, 2) === 's:') {
+ val = unsigncookie(raw.slice(2), secrets);
+
+ if (val) {
+ deprecate('cookie should be available in req.headers.cookie');
+ }
+
+ if (val === false) {
+ debug('cookie signature invalid');
+ val = undefined;
+ }
+ } else {
+ debug('cookie unsigned')
+ }
+ }
+ }
+
+ return val;
+}
+
+/**
+ * Hash the given `sess` object omitting changes to `.cookie`.
+ *
+ * @param {Object} sess
+ * @return {String}
+ * @private
+ */
+
+function hash(sess) {
+ // serialize
+ var str = JSON.stringify(sess, function (key, val) {
+ // ignore sess.cookie property
+ if (this === sess && key === 'cookie') {
+ return
+ }
+
+ return val
+ })
+
+ // hash
+ return crypto
+ .createHash('sha1')
+ .update(str, 'utf8')
+ .digest('hex')
+}
+
+/**
+ * Determine if request is secure.
+ *
+ * @param {Object} req
+ * @param {Boolean} [trustProxy]
+ * @return {Boolean}
+ * @private
+ */
+
+function issecure(req, trustProxy) {
+ // socket is https server
+ if (req.connection && req.connection.encrypted) {
+ return true;
+ }
+
+ // do not trust proxy
+ if (trustProxy === false) {
+ return false;
+ }
+
+ // no explicit trust; try req.secure from express
+ if (trustProxy !== true) {
+ return req.secure === true
+ }
+
+ // read the proto from x-forwarded-proto header
+ var header = req.headers['x-forwarded-proto'] || '';
+ var index = header.indexOf(',');
+ var proto = index !== -1
+ ? header.substr(0, index).toLowerCase().trim()
+ : header.toLowerCase().trim()
+
+ return proto === 'https';
+}
+
+/**
+ * Set cookie on response.
+ *
+ * @private
+ */
+
+function setcookie(res, name, val, secret, options) {
+ var signed = 's:' + signature.sign(val, secret);
+ var data = cookie.serialize(name, signed, options);
+
+ debug('set-cookie %s', data);
+
+ var prev = res.getHeader('Set-Cookie') || []
+ var header = Array.isArray(prev) ? prev.concat(data) : [prev, data];
+
+ res.setHeader('Set-Cookie', header)
+}
+
+/**
+ * Verify and decode the given `val` with `secrets`.
+ *
+ * @param {String} val
+ * @param {Array} secrets
+ * @returns {String|Boolean}
+ * @private
+ */
+function unsigncookie(val, secrets) {
+ for (var i = 0; i < secrets.length; i++) {
+ var result = signature.unsign(val, secrets[i]);
+
+ if (result !== false) {
+ return result;
+ }
+ }
+
+ return false;
+}
diff --git a/node_modules/express-session/node_modules/cookie-signature/History.md b/node_modules/express-session/node_modules/cookie-signature/History.md
new file mode 100644
index 0000000..bcf8cc9
--- /dev/null
+++ b/node_modules/express-session/node_modules/cookie-signature/History.md
@@ -0,0 +1,42 @@
+1.0.7 / 2023-04-12
+==================
+
+* backport the buffer support from the 1.2.x release branch (thanks @FadhiliNjagi!)
+
+1.0.6 / 2015-02-03
+==================
+
+* use `npm test` instead of `make test` to run tests
+* clearer assertion messages when checking input
+
+1.0.5 / 2014-09-05
+==================
+
+* add license to package.json
+
+1.0.4 / 2014-06-25
+==================
+
+ * corrected avoidance of timing attacks (thanks @tenbits!)
+
+1.0.3 / 2014-01-28
+==================
+
+ * [incorrect] fix for timing attacks
+
+1.0.2 / 2014-01-28
+==================
+
+ * fix missing repository warning
+ * fix typo in test
+
+1.0.1 / 2013-04-15
+==================
+
+ * Revert "Changed underlying HMAC algo. to sha512."
+ * Revert "Fix for timing attacks on MAC verification."
+
+0.0.1 / 2010-01-03
+==================
+
+ * Initial release
diff --git a/node_modules/express-session/node_modules/cookie-signature/Readme.md b/node_modules/express-session/node_modules/cookie-signature/Readme.md
new file mode 100644
index 0000000..2559e84
--- /dev/null
+++ b/node_modules/express-session/node_modules/cookie-signature/Readme.md
@@ -0,0 +1,42 @@
+
+# cookie-signature
+
+ Sign and unsign cookies.
+
+## Example
+
+```js
+var cookie = require('cookie-signature');
+
+var val = cookie.sign('hello', 'tobiiscool');
+val.should.equal('hello.DGDUkGlIkCzPz+C0B064FNgHdEjox7ch8tOBGslZ5QI');
+
+var val = cookie.sign('hello', 'tobiiscool');
+cookie.unsign(val, 'tobiiscool').should.equal('hello');
+cookie.unsign(val, 'luna').should.be.false;
+```
+
+## License
+
+(The MIT License)
+
+Copyright (c) 2012 LearnBoost <tj@learnboost.com>
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
\ No newline at end of file
diff --git a/node_modules/express-session/node_modules/cookie-signature/index.js b/node_modules/express-session/node_modules/cookie-signature/index.js
new file mode 100644
index 0000000..336d487
--- /dev/null
+++ b/node_modules/express-session/node_modules/cookie-signature/index.js
@@ -0,0 +1,51 @@
+/**
+ * Module dependencies.
+ */
+
+var crypto = require('crypto');
+
+/**
+ * Sign the given `val` with `secret`.
+ *
+ * @param {String} val
+ * @param {String|NodeJS.ArrayBufferView|crypto.KeyObject} secret
+ * @return {String}
+ * @api private
+ */
+
+exports.sign = function(val, secret){
+ if ('string' !== typeof val) throw new TypeError("Cookie value must be provided as a string.");
+ if (null == secret) throw new TypeError("Secret key must be provided.");
+ return val + '.' + crypto
+ .createHmac('sha256', secret)
+ .update(val)
+ .digest('base64')
+ .replace(/\=+$/, '');
+};
+
+/**
+ * Unsign and decode the given `val` with `secret`,
+ * returning `false` if the signature is invalid.
+ *
+ * @param {String} val
+ * @param {String|NodeJS.ArrayBufferView|crypto.KeyObject} secret
+ * @return {String|Boolean}
+ * @api private
+ */
+
+exports.unsign = function(val, secret){
+ if ('string' !== typeof val) throw new TypeError("Signed cookie string must be provided.");
+ if (null == secret) throw new TypeError("Secret key must be provided.");
+ var str = val.slice(0, val.lastIndexOf('.'))
+ , mac = exports.sign(str, secret);
+
+ return sha1(mac) == sha1(val) ? str : false;
+};
+
+/**
+ * Private
+ */
+
+function sha1(str){
+ return crypto.createHash('sha1').update(str).digest('hex');
+}
diff --git a/node_modules/express-session/node_modules/cookie-signature/package.json b/node_modules/express-session/node_modules/cookie-signature/package.json
new file mode 100644
index 0000000..738487b
--- /dev/null
+++ b/node_modules/express-session/node_modules/cookie-signature/package.json
@@ -0,0 +1,18 @@
+{
+ "name": "cookie-signature",
+ "version": "1.0.7",
+ "description": "Sign and unsign cookies",
+ "keywords": ["cookie", "sign", "unsign"],
+ "author": "TJ Holowaychuk ",
+ "license": "MIT",
+ "repository": { "type": "git", "url": "https://github.com/visionmedia/node-cookie-signature.git"},
+ "dependencies": {},
+ "devDependencies": {
+ "mocha": "*",
+ "should": "*"
+ },
+ "scripts": {
+ "test": "mocha --require should --reporter spec"
+ },
+ "main": "index"
+}
\ No newline at end of file
diff --git a/node_modules/express-session/node_modules/cookie/LICENSE b/node_modules/express-session/node_modules/cookie/LICENSE
new file mode 100644
index 0000000..058b6b4
--- /dev/null
+++ b/node_modules/express-session/node_modules/cookie/LICENSE
@@ -0,0 +1,24 @@
+(The MIT License)
+
+Copyright (c) 2012-2014 Roman Shtylman
+Copyright (c) 2015 Douglas Christopher Wilson
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
+
diff --git a/node_modules/express-session/node_modules/cookie/README.md b/node_modules/express-session/node_modules/cookie/README.md
new file mode 100644
index 0000000..71fdac1
--- /dev/null
+++ b/node_modules/express-session/node_modules/cookie/README.md
@@ -0,0 +1,317 @@
+# cookie
+
+[![NPM Version][npm-version-image]][npm-url]
+[![NPM Downloads][npm-downloads-image]][npm-url]
+[![Node.js Version][node-image]][node-url]
+[![Build Status][ci-image]][ci-url]
+[![Coverage Status][coveralls-image]][coveralls-url]
+
+Basic HTTP cookie parser and serializer for HTTP servers.
+
+## Installation
+
+This is a [Node.js](https://nodejs.org/en/) module available through the
+[npm registry](https://www.npmjs.com/). Installation is done using the
+[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally):
+
+```sh
+$ npm install cookie
+```
+
+## API
+
+```js
+var cookie = require('cookie');
+```
+
+### cookie.parse(str, options)
+
+Parse an HTTP `Cookie` header string and returning an object of all cookie name-value pairs.
+The `str` argument is the string representing a `Cookie` header value and `options` is an
+optional object containing additional parsing options.
+
+```js
+var cookies = cookie.parse('foo=bar; equation=E%3Dmc%5E2');
+// { foo: 'bar', equation: 'E=mc^2' }
+```
+
+#### Options
+
+`cookie.parse` accepts these properties in the options object.
+
+##### decode
+
+Specifies a function that will be used to decode a cookie's value. Since the value of a cookie
+has a limited character set (and must be a simple string), this function can be used to decode
+a previously-encoded cookie value into a JavaScript string or other object.
+
+The default function is the global `decodeURIComponent`, which will decode any URL-encoded
+sequences into their byte representations.
+
+**note** if an error is thrown from this function, the original, non-decoded cookie value will
+be returned as the cookie's value.
+
+### cookie.serialize(name, value, options)
+
+Serialize a cookie name-value pair into a `Set-Cookie` header string. The `name` argument is the
+name for the cookie, the `value` argument is the value to set the cookie to, and the `options`
+argument is an optional object containing additional serialization options.
+
+```js
+var setCookie = cookie.serialize('foo', 'bar');
+// foo=bar
+```
+
+#### Options
+
+`cookie.serialize` accepts these properties in the options object.
+
+##### domain
+
+Specifies the value for the [`Domain` `Set-Cookie` attribute][rfc-6265-5.2.3]. By default, no
+domain is set, and most clients will consider the cookie to apply to only the current domain.
+
+##### encode
+
+Specifies a function that will be used to encode a cookie's value. Since value of a cookie
+has a limited character set (and must be a simple string), this function can be used to encode
+a value into a string suited for a cookie's value.
+
+The default function is the global `encodeURIComponent`, which will encode a JavaScript string
+into UTF-8 byte sequences and then URL-encode any that fall outside of the cookie range.
+
+##### expires
+
+Specifies the `Date` object to be the value for the [`Expires` `Set-Cookie` attribute][rfc-6265-5.2.1].
+By default, no expiration is set, and most clients will consider this a "non-persistent cookie" and
+will delete it on a condition like exiting a web browser application.
+
+**note** the [cookie storage model specification][rfc-6265-5.3] states that if both `expires` and
+`maxAge` are set, then `maxAge` takes precedence, but it is possible not all clients by obey this,
+so if both are set, they should point to the same date and time.
+
+##### httpOnly
+
+Specifies the `boolean` value for the [`HttpOnly` `Set-Cookie` attribute][rfc-6265-5.2.6]. When truthy,
+the `HttpOnly` attribute is set, otherwise it is not. By default, the `HttpOnly` attribute is not set.
+
+**note** be careful when setting this to `true`, as compliant clients will not allow client-side
+JavaScript to see the cookie in `document.cookie`.
+
+##### maxAge
+
+Specifies the `number` (in seconds) to be the value for the [`Max-Age` `Set-Cookie` attribute][rfc-6265-5.2.2].
+The given number will be converted to an integer by rounding down. By default, no maximum age is set.
+
+**note** the [cookie storage model specification][rfc-6265-5.3] states that if both `expires` and
+`maxAge` are set, then `maxAge` takes precedence, but it is possible not all clients by obey this,
+so if both are set, they should point to the same date and time.
+
+##### partitioned
+
+Specifies the `boolean` value for the [`Partitioned` `Set-Cookie`](rfc-cutler-httpbis-partitioned-cookies)
+attribute. When truthy, the `Partitioned` attribute is set, otherwise it is not. By default, the
+`Partitioned` attribute is not set.
+
+**note** This is an attribute that has not yet been fully standardized, and may change in the future.
+This also means many clients may ignore this attribute until they understand it.
+
+More information about can be found in [the proposal](https://github.com/privacycg/CHIPS).
+
+##### path
+
+Specifies the value for the [`Path` `Set-Cookie` attribute][rfc-6265-5.2.4]. By default, the path
+is considered the ["default path"][rfc-6265-5.1.4].
+
+##### priority
+
+Specifies the `string` to be the value for the [`Priority` `Set-Cookie` attribute][rfc-west-cookie-priority-00-4.1].
+
+ - `'low'` will set the `Priority` attribute to `Low`.
+ - `'medium'` will set the `Priority` attribute to `Medium`, the default priority when not set.
+ - `'high'` will set the `Priority` attribute to `High`.
+
+More information about the different priority levels can be found in
+[the specification][rfc-west-cookie-priority-00-4.1].
+
+**note** This is an attribute that has not yet been fully standardized, and may change in the future.
+This also means many clients may ignore this attribute until they understand it.
+
+##### sameSite
+
+Specifies the `boolean` or `string` to be the value for the [`SameSite` `Set-Cookie` attribute][rfc-6265bis-09-5.4.7].
+
+ - `true` will set the `SameSite` attribute to `Strict` for strict same site enforcement.
+ - `false` will not set the `SameSite` attribute.
+ - `'lax'` will set the `SameSite` attribute to `Lax` for lax same site enforcement.
+ - `'none'` will set the `SameSite` attribute to `None` for an explicit cross-site cookie.
+ - `'strict'` will set the `SameSite` attribute to `Strict` for strict same site enforcement.
+
+More information about the different enforcement levels can be found in
+[the specification][rfc-6265bis-09-5.4.7].
+
+**note** This is an attribute that has not yet been fully standardized, and may change in the future.
+This also means many clients may ignore this attribute until they understand it.
+
+##### secure
+
+Specifies the `boolean` value for the [`Secure` `Set-Cookie` attribute][rfc-6265-5.2.5]. When truthy,
+the `Secure` attribute is set, otherwise it is not. By default, the `Secure` attribute is not set.
+
+**note** be careful when setting this to `true`, as compliant clients will not send the cookie back to
+the server in the future if the browser does not have an HTTPS connection.
+
+## Example
+
+The following example uses this module in conjunction with the Node.js core HTTP server
+to prompt a user for their name and display it back on future visits.
+
+```js
+var cookie = require('cookie');
+var escapeHtml = require('escape-html');
+var http = require('http');
+var url = require('url');
+
+function onRequest(req, res) {
+ // Parse the query string
+ var query = url.parse(req.url, true, true).query;
+
+ if (query && query.name) {
+ // Set a new cookie with the name
+ res.setHeader('Set-Cookie', cookie.serialize('name', String(query.name), {
+ httpOnly: true,
+ maxAge: 60 * 60 * 24 * 7 // 1 week
+ }));
+
+ // Redirect back after setting cookie
+ res.statusCode = 302;
+ res.setHeader('Location', req.headers.referer || '/');
+ res.end();
+ return;
+ }
+
+ // Parse the cookies on the request
+ var cookies = cookie.parse(req.headers.cookie || '');
+
+ // Get the visitor name set in the cookie
+ var name = cookies.name;
+
+ res.setHeader('Content-Type', 'text/html; charset=UTF-8');
+
+ if (name) {
+ res.write('Welcome back, ' + escapeHtml(name) + ' !
');
+ } else {
+ res.write('Hello, new visitor!
');
+ }
+
+ res.write('');
+}
+
+http.createServer(onRequest).listen(3000);
+```
+
+## Testing
+
+```sh
+$ npm test
+```
+
+## Benchmark
+
+```
+$ npm run bench
+
+> cookie@0.5.0 bench
+> node benchmark/index.js
+
+ node@18.18.2
+ acorn@8.10.0
+ ada@2.6.0
+ ares@1.19.1
+ brotli@1.0.9
+ cldr@43.1
+ icu@73.2
+ llhttp@6.0.11
+ modules@108
+ napi@9
+ nghttp2@1.57.0
+ nghttp3@0.7.0
+ ngtcp2@0.8.1
+ openssl@3.0.10+quic
+ simdutf@3.2.14
+ tz@2023c
+ undici@5.26.3
+ unicode@15.0
+ uv@1.44.2
+ uvwasi@0.0.18
+ v8@10.2.154.26-node.26
+ zlib@1.2.13.1-motley
+
+> node benchmark/parse-top.js
+
+ cookie.parse - top sites
+
+ 14 tests completed.
+
+ parse accounts.google.com x 2,588,913 ops/sec ±0.74% (186 runs sampled)
+ parse apple.com x 2,370,002 ops/sec ±0.69% (186 runs sampled)
+ parse cloudflare.com x 2,213,102 ops/sec ±0.88% (188 runs sampled)
+ parse docs.google.com x 2,194,157 ops/sec ±1.03% (184 runs sampled)
+ parse drive.google.com x 2,265,084 ops/sec ±0.79% (187 runs sampled)
+ parse en.wikipedia.org x 457,099 ops/sec ±0.81% (186 runs sampled)
+ parse linkedin.com x 504,407 ops/sec ±0.89% (186 runs sampled)
+ parse maps.google.com x 1,230,959 ops/sec ±0.98% (186 runs sampled)
+ parse microsoft.com x 926,294 ops/sec ±0.88% (184 runs sampled)
+ parse play.google.com x 2,311,338 ops/sec ±0.83% (185 runs sampled)
+ parse support.google.com x 1,508,850 ops/sec ±0.86% (186 runs sampled)
+ parse www.google.com x 1,022,582 ops/sec ±1.32% (182 runs sampled)
+ parse youtu.be x 332,136 ops/sec ±1.02% (185 runs sampled)
+ parse youtube.com x 323,833 ops/sec ±0.77% (183 runs sampled)
+
+> node benchmark/parse.js
+
+ cookie.parse - generic
+
+ 6 tests completed.
+
+ simple x 3,214,032 ops/sec ±1.61% (183 runs sampled)
+ decode x 587,237 ops/sec ±1.16% (187 runs sampled)
+ unquote x 2,954,618 ops/sec ±1.35% (183 runs sampled)
+ duplicates x 857,008 ops/sec ±0.89% (187 runs sampled)
+ 10 cookies x 292,133 ops/sec ±0.89% (187 runs sampled)
+ 100 cookies x 22,610 ops/sec ±0.68% (187 runs sampled)
+```
+
+## References
+
+- [RFC 6265: HTTP State Management Mechanism][rfc-6265]
+- [Same-site Cookies][rfc-6265bis-09-5.4.7]
+
+[rfc-cutler-httpbis-partitioned-cookies]: https://tools.ietf.org/html/draft-cutler-httpbis-partitioned-cookies/
+[rfc-west-cookie-priority-00-4.1]: https://tools.ietf.org/html/draft-west-cookie-priority-00#section-4.1
+[rfc-6265bis-09-5.4.7]: https://tools.ietf.org/html/draft-ietf-httpbis-rfc6265bis-09#section-5.4.7
+[rfc-6265]: https://tools.ietf.org/html/rfc6265
+[rfc-6265-5.1.4]: https://tools.ietf.org/html/rfc6265#section-5.1.4
+[rfc-6265-5.2.1]: https://tools.ietf.org/html/rfc6265#section-5.2.1
+[rfc-6265-5.2.2]: https://tools.ietf.org/html/rfc6265#section-5.2.2
+[rfc-6265-5.2.3]: https://tools.ietf.org/html/rfc6265#section-5.2.3
+[rfc-6265-5.2.4]: https://tools.ietf.org/html/rfc6265#section-5.2.4
+[rfc-6265-5.2.5]: https://tools.ietf.org/html/rfc6265#section-5.2.5
+[rfc-6265-5.2.6]: https://tools.ietf.org/html/rfc6265#section-5.2.6
+[rfc-6265-5.3]: https://tools.ietf.org/html/rfc6265#section-5.3
+
+## License
+
+[MIT](LICENSE)
+
+[ci-image]: https://badgen.net/github/checks/jshttp/cookie/master?label=ci
+[ci-url]: https://github.com/jshttp/cookie/actions/workflows/ci.yml
+[coveralls-image]: https://badgen.net/coveralls/c/github/jshttp/cookie/master
+[coveralls-url]: https://coveralls.io/r/jshttp/cookie?branch=master
+[node-image]: https://badgen.net/npm/node/cookie
+[node-url]: https://nodejs.org/en/download
+[npm-downloads-image]: https://badgen.net/npm/dm/cookie
+[npm-url]: https://npmjs.org/package/cookie
+[npm-version-image]: https://badgen.net/npm/v/cookie
diff --git a/node_modules/express-session/node_modules/cookie/SECURITY.md b/node_modules/express-session/node_modules/cookie/SECURITY.md
new file mode 100644
index 0000000..fd4a6c5
--- /dev/null
+++ b/node_modules/express-session/node_modules/cookie/SECURITY.md
@@ -0,0 +1,25 @@
+# Security Policies and Procedures
+
+## Reporting a Bug
+
+The `cookie` team and community take all security bugs seriously. Thank
+you for improving the security of the project. We appreciate your efforts and
+responsible disclosure and will make every effort to acknowledge your
+contributions.
+
+Report security bugs by emailing the current owner(s) of `cookie`. This
+information can be found in the npm registry using the command
+`npm owner ls cookie`.
+If unsure or unable to get the information from the above, open an issue
+in the [project issue tracker](https://github.com/jshttp/cookie/issues)
+asking for the current contact information.
+
+To ensure the timely response to your report, please ensure that the entirety
+of the report is contained within the email body and not solely behind a web
+link or an attachment.
+
+At least one owner will acknowledge your email within 48 hours, and will send a
+more detailed response within 48 hours indicating the next steps in handling
+your report. After the initial reply to your report, the owners will
+endeavor to keep you informed of the progress towards a fix and full
+announcement, and may ask for additional information or guidance.
diff --git a/node_modules/express-session/node_modules/cookie/index.js b/node_modules/express-session/node_modules/cookie/index.js
new file mode 100644
index 0000000..acd5acd
--- /dev/null
+++ b/node_modules/express-session/node_modules/cookie/index.js
@@ -0,0 +1,335 @@
+/*!
+ * cookie
+ * Copyright(c) 2012-2014 Roman Shtylman
+ * Copyright(c) 2015 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+'use strict';
+
+/**
+ * Module exports.
+ * @public
+ */
+
+exports.parse = parse;
+exports.serialize = serialize;
+
+/**
+ * Module variables.
+ * @private
+ */
+
+var __toString = Object.prototype.toString
+var __hasOwnProperty = Object.prototype.hasOwnProperty
+
+/**
+ * RegExp to match cookie-name in RFC 6265 sec 4.1.1
+ * This refers out to the obsoleted definition of token in RFC 2616 sec 2.2
+ * which has been replaced by the token definition in RFC 7230 appendix B.
+ *
+ * cookie-name = token
+ * token = 1*tchar
+ * tchar = "!" / "#" / "$" / "%" / "&" / "'" /
+ * "*" / "+" / "-" / "." / "^" / "_" /
+ * "`" / "|" / "~" / DIGIT / ALPHA
+ */
+
+var cookieNameRegExp = /^[!#$%&'*+\-.^_`|~0-9A-Za-z]+$/;
+
+/**
+ * RegExp to match cookie-value in RFC 6265 sec 4.1.1
+ *
+ * cookie-value = *cookie-octet / ( DQUOTE *cookie-octet DQUOTE )
+ * cookie-octet = %x21 / %x23-2B / %x2D-3A / %x3C-5B / %x5D-7E
+ * ; US-ASCII characters excluding CTLs,
+ * ; whitespace DQUOTE, comma, semicolon,
+ * ; and backslash
+ */
+
+var cookieValueRegExp = /^("?)[\u0021\u0023-\u002B\u002D-\u003A\u003C-\u005B\u005D-\u007E]*\1$/;
+
+/**
+ * RegExp to match domain-value in RFC 6265 sec 4.1.1
+ *
+ * domain-value =
+ * ; defined in [RFC1034], Section 3.5, as
+ * ; enhanced by [RFC1123], Section 2.1
+ * = | "."
+ * = [ [ ] ]
+ * Labels must be 63 characters or less.
+ * 'let-dig' not 'letter' in the first char, per RFC1123
+ * = |
+ * = | "-"
+ * = |
+ * = any one of the 52 alphabetic characters A through Z in
+ * upper case and a through z in lower case
+ * = any one of the ten digits 0 through 9
+ *
+ * Keep support for leading dot: https://github.com/jshttp/cookie/issues/173
+ *
+ * > (Note that a leading %x2E ("."), if present, is ignored even though that
+ * character is not permitted, but a trailing %x2E ("."), if present, will
+ * cause the user agent to ignore the attribute.)
+ */
+
+var domainValueRegExp = /^([.]?[a-z0-9]([a-z0-9-]{0,61}[a-z0-9])?)([.][a-z0-9]([a-z0-9-]{0,61}[a-z0-9])?)*$/i;
+
+/**
+ * RegExp to match path-value in RFC 6265 sec 4.1.1
+ *
+ * path-value =
+ * CHAR = %x01-7F
+ * ; defined in RFC 5234 appendix B.1
+ */
+
+var pathValueRegExp = /^[\u0020-\u003A\u003D-\u007E]*$/;
+
+/**
+ * Parse a cookie header.
+ *
+ * Parse the given cookie header string into an object
+ * The object has the various cookies as keys(names) => values
+ *
+ * @param {string} str
+ * @param {object} [opt]
+ * @return {object}
+ * @public
+ */
+
+function parse(str, opt) {
+ if (typeof str !== 'string') {
+ throw new TypeError('argument str must be a string');
+ }
+
+ var obj = {};
+ var len = str.length;
+ // RFC 6265 sec 4.1.1, RFC 2616 2.2 defines a cookie name consists of one char minimum, plus '='.
+ if (len < 2) return obj;
+
+ var dec = (opt && opt.decode) || decode;
+ var index = 0;
+ var eqIdx = 0;
+ var endIdx = 0;
+
+ do {
+ eqIdx = str.indexOf('=', index);
+ if (eqIdx === -1) break; // No more cookie pairs.
+
+ endIdx = str.indexOf(';', index);
+
+ if (endIdx === -1) {
+ endIdx = len;
+ } else if (eqIdx > endIdx) {
+ // backtrack on prior semicolon
+ index = str.lastIndexOf(';', eqIdx - 1) + 1;
+ continue;
+ }
+
+ var keyStartIdx = startIndex(str, index, eqIdx);
+ var keyEndIdx = endIndex(str, eqIdx, keyStartIdx);
+ var key = str.slice(keyStartIdx, keyEndIdx);
+
+ // only assign once
+ if (!__hasOwnProperty.call(obj, key)) {
+ var valStartIdx = startIndex(str, eqIdx + 1, endIdx);
+ var valEndIdx = endIndex(str, endIdx, valStartIdx);
+
+ if (str.charCodeAt(valStartIdx) === 0x22 /* " */ && str.charCodeAt(valEndIdx - 1) === 0x22 /* " */) {
+ valStartIdx++;
+ valEndIdx--;
+ }
+
+ var val = str.slice(valStartIdx, valEndIdx);
+ obj[key] = tryDecode(val, dec);
+ }
+
+ index = endIdx + 1
+ } while (index < len);
+
+ return obj;
+}
+
+function startIndex(str, index, max) {
+ do {
+ var code = str.charCodeAt(index);
+ if (code !== 0x20 /* */ && code !== 0x09 /* \t */) return index;
+ } while (++index < max);
+ return max;
+}
+
+function endIndex(str, index, min) {
+ while (index > min) {
+ var code = str.charCodeAt(--index);
+ if (code !== 0x20 /* */ && code !== 0x09 /* \t */) return index + 1;
+ }
+ return min;
+}
+
+/**
+ * Serialize data into a cookie header.
+ *
+ * Serialize a name value pair into a cookie string suitable for
+ * http headers. An optional options object specifies cookie parameters.
+ *
+ * serialize('foo', 'bar', { httpOnly: true })
+ * => "foo=bar; httpOnly"
+ *
+ * @param {string} name
+ * @param {string} val
+ * @param {object} [opt]
+ * @return {string}
+ * @public
+ */
+
+function serialize(name, val, opt) {
+ var enc = (opt && opt.encode) || encodeURIComponent;
+
+ if (typeof enc !== 'function') {
+ throw new TypeError('option encode is invalid');
+ }
+
+ if (!cookieNameRegExp.test(name)) {
+ throw new TypeError('argument name is invalid');
+ }
+
+ var value = enc(val);
+
+ if (!cookieValueRegExp.test(value)) {
+ throw new TypeError('argument val is invalid');
+ }
+
+ var str = name + '=' + value;
+ if (!opt) return str;
+
+ if (null != opt.maxAge) {
+ var maxAge = Math.floor(opt.maxAge);
+
+ if (!isFinite(maxAge)) {
+ throw new TypeError('option maxAge is invalid')
+ }
+
+ str += '; Max-Age=' + maxAge;
+ }
+
+ if (opt.domain) {
+ if (!domainValueRegExp.test(opt.domain)) {
+ throw new TypeError('option domain is invalid');
+ }
+
+ str += '; Domain=' + opt.domain;
+ }
+
+ if (opt.path) {
+ if (!pathValueRegExp.test(opt.path)) {
+ throw new TypeError('option path is invalid');
+ }
+
+ str += '; Path=' + opt.path;
+ }
+
+ if (opt.expires) {
+ var expires = opt.expires
+
+ if (!isDate(expires) || isNaN(expires.valueOf())) {
+ throw new TypeError('option expires is invalid');
+ }
+
+ str += '; Expires=' + expires.toUTCString()
+ }
+
+ if (opt.httpOnly) {
+ str += '; HttpOnly';
+ }
+
+ if (opt.secure) {
+ str += '; Secure';
+ }
+
+ if (opt.partitioned) {
+ str += '; Partitioned'
+ }
+
+ if (opt.priority) {
+ var priority = typeof opt.priority === 'string'
+ ? opt.priority.toLowerCase() : opt.priority;
+
+ switch (priority) {
+ case 'low':
+ str += '; Priority=Low'
+ break
+ case 'medium':
+ str += '; Priority=Medium'
+ break
+ case 'high':
+ str += '; Priority=High'
+ break
+ default:
+ throw new TypeError('option priority is invalid')
+ }
+ }
+
+ if (opt.sameSite) {
+ var sameSite = typeof opt.sameSite === 'string'
+ ? opt.sameSite.toLowerCase() : opt.sameSite;
+
+ switch (sameSite) {
+ case true:
+ str += '; SameSite=Strict';
+ break;
+ case 'lax':
+ str += '; SameSite=Lax';
+ break;
+ case 'strict':
+ str += '; SameSite=Strict';
+ break;
+ case 'none':
+ str += '; SameSite=None';
+ break;
+ default:
+ throw new TypeError('option sameSite is invalid');
+ }
+ }
+
+ return str;
+}
+
+/**
+ * URL-decode string value. Optimized to skip native call when no %.
+ *
+ * @param {string} str
+ * @returns {string}
+ */
+
+function decode (str) {
+ return str.indexOf('%') !== -1
+ ? decodeURIComponent(str)
+ : str
+}
+
+/**
+ * Determine if value is a Date.
+ *
+ * @param {*} val
+ * @private
+ */
+
+function isDate (val) {
+ return __toString.call(val) === '[object Date]';
+}
+
+/**
+ * Try decoding a string using a decoding function.
+ *
+ * @param {string} str
+ * @param {function} decode
+ * @private
+ */
+
+function tryDecode(str, decode) {
+ try {
+ return decode(str);
+ } catch (e) {
+ return str;
+ }
+}
diff --git a/node_modules/express-session/node_modules/cookie/package.json b/node_modules/express-session/node_modules/cookie/package.json
new file mode 100644
index 0000000..22e3f92
--- /dev/null
+++ b/node_modules/express-session/node_modules/cookie/package.json
@@ -0,0 +1,44 @@
+{
+ "name": "cookie",
+ "description": "HTTP server cookie parsing and serialization",
+ "version": "0.7.2",
+ "author": "Roman Shtylman ",
+ "contributors": [
+ "Douglas Christopher Wilson "
+ ],
+ "license": "MIT",
+ "keywords": [
+ "cookie",
+ "cookies"
+ ],
+ "repository": "jshttp/cookie",
+ "devDependencies": {
+ "beautify-benchmark": "0.2.4",
+ "benchmark": "2.1.4",
+ "eslint": "8.53.0",
+ "eslint-plugin-markdown": "3.0.1",
+ "mocha": "10.2.0",
+ "nyc": "15.1.0",
+ "safe-buffer": "5.2.1",
+ "top-sites": "1.1.194"
+ },
+ "files": [
+ "HISTORY.md",
+ "LICENSE",
+ "README.md",
+ "SECURITY.md",
+ "index.js"
+ ],
+ "main": "index.js",
+ "engines": {
+ "node": ">= 0.6"
+ },
+ "scripts": {
+ "bench": "node benchmark/index.js",
+ "lint": "eslint .",
+ "test": "mocha --reporter spec --bail --check-leaks test/",
+ "test-ci": "nyc --reporter=lcov --reporter=text npm test",
+ "test-cov": "nyc --reporter=html --reporter=text npm test",
+ "update-bench": "node scripts/update-benchmark.js"
+ }
+}
diff --git a/node_modules/express-session/package.json b/node_modules/express-session/package.json
new file mode 100644
index 0000000..e332243
--- /dev/null
+++ b/node_modules/express-session/package.json
@@ -0,0 +1,47 @@
+{
+ "name": "express-session",
+ "version": "1.18.1",
+ "description": "Simple session middleware for Express",
+ "author": "TJ Holowaychuk (http://tjholowaychuk.com)",
+ "contributors": [
+ "Douglas Christopher Wilson ",
+ "Joe Wagner "
+ ],
+ "repository": "expressjs/session",
+ "license": "MIT",
+ "dependencies": {
+ "cookie": "0.7.2",
+ "cookie-signature": "1.0.7",
+ "debug": "2.6.9",
+ "depd": "~2.0.0",
+ "on-headers": "~1.0.2",
+ "parseurl": "~1.3.3",
+ "safe-buffer": "5.2.1",
+ "uid-safe": "~2.1.5"
+ },
+ "devDependencies": {
+ "after": "0.8.2",
+ "cookie-parser": "1.4.6",
+ "eslint": "8.56.0",
+ "eslint-plugin-markdown": "3.0.1",
+ "express": "4.17.3",
+ "mocha": "10.2.0",
+ "nyc": "15.1.0",
+ "supertest": "6.3.4"
+ },
+ "files": [
+ "session/",
+ "HISTORY.md",
+ "index.js"
+ ],
+ "engines": {
+ "node": ">= 0.8.0"
+ },
+ "scripts": {
+ "lint": "eslint . && node ./scripts/lint-readme.js",
+ "test": "mocha --require test/support/env --check-leaks --bail --no-exit --reporter spec test/",
+ "test-ci": "nyc --reporter=lcov --reporter=text npm test",
+ "test-cov": "nyc npm test",
+ "version": "node scripts/version-history.js && git add HISTORY.md"
+ }
+}
diff --git a/node_modules/express-session/session/cookie.js b/node_modules/express-session/session/cookie.js
new file mode 100644
index 0000000..8bb5907
--- /dev/null
+++ b/node_modules/express-session/session/cookie.js
@@ -0,0 +1,152 @@
+/*!
+ * Connect - session - Cookie
+ * Copyright(c) 2010 Sencha Inc.
+ * Copyright(c) 2011 TJ Holowaychuk
+ * MIT Licensed
+ */
+
+'use strict';
+
+/**
+ * Module dependencies.
+ */
+
+var cookie = require('cookie')
+var deprecate = require('depd')('express-session')
+
+/**
+ * Initialize a new `Cookie` with the given `options`.
+ *
+ * @param {IncomingMessage} req
+ * @param {Object} options
+ * @api private
+ */
+
+var Cookie = module.exports = function Cookie(options) {
+ this.path = '/';
+ this.maxAge = null;
+ this.httpOnly = true;
+
+ if (options) {
+ if (typeof options !== 'object') {
+ throw new TypeError('argument options must be a object')
+ }
+
+ for (var key in options) {
+ if (key !== 'data') {
+ this[key] = options[key]
+ }
+ }
+ }
+
+ if (this.originalMaxAge === undefined || this.originalMaxAge === null) {
+ this.originalMaxAge = this.maxAge
+ }
+};
+
+/*!
+ * Prototype.
+ */
+
+Cookie.prototype = {
+
+ /**
+ * Set expires `date`.
+ *
+ * @param {Date} date
+ * @api public
+ */
+
+ set expires(date) {
+ this._expires = date;
+ this.originalMaxAge = this.maxAge;
+ },
+
+ /**
+ * Get expires `date`.
+ *
+ * @return {Date}
+ * @api public
+ */
+
+ get expires() {
+ return this._expires;
+ },
+
+ /**
+ * Set expires via max-age in `ms`.
+ *
+ * @param {Number} ms
+ * @api public
+ */
+
+ set maxAge(ms) {
+ if (ms && typeof ms !== 'number' && !(ms instanceof Date)) {
+ throw new TypeError('maxAge must be a number or Date')
+ }
+
+ if (ms instanceof Date) {
+ deprecate('maxAge as Date; pass number of milliseconds instead')
+ }
+
+ this.expires = typeof ms === 'number'
+ ? new Date(Date.now() + ms)
+ : ms;
+ },
+
+ /**
+ * Get expires max-age in `ms`.
+ *
+ * @return {Number}
+ * @api public
+ */
+
+ get maxAge() {
+ return this.expires instanceof Date
+ ? this.expires.valueOf() - Date.now()
+ : this.expires;
+ },
+
+ /**
+ * Return cookie data object.
+ *
+ * @return {Object}
+ * @api private
+ */
+
+ get data() {
+ return {
+ originalMaxAge: this.originalMaxAge,
+ partitioned: this.partitioned,
+ priority: this.priority
+ , expires: this._expires
+ , secure: this.secure
+ , httpOnly: this.httpOnly
+ , domain: this.domain
+ , path: this.path
+ , sameSite: this.sameSite
+ }
+ },
+
+ /**
+ * Return a serialized cookie string.
+ *
+ * @return {String}
+ * @api public
+ */
+
+ serialize: function(name, val){
+ return cookie.serialize(name, val, this.data);
+ },
+
+ /**
+ * Return JSON representation of this cookie.
+ *
+ * @return {Object}
+ * @api private
+ */
+
+ toJSON: function(){
+ return this.data;
+ }
+};
diff --git a/node_modules/express-session/session/memory.js b/node_modules/express-session/session/memory.js
new file mode 100644
index 0000000..11ed686
--- /dev/null
+++ b/node_modules/express-session/session/memory.js
@@ -0,0 +1,187 @@
+/*!
+ * express-session
+ * Copyright(c) 2010 Sencha Inc.
+ * Copyright(c) 2011 TJ Holowaychuk
+ * Copyright(c) 2015 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+'use strict';
+
+/**
+ * Module dependencies.
+ * @private
+ */
+
+var Store = require('./store')
+var util = require('util')
+
+/**
+ * Shim setImmediate for node.js < 0.10
+ * @private
+ */
+
+/* istanbul ignore next */
+var defer = typeof setImmediate === 'function'
+ ? setImmediate
+ : function(fn){ process.nextTick(fn.bind.apply(fn, arguments)) }
+
+/**
+ * Module exports.
+ */
+
+module.exports = MemoryStore
+
+/**
+ * A session store in memory.
+ * @public
+ */
+
+function MemoryStore() {
+ Store.call(this)
+ this.sessions = Object.create(null)
+}
+
+/**
+ * Inherit from Store.
+ */
+
+util.inherits(MemoryStore, Store)
+
+/**
+ * Get all active sessions.
+ *
+ * @param {function} callback
+ * @public
+ */
+
+MemoryStore.prototype.all = function all(callback) {
+ var sessionIds = Object.keys(this.sessions)
+ var sessions = Object.create(null)
+
+ for (var i = 0; i < sessionIds.length; i++) {
+ var sessionId = sessionIds[i]
+ var session = getSession.call(this, sessionId)
+
+ if (session) {
+ sessions[sessionId] = session;
+ }
+ }
+
+ callback && defer(callback, null, sessions)
+}
+
+/**
+ * Clear all sessions.
+ *
+ * @param {function} callback
+ * @public
+ */
+
+MemoryStore.prototype.clear = function clear(callback) {
+ this.sessions = Object.create(null)
+ callback && defer(callback)
+}
+
+/**
+ * Destroy the session associated with the given session ID.
+ *
+ * @param {string} sessionId
+ * @public
+ */
+
+MemoryStore.prototype.destroy = function destroy(sessionId, callback) {
+ delete this.sessions[sessionId]
+ callback && defer(callback)
+}
+
+/**
+ * Fetch session by the given session ID.
+ *
+ * @param {string} sessionId
+ * @param {function} callback
+ * @public
+ */
+
+MemoryStore.prototype.get = function get(sessionId, callback) {
+ defer(callback, null, getSession.call(this, sessionId))
+}
+
+/**
+ * Commit the given session associated with the given sessionId to the store.
+ *
+ * @param {string} sessionId
+ * @param {object} session
+ * @param {function} callback
+ * @public
+ */
+
+MemoryStore.prototype.set = function set(sessionId, session, callback) {
+ this.sessions[sessionId] = JSON.stringify(session)
+ callback && defer(callback)
+}
+
+/**
+ * Get number of active sessions.
+ *
+ * @param {function} callback
+ * @public
+ */
+
+MemoryStore.prototype.length = function length(callback) {
+ this.all(function (err, sessions) {
+ if (err) return callback(err)
+ callback(null, Object.keys(sessions).length)
+ })
+}
+
+/**
+ * Touch the given session object associated with the given session ID.
+ *
+ * @param {string} sessionId
+ * @param {object} session
+ * @param {function} callback
+ * @public
+ */
+
+MemoryStore.prototype.touch = function touch(sessionId, session, callback) {
+ var currentSession = getSession.call(this, sessionId)
+
+ if (currentSession) {
+ // update expiration
+ currentSession.cookie = session.cookie
+ this.sessions[sessionId] = JSON.stringify(currentSession)
+ }
+
+ callback && defer(callback)
+}
+
+/**
+ * Get session from the store.
+ * @private
+ */
+
+function getSession(sessionId) {
+ var sess = this.sessions[sessionId]
+
+ if (!sess) {
+ return
+ }
+
+ // parse
+ sess = JSON.parse(sess)
+
+ if (sess.cookie) {
+ var expires = typeof sess.cookie.expires === 'string'
+ ? new Date(sess.cookie.expires)
+ : sess.cookie.expires
+
+ // destroy expired session
+ if (expires && expires <= Date.now()) {
+ delete this.sessions[sessionId]
+ return
+ }
+ }
+
+ return sess
+}
diff --git a/node_modules/express-session/session/session.js b/node_modules/express-session/session/session.js
new file mode 100644
index 0000000..fee7608
--- /dev/null
+++ b/node_modules/express-session/session/session.js
@@ -0,0 +1,143 @@
+/*!
+ * Connect - session - Session
+ * Copyright(c) 2010 Sencha Inc.
+ * Copyright(c) 2011 TJ Holowaychuk
+ * MIT Licensed
+ */
+
+'use strict';
+
+/**
+ * Expose Session.
+ */
+
+module.exports = Session;
+
+/**
+ * Create a new `Session` with the given request and `data`.
+ *
+ * @param {IncomingRequest} req
+ * @param {Object} data
+ * @api private
+ */
+
+function Session(req, data) {
+ Object.defineProperty(this, 'req', { value: req });
+ Object.defineProperty(this, 'id', { value: req.sessionID });
+
+ if (typeof data === 'object' && data !== null) {
+ // merge data into this, ignoring prototype properties
+ for (var prop in data) {
+ if (!(prop in this)) {
+ this[prop] = data[prop]
+ }
+ }
+ }
+}
+
+/**
+ * Update reset `.cookie.maxAge` to prevent
+ * the cookie from expiring when the
+ * session is still active.
+ *
+ * @return {Session} for chaining
+ * @api public
+ */
+
+defineMethod(Session.prototype, 'touch', function touch() {
+ return this.resetMaxAge();
+});
+
+/**
+ * Reset `.maxAge` to `.originalMaxAge`.
+ *
+ * @return {Session} for chaining
+ * @api public
+ */
+
+defineMethod(Session.prototype, 'resetMaxAge', function resetMaxAge() {
+ this.cookie.maxAge = this.cookie.originalMaxAge;
+ return this;
+});
+
+/**
+ * Save the session data with optional callback `fn(err)`.
+ *
+ * @param {Function} fn
+ * @return {Session} for chaining
+ * @api public
+ */
+
+defineMethod(Session.prototype, 'save', function save(fn) {
+ this.req.sessionStore.set(this.id, this, fn || function(){});
+ return this;
+});
+
+/**
+ * Re-loads the session data _without_ altering
+ * the maxAge properties. Invokes the callback `fn(err)`,
+ * after which time if no exception has occurred the
+ * `req.session` property will be a new `Session` object,
+ * although representing the same session.
+ *
+ * @param {Function} fn
+ * @return {Session} for chaining
+ * @api public
+ */
+
+defineMethod(Session.prototype, 'reload', function reload(fn) {
+ var req = this.req
+ var store = this.req.sessionStore
+
+ store.get(this.id, function(err, sess){
+ if (err) return fn(err);
+ if (!sess) return fn(new Error('failed to load session'));
+ store.createSession(req, sess);
+ fn();
+ });
+ return this;
+});
+
+/**
+ * Destroy `this` session.
+ *
+ * @param {Function} fn
+ * @return {Session} for chaining
+ * @api public
+ */
+
+defineMethod(Session.prototype, 'destroy', function destroy(fn) {
+ delete this.req.session;
+ this.req.sessionStore.destroy(this.id, fn);
+ return this;
+});
+
+/**
+ * Regenerate this request's session.
+ *
+ * @param {Function} fn
+ * @return {Session} for chaining
+ * @api public
+ */
+
+defineMethod(Session.prototype, 'regenerate', function regenerate(fn) {
+ this.req.sessionStore.regenerate(this.req, fn);
+ return this;
+});
+
+/**
+ * Helper function for creating a method on a prototype.
+ *
+ * @param {Object} obj
+ * @param {String} name
+ * @param {Function} fn
+ * @private
+ */
+function defineMethod(obj, name, fn) {
+ Object.defineProperty(obj, name, {
+ configurable: true,
+ enumerable: false,
+ value: fn,
+ writable: true
+ });
+};
diff --git a/node_modules/express-session/session/store.js b/node_modules/express-session/session/store.js
new file mode 100644
index 0000000..3793877
--- /dev/null
+++ b/node_modules/express-session/session/store.js
@@ -0,0 +1,102 @@
+/*!
+ * Connect - session - Store
+ * Copyright(c) 2010 Sencha Inc.
+ * Copyright(c) 2011 TJ Holowaychuk
+ * MIT Licensed
+ */
+
+'use strict';
+
+/**
+ * Module dependencies.
+ * @private
+ */
+
+var Cookie = require('./cookie')
+var EventEmitter = require('events').EventEmitter
+var Session = require('./session')
+var util = require('util')
+
+/**
+ * Module exports.
+ * @public
+ */
+
+module.exports = Store
+
+/**
+ * Abstract base class for session stores.
+ * @public
+ */
+
+function Store () {
+ EventEmitter.call(this)
+}
+
+/**
+ * Inherit from EventEmitter.
+ */
+
+util.inherits(Store, EventEmitter)
+
+/**
+ * Re-generate the given requests's session.
+ *
+ * @param {IncomingRequest} req
+ * @return {Function} fn
+ * @api public
+ */
+
+Store.prototype.regenerate = function(req, fn){
+ var self = this;
+ this.destroy(req.sessionID, function(err){
+ self.generate(req);
+ fn(err);
+ });
+};
+
+/**
+ * Load a `Session` instance via the given `sid`
+ * and invoke the callback `fn(err, sess)`.
+ *
+ * @param {String} sid
+ * @param {Function} fn
+ * @api public
+ */
+
+Store.prototype.load = function(sid, fn){
+ var self = this;
+ this.get(sid, function(err, sess){
+ if (err) return fn(err);
+ if (!sess) return fn();
+ var req = { sessionID: sid, sessionStore: self };
+ fn(null, self.createSession(req, sess))
+ });
+};
+
+/**
+ * Create session from JSON `sess` data.
+ *
+ * @param {IncomingRequest} req
+ * @param {Object} sess
+ * @return {Session}
+ * @api private
+ */
+
+Store.prototype.createSession = function(req, sess){
+ var expires = sess.cookie.expires
+ var originalMaxAge = sess.cookie.originalMaxAge
+
+ sess.cookie = new Cookie(sess.cookie);
+
+ if (typeof expires === 'string') {
+ // convert expires to a Date object
+ sess.cookie.expires = new Date(expires)
+ }
+
+ // keep originalMaxAge intact
+ sess.cookie.originalMaxAge = originalMaxAge
+
+ req.session = new Session(req, sess);
+ return req.session;
+};
diff --git a/node_modules/express/History.md b/node_modules/express/History.md
new file mode 100644
index 0000000..924f105
--- /dev/null
+++ b/node_modules/express/History.md
@@ -0,0 +1,3647 @@
+4.21.1 / 2024-10-08
+==========
+
+* Backported a fix for [CVE-2024-47764](https://nvd.nist.gov/vuln/detail/CVE-2024-47764)
+
+4.21.0 / 2024-09-11
+==========
+
+ * Deprecate `res.location("back")` and `res.redirect("back")` magic string
+ * deps: serve-static@1.16.2
+ * includes send@0.19.0
+ * deps: finalhandler@1.3.1
+ * deps: qs@6.13.0
+
+4.20.0 / 2024-09-10
+==========
+ * deps: serve-static@0.16.0
+ * Remove link renderization in html while redirecting
+ * deps: send@0.19.0
+ * Remove link renderization in html while redirecting
+ * deps: body-parser@0.6.0
+ * add `depth` option to customize the depth level in the parser
+ * IMPORTANT: The default `depth` level for parsing URL-encoded data is now `32` (previously was `Infinity`)
+ * Remove link renderization in html while using `res.redirect`
+ * deps: path-to-regexp@0.1.10
+ - Adds support for named matching groups in the routes using a regex
+ - Adds backtracking protection to parameters without regexes defined
+ * deps: encodeurl@~2.0.0
+ - Removes encoding of `\`, `|`, and `^` to align better with URL spec
+ * Deprecate passing `options.maxAge` and `options.expires` to `res.clearCookie`
+ - Will be ignored in v5, clearCookie will set a cookie with an expires in the past to instruct clients to delete the cookie
+
+4.19.2 / 2024-03-25
+==========
+
+ * Improved fix for open redirect allow list bypass
+
+4.19.1 / 2024-03-20
+==========
+
+ * Allow passing non-strings to res.location with new encoding handling checks
+
+4.19.0 / 2024-03-20
+==========
+
+ * Prevent open redirect allow list bypass due to encodeurl
+ * deps: cookie@0.6.0
+
+4.18.3 / 2024-02-29
+==========
+
+ * Fix routing requests without method
+ * deps: body-parser@1.20.2
+ - Fix strict json error message on Node.js 19+
+ - deps: content-type@~1.0.5
+ - deps: raw-body@2.5.2
+ * deps: cookie@0.6.0
+ - Add `partitioned` option
+
+4.18.2 / 2022-10-08
+===================
+
+ * Fix regression routing a large stack in a single route
+ * deps: body-parser@1.20.1
+ - deps: qs@6.11.0
+ - perf: remove unnecessary object clone
+ * deps: qs@6.11.0
+
+4.18.1 / 2022-04-29
+===================
+
+ * Fix hanging on large stack of sync routes
+
+4.18.0 / 2022-04-25
+===================
+
+ * Add "root" option to `res.download`
+ * Allow `options` without `filename` in `res.download`
+ * Deprecate string and non-integer arguments to `res.status`
+ * Fix behavior of `null`/`undefined` as `maxAge` in `res.cookie`
+ * Fix handling very large stacks of sync middleware
+ * Ignore `Object.prototype` values in settings through `app.set`/`app.get`
+ * Invoke `default` with same arguments as types in `res.format`
+ * Support proper 205 responses using `res.send`
+ * Use `http-errors` for `res.format` error
+ * deps: body-parser@1.20.0
+ - Fix error message for json parse whitespace in `strict`
+ - Fix internal error when inflated body exceeds limit
+ - Prevent loss of async hooks context
+ - Prevent hanging when request already read
+ - deps: depd@2.0.0
+ - deps: http-errors@2.0.0
+ - deps: on-finished@2.4.1
+ - deps: qs@6.10.3
+ - deps: raw-body@2.5.1
+ * deps: cookie@0.5.0
+ - Add `priority` option
+ - Fix `expires` option to reject invalid dates
+ * deps: depd@2.0.0
+ - Replace internal `eval` usage with `Function` constructor
+ - Use instance methods on `process` to check for listeners
+ * deps: finalhandler@1.2.0
+ - Remove set content headers that break response
+ - deps: on-finished@2.4.1
+ - deps: statuses@2.0.1
+ * deps: on-finished@2.4.1
+ - Prevent loss of async hooks context
+ * deps: qs@6.10.3
+ * deps: send@0.18.0
+ - Fix emitted 416 error missing headers property
+ - Limit the headers removed for 304 response
+ - deps: depd@2.0.0
+ - deps: destroy@1.2.0
+ - deps: http-errors@2.0.0
+ - deps: on-finished@2.4.1
+ - deps: statuses@2.0.1
+ * deps: serve-static@1.15.0
+ - deps: send@0.18.0
+ * deps: statuses@2.0.1
+ - Remove code 306
+ - Rename `425 Unordered Collection` to standard `425 Too Early`
+
+4.17.3 / 2022-02-16
+===================
+
+ * deps: accepts@~1.3.8
+ - deps: mime-types@~2.1.34
+ - deps: negotiator@0.6.3
+ * deps: body-parser@1.19.2
+ - deps: bytes@3.1.2
+ - deps: qs@6.9.7
+ - deps: raw-body@2.4.3
+ * deps: cookie@0.4.2
+ * deps: qs@6.9.7
+ * Fix handling of `__proto__` keys
+ * pref: remove unnecessary regexp for trust proxy
+
+4.17.2 / 2021-12-16
+===================
+
+ * Fix handling of `undefined` in `res.jsonp`
+ * Fix handling of `undefined` when `"json escape"` is enabled
+ * Fix incorrect middleware execution with unanchored `RegExp`s
+ * Fix `res.jsonp(obj, status)` deprecation message
+ * Fix typo in `res.is` JSDoc
+ * deps: body-parser@1.19.1
+ - deps: bytes@3.1.1
+ - deps: http-errors@1.8.1
+ - deps: qs@6.9.6
+ - deps: raw-body@2.4.2
+ - deps: safe-buffer@5.2.1
+ - deps: type-is@~1.6.18
+ * deps: content-disposition@0.5.4
+ - deps: safe-buffer@5.2.1
+ * deps: cookie@0.4.1
+ - Fix `maxAge` option to reject invalid values
+ * deps: proxy-addr@~2.0.7
+ - Use `req.socket` over deprecated `req.connection`
+ - deps: forwarded@0.2.0
+ - deps: ipaddr.js@1.9.1
+ * deps: qs@6.9.6
+ * deps: safe-buffer@5.2.1
+ * deps: send@0.17.2
+ - deps: http-errors@1.8.1
+ - deps: ms@2.1.3
+ - pref: ignore empty http tokens
+ * deps: serve-static@1.14.2
+ - deps: send@0.17.2
+ * deps: setprototypeof@1.2.0
+
+4.17.1 / 2019-05-25
+===================
+
+ * Revert "Improve error message for `null`/`undefined` to `res.status`"
+
+4.17.0 / 2019-05-16
+===================
+
+ * Add `express.raw` to parse bodies into `Buffer`
+ * Add `express.text` to parse bodies into string
+ * Improve error message for non-strings to `res.sendFile`
+ * Improve error message for `null`/`undefined` to `res.status`
+ * Support multiple hosts in `X-Forwarded-Host`
+ * deps: accepts@~1.3.7
+ * deps: body-parser@1.19.0
+ - Add encoding MIK
+ - Add petabyte (`pb`) support
+ - Fix parsing array brackets after index
+ - deps: bytes@3.1.0
+ - deps: http-errors@1.7.2
+ - deps: iconv-lite@0.4.24
+ - deps: qs@6.7.0
+ - deps: raw-body@2.4.0
+ - deps: type-is@~1.6.17
+ * deps: content-disposition@0.5.3
+ * deps: cookie@0.4.0
+ - Add `SameSite=None` support
+ * deps: finalhandler@~1.1.2
+ - Set stricter `Content-Security-Policy` header
+ - deps: parseurl@~1.3.3
+ - deps: statuses@~1.5.0
+ * deps: parseurl@~1.3.3
+ * deps: proxy-addr@~2.0.5
+ - deps: ipaddr.js@1.9.0
+ * deps: qs@6.7.0
+ - Fix parsing array brackets after index
+ * deps: range-parser@~1.2.1
+ * deps: send@0.17.1
+ - Set stricter CSP header in redirect & error responses
+ - deps: http-errors@~1.7.2
+ - deps: mime@1.6.0
+ - deps: ms@2.1.1
+ - deps: range-parser@~1.2.1
+ - deps: statuses@~1.5.0
+ - perf: remove redundant `path.normalize` call
+ * deps: serve-static@1.14.1
+ - Set stricter CSP header in redirect response
+ - deps: parseurl@~1.3.3
+ - deps: send@0.17.1
+ * deps: setprototypeof@1.1.1
+ * deps: statuses@~1.5.0
+ - Add `103 Early Hints`
+ * deps: type-is@~1.6.18
+ - deps: mime-types@~2.1.24
+ - perf: prevent internal `throw` on invalid type
+
+4.16.4 / 2018-10-10
+===================
+
+ * Fix issue where `"Request aborted"` may be logged in `res.sendfile`
+ * Fix JSDoc for `Router` constructor
+ * deps: body-parser@1.18.3
+ - Fix deprecation warnings on Node.js 10+
+ - Fix stack trace for strict json parse error
+ - deps: depd@~1.1.2
+ - deps: http-errors@~1.6.3
+ - deps: iconv-lite@0.4.23
+ - deps: qs@6.5.2
+ - deps: raw-body@2.3.3
+ - deps: type-is@~1.6.16
+ * deps: proxy-addr@~2.0.4
+ - deps: ipaddr.js@1.8.0
+ * deps: qs@6.5.2
+ * deps: safe-buffer@5.1.2
+
+4.16.3 / 2018-03-12
+===================
+
+ * deps: accepts@~1.3.5
+ - deps: mime-types@~2.1.18
+ * deps: depd@~1.1.2
+ - perf: remove argument reassignment
+ * deps: encodeurl@~1.0.2
+ - Fix encoding `%` as last character
+ * deps: finalhandler@1.1.1
+ - Fix 404 output for bad / missing pathnames
+ - deps: encodeurl@~1.0.2
+ - deps: statuses@~1.4.0
+ * deps: proxy-addr@~2.0.3
+ - deps: ipaddr.js@1.6.0
+ * deps: send@0.16.2
+ - Fix incorrect end tag in default error & redirects
+ - deps: depd@~1.1.2
+ - deps: encodeurl@~1.0.2
+ - deps: statuses@~1.4.0
+ * deps: serve-static@1.13.2
+ - Fix incorrect end tag in redirects
+ - deps: encodeurl@~1.0.2
+ - deps: send@0.16.2
+ * deps: statuses@~1.4.0
+ * deps: type-is@~1.6.16
+ - deps: mime-types@~2.1.18
+
+4.16.2 / 2017-10-09
+===================
+
+ * Fix `TypeError` in `res.send` when given `Buffer` and `ETag` header set
+ * perf: skip parsing of entire `X-Forwarded-Proto` header
+
+4.16.1 / 2017-09-29
+===================
+
+ * deps: send@0.16.1
+ * deps: serve-static@1.13.1
+ - Fix regression when `root` is incorrectly set to a file
+ - deps: send@0.16.1
+
+4.16.0 / 2017-09-28
+===================
+
+ * Add `"json escape"` setting for `res.json` and `res.jsonp`
+ * Add `express.json` and `express.urlencoded` to parse bodies
+ * Add `options` argument to `res.download`
+ * Improve error message when autoloading invalid view engine
+ * Improve error messages when non-function provided as middleware
+ * Skip `Buffer` encoding when not generating ETag for small response
+ * Use `safe-buffer` for improved Buffer API
+ * deps: accepts@~1.3.4
+ - deps: mime-types@~2.1.16
+ * deps: content-type@~1.0.4
+ - perf: remove argument reassignment
+ - perf: skip parameter parsing when no parameters
+ * deps: etag@~1.8.1
+ - perf: replace regular expression with substring
+ * deps: finalhandler@1.1.0
+ - Use `res.headersSent` when available
+ * deps: parseurl@~1.3.2
+ - perf: reduce overhead for full URLs
+ - perf: unroll the "fast-path" `RegExp`
+ * deps: proxy-addr@~2.0.2
+ - Fix trimming leading / trailing OWS in `X-Forwarded-For`
+ - deps: forwarded@~0.1.2
+ - deps: ipaddr.js@1.5.2
+ - perf: reduce overhead when no `X-Forwarded-For` header
+ * deps: qs@6.5.1
+ - Fix parsing & compacting very deep objects
+ * deps: send@0.16.0
+ - Add 70 new types for file extensions
+ - Add `immutable` option
+ - Fix missing ` 
+
+
+Security considerations
+-----------------------
+Besides incorporating a salt to protect against rainbow table attacks, bcrypt is an adaptive function: over time, the
+iteration count can be increased to make it slower, so it remains resistant to brute-force search attacks even with
+increasing computation power. ([see](http://en.wikipedia.org/wiki/Bcrypt))
+
+While bcrypt.js is compatible to the C++ bcrypt binding, it is written in pure JavaScript and thus slower ([about 30%](https://github.com/dcodeIO/bcrypt.js/wiki/Benchmark)), effectively reducing the number of iterations that can be
+processed in an equal time span.
+
+The maximum input length is 72 bytes (note that UTF8 encoded characters use up to 4 bytes) and the length of generated
+hashes is 60 characters.
+
+Usage
+-----
+The library is compatible with CommonJS and AMD loaders and is exposed globally as `dcodeIO.bcrypt` if neither is
+available.
+
+### node.js
+
+On node.js, the inbuilt [crypto module](http://nodejs.org/api/crypto.html)'s randomBytes interface is used to obtain
+secure random numbers.
+
+`npm install bcryptjs`
+
+```js
+var bcrypt = require('bcryptjs');
+...
+```
+
+### Browser
+
+In the browser, bcrypt.js relies on [Web Crypto API](http://www.w3.org/TR/WebCryptoAPI)'s getRandomValues
+interface to obtain secure random numbers. If no cryptographically secure source of randomness is available, you may
+specify one through [bcrypt.setRandomFallback](https://github.com/dcodeIO/bcrypt.js#setrandomfallbackrandom).
+
+```js
+var bcrypt = dcodeIO.bcrypt;
+...
+```
+
+or
+
+```js
+require.config({
+ paths: { "bcrypt": "/path/to/bcrypt.js" }
+});
+require(["bcrypt"], function(bcrypt) {
+ ...
+});
+```
+
+Usage - Sync
+------------
+To hash a password:
+
+```javascript
+var bcrypt = require('bcryptjs');
+var salt = bcrypt.genSaltSync(10);
+var hash = bcrypt.hashSync("B4c0/\/", salt);
+// Store hash in your password DB.
+```
+
+To check a password:
+
+```javascript
+// Load hash from your password DB.
+bcrypt.compareSync("B4c0/\/", hash); // true
+bcrypt.compareSync("not_bacon", hash); // false
+```
+
+Auto-gen a salt and hash:
+
+```javascript
+var hash = bcrypt.hashSync('bacon', 8);
+```
+
+Usage - Async
+-------------
+To hash a password:
+
+```javascript
+var bcrypt = require('bcryptjs');
+bcrypt.genSalt(10, function(err, salt) {
+ bcrypt.hash("B4c0/\/", salt, function(err, hash) {
+ // Store hash in your password DB.
+ });
+});
+```
+
+To check a password:
+
+```javascript
+// Load hash from your password DB.
+bcrypt.compare("B4c0/\/", hash, function(err, res) {
+ // res === true
+});
+bcrypt.compare("not_bacon", hash, function(err, res) {
+ // res === false
+});
+
+// As of bcryptjs 2.4.0, compare returns a promise if callback is omitted:
+bcrypt.compare("B4c0/\/", hash).then((res) => {
+ // res === true
+});
+```
+
+Auto-gen a salt and hash:
+
+```javascript
+bcrypt.hash('bacon', 8, function(err, hash) {
+});
+```
+
+**Note:** Under the hood, asynchronisation splits a crypto operation into small chunks. After the completion of a chunk, the execution of the next chunk is placed on the back of [JS event loop queue](https://developer.mozilla.org/en/docs/Web/JavaScript/EventLoop), thus efficiently sharing the computational resources with the other operations in the queue.
+
+API
+---
+### setRandomFallback(random)
+
+Sets the pseudo random number generator to use as a fallback if neither node's `crypto` module nor the Web Crypto
+API is available. Please note: It is highly important that the PRNG used is cryptographically secure and that it is
+seeded properly!
+
+| Parameter | Type | Description
+|-----------------|-----------------|---------------
+| random | *function(number):!Array.<number>* | Function taking the number of bytes to generate as its sole argument, returning the corresponding array of cryptographically secure random byte values.
+| **@see** | | http://nodejs.org/api/crypto.html
+| **@see** | | http://www.w3.org/TR/WebCryptoAPI/
+
+**Hint:** You might use [isaac.js](https://github.com/rubycon/isaac.js) as a CSPRNG but you still have to make sure to
+seed it properly.
+
+### genSaltSync(rounds=, seed_length=)
+
+Synchronously generates a salt.
+
+| Parameter | Type | Description
+|-----------------|-----------------|---------------
+| rounds | *number* | Number of rounds to use, defaults to 10 if omitted
+| seed_length | *number* | Not supported.
+| **@returns** | *string* | Resulting salt
+| **@throws** | *Error* | If a random fallback is required but not set
+
+### genSalt(rounds=, seed_length=, callback)
+
+Asynchronously generates a salt.
+
+| Parameter | Type | Description
+|-----------------|-----------------|---------------
+| rounds | *number | function(Error, string=)* | Number of rounds to use, defaults to 10 if omitted
+| seed_length | *number | function(Error, string=)* | Not supported.
+| callback | *function(Error, string=)* | Callback receiving the error, if any, and the resulting salt
+| **@returns** | *Promise* | If `callback` has been omitted
+| **@throws** | *Error* | If `callback` is present but not a function
+
+### hashSync(s, salt=)
+
+Synchronously generates a hash for the given string.
+
+| Parameter | Type | Description
+|-----------------|-----------------|---------------
+| s | *string* | String to hash
+| salt | *number | string* | Salt length to generate or salt to use, default to 10
+| **@returns** | *string* | Resulting hash
+
+### hash(s, salt, callback, progressCallback=)
+
+Asynchronously generates a hash for the given string.
+
+| Parameter | Type | Description
+|-----------------|-----------------|---------------
+| s | *string* | String to hash
+| salt | *number | string* | Salt length to generate or salt to use
+| callback | *function(Error, string=)* | Callback receiving the error, if any, and the resulting hash
+| progressCallback | *function(number)* | Callback successively called with the percentage of rounds completed (0.0 - 1.0), maximally once per `MAX_EXECUTION_TIME = 100` ms.
+| **@returns** | *Promise* | If `callback` has been omitted
+| **@throws** | *Error* | If `callback` is present but not a function
+
+### compareSync(s, hash)
+
+Synchronously tests a string against a hash.
+
+| Parameter | Type | Description
+|-----------------|-----------------|---------------
+| s | *string* | String to compare
+| hash | *string* | Hash to test against
+| **@returns** | *boolean* | true if matching, otherwise false
+| **@throws** | *Error* | If an argument is illegal
+
+### compare(s, hash, callback, progressCallback=)
+
+Asynchronously compares the given data against the given hash.
+
+| Parameter | Type | Description
+|-----------------|-----------------|---------------
+| s | *string* | Data to compare
+| hash | *string* | Data to be compared to
+| callback | *function(Error, boolean)* | Callback receiving the error, if any, otherwise the result
+| progressCallback | *function(number)* | Callback successively called with the percentage of rounds completed (0.0 - 1.0), maximally once per `MAX_EXECUTION_TIME = 100` ms.
+| **@returns** | *Promise* | If `callback` has been omitted
+| **@throws** | *Error* | If `callback` is present but not a function
+
+### getRounds(hash)
+
+Gets the number of rounds used to encrypt the specified hash.
+
+| Parameter | Type | Description
+|-----------------|-----------------|---------------
+| hash | *string* | Hash to extract the used number of rounds from
+| **@returns** | *number* | Number of rounds used
+| **@throws** | *Error* | If `hash` is not a string
+
+### getSalt(hash)
+
+Gets the salt portion from a hash. Does not validate the hash.
+
+| Parameter | Type | Description
+|-----------------|-----------------|---------------
+| hash | *string* | Hash to extract the salt from
+| **@returns** | *string* | Extracted salt part
+| **@throws** | *Error* | If `hash` is not a string or otherwise invalid
+
+
+Command line
+------------
+`Usage: bcrypt [salt]`
+
+If the input has spaces inside, simply surround it with quotes.
+
+Downloads
+---------
+* [Distributions](https://github.com/dcodeIO/bcrypt.js/tree/master/dist)
+* [ZIP-Archive](https://github.com/dcodeIO/bcrypt.js/archive/master.zip)
+* [Tarball](https://github.com/dcodeIO/bcrypt.js/tarball/master)
+
+Credits
+-------
+Based on work started by Shane Girish at [bcrypt-nodejs](https://github.com/shaneGirish/bcrypt-nodejs) (MIT-licensed),
+which is itself based on [javascript-bcrypt](http://code.google.com/p/javascript-bcrypt/) (New BSD-licensed).
+
+License
+-------
+New-BSD / MIT ([see](https://github.com/dcodeIO/bcrypt.js/blob/master/LICENSE))
diff --git a/node_modules/bcryptjs/bin/bcrypt b/node_modules/bcryptjs/bin/bcrypt
new file mode 100644
index 0000000..4cfc9d9
--- /dev/null
+++ b/node_modules/bcryptjs/bin/bcrypt
@@ -0,0 +1,25 @@
+#!/usr/bin/env node
+
+var path = require("path"),
+ bcrypt = require(path.join(__dirname, '..', 'index.js')),
+ pkg = require(path.join(__dirname, '..', 'package.json'));
+
+if (process.argv.length < 3) {
+ process.stderr.write([ // No dependencies, so we do it from hand.
+ "",
+ " |_ _ _ _ |_",
+ " |_)(_| \\/|_)|_ v"+pkg['version']+" (c) "+pkg['author'],
+ " / | "
+ ].join('\n')+'\n\n'+" Usage: "+path.basename(process.argv[1])+" [rounds|salt]\n");
+ process.exit(1);
+} else {
+ var salt;
+ if (process.argv.length > 3) {
+ salt = process.argv[3];
+ var rounds = parseInt(salt, 10);
+ if (rounds == salt)
+ salt = bcrypt.genSaltSync(rounds);
+ } else
+ salt = bcrypt.genSaltSync();
+ process.stdout.write(bcrypt.hashSync(process.argv[2], salt)+"\n");
+}
diff --git a/node_modules/bcryptjs/bower.json b/node_modules/bcryptjs/bower.json
new file mode 100644
index 0000000..c152405
--- /dev/null
+++ b/node_modules/bcryptjs/bower.json
@@ -0,0 +1,22 @@
+{
+ "name": "bcryptjs",
+ "description": "Optimized bcrypt in plain JavaScript with zero dependencies.",
+ "version": "2.4.3",
+ "main": "dist/bcrypt.min.js",
+ "license": "New-BSD",
+ "homepage": "http://dcode.io/",
+ "repository": {
+ "type": "git",
+ "url": "git://github.com/dcodeIO/bcrypt.js.git"
+ },
+ "keywords": ["bcrypt", "password", "auth", "authentication", "encryption", "crypt", "crypto"],
+ "dependencies": {},
+ "devDependencies": {},
+ "ignore": [
+ "**/.*",
+ "node_modules",
+ "bower_components",
+ "test",
+ "tests"
+ ]
+}
diff --git a/node_modules/bcryptjs/dist/README.md b/node_modules/bcryptjs/dist/README.md
new file mode 100644
index 0000000..4020f45
--- /dev/null
+++ b/node_modules/bcryptjs/dist/README.md
@@ -0,0 +1,15 @@
+Distributions
+=============
+bcrypt.js is available as the following distributions:
+
+* **[bcrypt.js](https://github.com/dcodeIO/bcrypt.js/blob/master/dist/bcrypt.js)**
+ contains the commented source code.
+
+* **[bcrypt.min.js](https://github.com/dcodeIO/bcrypt.js/blob/master/dist/bcrypt.min.js)**
+ has been compiled with Closure Compiler using advanced optimizations.
+
+* **[bcrypt.min.map](https://github.com/dcodeIO/bcrypt.js/blob/master/dist/bcrypt.min.map)**
+ contains the source map generated by Closure Compiler.
+
+* **[bcrypt.min.js.gz](https://github.com/dcodeIO/bcrypt.js/blob/master/dist/bcrypt.min.js.gz)**
+ has also been gzipped using `-9`.
diff --git a/node_modules/bcryptjs/dist/bcrypt.js b/node_modules/bcryptjs/dist/bcrypt.js
new file mode 100644
index 0000000..a50dbee
--- /dev/null
+++ b/node_modules/bcryptjs/dist/bcrypt.js
@@ -0,0 +1,1379 @@
+/*
+ Copyright (c) 2012 Nevins Bartolomeo 
+
+> BigNum in pure javascript
+
+[](http://travis-ci.org/indutny/bn.js)
+
+## Install
+`npm install --save bn.js`
+
+## Usage
+
+```js
+const BN = require('bn.js');
+
+var a = new BN('dead', 16);
+var b = new BN('101010', 2);
+
+var res = a.add(b);
+console.log(res.toString(10)); // 57047
+```
+
+**Note**: decimals are not supported in this library.
+
+## Notation
+
+### Prefixes
+
+There are several prefixes to instructions that affect the way the work. Here
+is the list of them in the order of appearance in the function name:
+
+* `i` - perform operation in-place, storing the result in the host object (on
+ which the method was invoked). Might be used to avoid number allocation costs
+* `u` - unsigned, ignore the sign of operands when performing operation, or
+ always return positive value. Second case applies to reduction operations
+ like `mod()`. In such cases if the result will be negative - modulo will be
+ added to the result to make it positive
+
+### Postfixes
+
+The only available postfix at the moment is:
+
+* `n` - which means that the argument of the function must be a plain JavaScript
+ Number. Decimals are not supported.
+
+### Examples
+
+* `a.iadd(b)` - perform addition on `a` and `b`, storing the result in `a`
+* `a.umod(b)` - reduce `a` modulo `b`, returning positive value
+* `a.iushln(13)` - shift bits of `a` left by 13
+
+## Instructions
+
+Prefixes/postfixes are put in parens at the of the line. `endian` - could be
+either `le` (little-endian) or `be` (big-endian).
+
+### Utilities
+
+* `a.clone()` - clone number
+* `a.toString(base, length)` - convert to base-string and pad with zeroes
+* `a.toNumber()` - convert to Javascript Number (limited to 53 bits)
+* `a.toJSON()` - convert to JSON compatible hex string (alias of `toString(16)`)
+* `a.toArray(endian, length)` - convert to byte `Array`, and optionally zero
+ pad to length, throwing if already exceeding
+* `a.toArrayLike(type, endian, length)` - convert to an instance of `type`,
+ which must behave like an `Array`
+* `a.toBuffer(endian, length)` - convert to Node.js Buffer (if available). For
+ compatibility with browserify and similar tools, use this instead:
+ `a.toArrayLike(Buffer, endian, length)`
+* `a.bitLength()` - get number of bits occupied
+* `a.zeroBits()` - return number of less-significant consequent zero bits
+ (example: `1010000` has 4 zero bits)
+* `a.byteLength()` - return number of bytes occupied
+* `a.isNeg()` - true if the number is negative
+* `a.isEven()` - no comments
+* `a.isOdd()` - no comments
+* `a.isZero()` - no comments
+* `a.cmp(b)` - compare numbers and return `-1` (a `<` b), `0` (a `==` b), or `1` (a `>` b)
+ depending on the comparison result (`ucmp`, `cmpn`)
+* `a.lt(b)` - `a` less than `b` (`n`)
+* `a.lte(b)` - `a` less than or equals `b` (`n`)
+* `a.gt(b)` - `a` greater than `b` (`n`)
+* `a.gte(b)` - `a` greater than or equals `b` (`n`)
+* `a.eq(b)` - `a` equals `b` (`n`)
+* `a.toTwos(width)` - convert to two's complement representation, where `width` is bit width
+* `a.fromTwos(width)` - convert from two's complement representation, where `width` is the bit width
+* `BN.isBN(object)` - returns true if the supplied `object` is a BN.js instance
+
+### Arithmetics
+
+* `a.neg()` - negate sign (`i`)
+* `a.abs()` - absolute value (`i`)
+* `a.add(b)` - addition (`i`, `n`, `in`)
+* `a.sub(b)` - subtraction (`i`, `n`, `in`)
+* `a.mul(b)` - multiply (`i`, `n`, `in`)
+* `a.sqr()` - square (`i`)
+* `a.pow(b)` - raise `a` to the power of `b`
+* `a.div(b)` - divide (`divn`, `idivn`)
+* `a.mod(b)` - reduct (`u`, `n`) (but no `umodn`)
+* `a.divRound(b)` - rounded division
+
+### Bit operations
+
+* `a.or(b)` - or (`i`, `u`, `iu`)
+* `a.and(b)` - and (`i`, `u`, `iu`, `andln`) (NOTE: `andln` is going to be replaced
+ with `andn` in future)
+* `a.xor(b)` - xor (`i`, `u`, `iu`)
+* `a.setn(b)` - set specified bit to `1`
+* `a.shln(b)` - shift left (`i`, `u`, `iu`)
+* `a.shrn(b)` - shift right (`i`, `u`, `iu`)
+* `a.testn(b)` - test if specified bit is set
+* `a.maskn(b)` - clear bits with indexes higher or equal to `b` (`i`)
+* `a.bincn(b)` - add `1 << b` to the number
+* `a.notn(w)` - not (for the width specified by `w`) (`i`)
+
+### Reduction
+
+* `a.gcd(b)` - GCD
+* `a.egcd(b)` - Extended GCD results (`{ a: ..., b: ..., gcd: ... }`)
+* `a.invm(b)` - inverse `a` modulo `b`
+
+## Fast reduction
+
+When doing lots of reductions using the same modulo, it might be beneficial to
+use some tricks: like [Montgomery multiplication][0], or using special algorithm
+for [Mersenne Prime][1].
+
+### Reduction context
+
+To enable this tricks one should create a reduction context:
+
+```js
+var red = BN.red(num);
+```
+where `num` is just a BN instance.
+
+Or:
+
+```js
+var red = BN.red(primeName);
+```
+
+Where `primeName` is either of these [Mersenne Primes][1]:
+
+* `'k256'`
+* `'p224'`
+* `'p192'`
+* `'p25519'`
+
+Or:
+
+```js
+var red = BN.mont(num);
+```
+
+To reduce numbers with [Montgomery trick][0]. `.mont()` is generally faster than
+`.red(num)`, but slower than `BN.red(primeName)`.
+
+### Converting numbers
+
+Before performing anything in reduction context - numbers should be converted
+to it. Usually, this means that one should:
+
+* Convert inputs to reducted ones
+* Operate on them in reduction context
+* Convert outputs back from the reduction context
+
+Here is how one may convert numbers to `red`:
+
+```js
+var redA = a.toRed(red);
+```
+Where `red` is a reduction context created using instructions above
+
+Here is how to convert them back:
+
+```js
+var a = redA.fromRed();
+```
+
+### Red instructions
+
+Most of the instructions from the very start of this readme have their
+counterparts in red context:
+
+* `a.redAdd(b)`, `a.redIAdd(b)`
+* `a.redSub(b)`, `a.redISub(b)`
+* `a.redShl(num)`
+* `a.redMul(b)`, `a.redIMul(b)`
+* `a.redSqr()`, `a.redISqr()`
+* `a.redSqrt()` - square root modulo reduction context's prime
+* `a.redInvm()` - modular inverse of the number
+* `a.redNeg()`
+* `a.redPow(b)` - modular exponentiation
+
+## LICENSE
+
+This software is licensed under the MIT License.
+
+[0]: https://en.wikipedia.org/wiki/Montgomery_modular_multiplication
+[1]: https://en.wikipedia.org/wiki/Mersenne_prime
diff --git a/node_modules/bn.js/lib/bn.js b/node_modules/bn.js/lib/bn.js
new file mode 100644
index 0000000..ee78646
--- /dev/null
+++ b/node_modules/bn.js/lib/bn.js
@@ -0,0 +1,3446 @@
+(function (module, exports) {
+ 'use strict';
+
+ // Utils
+ function assert (val, msg) {
+ if (!val) throw new Error(msg || 'Assertion failed');
+ }
+
+ // Could use `inherits` module, but don't want to move from single file
+ // architecture yet.
+ function inherits (ctor, superCtor) {
+ ctor.super_ = superCtor;
+ var TempCtor = function () {};
+ TempCtor.prototype = superCtor.prototype;
+ ctor.prototype = new TempCtor();
+ ctor.prototype.constructor = ctor;
+ }
+
+ // BN
+
+ function BN (number, base, endian) {
+ if (BN.isBN(number)) {
+ return number;
+ }
+
+ this.negative = 0;
+ this.words = null;
+ this.length = 0;
+
+ // Reduction context
+ this.red = null;
+
+ if (number !== null) {
+ if (base === 'le' || base === 'be') {
+ endian = base;
+ base = 10;
+ }
+
+ this._init(number || 0, base || 10, endian || 'be');
+ }
+ }
+ if (typeof module === 'object') {
+ module.exports = BN;
+ } else {
+ exports.BN = BN;
+ }
+
+ BN.BN = BN;
+ BN.wordSize = 26;
+
+ var Buffer;
+ try {
+ if (typeof window !== 'undefined' && typeof window.Buffer !== 'undefined') {
+ Buffer = window.Buffer;
+ } else {
+ Buffer = require('buffer').Buffer;
+ }
+ } catch (e) {
+ }
+
+ BN.isBN = function isBN (num) {
+ if (num instanceof BN) {
+ return true;
+ }
+
+ return num !== null && typeof num === 'object' &&
+ num.constructor.wordSize === BN.wordSize && Array.isArray(num.words);
+ };
+
+ BN.max = function max (left, right) {
+ if (left.cmp(right) > 0) return left;
+ return right;
+ };
+
+ BN.min = function min (left, right) {
+ if (left.cmp(right) < 0) return left;
+ return right;
+ };
+
+ BN.prototype._init = function init (number, base, endian) {
+ if (typeof number === 'number') {
+ return this._initNumber(number, base, endian);
+ }
+
+ if (typeof number === 'object') {
+ return this._initArray(number, base, endian);
+ }
+
+ if (base === 'hex') {
+ base = 16;
+ }
+ assert(base === (base | 0) && base >= 2 && base <= 36);
+
+ number = number.toString().replace(/\s+/g, '');
+ var start = 0;
+ if (number[0] === '-') {
+ start++;
+ this.negative = 1;
+ }
+
+ if (start < number.length) {
+ if (base === 16) {
+ this._parseHex(number, start, endian);
+ } else {
+ this._parseBase(number, base, start);
+ if (endian === 'le') {
+ this._initArray(this.toArray(), base, endian);
+ }
+ }
+ }
+ };
+
+ BN.prototype._initNumber = function _initNumber (number, base, endian) {
+ if (number < 0) {
+ this.negative = 1;
+ number = -number;
+ }
+ if (number < 0x4000000) {
+ this.words = [ number & 0x3ffffff ];
+ this.length = 1;
+ } else if (number < 0x10000000000000) {
+ this.words = [
+ number & 0x3ffffff,
+ (number / 0x4000000) & 0x3ffffff
+ ];
+ this.length = 2;
+ } else {
+ assert(number < 0x20000000000000); // 2 ^ 53 (unsafe)
+ this.words = [
+ number & 0x3ffffff,
+ (number / 0x4000000) & 0x3ffffff,
+ 1
+ ];
+ this.length = 3;
+ }
+
+ if (endian !== 'le') return;
+
+ // Reverse the bytes
+ this._initArray(this.toArray(), base, endian);
+ };
+
+ BN.prototype._initArray = function _initArray (number, base, endian) {
+ // Perhaps a Uint8Array
+ assert(typeof number.length === 'number');
+ if (number.length <= 0) {
+ this.words = [ 0 ];
+ this.length = 1;
+ return this;
+ }
+
+ this.length = Math.ceil(number.length / 3);
+ this.words = new Array(this.length);
+ for (var i = 0; i < this.length; i++) {
+ this.words[i] = 0;
+ }
+
+ var j, w;
+ var off = 0;
+ if (endian === 'be') {
+ for (i = number.length - 1, j = 0; i >= 0; i -= 3) {
+ w = number[i] | (number[i - 1] << 8) | (number[i - 2] << 16);
+ this.words[j] |= (w << off) & 0x3ffffff;
+ this.words[j + 1] = (w >>> (26 - off)) & 0x3ffffff;
+ off += 24;
+ if (off >= 26) {
+ off -= 26;
+ j++;
+ }
+ }
+ } else if (endian === 'le') {
+ for (i = 0, j = 0; i < number.length; i += 3) {
+ w = number[i] | (number[i + 1] << 8) | (number[i + 2] << 16);
+ this.words[j] |= (w << off) & 0x3ffffff;
+ this.words[j + 1] = (w >>> (26 - off)) & 0x3ffffff;
+ off += 24;
+ if (off >= 26) {
+ off -= 26;
+ j++;
+ }
+ }
+ }
+ return this.strip();
+ };
+
+ function parseHex4Bits (string, index) {
+ var c = string.charCodeAt(index);
+ // 'A' - 'F'
+ if (c >= 65 && c <= 70) {
+ return c - 55;
+ // 'a' - 'f'
+ } else if (c >= 97 && c <= 102) {
+ return c - 87;
+ // '0' - '9'
+ } else {
+ return (c - 48) & 0xf;
+ }
+ }
+
+ function parseHexByte (string, lowerBound, index) {
+ var r = parseHex4Bits(string, index);
+ if (index - 1 >= lowerBound) {
+ r |= parseHex4Bits(string, index - 1) << 4;
+ }
+ return r;
+ }
+
+ BN.prototype._parseHex = function _parseHex (number, start, endian) {
+ // Create possibly bigger array to ensure that it fits the number
+ this.length = Math.ceil((number.length - start) / 6);
+ this.words = new Array(this.length);
+ for (var i = 0; i < this.length; i++) {
+ this.words[i] = 0;
+ }
+
+ // 24-bits chunks
+ var off = 0;
+ var j = 0;
+
+ var w;
+ if (endian === 'be') {
+ for (i = number.length - 1; i >= start; i -= 2) {
+ w = parseHexByte(number, start, i) << off;
+ this.words[j] |= w & 0x3ffffff;
+ if (off >= 18) {
+ off -= 18;
+ j += 1;
+ this.words[j] |= w >>> 26;
+ } else {
+ off += 8;
+ }
+ }
+ } else {
+ var parseLength = number.length - start;
+ for (i = parseLength % 2 === 0 ? start + 1 : start; i < number.length; i += 2) {
+ w = parseHexByte(number, start, i) << off;
+ this.words[j] |= w & 0x3ffffff;
+ if (off >= 18) {
+ off -= 18;
+ j += 1;
+ this.words[j] |= w >>> 26;
+ } else {
+ off += 8;
+ }
+ }
+ }
+
+ this.strip();
+ };
+
+ function parseBase (str, start, end, mul) {
+ var r = 0;
+ var len = Math.min(str.length, end);
+ for (var i = start; i < len; i++) {
+ var c = str.charCodeAt(i) - 48;
+
+ r *= mul;
+
+ // 'a'
+ if (c >= 49) {
+ r += c - 49 + 0xa;
+
+ // 'A'
+ } else if (c >= 17) {
+ r += c - 17 + 0xa;
+
+ // '0' - '9'
+ } else {
+ r += c;
+ }
+ }
+ return r;
+ }
+
+ BN.prototype._parseBase = function _parseBase (number, base, start) {
+ // Initialize as zero
+ this.words = [ 0 ];
+ this.length = 1;
+
+ // Find length of limb in base
+ for (var limbLen = 0, limbPow = 1; limbPow <= 0x3ffffff; limbPow *= base) {
+ limbLen++;
+ }
+ limbLen--;
+ limbPow = (limbPow / base) | 0;
+
+ var total = number.length - start;
+ var mod = total % limbLen;
+ var end = Math.min(total, total - mod) + start;
+
+ var word = 0;
+ for (var i = start; i < end; i += limbLen) {
+ word = parseBase(number, i, i + limbLen, base);
+
+ this.imuln(limbPow);
+ if (this.words[0] + word < 0x4000000) {
+ this.words[0] += word;
+ } else {
+ this._iaddn(word);
+ }
+ }
+
+ if (mod !== 0) {
+ var pow = 1;
+ word = parseBase(number, i, number.length, base);
+
+ for (i = 0; i < mod; i++) {
+ pow *= base;
+ }
+
+ this.imuln(pow);
+ if (this.words[0] + word < 0x4000000) {
+ this.words[0] += word;
+ } else {
+ this._iaddn(word);
+ }
+ }
+
+ this.strip();
+ };
+
+ BN.prototype.copy = function copy (dest) {
+ dest.words = new Array(this.length);
+ for (var i = 0; i < this.length; i++) {
+ dest.words[i] = this.words[i];
+ }
+ dest.length = this.length;
+ dest.negative = this.negative;
+ dest.red = this.red;
+ };
+
+ BN.prototype.clone = function clone () {
+ var r = new BN(null);
+ this.copy(r);
+ return r;
+ };
+
+ BN.prototype._expand = function _expand (size) {
+ while (this.length < size) {
+ this.words[this.length++] = 0;
+ }
+ return this;
+ };
+
+ // Remove leading `0` from `this`
+ BN.prototype.strip = function strip () {
+ while (this.length > 1 && this.words[this.length - 1] === 0) {
+ this.length--;
+ }
+ return this._normSign();
+ };
+
+ BN.prototype._normSign = function _normSign () {
+ // -0 = 0
+ if (this.length === 1 && this.words[0] === 0) {
+ this.negative = 0;
+ }
+ return this;
+ };
+
+ BN.prototype.inspect = function inspect () {
+ return (this.red ? '